AC1015MYPP5B md a{N(^A_:Mw ( ( {f%˥u%qPW %m6((W?D+LPSL(glH3f333f3333f3ffffff3f̙3f3f333f333333333f33333333f33f3ff3f3f3f3333f33̙33333f3333333f3333f3ffffff3f33ff3f3f3f3fff3ffffffffffff3ffff̙fff3fffffff3ffffff3f333f3333f3ffffff3f̙̙3̙f̙̙̙̙3f3f333f3333f3ffffff3f̙3f3f3f333f3333f3ffffff3f̙3f3f (((555CCCPPP]]]kkkxxxڒ+b5b{#8_|hNm3_3UЕ@@*Q t@L Ad@i0A$&ffffrOɩjfffff?@bP.u%m.@0%uUʡdz,W'  0/| CRh߼@b>(@"@je B*MA0a|#W/<@&&C$ PP*+^+?zvz7Ьs*Bz7Ыsffffff9@d ףp= ?U "RP@CT,08DHLT\ZDeDhmQHH=HHAHF:Ĵ̴ '{FA5D115B-7CBF-4EE4-9871-1903DB91F546}QQQQQ-ռf;0!VG̠ĸĩ_϶5=@D55M٥ AcMeStateMgrCPPQTUSQԀ !,ilN,l`R k*{(!0< 72$1!-l-iM@z j:*Jr:zP'D55M٥AcMeGSManagerBPSQT :!,ilN,l` k#Ks+s b+ {((97:"24:4 7&04>!0< 72$1"H,m쭌-n)i  j*b" r" " rH+E8}Mё%AɽՍЁ͍ɥѥѽ 5 ѽͬ% AcmIdStdANSIDPRQSTS@ Z)H-n-M쎬nlnM.-D.h( m -,l-m -'D.쌮me -e@ j# j" rH*(97:"24:4 7&04>!0< 72$1"-n)i  jrz* r" " rH-E8}Mё%AɽՍЁ͍ɥѥѽ 5 ѽͬ%AcmTaperStdANSIEPPUTTSTS@ j)H-n-M쎬nlnM.-D.h( m -,l-m -'D.쌮me -e@ k# rK+" rH<VzꕆY.{2/kIB; 8* J#~c BB4a&t-M$ ԹѦ,?_/FAg.>GbV)rS0Q,BH@QPt!H5X @F{D;f?(`Ѳ "7͑$BH@QPt!H5X @F{D;f?Q>~oM܃>3(D@R%Pt!.,:89@^D&D@RePt!J/]` 5%"2f %6u.D@RPt!`.>IY[5%"2  f %T,D@RPt!k-ej!` |$r"4]H0f %+}&D@S%Pt!`.>Idt֯-u 4f %,D@SePt!J/],֯-u 4  %j.D@SPt!G VFdu|$r"4fȌf %H(D@SPt!˦.+U Dd } %r(D@T%U$!ː p*@8DF %m&D@TeU$!>T*n@8f %˥,D@TU$!$PnJ@8@1f % (D@TU$!>T*h E11 f %H(D@U%U$!ː p*%I$a.h E~f %G&D@UeU$!ː p*;Ϯhd E~f %EQ,D@UU$!$P%I$h E11 f %(D@UU$!˦.+%I$a.\ E~f %-,D@V%U$!ˮ.+鋯@8DF %<(D@VeU$!$P닯,@8f %Xb(D@VU$!IVj5ao$j\[ f %sB(D@VU$!ʪc^hqqol[22 f %d,D@W%U$!ʲc^Qo$Q% f %H0D@WeU$!ʲc^`'I/.8o$z8y f %K,D@WU$!ʖZxՈ//`'I5Ki ((z8y %g(D@WU$!̓$w򊡠D{:(f %,D@X%U$!c*߇6y:(GCf %0D@XeU$!c*UXFy:([22 f %,D@XU$!ȸy?,XUD$22qf %j,D@XU$!AVj5a>.Njqqolu>jIf %60D@Y%U$!IVj5aw򊡠Dpqqol?D %,D@YeU$!K {~usÑ_D? %(D@YU$!c*\'I/.8_}~f %Vf(D@YU$!uGo$y4Q% f %0D@Z%U$!uGo"b8D$RCG f %b(D@ZeU$!ʖZxՈ6߆D5Ki (f % 0D@ZU$!K {~,O>F5Ki (Q% f %(D@ZU$!Ȱy?,D$jIu f %L0D@[%U$!Ȱy?,6߆D$y\0x % (D@[eU$!K {~"b8!sÑ~f %/,D@[U$!̓$b"_}dxH\0 %&0D@[U$!{$W4_}j\[ f %p,D@\%U$!uGoW$y[j\f %t0D@\eU$!ʖZxՈQ4!sÑjIu f %t(D@\U$!AVj7a*|$r"$9 f %R&D@\U$!>T*Ul_`.f %&D@]%U$!AVj7a*;ϮhEqb2f %w(D@]eU$!AVj7a*l_`.Q\je،f %g&D@]U$!>T*Uj( f %&D@]U$!AVj7a*;Ϯi|$r"$f %3(D@^%U$!AVj7a*j( _ ȉ f %5&D@^eU$!˦.+VEqb2f %s(D@^U$!ʲcZEqb2 f %?(D@^U$!ʲcZ|$r"$ f %,&D@_%U$!ʲcZ틯n_`.f %nI&D@_eU$!ˮ.+V|$r"$f %&D@_U$!ʲcZ닯j( f %-(D@_U$!ʲcZ|$r"$ǚ f % (D@`%PD!IVj7a*.]4LYa B f %Q(D@`ePD!Ȼv2Wa B r4Љ f %(D@`PD!Õv2Wa B$Xr4f %(D@`PD!Õv2UJUa B$f %b(D@a%PD!QVj7a*0]4LYa B.f %è(D@aePD!Õv2Ya B.Xr4Ќf %l+D@aD!Ȼv2UJYa B2f!*%)D@ct!˦.+鋯/c!~f!, %Q&D@d%Pt!˦.+鋯Y Df %1R-D@det!aʯy2/N*<r&\p3U %v2D@d4!oTX:ZArL )*ht@ f J%+D@e%!Ϣ)g?~f L %U-(D@eeP!|Q$/~Qv+cU f %~l(D@eP!0y}xTRc  f %/SW@eP!z/8@VT@#α+:/SW@f%P!:c8@rS)@ꞋŻluJD(D@feP!ε(e1u(p}xTRf %RS^fP!G.7@Vz>@Qy*ГzժQB4a&t\,mZ2)rS0Q,T7%D@ft!^dAD0&Y)bAf %%D@g%t!A;\lv˖$f %{%D@get!^dAD0(Y)bAf %%D@gt!A;\lv˖&f %%D@gt!A;\lv˖(f %&SE@h%t!+6@;Rne@-Vϡz%D@het!^v˖(Y)Af %},SQ@ht!9Z6@;Rne@Fk%?\H3ϕ.SU@ht!+6@߲ C@-V&\4$'D@i%t!^dAD0(bAY)f %s~,SQ@iet!9Z6@;Rne@Fk%?H3pr.SU@it!+6@ղ C@-V&\$ a'D@it!^dAD0&72 f %=*SM@j%t!9Z6@;Rne@F^&ϘO%D@jet!z>igy((k? %|+D@jt!pᣉ5E/r*2T.f % +D@jt!p᥉j5EPˆ*g %fA-D@k%t!<թic99jG(3 f %f-D@ket!<өh?9w#&Ց f %P%D@kt!z:c桮(=z %E,SQ@kt!4q5@vϹ@7K9:28Dh@l%t!pm=Lwt@i- @)5B K?{(SI@let!?OGS5@t@2;WDϙN&SE@lt!?OGS5@1P@! tQD8Dh@lt!pm=Lwt@i-%>4n @q& K?,SQ@m%t!?OGS5@J:M@fws/{=uz.SU@met!45@\ e@dϏr8Dh@mt!pm=Lwt@i-mZ?U K?.SU@mt!?OG5@K@H(z\1Tn,SQ@n%t!Zu5@g@˞qQ N8Dh@net!pm=Lwt@i-d{}@?1Ur K?,SQ@nt!?OG5@L@,es&ꈙϮ(SI@nt!?OG5@4{@;):7AT8Dh@o%t!pm=Lwt@i-W((??] <K?N<,SQ@oet!?OG5@t@Gxȴ,SQ@ot!!Z5@#]@tύ{8Dh@ot!pm=Lwt@i-؈6@ =8~ K?'-&SE@p%t!?OG5@~J:M@% 3όH%D@pet!^AYCtf %:%D@pt!͹A;ZlF"`~f %k%D@pt!^J!!qf %A%D@q%t!͹A;ZlF"`~f %%D@qet!͹A;Zl1Uf %&SE@qt!+6@@-VB'D@qt!^1Uq! f %+a.SU@r%t!9Z6@@EpF?pR.SU@ret!+6@ܿ@-V1L'D@rt!^J!cC~ %O.SU@rt!9Z6@0T?Es\v~.SU@s%t!+6@K ?-Vz1L߳Ͻ'D@set!^AYш*f %}*SM@st!9Z6@0T?E^Z1O%D@st!Y3egy((k? %+D@t%t!ٹ r o}/r*2T.f %u+D@tet!ٹ ro|Pˆ*g %SH-D@tt!])&pnffG(3 f %-D@tt!ɯ])&xnfs#&ԑ f %f%D@u%t!Y7 c桮(=z %c.SU@uet!73X3@tϹ@fOɸ̐+7K:ϩW8Dh@ut!d,wt@i- @)5B K?c(SI@ut!?&2@t@2;WD{&SE@v%t!?&2@1P@!t8Dh@vet!d,wt@i-%>4n @q& K?);.SU@vt!?&2@J:M@L/{r=u.SU@vt!73XA3@\ e@&Od$n8Dh@w%t!d,wt@i-|mZ? U K?).SU@wet!?@I@AO?Z\1TTf,SQ@wt!;K93@g@&O˞QQU8Dh@wt!d,wt@i-b{}@>1Ur K?,SQ@x%t!?@L@m &hϙt(SI@xet!?&c3@2{@; :7AT@8Dh@xt!d,wt@i-W((??] <K?,SQ@xt!?&c3@t@QO?`xϒ,SQ@y%t!>K9E3@#]@&Ot8Dh@yet!d,wt@i-؈6@ =8~ K?&SE@yt!?&c3@|J:M@% 39(D@yP!Kȁg?~f %(D@z%P!T&Y$/~Qv+cU f %$(D@zeP!ؘ3é1}xTRc  f % /SW@zP!xu&0@rS)@;luJϱ (D@zP!֮uy6& L`}xTRf %*DRS^{%P!p҇1@Vz>@q% ?Г{B4a&tA~o"7͑$BH@~%Pt!&۠ @F{D;f?4L6DEOgBH@~ePt!&۠ @F{D;f?0EbEO(D@~Pt!aj6jU f %~.D@~Pt!wˢj'U c`f % .D@%Pt!΁z/)j60#-Ϳ f %(D@ePt!wh~hlķ6[f %2C.D@Pt!a2iG·6[c`f %^0D@Pt!QBh96k6j8#-Ϳ f %'D@@%Pt!i8ɲThP4#f %/D@@ePt!i8ɲh~h0#C` f %1D@@Pt!ٯh/ѪThPlU c`f %`r)D@@Pt!XCc}D6zY f %Y)D@A%Pt!ɒp@*X f70_  f %)D@AePt!ɒp@*|$r"4;y f %)D@AU$!XD@8DF %'D@AU$!ε(e1'G%@8f %%)D@B%U$!ε(e1h E11 f %L)D@BeU$!֮uy|yd@8f %:'D@BU$!XDy|d E~f %S)D@BU$!֮uy|ydd E~f %T'D@C%U$!ɒp@)jy2&f %'D@CeU$!{G=)Df2*f %2\'D@CU$!ɒp@)jwN}~f %oK'D@CU$!{G=)DdN}~f %-D@D%U$!XDN0P"y:(GCf %T-D@DeU$!C$8'G%D$22qf %e-D@DU$!XDN0P"jqqolu>jIf %,-D@DU$!C$8'G%!sÑ_D %h|)D@E%U$!C$85Ki (Q% f %%)D@EeU$!C$8D$jIu f %R)D@EU$!C$8$y\0x %E)D@EU$!+C-G jEqb2f %./D@F%U$!ȷ0*ǺEqb29 f %$)D@FeU$!Y6|$r"$9 f %1D@FU$!Y6(fl_`.Q\je،f %)D@FU$!ȷ0*(fj( f %!1D@G%U$!+C2Mdj( _ ȉ f %p'D@GeU$!z?l_`.v$*L %Ϝ'D@GU$!z?82@$  %^/D@GU$!z? +G|$r"$G f %)D@H%U$!֮uy@8 ͵Xf %)D@HeU$!ɒp@)5cj@8f %)D@HU$!֮uydDld E~f %9)D@HU$!֮uyS EDF %%)D@I%U$!ɒp@)76b@11 f %)D@IeU$!ɒp@)d Evhf %i)D@IU$!{G=)2#ţof %)D@IU$!{G=)2&ţof %f)D@J%U$!{G=)N}ӳ@ %#)D@JeU$!{G=)N}c f %H)D@JU$!)0#c  f %9'D@JU$!{G=)jlJ4#f %)D@K%U$!ɒp@)S Ec f %%)D@KeU$!ɒp@)5cjO Ef %(/D@KU$!֮uy\h;!Q Ec f %|)D@KU$!ɒp@)0#⚗f %&)D@L%U$!ɒp@)؁ر˜c f %)D@LeU$!ɠ=qdDl0#f %)D@LU$!ɠ=q2#c  f %S%'D@LU$!)jy0#f %H\)D@M%U$!֮uydDl76bf %)D@MeU$!ɒp@).# ͵Xf %)D@MU$!ɒp@)h;!\j0#f %/D@MU$!ɠ=qc52#Š ͵Xf %O)D@N%PD!+GYa B.r4Љ f %g/D@NePD!+GЇ)[a B$r4 f % )D@NPD!+BfYa B f %1D@NPD!z;dWa B r4Љ f %9)D@O%PD!z>Wa B$Xr4f %;1D@OePD!z>fYa B.Xr4Ќf %)D@OPD!z;(ІjYa B2f %;/D@OPD!+Bǁ)Ya B2Xr4f %!'D@P%Pt!ɒp@*Ddc}D6f %ް'D@PePt!ɒp@)ʄdX f70f %y'D@PPt!XC'G%X f70f %}'D@PPt!XDG%c}D6f %|'D@Q%Pt!q:mej|杝;f %.'D@QePt!͕MAiN%s8f %Tz)D@QP!ؘ3é1+ d0#f %)D@QP!Kȁŀ'bHt|f %F-D@R%P!T&YM6& $/~Qvc f %N'D@ReP!KȁN0P#g?~f %N'D@RP!C$8!+g?~f %W)D@RP!Ϣ)u(p0#f %)D@S%P!ϐRVz0Q,;&D@Vet!ڔWωud( !Qf %4(D@Vt!3DboK93v˖&f %ZC(D@Vt!3DboK93v˖$f %&D@W%t!ڔWωud& !Qf %#(D@Wet!3DboK93v˖(f %:-SS@Wt![Ră:S@v&\&&D@Wt!ڔWωud(27f %C'SG@X%t!ڼFh;Rne@ԢϷ.-SS@Xet![Ră:S@v&\&(D@Xt!ڔWɉud&YQ ! f %%/SW@Xt!ڼFh;Rne@Ԣ " !1Dl+SO@Y%t!ZR;Rne@v&(D@Yet!ڔWv˖$YQ !f %G/SW@Yt!ټFh;Rne@ԢK" !14G;&D@Yt!ʔW`k`R %/(D@Z%t!3D^oK93F"`~f %Q(D@Zet!3D^oK93F"`~f %&D@Zt!ʔWV @% %1-(D@Zt!3D^oK931Uf %O/SW@[%t!YRkC@v/?`(D@[et!ʔW`h Usf %W'SG@[t!ؼFh@T,/SW@[t!YR(`?v/?1L[(D@\%t!ʔW`Rk f %/SW@\et!ؼFh0T?TW `l+SO@\t!XR0T?v/1π(D@\t!ʔWF"`%V~ %¸/SW@]%t!׼Fh0T?T )D@]eP!uU//g?~_f %>A)D@]P!uU//g?~ f %K|-D@]P!7%Ma}V ߅] f %;-D@^%P!RGeu0#_^)f %C2S]@^eP!B&[Ķ?VT@2;/l+:I)D@^P!FRGeuU~}xTRf %aWSh^P!*rS)@K Y}omch>B4a&t)07M}ꣽГxL9 ʺ>Vz0Q,)D@_%PD!H``oK932*f %7r-D@_ePD!{,``oJ2*uLof %)D@_PD!̓,`2&S@ %)D@_PD!̓,`)812&f %5)D@`%PD!H``oK93N}~f %)D@`ePD!̓,`N}ӳ@ %)D@`PD!H`N}ӳ@ %U)D@`PD!H`2&S@ %I)D@a%PD!H`2&̧of %)D@aePD!̓,`)81N}~f %)D@aPt!`J2l8X f70_  f %)D@aPt!`J2l8|$r"4;y f %%)D@b%Pt! w0c}D6zY f %])D@bePt!–$LC ŗX?^D)D@bPt!BV$E&2X#~f %T/D@bPt!JD`@Ibˬ %y/D@c%Pt!C2XE&!U%.V f %y)D@cePt!JD`PI0!Z;dVf %P/D@cPt!BV$ԝVRZ;dVUIbˬ %/D@cPt!PUKRpI0N!U%.|>e, %?J)D@d%U$!Ϻ Q .1@8f %;)D@deU$!Ϻ Qp E@11 f % )D@dU$!Ϻ QQEҿ@ @8f %^-D@dU$!(w0eth/d E~Df %%)D@e%U$!Ϻ QQEҿ@ l E~f %Y)D@eeU$!`J2l8l E@11 f %)D@eU$!MJ9.` E~f %)D@eU$!5J9.@8DF %)D@f%U$!hJ2l8OEҿ@ @8f % z'D@feU$!(w0)92*f %='D@fU$!P`. 2&f %e'D@fU$! w0)8P}~f %I'D@g%U$!P`. P}~f %t/D@geU$!`J2l8ݕ|#o$Q% f %/D@gU$!vU;5Ki ((z8y %)D@gU$!fU;$y4Q% f %x%)D@h%U$!fU;D$CG f %A/D@heU$!`J2l8ݕ|#~_}dxH0 %/D@hU$!vU;$y[j\f % )D@hU$!fU;!sÑjIu f %)D@i%U$!^Up_`._ ȉ f %1D@ieU$!^UL35)p_`.\je،f %)D@iU$!Ϟ˕ <0VL35)Eqb2f %1D@iU$!Ϯ˕ <0V|pw Eqb2 f %t)D@j%U$!ʅ3lB j( f %Ԭ1D@jeU$!ʅ3lת}@/j( _ ȉ f %KM)D@jU$!¹ .|$r"$ f %1D@jU$!¹ .B |$r"$ǚ f %\U)D@k%U$!\#wt@OGlD )D@keU$!U*Wwt@OGlD})D@kU$! w0@8DF %&)D@kU$!@`2*̧of %u)D@l%U$!H`2&T3@ %6f,D@le$!H`P}ӳ@!*%*D@nt! w0. X f70f!, %'D@nPt!w0/ c}D6f %0)D@o%Pt!`J2l8c}D6f %)D@oePt!`J2l8X f70f %wA)D@oP!s4j!KHt|f %)D@oP!uU//{e~0#f %ʗ/D@p%P!ȆRGeuM`l~0#T]ɋ߅ %x)D@peP!uU//Օ|#g?~f %)D@pP!VU;j!Kg?~f %i_)D@pP!o-Xs ;^9Ht|f %)D@q%P!˓-E50#f %/D@qeP!ςKg8y1 eA(/~Qvc f %Ҙ)D@qP!{,`E5g?~f %Y,D@q!o-X^oK93g?~f J%o|,D@re!ðgM3 @  D.:Dl@rP!ìgM3 @N:YB ,?xOK?:Dl@rP!ìgM3 @qm}h b?"Yg)OK?W'D@s%P!~弄f%zNTf %7*SM@seP!'3H0VT@7+:ϳ'D@sP!D9AT*U+c %'D@sP!~弄wV9.!ff %6M*SM@t%P!tx0rS)@;luJǤSDteP! '3H0rS)@.+lm=c&B4a&tx2jГyMg>Vz[4CГya_*:B4a&t]m?wª)rS0Q,`&D@tt!-~5d)v˖$f %5,D@tt!bzw!+EÉud( !YQf %,D@u%t!@ltHud& !YQf %D,D@uet!M{x&`dAD0&Y)bAf %,D@ut!֠#^dAD0(Y)bAf %F&D@ut!]Ĥkv˖(f %x-SS@v%t!O_1ă:S@m 9f\&ϴ9Dj@vet!0l;Rne@i-?$b>K?'SG@vt!,|A1;Rne@8mtY)SK@vt!X1;Rne@[$ V9Dj@w%t!0l;Rne@i-%OA?0&9@A K?0-SS@wet!l(2;Rne@okk%?\H3&-SS@wt! 1ă:S@fe\&n9Dj@wt!0l;Rne@i-}"0@YVGwK?/SW@x%t! N1;Rne@h:c" !1D/SW@xet!B2߲ C@M#Gt~&\4σ9Dj@xt!0l;Rne@i-BئI>@kkACP K?~-SS@xt!4%2;Rne@6%?H3:''SG@y%t!1;Rne@mK9C϶9Dj@yet!0l;Rne@i-*@$Ő K?#/SW@yt!,|A1;Rne@" !14J/SW@yt!Iyo2ղ C@3$&\$9Dj@z%t!0l;Rne@i- @xÊĐ K?jq-SS@zet!l(2;Rne@%&Lp&϶.&D@zt!ѧ6ўigy((k? %m&D@zt!t̥=~9,f %+&D@{%t!t̥=~c5G]f*f %#&D@{et!ѧ6ўPˆ*g %(D@{t!ѧ6ўjG(3 f %&D@{t!t̥=~.t2(f %C&D@|%t!t̥=~*<r&f %z/SW@|et!Z4Қ3\ e@XdϚQ&D@|t!ѧ6ўPˆ* pF. %&&D@|t!ѧ6ўVq&3YDf %c-SS@}%t!\uc3L@9ꈙϙ/SW@}et!Z4Қ34{@X):7AT j(D@}t!ѧ6ўigy( ܊f %*-SS@}t!\uc3t@9xk-SS@~%t!Z4Қ3#]@Xtv&D@~et!ѧ6ўjG((k %-SS@~t!\uc3~J:M@9 3/&D@~t!O#)nYv˖$f %,D@%t! _jnDM͉ud( !YQf %K(,D@et!7?QnڻCi/Wωud& !Qf %,D@t!MQvBvdAD0&Y)bAf %I,D@t!3 vlTodAD0(Y)bAf %z&D@%t!Wfyn/Ĉv˖(f %>-SS@et!]-ă:S@"ff\&Z9Dj@t!^ً(;Rne@i-?>$b>K?G'SG@t!nљ{-;Rne@SϾ)SK@%t!_|,-;Rne@?t ϝ(9Dj@et!^ً(;Rne@i-OA?p&9@A K?tr-SS@t!"H.;Rne@%?H3ϔ1-SS@t!"Y-ă:S@ n&\&9Dj@%t!^ً(;Rne@i-}"0@YVGwK?@/SW@et!-6-;Rne@h9: " !1Dk/SW@t! wڂ;. C@׼ ~&\4x_9Dj@t!^ً(;Rne@i->ئI>@kkACP K?٤-SS@%t!0q/^.;Rne@N%0LX3ϲ+SO@et!IDv-;Rne@"f^&Ϟ9Dj@t!^ً(;Rne@i-*@%Ő K?/SW@t!nљ{-;Rne@Wi%K" !14D/SW@%t!76.۲ C@ $b>K?L'SG@t!,|A1@8mt)SK@%t!X1@[$ g9Dj@et!0l0T?i-OA?&9@A K?/SW@t!l(2@okpF?p/SW@t! 1`?feZ1L]9Dj@%t!0l0T?i-}"0@VGwK?]/SW@et! N10T?h:c+W `/SW@t!B2ܿ@M#Gt~1Lϑt9Dj@t!0l0T?i-:ئI>@^kkACP K?W/SW@%t!4%20T?6\v~.+SO@et!10T?mK9^:19Dj@t!0l0T?i-*@%Ő K?/SW@t!,|A10T?W m/SW@%t!Iyo2K ?3$z1L߳[<9Dj@et!0l0T?i- @xÊĐ K?q-SS@t!l(20T?%&LpZ17k&D@t!O#)nYF"`~f %s,D@%t! _jnDM`k`R %ĩ,D@et!7?QnڻCi/WV % %,D@t!MQvBvAYCkf %1i,D@t!3 vlTo1J!!qf %V&D@%t!Wfyn/Ĉ1Uf %/SW@et!]-kC@"f`ϥ9Dj@t!^ً(0T?i-?$b>K?'SG@t!nљ{-@SP)SK@%t!_|,-@?t 9Dj@et!^ً(0T?i-%OA?0&9@A K?W/SW@t!#H.@>F?pY/SW@t!"Y-(`? n?1LϾ9Dj@%t!^ً(0T?i-}"0@VGwK?S/SW@et!-6-0T?h9:W `/SW@t! wڂ;.迥@׼ 1Lr9Dj@t!^ً(0T?i->ئI>@kkACP K?N/SW@%t!0q/^.0T?N̍v~+SO@et!IDv-0T?"f_19Dj@t!^ً(0T?i-*@%Ő K?/SW@t!nљ{-0T?Wi% . /SW@%t!76.K ? neOY2*uLof %0b)D@PD!}>f2&S@ %cU1D@%PD!}>feO[N}ӳ@ %-D@ePD!λ}>nnاcN}~ӳf % 1D@PD!YbnئeN}S@ %lCH@Pt! @F{D;f? Q>~o"7͑$ϳMCH@%Pt!#N @F{D;f? Q>Bp^'D@ePt!]fU f %?/D@Pt!Q扖 ~U c`f %_/D@Pt!_;Va~8r46#C` f %'D@%Pt!wu&ՙW9N4#f %;/D@ePt!wu&f0#-Ϳ f %/D@Pt!ՙW9O6[c`f %T'D@Pt!Q扖n5ķ6[f %6/D@%Pt!]U·6[c`f %A/D@ePt!ΐkQn40#C` f % )D@Pt!ðgM9@^D&'D@Pt!gFZ*i5%"2f %:/D@%Pt!\?4c U75%"2_  f %-D@ePt!Vٌ)|$r"4]H0f %E9'D@Pt!\?4ʚі֯-u 4f % -D@Pt!gFZ*iv[0}z֯-u 4  %Z/D@%Pt!lنʚі|$r"4IfȌf %)D@ePt!Emz[^/c!Ibˬ %)D@Pt!Emz[^S%.bv(f %ơ)D@U$!Emz]^\&F-d.Y@8f %b()D@%U$!Emz]^l E@11 f %f?-D@eU$!pf[y^bW` E~Df %)D@U$!ɘΠA+`gEqb2f %3)D@U$!pyEqb29 f %MM'D@%U$!pyl_`.v$*L %'D@eU$!py82@$_  %)D@U$!pyf3el_`.f %d)D@U$!ɘΠA+`g|$r"$f %w)D@%U$!pyf3ej( f %J{)D@eU$!py|$r"$G f %)D@U$!V47{ ^n_`. ȉ f %'D@U$!Emz]^qՍ n_`.f %])D@%U$!V47{ ^n_`.Q\je،f %'D@eU$!V47{ ^b[y^Eqb2f %ʞ'D@U$!Emz]^qՍ j( f %r'D@U$!V47{ ^b[y_|$r"$f %E7)D@%U$!V47{ ^j( _ ȉ f %')D@eU$!ɘΠA@8 ͵Xf %/'D@U$!5nuf3@8f %d3'D@U$!ɘΠAhAd E~f %)D@%U$!ɘΠAS EDF %)D@eU$!5nu76b@11 f %-D@U$!5nu^&F-d.Y@81f %)D@U$!xf@8DF %-)D@%U$!pfAhed E~f %)D@eU$!5nud Evhf %V/D@U$!5nuHkXS Ec f %&'D@U$!5nuf3O Ef %S)D@%U$!ɘΠAQ Ec f %)D@eU$!ɯE`}#0#c f %'D@U$!ɘΠAHkX0#f % )D@U$!ɘΠA2#v,p f %)D@%U$!ɘΠAj_Xhc  f %p'D@eU$!ɘΠAhA76bf %p/D@U$!ɯE`}#hA.# ͵Xf %r'D@U$!ɯE`}#f30#f % )D@%U$!ɘΠA2#Š ͵Xf %y)D@ePD!ʔ1Ya B.r4Љ f %$'D@PD!pyt̥=~Ya B$f %<)D@PD!ʔ1Ya B$Xr4 f %֟'D@%PD!ʔ1`+Ya B f %y'D@ePD!py:2@$4Xrf %e)D@PD!pyYa B.Xr4Љ f %'D@PD!pyt̥=~Ya B2f %'D@%PD!pyYa B.v$*L %'D@ePD!ʔ1`+Ya B.f %,D@D!ʔ1Ya B2Xr4f!*%*D@t!Emz[^b[y_Y Df!, % 'D@%Pt!Emz]^[y_/c!~f %$5'D@ePt!χ53![i%s8f %'D@Pt!ͤFiMM|杝;f %,D@t!ѧ6ў džVq&&\ f %/1D@%4!5xi̔9,F.pf J%N,D@!M/Xsq $.8>mZZdf L %)D@P!&y !1*|@Bdhf %)D@%P!*Tb4>Bdhf %c)D@eP!TU@;3b.hf %Ɛ)D@P!gĪ}UB;3b.hf %'D@P!ȇĪ}UBdhf %P(SI@%P!Y] @\NL24@+qQY)D@eP!Tb;3b.hK f %(SI@P!O @4@$%)D@P!ȇĪ}s.dX f %̅SD%P! Y] @Ju2@vclUj;śeL<1ˏF>x:9&.T7ң("ˏF>x BeL.) clUj9>CbVuιJ0Q,o_&D@et!Vhz"% z`0df %m&D@t!:`4zd?@f % &D@t!|8Mz`0df %N&D@%t!{V"4zd?@f %&D@et!LA p7z`0df %i&D@t!hzži4zd?@f %c&D@t!ˤi?I4zd?@f %.=-SS@%t!\#@=0hY2@N\ISd&D@et!Vhz n7z`0df %-SS@t!t'9#@X_EO2@_fx-SS@t!H[#@=0hY2@C+SS&D@%t!LAMz`0df %-SS@et! T8#@X_EO2@|<2#I~&D@t!@5"% z`0df %W/SW@t!La"@X_EO2@AD) }/SW@%t!0#@=0hY2@SڵgE+Sϧ(D@et!τ83 Hz`0df %5&D@t!_TX:O` ~v %&D@t!Yʯy24,]~6bf %?&D@%t!Yʯy24,]~bf %&D@et!_TX:Opb v %w&D@t!Yʯy24,]~`f %;/SW@t! '@{ӧ0@=U{ɐ &D@%t!_TX:O`m߯pmf %P)SK@et!+ U&@^0@ќ/SW@t! '@|ӧ81@=U{ɐ  (D@t!_TX:Opbv~ f %L1S[@%t!+ U&@^1@0<Odw)SK@et! '@^[1@ʈ=U{ɐ&D@t!_TX:~b v %?/SW@t!* U&@^[1@!C,ϧ&D@%t!6m:$`tyz`0df %v`&D@et!686zd?f %\G&D@t!ς`xz`0df %ָ&D@t!d2AZ4zd?@f %X&D@%t! 1J_Хz`0df %L&D@et!RZr4zd?@f % &D@t!8 6zd?f %-SS@t!4ԍV@=0hY2@fSπ(D@%t!.m:_ХJ6z`0df %/SW@et!GÛ@X_EO2@ F)!-SS@t!csU&9@=0hY2@ʒփSV(D@t! 18z`0df %"/SW@%t!)KZ^@X_EO2@ozB)&D@et! [x$`tyz`0df %9-SS@t!__@X_EO2@HΒ)ϼ3-SS@t!Xl@=0hY2@!+Sϵ&D@%t!ς`x|^n{z`0df %>&D@et!oTX:yZ2"Zs QIf %K&D@t!aʯy240]pYZf %[&D@t!aʯy240]nYZf %&D@%t!oTX:yZ3"ZsLQIf %ʉ&D@et!aʯy240]nYXf %=1S[@t! '@0pƙ-@=U{ɐ; Rϳz(D@t!oTX:wZ2"Z۸Ė`j f %s)SK@%t!, U&@q,,@z/SW@et! '@2pƙ-@=U{ɐ,[wh&D@t!oTX:{Z3"Zs QIf %/SW@t!, U&@q,U-@z.aj)#G)SK@%t! '@q,-@=U{ɐϷ&D@et!oTX:nYZsLQIf %f/SW@t!, U&@q,-@z.ij)#)D@P!U/Xsq (.8> ӺbVf %)D@%P!.y #1*|@$s>PNNf %D)D@eP!2Tb4>$s>PNNf %)D@P!TU@, Nf %)D@P!oĪ}UB, Nf %'D@%P!ȏĪ}U$s>PNNf %(SI@eP!Y] @|9(''@%϶A`cϡ)D@P!Tb, N9Ywf %(SI@P!O @d^\'@"w#~)D@%P!ȏĪ}igR /.f %'SLeP! Y] @s)@vc/@ ɛ<1w1(:9*.<(&w1( B.i e@/>GbWs)@0Q,|)D@PD!M/Xtq"=\ߚb@? f %)D@PD!M/Xtq"KF!wJdf %X~)D@%PD!U/Xtq,.886!wJdf %)D@ePD!U/Xtq!wJdW67映f %z)D@PD!̪V=\ߚb@? f %)D@PD!̢V(.882!wJdf %%)D@%PD!̪V!wJdW67映f %)D@ePD!̪V,.886=\ߚbf %`)D@PD!U/Xtq,.886=\ߚbf %F)D@PD!U/XtqKH=\ߚbf %\/D@%Pt!`ay*3q.H(=Tb>[3 %;)D@ePt!JH).B_ Vf %2)D@Pt!˘ p B0 @*=bf %w-D@U$!>T*nw*]8XBf %)D@%U$!$PnJ_lXf %Q)D@eU$!>T*sb]ʗu f %S/D@U$!ˮ.+%I$a.sbOU %)D@U$!ˮ.+sb]ʗu f %5/D@%U$!$P닯,_lXu9]ʗf %mh'D@eU$!M/Xtq"*=Tb7W6f %V'D@U$!M/Xtq=\ߚbOU %'D@U$!̚V,=Tb76f %('D@%U$!̚V?\ߚbOU 6 %0/D@eU$!ʲc^Q_lXia f %jr/D@¥U$!ʖZxՈ//`'H,YqVB f %/D@U$!c*߇6_lXia f %/D@%U$!ȸy?,XU,YqV*B f %b)D@eU$!uGo"b8,YqVf %)D@åU$!ʖZxՈ6߆D*YqVf %)D@U$!S {~.O>F,YqVf %)D@%U$!AVj7a*|ZT f %v'D@eU$!>T*U%R`f %)D@ĥU$!AVj7a*%R`/pm5f %f'D@U$!>T*UpYjXf %2'D@%U$!AVj7a*;Ϯh|Zf %8)D@eU$!AVj7a*pYjX!f %a'D@ťU$!AVj7a*;Ϯi~bf %K'D@U$!ˮ.+V~bf %K)D@%U$!ʲcZ~b T f %})D@eU$!ʲcZ|Z T f %(f'D@ƥU$!ʲcZ닯%R`f %\'D@U$!˦.+V|Zf %5)D@%U$!ʲcZ|Z8Ė`Z f %x'D@eU$!ʲcZ틯pYjXf %ә)D@ǥU$!-@΋xB1@OGlDlN)D@U$!;.;ja͋xB1@OGlD-)D@%U$!-@%-@OGlD )D@eU$!;.;ja%-@OGlDi-D@ȥU$!ː p*;Ϯh,=Tb5, %r3)D@U$!ː p*%I$a.*=Tbf %)D@%U$!M/Xtq"KF=\ߚbf %Jn)D@eU$!M/Xtq$.886=\ߚbf %{)D@ɥU$!̒V$.882=\ߚbf %#)D@PD!QVj7a*0]4L{jlXf %H)D@%PD!Õv2{jlX^Zf %-D@ePD!Õv2.]{jZт>O f %+)D@ʥPD!Õv2UJ{jZf %)D@PD!IVj7a*.]4LF>C`f %p'D@%PD!AVj7a*F>Bb5߯pmf %Y)D@ePD!ȳv2UJF>Bbf %0D@˥D!Ȼv2,]F>C`т>Of!%s*D@et! JH)*=bOU ! %'D@ϥPt!ː p *=TbOe %Û)D@Pt!ˠ p _ V*B f %)D@%Pt!JH)_lX*B{f %-D@ePt!Ȼ"sݠ\$DnbOU %L)D@ХP!Tci , N4f %b)D@P!T ӺbV /.f %-D@%P!T4, NI % -D@eP!.y U$s>PNN/.} f %'D@ѥP!U/Xsq  ӺbVa if %'D@P!̢V,YqV34 %~,D@%t!d2AZ|^n{4zdL,4f %g,D@et! [xz`0d^ͬ/ %f;,D@ҥt!{V"1 4zdL,4f %4.D@t!@5P"Dz`0d^,/ %))D@%P!Tci mZZdrX f %o)D@eP!T;3b.h1t f %\-D@ӥP!`Fp|>AbTBdhXrf %-D@P!Tci (ǩ|`;3b.h&.'DP %['D@%P!M/Xsq !wJd1t % *D@e!̒VmZZd?@f J%t],D@!̒VKB} nEf L %۸)D@%P!`Fp|ɩ|`(Bx(Mf %B)D@eP!Tci ?bU>>Kf %&D@եt!_TX:I4TA\gf %z&D@t!Yʯy24,]hJAf %tJ&D@%t!_TX: k.?~9f %>&D@et!Yʯy24,]1,ҕ?f %[&D@֥t!Yʯy24,]3,ҕ=f %~)SK@t! '@iJ=U{ɐϖ(D@%t!_TX:3,ҕ=9~f %1S[@et!+ U&@iJ:0>Y1n/SW@ץt! '@$H5Tʈ=U{ɐ$fσ(D@t!_TX: k.?\g`f %31S[@%t!+ U&@iJ8+, /SW@et! '@BK* =U{ɐ"V`C&D@إt!_TX:I4TA?Ef %s)SK@t!* U&@ ~4%f [:&D@%t!ɐ +77xVEf %(D@et!:`>M-& d f %'D@PD!̢V;LCaf %)D@%PD!̢V(.886_PGCf %O)D@ePD!̢V(.882;LCf %-D@PD!̒VKF_PGCaf %;'D@PD!̢V_PGC%1 %R-D@%PD!̢VKF;LC1 %#?'D@ePD!M/Xtq;LCaf %)D@PD!M/Xtq"KF;LCf %%'D@PD!M/Xtq"]PGC%1 %?)D@%PD!M/XtqKH]PGCf %|-D@ePt!>T*KndVjb`NA5uf %7/D@Pt!Ȼ"G`J8>C0Mrf %b)D@Pt!˦.+;3Ҵ2z~f %3)D@%U$!ː p*%I$a.hW'f %9/D@eU$!ː p*;ϮhhW'|`- `f %55)D@U$!>T*he.NhW'읷f %y/D@U$!K {~u򊕲vߗ#Fff %)D@%U$!Ȱy?,6߆Dvߗ#f %=)D@eU$!K {~"b8vߗ#f %"/D@U$!̓$b"hW'lf %ϒ/D@U$!uGoW擲vߗ#Fff %k6)D@%U$!ʖZxՈQ4vߗ#f %)D@eU$!AVj7a*r=½ f %D'D@U$!>T*UM' /f % 'D@U$!AVj7a*;ϮiP)f %)D@%U$!AVj7a*M' /2T+c`f %'D@eU$!>T*UhK Af %W'D@U$!AVj7a*;Ϯir=f %^)D@U$!AVj7a*hK A"E`f % )D@%U$!ʲcZr=I½ f %7'D@eU$!˦.+Vr=f %[>'D@U$!ʪcZ鋯hK Af % )D@U$!ʲcZr=?E`f %#'D@%U$!˦.+VP)f %6'D@eU$!ʲcZ닯O' /f %Y7)D@U$!ʲcZP)I½ f %3)D@U$!-@RlOGlD$)D@%U$!7.;jaRlOGlD!z)D@eU$!-@*o6 OGlDb)D@U$!7.;ja)o6 OGlD"G/D@U$!>T*n㜤heEbTT"`KB `f %'D@P!̢VT:'#el %'D@P!U/Xsq vߗ# ᔪ( %,D@%t!xV xVEO'Ą % ,D@et!68_¶1׆:YM|;?>jnn':Dj@6et!é7lwt@qm}3|: ?}'o'D@6t!6?@$SdE5GV*f @9*SK@6t!)Ws4@WO:@:/REGad If'D@7%t!hME5GV*m+' @i'D@7et!>?@8u*Ցx r @7{*SK@7t!(C4@$Tv@?qT ISJ7t!)Ws4@$Tv@\꠱)!.ċiִQˎPFS <^ѱj)咁%;SzbmAOo7c bU#mAODњE;SSi9ѱj()4q.PFSQ:7!njPkQˣ痟 )!.Y Ģv$T0Rz)D@8%t!ʔ1t3B& s f @l[)D@8et!ɢ^ R,]4LaX9f @=)D@8t!ȳv2hlTxZ3f @Y)D@8t!ɢ^ RaX9o֌f @T)D@9%t!M/XtqRH%n3>Vj f @`/D@9et!U/XtqRlhDYY7Xo`f @N-D@9t!ɢ^ RKxZ3!pS x @-%)D@9t!ȳv2aX9o֌f @61)D@:%t!ɲ^ Rt3B& s f @Yj)D@:et!Õv2llT<2@,f @YU)D@:t!ɲ^ R0]4Lt3B&f @)D@:t!Õv2t3B& s f @8/D@;%t!ɲ^ RK<2@,rf @5-D@;et!e/XtqRll?&vP$*L @)D@;t!]/XtqRʆg*=ꉠf @)D@;t!ɲ^ RKN:.K*^f @D)D@<%t!]/Xtq:llTW_&^f @y)D@.K*^~ @m'D@=t!ɲ^ RW_&L^pJ͋ @G-D@=t!e/XtqRll[;~^2Ɂ @Q(SG@>%t!6Ka*@+d/@xB Im(SG@>et!K *@%/@M8 Iyn'D@>t!]/XtqRW_&^pJ͋ @8-D@>t!ɲ^ RK$d`_ @c)D@?%t!Õv2W_&L^ECHbntz%$=! 4?_H:9..d+0(R-D@Ie4!Y2fIa B2f@ A3/D@It!Y2M2Ia B2Xr4f A)D@It!Y7@$Xr4f Aq/D@J%t!Y7L2@$@11 f A*:Dj@Jet!é7lwt@ '9@ $80?])D@Jt!d,wt@[o P 0?J:Dj@Let!é7lwt@$! s@=1@) 0?q:Dj@Lt!3`o q@GЭz=@"?0?2DZ@Lt!™tD@_1 @/!.~@b8B 0?:Dj@M%t!#ppz @GЭz==Q@?zP 0?:Dj@Met!=]?.!?=K*?Ȏ  0?{:Dj@Mt!é7lwt@ (j@/Ϻ 0?4:Dj@Mt!é7lwt@ !!.~@: P 0?A):Dj@N%t!í7lwt@$! I|D@yuS 0?e:Dj@Net!h8z @GЭz=RuO@1U\D 0?`2DZ@Nt!"* $X?.!?:?84W3~0?:Dj@Nt!Xq@GЭz=@) 0?z:Dj@O%t!‹դB_1 @ @$80?:Dj@Oet!é7lwt@ X?  0?>:Dj@Ot!é7lwt@$! Ҧ@0Կ 0?:Dj@Ot!7;@GЭz=^+R@="8B 0?':Dj@P%t!³դB)@'9@"?0?x:Dj@Pet!Gh8+;@GЭz=Ia B.@11 f A'1D@Rt!z>fIa B.Xr4Ќf A[)D@Rt!é7lwt@ko?Gd H#))D@S%t!é7lwt@FD H#R)D@Set!ʠ*xt*82nh An)D@St!ʠ*xAzl6 f Ap)D@St!ʠ*xS{, c, f Ac)D@T%t!ʠ*x""L{f AVJ'D@Tet!ʠ*xt*8P{"L A=)D@Tt!ʠ*xΆDhf A)D@Tt!ʠ*xΆD f A'D@U%t!ʠ*xvt@O8f A)D@Uet!qH-PG<.P~6 f AG)D@Ut!qH-PG<.|z f A4)D@Ut!qH-PS{, |z f AU)D@V%t!qH-P"hf A()D@Vet!qH-PH3Ac, f A\'D@Vt!qH-PH3A f AG)D@Vt!qH-Pɹ3 f A'D@W%t!qH-P>:@9Ff Ax[)D@Wet!qH-P|(<'O+f Ah")D@Wt!ʠ*x<>$7{ f A)D@Wt!qH-PDmiW`:$7{ f A)D@X%t!ʠ*x|(<yUf A)D@Xet!qH-PDmiW`:P~6 f A)D@Xt!ʠ*xAzl6yUf AB'D@Xt!ʠ*x9>O+'f A}'D@Y%t!qH-P<>~bf A )D@Yet!ʠ*x9>8O f A )D@Yt!qH-P>:@~bf A)D@Yt!ʲcZ@ @11 f A=r'D@Z%t!ՁKV@ f A)D@Zet!ʲcZMa B.@11 f A'D@Zt!ʲcZ`R@$f A'D@Zt!ʲcZ`RMa B2f A)D@[%t!ʲcZMa B.Xr4Ќf A''D@[et!ՁKVMa B.f A<)D@[t!ՁK$J>:Àz f A1D@[t!ʠ*x`R,:Àz f AaZ1D@\%t!ՁK*ʻ($J>\< f Ak)D@\et!ʠ*xR'Kf&9>f A)D@\t!ʠ*xR'Kf&vt@f A)D@\t!qH-P*ʻ(H3Af Ad)D@]%t!qH-P*ʻ(ɹ3~f A:Dj@]et!š$LCO@ 0'9@7 $80?+:Dj@]t!;dLPS/ @H!.~@b8B 0?B+:Dj@]t!Wd{$ַ@GЭz=@ "?0?D:Dj@^%t!ª$LCO@$! s@1) 0?~:Dj@^et!bqV^0 @GЭz==Q@>zP 0? 2DZ@^t!mD30?P=K*?Ȏ  0?T:Dj@^t!š$LCO@ (j@2Ϻ 0?G:Dj@_%t!JrTg30?j?tW3~0?2:Dj@_et!zESg̔0 @GЭz=NuO@5U\D 0?M:Dj@_t!š$LCO@$! `|D@yuS 0?:Dj@_t!k쎷ַ@GЭz='@>) 0?2DZ@`%t!ɚg LPS/ @ @) $80?:Dj@`et!š$LCO@ !.~@V P 0?52DZ@`t!隄gfs (@('9@&"?0?:Dj@`t!ڥk~ ^@GЭz=^+R@)b8B 0?#:Dj@a%t!š$LCO@$! Ҧ@5װԿ 0?]:Dj@aet!ESg :@GЭz=&=K*?3( 0?Ek2DZ@at!8NrTg=!@=Q@0Ϻ 0?.:Dj@at!š$LCO@ ?  0?l)D@b%t!š$LCO@d8wD H#w:Dj@bet!š$LCO@$! `9?#HaAzO0?":Dj@bt!"Wd{ ^@GЭz=) @@"0?L:Dj@bt!;s (@5@V P 0?:Dj@c%t!"uV^ :@GЭz=!R?tW3~0?Q 2DZ@cet!PmD=!@(j@6U\D 0?v)D@ct!PHkV@|d|H#n)D@ct!PHk~bf A\)D@ft!ɺV>:@~bf A4)D@g%t!ɺV miW`:$7{ f Av)D@get!ɺV miW`:P~6 f A)D@gt!ɺV"hf AD)D@gt!ɺV9S{, |z f A0)D@h%t!ɺVG<.|z f A")D@het!ɺV舕3Ac, f A<'D@ht!ɺV舕3A f AŤ)D@ht!ɺVɹ3 f A-'D@i%t!ɺV>:@9Gf A^)D@iet!˪Nt*82nh A1'D@it!˪Nt*8P{"%L A)D@it!˪N)""%L{f A7)D@j%t!˪N9S{, c, f Aڴ)D@jet!˪NΆDhf AO)D@jt!˪NΆD f A~)D@jt!˪NAzl6 f A\)D@k%t!˪NAzl6yUf Ap)D@ket!˪NL(<yUf AO)D@kt!˪NT<>$7{ f A'D@kt!˪Nl9>O+'f A)D@l%t!˪Nl9>8O f A7'D@let!˪Nvt@O8f A'D@lt!V47{ ^fG%@ f A1)D@lt!](^ٙ^S sp f AL)D@m%t!](^ٙ^0(<,Ҧ#f A1D@met!ɺVGfWBpP@<,Ҧ#f A[B1D@mt!](^ٙ^nUS=u{f A+)D@mt!˪NnUvt@f A1)D@n%t!ɺV꾵?nSɹ3~f AB)D@net!ɺV꾵?nS舕3Af A)D@nt!˪NnUl9>f A 'D@nt!ʲcZ`Rp-bf As'D@o%t!ՁKVp-`f A!)D@oet!ʲcZp-`Zf Ac)D@ot!ʲcZp-`\" p5f A)D@ot!ʠ*x$DfUV\ f A'D@p%t!ʠ*x3 =d)4w ǰf AV'D@pet!ʠ*x/dpIf AO)D@pt!ʠ*x1flbIp f Af0'D@pt!ʠ*xm8dO@' ¹ AH'D@q%t!ʠ*xm8dC\UV AÙ)D@qet!ʠ*x_ݍh0Tˋ"f AC)D@qt!ʠ*x1flbq:͖ f A)D@qt!qH-P..KRcZ  f A:)D@r%t!qH-P}U[ rdE8%?`f Aۺ)D@}t!qH-P&>8%s `f AO )D@~%t!qH-P{6e_@As `f Ath)D@~et!qH-P{6e_@Asnf AH)D@~t!qH-PEsnf Aoo'D@~t!qH-PYbEd@3t A 'D@%t!qH-P㧱E0Xy2 Av)D@et!qH-P㧱EMf A`@'D@t!qH-PS GMf Ad)D@t!ʲcZ5,Ҕ/2T+cŏ`f A'D@%t!ʲcZ`RP=f A)D@et!ʲcZ5,Ҕ/~ 4f `f AF'D@t!ՁKV5,Ҕ/f A/'D@t!ʲcZ`R5,ҕ)f A)D@%t!ՁK]E !҃ԑ`f A{1D@et!ʠ*x`R,w^r(G҃ԑ`f A1D@t!ՁK*ʻ(]E !Ue/f A=)D@t!ʠ*xR'Kf&Urq !f A)D@%t!ʠ*xR'Kf&H~#f Ai)D@et!qH-P*ʻ(㧱Ef AY)D@t!qH-P*ʻ(S Gf A)D@t!z;2Lj@ f Aϑ1D@%t!z;d@ @11 f A<)D@et!z>Qa B.@11 f At1D@t!z>fQa B.Xr4Ќf A:Dj@t!é7lwt@D pP4@ :nP /)D@%t!pm=Lwt@[o:Dj@t!é7lwt@v t ¤;t:@+E& /u:Dj@t!LfmX`{! @C@>C /x:Dj@%t!/ֆ·y.\@VF?,tO/:Dj@et!* /Oi:Dj@et!é7lwt@D %+@8-\֛w/:Dj@t!å7lwt@v t Sa?O/:Dj@t!q|tb0ؿH@C ?#*tO/ 2DZ@%t!ĵ?,4^% @צ@;C /j:Dj@et!de@0@C x@U xz/5/:Dj@t!d~S:@Q@nP /o:Dj@t!é7lwt@D צ@3ۉ /ڛ:Dj@%t!é7lwt@v t @l@$/E /i:Dj@et!P[q @C@/#s[/r2DZ@t!H+*%- @pP4@Z)cP /:Dj@t!q|8{! @C'@89EP /2DZ@%t!ˆ?,4·y.\@NL? >* /Y)D@et!oU,2G @/RCH"`)D@t!sU,\Tk@/RCH"L)D@t!uĨDTk@/RCH"J$)D@%t!uĨ2G @/RCH")D@et!Y2fIa B2f A/D@t!Y2M2Qa B2Xr4f A>)D@t!Y7@$Xr4f Ae/D@%t!Y7L2@$@11 f AI)D@et!é7lwt@&$ H")D@t!é7lwt@& H")D@t!ʲcZm\өt*@$f A<)D@%t!Ͷ}sNЪV,@ f A)D@et!ʲcZ@ @11 f A)D@t!ʲcZMa B.@11 f A{)D@t!ʲcZMa B.Xr4Ќf AN)D@%t!Ͷ}sNЪV,Ma B.f AHL)D@et!ՁKoԷ2z~pf A-'D@t!ՁK߮2˨Eza) A)D@t!ՁK鄧 C, f A)D@%t!ՁKF^C, f A)D@et!ՁKw댲f A !)D@t!ՁKz~pf A )D@t!ՁK r:.Mk f AZ)D@%t!ՁKt58: f AZ)D@et!ՁK}oԷ2: f A'D@t!ՁK_I*:C(" Ay)D@t!ՁK_I*:PZ f AQ>)D@%t!ՁK>PZ f A)D@et!ՁKF^2z f As7)D@t!ՁK@~j:_« f AU/D@et!ՁKum\w _« f A/D@t!Ͷ}sNЪ`RܤVz>:8W f A2B)D@t!ՁK`R*B8f A)D@%t!ՁK`R(>f A\)D@et!ՁK`R(_I*:f A)D@t!ՁK`R* f AԚ:Dj@t!š$LCO@D qP4@nP /|p:Dj@%t!Tw.4@%+@%[/Tr:Dj@et!kO2`(cJ6c @Cl @Z)cP /:Dj@t!Š$LCO@v t v@ f8 @ / :Dj@t!+[sS_Z3SG@CL?&*]@ />2DZ@%t! 0hRΰ_эW @'@8ۉ /MD:Dj@et!š$LCO@D VF?+t>* /:Dj@t!4fXݍW @צ@?C /:Dj@t!‘SJn3SG@C ?1jtO/:Dj@%t!š$LCO@v t Sa? O/.:Dj@et!҈/ b6c @C x@U xz/2DZ@t!á~.4@Q@ :nP /:Dj@t!š$LCO@D %+@/8-\֛w/>Y:Dj@%t!!~%+ @qP4@)cP /:Dj@et!҈/ D;'՝ @C@e3[/:Dj@t!š$LCO@v t Ml@'/E /:Dj@t!QSJ,A @C'@89EP /z:Dj@%t!4fXp/"Z@|L?'t>* /(=:Dj@et!š$LCO@D צ@6_ۉ /)D@t!š$LCO@$[o?@ H":Dj@t!š$LCO@v t $¤;t:@2+E& /:7:Dj@%t!K2`(c;'՝ @CQ@  /P2DZ@et! Tw%+ @ x@xm\֛w/:Dj@t!ëWsS_A @C@pUC /2DZ@t! 0hRΰ_tp/"Z@*VF?8tO/)D@%t!RA(QxE @/RCH"K/)D@et!rA(BwF@/RCH")D@t!ù+ĭ$|c*wF@/RCH"t)D@t!9+ĭ$|c\QxE @/RCH" )D@%t!](^ݙV@~jPZ f A))D@t!](^ٙVxF^2z f Ah'D@%t!](^ٙV߮2˨Efa) A'D@et!](^ݙV 2bw A2P)D@t!](^ٙVXw댲f A)D@t!](^ݙV߮2˨f AE)D@et!ʲcZ{jlXZf A)D@t!Ͷ}sNЪV,{jlXf A)D@t!ՁKצW^Vx f A'D@%t!ՁK VHLTf AWO'D@et!ՁK}Q!2VFqlf AS,'D@t!ՁKǦW^VFqlf A)D@t!ՁKRXïef Aʬ)D@%t!ՁKRXx)f A)D@et!ՁKfY8bx)f A6'D@t!ՁKJX%drV A'D@t!ՁKq81bN *:f A'D@%t!ՁK0;blnQ2f A 'D@et!ՁKfY8blnQ2f Aڶ)D@t!ՁK#h4 dl |f A`'D@t!ՁK#h4 drV A'D@%t!ՁKY[7ZdE>3 f A%'D@et!ՁKY[7Zd .f A#)D@t!ՁKm81b  f A'D@t!ՁK0;b |lf A|'D@%t!ՁKD9DbN *:f AJ'D@et!ՁKD9DbfO/?:Dj@t!Gy 0@C]j3@+6:/:Dj@t!é7lwt@$ pҭH@+6^W2x/'2DZ@%t!DEHxQ @w+o@ ѻP /L:Dj@et!Cy }B8K @Cr@ 1+/::Dj@t!é7lwt@< [`D }җ@44\x /j:Dj@t!3 'bp @C>ZS@A4P /2DZ@%t!p T k@p&?+ӴȐ /:Dj@et!é7lwt@$ 4ǜi@2D /2DZ@t!¿\ k@? RG~/-:Dj@t!I0bp @CX @DF /V:Dj@%t!é7lwt@< [`D 14@p0 /:Dj@et!0}B8K @C을b@+8LM /+X:Dj@t!x#tqQ @ed@9RJdwO/e:Dj@t!é7lwt@$ w+o@ xH5 /K:Dj@%t!é7lwt@< [`D O4@k /6,:Dj@et!0@Cxv@ѻP /t:Dj@¥t!#tq na@vҭH@0+/:Dj@t!/I0s@Cp&?q( /:Dj@%t!\(VY^ @5ZS@2D /0)D@et!%~X+&6H@/RCH")D@åt!~X+0- @/RCH")D@t!!X- @/RCH",)D@%t!A&6H@/RCH"Q)D@et!z;2Lj@ f AՑ1D@ĥt!z;d@ @11 f A)D@t!z>Ia B.@11 f A1D@%t!z>fIa B.Xr4Ќf A)D@et!é7lwt@)|` H")D@ťt!é7lwt@[o?H" )D@t!ȱheј!f Avh)D@%t!ȱ RP: s f AZ)D@et!ȱ9at*f AVr'D@ƥt!ȱӐU=NX}f ADJ)D@t!ȱӐU!f Ad)D@%t!ȱxk;I:f Aߙ))D@et!ȱ4=ׂ ;I:f Aߦ`)D@ǥt!ȱ4=ׂ Lg0 f A)D@t!ȱ42@<5Ԕf AߣW)D@%t!ȱ dwtf f Am )D@et!ȱ dtk f A:'D@ȥt!ȱ9atktf A)D@t!ȱkX}= f A߶)D@%t!ȱ&@*f Al)D@et!ȱ&@Mq5 f Aߚ)D@ɥt!ȱ1 2Mq5 f A''D@t!ȱd8G-8 A='D@%t!ȱO8f A.)D@et!ȱTIcx6 f Al)D@ʥt!ȱd8;Xf Aj)D@t!ȱTIcx6Lg0 f Ap)D@%t!ȱ1 2;Xf Aœ'D@et!ȱ-{~8G-8 A'D@˥t!ȱ O8p^ĩ A܄)D@t!ȱ-{~85Ԕf Aߟ)D@%t!ȱ RP:^ĩߎ f AH)D@et!ʲcZ@ @11 f A )D@̥t!2Ў(V,@ f Ar*)D@t!ʲcZMa B.@11 f A߰U)D@%t!ʲcZuL#*@$f A߮)D@et!ʲcZuL#*Ma B2f A)D@ͥt!ʲcZMa B.Xr4Ќf A)D@t!2Ў(V,Ma B.f A߱)D@%t!2Ў(@80 f A߸]/D@et!ȱ#uL I0 f A/D@Υt!2Ў(tB,l+@8y""f AQ6)D@t!ȱ,l+tB(-{~8f AGc)D@%t!ȱ,l+tB*ӐUf Ao)D@et!ȱ,l+tB(42@O/) :Dj@ԥt!ђm*@Ced@ 6:/k:Dj@t!#jgL_><@b@8H5 /:Dj@%t!QyT8ar@C?"RG~//U:Dj@et!ñ*?!G%^ @Hǜi@DF /q)D@եt!Kf$_vI/G@/RCH")D@t!iKf$_BU! @/RCH"H)D@%t! $CU! @/RCH")D@et! I/G@/RCH"'D@֥t!V47{ ^D+;sMa B.f A('D@t!H^sՍ Ma B2f A)D@%t!V47{ ^Ma B2Xr4f As)D@et!V47{ ^@$Xr4f A?)D@ץt!V47{ ^@$@11 f Ag'D@t!H^sՍ @$f Aߝ.'D@%t!.١Vo2˶h$z4f Ao)D@et!.١V؄ dtk f A'D@إt!.١Vatktf A<)D@t!.١V8kX}= f A8)D@%t!.١VX&@*f A )D@et!.١VX&@Mq5 f Aߠ)D@٥t!.١V$z4Mq5 f A!)D@t!.١Vd8q f A'D@%t!.١VO8f A'D@et!.١V {~8G{, Az)D@ڥt!.١V؄ dwtf f Aߍ$)D@t!.١V<2@<^ĩߎ f Aߴ)D@%t!.١V {~8 s f Ad]'D@et!.١VO8p^ĩ Aߛ'D@ۥt!.١Vd8G{, AH)D@t!.١V$z4 f AߛF)D@%t!.١V=4=ׂ q f Aߣ)D@et!.١V}4=ׂ ;I:f A)D@ܥt!.١V8k;I:f A<)D@t!.١Vat*f Aߪ$'D@%t!.١VӐU=>X}f A{)D@et!.١VӐU!f A߇)D@ݥt!.١Vxeј!f A`'D@t!V47{ ^D+;s@ f Ao)D@%t!H^Ö sp f A{\)D@et!H^0(@11 f AW1D@ޥt!.١V;rD*Wmt:@11 f AZ1D@t!H^2˶hoUÖ@(|} f Aߑ'D@%t!.١Vo2˶h<2@oQП}X$S26f ALv1D@t!iAd@ t'V f A=m)D@t!z>F3ZP|fzO/-D@%t!{If5A|,E.< AF:Dj@et!M.s+_Z@+^4-DT!?4Za /:Dj@t!é7lwt@t {u@#&/#/D@t!{(QY2䤪QEӃ f A]":Dj@%t!Qn{ @+^u@ l˨/x:Dj@et!! 4 @ @_.EP / :Dj@t!E.s @+^6I@ nEP /:Dj@t!JQ\@^@ W/9?%aʂP /:Dj@%t!é7lwt@t Gp?@oP /Z1D@et!ΓMu8ikb >]EN y)*f A:Dj@t!@L8/QH:Dj@t!é7lwt@t @*uCP /b:Dj@t!é7lwt@t l?aʂP //D@%t!U'wc]NdKF.<Hk A,:Dj@et!MR.o1@+^!3|@ .EP /':Dj@t!sI!@ {u@0,˨/:Dj@t!]EN y)*f A)D@%t!2Ў(j]5 QEӃ f A)D@et!$P8>]EN WMaf AE)D@t!$Pj- y)*f A)D@t!2Ў(h2䤪Zm f A/)D@%t!$Pj- Q f Ai)D@et!2Ў(1D Zm f AK)D@t!$PlL:6 Q f A)D@t!2Ў(1D # f AOu)D@%t!2Ў(/c#<9 f AG=)D@et!$Pvt@ f A'D@t!2Ў($E.< A]'D@t!$P KF.<Ik A)D@%t!2Ў(]c&8󷑋 f A&)D@et!$P KF.zO/:Dj@ t!  @ ́-@ *uCP /:Dj@ t!ӠAY@+^,DT!?4f@ /b:Dj@%t! ߈+R@ Zp?@[+ //U)D@et!iydg]EN y)*f A)D@t!hN2䤪QEӃ f AՊ)D@t!HFxj- y)*f A0)D@%t!hN2䤪Zm f AdH)D@et!HFxj- Q f A[)D@t!hNH1D Zm f A )D@t!hNxj]5 QEӃ f A)D@%t!HF>]EN WMaf A')D@et!hNxeјWMaf A)D@t!HFxj]5 wtf f A)D@t!HFvt@ f Ad)D@%t!hN/c#<9 f A)D@et!HFZ&F-dSvt@f Am)D@t!hN;rE*Qxeјf Ax)D@t!hN;rE*Qxj]5 f Ae)D@%t!HFZ&F-dS/c#Tf AW'D@t!2Ў(1ĩT(: A'D@%t!$P$>T*cED1f AfH)D@et!$PW,H Xf A2)D@t!2Ў("TV>R f A'D@t!$PW,H XI{ Aj='D@%t!2Ў(N#&XRU>f A)D@et!2Ў(%I$`$1ĩTf A$)D@t!2Ў(%I$`$..KRf A)D@t!$P}L# $df A)D@%t!$P}L# ldf Aw1D@et!ʲcZ%I$`$1,ҕ)]KF f Ac)D@t!ʲcZhƽJ/~ 4f `f Al1D@t!$PV,C٢0-1f f AU)D@ %t!ʲcZhƽJ/~y`f A:B1D@ et!ʲcZ%I$`$=p) _f At)D@ t!ʲcZdW A~y`f A1D@ t!$PV,ɤ'JC*U`f A)D@!%t!$Pg Elw+f A)D@!et!2Ў(QGH:`f Az'D@!t!2Ў(OD"EJiO AX!'D@!t!$P?(xES A'D@"%t!2Ў( EJiO A'D@"et!$P?(xEH:f A|*)D@"t!$P>HȀVCS`f Aze)D@"t!2Ў(OD"E?r f A k)D@#%t!$P>HȀVC!4T`f AF)D@#et!2Ў(GӭPA?r f A0)D@#t!$PyFs )!4T`f AG)D@#t!2Ў(GӭPAQC `f AP'D@$%t!2Ў(Lyм#eQf A'D@$et!$PFɗj#t/pS?f ATI)D@$t!2Ў(1'Qeڈf A)D@$t!$PFɗj# aGf AB)D@%%t!2Ў(1'QC `f A;)D@%et!$P}Fs ) aGf A)D@%t!$PeK!S?t/f A)D@%t!2Ў(Lyм#YRw`f A>B)D@&%t!$P@~"YRw`f A@)D@&et!2Ў(eK!0_߈`f Aŝ)D@&t!$P}L# @~"f A)D@&t!$P}L# eK!f A0)D@'%t!2Ў(%I$`$ Ef A)D@'et!2Ў(%I$`$QGf A!)D@'t!z>脃I*.w"wՉ f A\)D@'t!cTfIa B2f A)D@(%t!Y7XV$! nf AD)D@(et!J"AS-$j@ f Ad)D@(t!ȸѽ- .,Ctpf ABd)D@(t!!BHt jލsTf A)D@)%t!@X9 "mhrp f A)D@)et!ʅ!+k0Іfp4f Al:Dj@)t!é7lwt@Эz7 ? Si:/?(:Dj@)t!򓄩BPg@^]3hʻ<@,r/?2:Dj@*%t!OhY;@^P#W@=%&P /?C:Dj@*et!旕^`iKY@^]3HNզ+(?;Qv /?&:Dj@*t!°I?\A@a^`o@.㯅 /?:Dj@*t!é7lwt@@*h68O/?Ϩ:Dj@+%t!é7lwt@Эz7 Mi@%2} G /?8c:Dj@+et!ޗ^sL@^]3j@ wwP /?9P:Dj@+t!¤I?Vt @^S]?rP /?6:Dj@+t!꓄Bm,N~@^]3 @/aTw/?_:Dj@,%t!Oh @^D›+@׍G /?:Dj@,et!é7lwt@`o@ EP /?p':Dj@,t!é7lwt@Эz7 (@$>OA /?i:Dj@,t!Xwm,N~@^]3P#W@ ,; /?:Dj@-%t!Xm.p @a^aʻ<@ *h68O/?A:Dj@-et!dkXHsL@^]3=@.㯅 /?V:Dj@-t!R-Vt @a^BW5?2Qv /? ?:Dj@-t!é7lwt@-›+@7%&P /?:Dj@.%t!é7lwt@lW5? rP /?|:Dj@.et!é7lwt@Эz7 rَj@ /??:Dj@.t!kXHpiKY@^]3]?%c% /?:Dj@.t!R-lA@a^j@ EP /?‘:Dj@/%t!pwdg@^]3jד@G /?u:Dj@/et!pm.p0Y;@^@ baTw/?Q)D@/t!d,wt@[o @.4o@yXV$,Ctpf A1d1D@4%t!J"ASd@ w"wՉ f A/D@4et!!BT쐷ލsT@11 f A/D@4t!*!QЇk0@Gjw\ f A_=ISI4t!B83@{3@>x PHb@ WmP3 :Dj@5%t!.4@⨂&@d8ಸ(?: k=t/?[-D@5et!!BU;p4o\C+ A=/D@5t!J"ASЇk1Ia B2#"6 f Ab1D@5t!z>Tf脃I*.Xr4Ќf A!-D@6%t!ȸѽ- .n! f A1D@6et!T.4oA @dlwkcF2mhrp f Ad$ISI6t!E\*3@fW@s,!~C~m p Ǹ Rt}+= cS :Dj@6t!.4,|.@d8kNa @ /? )D@7%t!ʲcZ섃I*.w"wՉ f A)D@7et!$PlNwtf f Af5)D@7t!2Ў(heј! f Ay?'D@7t!2Ў(Xx\;i$f A~'D@8%t!$PW05>f A)D@8et!$P_ $;if A?)D@8t!2Ў(W0uW& f An'D@8t!$P_ zc-B) Aa'D@9%t!2Ў( d o&uW AV)D@9et!2Ў(lN>5f A>)D@9t!$PXx\! f A)D@9t!$PXw+0B)c f A)D@:%t!2Ў( d V} f Ab)D@:et!2Ў(T.;"6 sP f A)D@:t!$P42@8 ȍf AT)D@:t!2Ў(18#4JWȋf A)D@;%t!$P})_".z6FN f A'D@;et!$PT.;"6 JW Auy'D@;t!2Ў(u)_".z6Nȕ A0)D@;t!2Ў(܌s2FN f AZ)D@<%t!$P18#4#59f A/)D@%t!ʲcZ섃I*.Xr4Ќf AS/D@>et!$PV, .n! f Ap<Sp@>t!@0J@fW@ťR.?|)JJҶ;0R )D@>t!$P}L# T.;"6f AG)D@?%t!$P}L# 42@8f A)D@?et!2Ў(%I$`$lNf A)D@?t!2Ў(%I$`$heјf A)D@?t!š$LCO@I1OH"*:Dj@@%t!š$LCO@Эz7 َj@ /?:U:Dj@@et!ùh[6a@^]3iד@G /?^:Dj@@t!úı/x_|:@^@"aTw/?9:Dj@@t!É [FDEX@^]3V]?!c% /?p:Dj@A%t!¸`WB@a^,j@EP /?B:Dj@Aet!š$LCO@&›+@=&P /? :Dj@At!š$LCO@Эz7 (@+>OA /?*:Dj@At!i [\@^]3=@!㯅 /?1:Dj@B%t!ˆ`Wl h @^bW5?;v /?)g:Dj@Bet!Ùh[|r|@^]3P#W@<,; /?S:Dj@Bt!Úı/x_R@^nʻ<@*h68O/?P:Dj@Bt!š$LCO@mo@EP /?X:Dj@C%t!š$LCO@Эz7 Zi@(r} G /?:Dj@Cet!±RLr|@^]3 @aTw/?w:Dj@Ct! ]4S@a^P›+@!WG /?X:Dj@Ct!9>@^]30j@wwP /?Q:Dj@D%t!s,8' h @a^]?rP /?:Dj@Det!š$LCO@@+*h68O/?:Dj@Dt!š$LCO@W5?rP /?:Dj@Dt!š$LCO@Эz7 ` ?&i:/?Q:Dj@E%t!9>VDEX@^]3Nզ+(?v /?&:Dj@Eet!Õs,8'R@a^to@#㯅 /?:Dj@Et!qRLJa@^]3oʻ<@,r/? :Dj@Et!s ]4|:@^P#W@=&P /?E)D@F%t!©leT[o-@d8H"ٖ)D@Fet!™leT[/(_v$@d8H"$)D@Ft!lФ 0(_v$@d8H"?)D@Ft!lФo-@d8H"O)D@G%t!V47{ ^XV$! nf Ap^)D@Get!XF])_".z6FN f Av)D@Gt!xN18#4JWȋf A\t)D@Gt!xNs2FN f A)D@H%t!XF18#4#59f A})D@Het!xNs2V} f Ab)D@Ht!XFXw+0#59f Aޑ'D@Ht!XF<.;"6 JW A X'D@I%t!xN])_".z6Nȏ A)D@Iet!xN] d V} f A)D@It!XF Zw+0B)c f AW'D@It!XFXW05>f AnJ'D@J%t!xNx\;i$f A`)D@Jet!xNhlN>5f A )D@Jt!XF(x\! f A)D@Jt!XF_ $;if A9)D@K%t!xNXW0uW& f AX'D@Ket!XF_ zc%B) AA'D@Kt!xN d o&uW A3)D@Kt!xNxeј! f A)D@L%t!XFXlNwtf f A)D@Let!XF<2@8 ȍf Aj)D@Lt!xN<.;"6 sP f AĀ/D@Lt!V47{ ^^&F-dSI*.rpmhf Ao)D@M%t!V47{ ^]a B2! nf A1D@Met!xNsՍ W|4Xr4Ќf A9<Sp@Mt!#W)ƶ;@ަeo\n?z^L[fW@0R1D@Mt!V47{ ^^&F-dS%@ jw\ f A4)D@N%t!V47{ ^XV$@11 f A41D@Net!xNsՍ Wl9 "w"wՉ f Al<Sp@Nt!#W)U#q@ަeo\sN:^L[r{3@0R)D@Nt!XF^&F-dS<2@8f Au)D@O%t!xN;rE*Qxeјf A.)D@Oet!xN;rE*QhlNf A?!)D@Ot!XF^&F-dS<.;"6f A^)D@Ot!ʲcZ;6;` Sf A0t'D@P%t!2Ў(4vb~ 'D@Ret!2Ў(`=bxifE0J@rgNq,1@%R¬)JJ6H0R/D@Vt!ʲcZ%I$`$%OZ"Kfe# A)D@Vt!ʲcZ{jlX Sf Ac/D@W%t!$PV,X>Z Ac:Sl@Wet!@0J@P{d-@ťRZb)JJ1Y`0Ri)D@Wt!2Ў(%I$`$B1u Xf AU)D@Wt!2Ў(%I$`$2.KVf A)D@X%t!$P}L# $bf AT)D@Xet!$P}L# `=bf AK)D@Xt!ʲcZv/{`f A,)D@Xt!$P?Aw+f A)D@Y%t!2Ў(SCkp/`f Ad'D@Yet!2Ў(^+9HAM8f A'D@Yt!$P$ 4ARWf A*)D@Yt!$PH ?M8`f A])D@Z%t!2Ў($ 4Aoi?f AZ'D@Zet!$PH ?}"Rf A@N'D@Zt!2Ў(0H ??oif A1R'D@Zt!2Ў(MARWf AH'D@[%t!$P^+9HA/kpf A})D@[et!$P87~--"R}f A)D@[t!2Ў(0H ? ߋi `f Ac'D@[t!2Ў( y}o)kǛf A'D@\%t!$PlkO)n_[ Ad'D@\et!$Pdv)kǝf A'D@\t!2Ў(tkO)(Y A)D@\t!2Ў(4-_[ `f Av)D@]%t!$Py}o)Au`f A.'D@]et!2Ў( 4- i; A'D@]t!$P87~--Auf A)D@]t!$PaX'Y`f A )D@^%t!2Ў(dv)Xo f A1D@^et!ʲcZ%I$`$w=F!%f AH)D@^t!ʲcZdW A{`f A/D@^t!$PV,8Aq¢*U Au<Sp@_%t!B0J@M ԮťR-<([() JKmga 0R/D@_et!ʲcZ%I$`$5,ҕ)!2Uf A)D@_t!ʲcZv/~ 4f `f A1D@_t!$PV,uU-4ݥ+f A' <Sp@`%t!D0J@AȥR-%Al)JJ=)0R)D@`et!$P}L# aX'f Al)D@`t!$P}L# dv)f AP)D@`t!2Ў(%I$`$MAf A2,D@a%4!2Ў(%I$`$SCf%*ABA@@ke4!v $}1ɡT.l${uD Mv*jr@D@@k4!&CIS, pR BMQAS@  PEB@@kt!&CIS,F@r< 818ATV@ # PE[EA@@l!t!&CIS, ԑҌ DAT@ 3 PE1vD@@la4!&CIS,#& N/AAPԑ@ C PE@Al4!S_K-D@ 4! b6N~˨fB5 EL)D@ t! baw#8o~My EL)D@!%t!jUiA*&k@%B*!t!P\Pkd @E @%B*at!TPj| @ELG%B*t!r-5T|Γ @EL%B*t!|T{& @Et%B+!t!rkhX饿 @F m'B+a4!(LX;F 2 @FL A+4!"?3,D@+4!6")!|.J -mR68f#l EL)D@,%t!اߜ*, .HLA5~f EL)D@,et!8bZF2 -mR68f EL)D@,t!ޏ ip+F.LA5~f ELvv)D@,t!]P32 @m/.HC2DZ@-%t!]Pwt@uS Q>~O)D@-et!߅w]HkD,I!FC8*f EL$:Dj@-t!Ӣٮmwt@%S-DT!? Q>BP Ǭ)D@-t!ۅ.9pfeљ sp f ELL:Dj@.%t!»ٮm32@̇S-DT! @4L6D )D@.et!ۢݮ]R6l+[-~f ELH2DZ@.t!]P32@US!3|@ӽ)D@.t!٦\",2$wtf`f EL'D@/%t!ߧiA#ȧ~ -mR68f EL()D@/et!",PwD$T68f ELG)'D@/t!آ̜ 9,H $T68f ELS]'D@/t!ڣTg(&-$\C5~f EL^'D@0%t!܀x-$\C5~f EL)D@0et!dřWI +s.F-$\C5~f ELK'D@0t!]yU8]eLA5~f ELs)D@0t!Eg&(Qai4$T68f ELˆ'D@1%t!B` JAY$T68f EL'D@1et!؅5$ -mR68f EL'D@1t!De3]LA5~f ELZ'D@1t!AA1 `f-$\C5~f EL.)D@2%t!C\&PcLH6-$\C5~f EL(|'D@2et!EFɱP%-$\C5~f ELdSH2t!У{DqNEa@9jLcdxZ&~tc?ۿD wXf"?iKH2t!rÅŀNEa@9jLkPxZ&~tc?7؈ 6{"?h#KH3%t!5Sz@qƍ?29jLc8lZ&~tc? 6˥"?n8KH3et!R qƍ?9jLktZ&~tc? 'ۿDǢXf"?('D@3t!@ 9Xb-mR68f EL%'D@3t!C:ϸ 'LA5~f EL,)D@4%t!Dk ӏ4 -mR68f EL.y)D@4et!BN>34BG@j7Ыsj!)D@9t!pA*}J2> mSf EL)D@:%t!pA*k}$2 f ELM2DZ@:et!Q0@j7ЫsS@ת)D@:t!pA*tj+>$WUB f ELC:4!0R*cB@BA2A&B;!4!iА @ %B;at!Xp#,k7@@Y%B;t!$\Cĩ@@@%B;t!Hs>1ū@A [%B!t!]P\@CLC%B>at!Fh_A\@C)%B>t!` &@C]%B>t!RPݜkP}P2@D %B?!t!2SѰ&՜@DL6%B?at!ȁ@D%B?t!4jU؁i@D%B?t!cFi@E 5%B@!t!GIAg@EL%B@at!ss>1ū@En%B@t!3R Cĩ@E{%B@t!b*>#,k7@F 'BA!4!Nv @FL AAa4!"?%,D@A4!'!G[8 P#f#l EL~'D@At!߄'! /P%q EL'D@B%t! !P m EL-)D@Bet!݀ZC!k% f ELܨ'D@Bt!'!I`kf EL:Dj@Bt!]P32 @qm}s\$Ԉ4?,mCOM:Dj@C%t!]P32 @^:YB C >?"ڔL'D@Cet!pA*' R$g EL 'D@Ct!pA*k}$BTD ELCC4!0R*cBABA(2A)&BD!4!1zE8Ҧl@ %BDat!|}@X7I@@Z%BDt!bqD ]6@@pH%BDt! L*3@A `%BE!t!5}P9s@@AL%BEat!6zTZLW.Z@A%BEt!uX~O{@A%BEt!L\`Av@B ϕ%BF!t!B_edrq@BL%BFat!F}h, R@B %B[at!SExv@B|u%B[t!:et59@C !%B[t!SfIpRvѣ@CL%B\!t!Pb7l@CC%B\at! uUl.:b@Ch%B\t!F}hB[*@D `%B\t!B_edZy@DL /%B]!t!L\`ZX0<@D*z%B]at!uX^uo@D7%B]t!6zT@E %B]t!5}P㲰@EL@%B^!t! L_Լ@EN%B^at!bqDҤ@E[%B^t!|}@کV@F V'B^4!1zE8 [@FL A_!4!"?C_e4!0R*cBA~BA2A.&B_4!1zE8 @ Rt%B_t!|}@u x]@@Kz%B`!t!bqD>=@@%B`at! Ls(@A 7%B`t!5}P28z@AL5%B`t!6zTʹ@Aͅ%Ba!t!uXQљN@AQZ%Baat!L\`2@B a7%Bat!B_ed @BL%Bat!F}h@BnW%Bb!t! uUl@Bc%Bbat!Pb7lFPS.e@C SA%Bbt!SfIpʕӔ@CL8%Bbt!:etoB@C_%Bc!t!SExJ@C#%Bcat!x3#@D X%Bct!6M|h@DL+%Bct!1y`@D+%Bd!t!rv)i^%x@D%Bdat! @E %Bdt!u(]@EL%%Bdt!Lф2Ϗ@E9R%Be!t!СAфn9B@E%Beat!rix&:kE@F m'Be4!5PL'@FL Ae4!"?ڿ,D@f%4!ܠ?;24$f#l ELaCfe4!0R*cBABA2A&Bf4!5w@ ?-%Bft!rixi@@%Bg!t!СAф8@@}e%Bgat!Lфkg @A &%Bgt!unO@AL}%Bgt!ʕ>@A%Bh!t!rv)iC@Af%Bhat!1yr@B %Bht!6M|LF1@BLN%Bht!x>1M@B[T%Bi!t!SEx@B%Biat!:etmQr@C 2%Bit!SfIp K@CL%Bit!Pb7lvA ^@C%Bj!t! uUl@C%Bjat!F}hP@D 7%Bjt!B_edX@DL:%Bjt!L\`>U@D%Bk!t!uXV.x@D %Bkat!6zTz,*@E %Bkt!5}P6l驲@ELn%Bkt! LJ@E%Bl!t!bqDx@E"%Blat!|}@~š@F N'Bl4!1zE8 @FL ,Al4!"?v*D@m%4!ܠ?;2;Py"]E2#l EL;Cme4!0R*cBABA2A?&Bm4!5NeL<@ =%Bmt!rixϮ@@ %Bn!t!СAфq!@@%Bnat!Lф=@A  %Bnt!u~@AL:%Bnt! y@A=%Bo!t!rv)i}@A%Boat!1y"^@B h%Bot!6M|Uχ@BLv2%Bot!x@@B-%Bp!t!SExT@B%Bpat!:etD%!@C Z%Bpt!SfIp @CL%Bpt!Pb7lХ@C'%Bq!t! uUl^f3l@C%Bqat!F}h6&Y؃@D %Bqt!B_edsC@DL3%Bqt!L\`~l*@D&%Br!t!uXM@D&%Brat!6zTc|@E Ң%Brt!5}PW@EL%Brt! Lj,*E@E*%Bs!t!bqD;צ@E%Bsat!|}@:H@F {i'Bs4!1zE8Nd~@FL ]As4!"?0D@t%4!ܠ?;2p8Ivl-&Ɠ3f#l ELB-D@tet!ܠ?;2p8IwW/u"Ns# ELI)D@tt!ޡq2z-Jt"f ELE )D@tt!ޡq2z-JGt2&f EL7'D@u%t!ܠ?;2ܤV$ 8)f ELn-D@uet!ޡq2z-J' R$D EL(9)D@ut!ޡq2z-JۜO"F+N( ELI'D@v%t!ܠ?;2 {H~R&XS5 EL,%D@vet!?;2d=Glj,x ELCv4!0R*cBABA2A&Bv4![5@ ,%Bw!t! $-4@@R%Bwat!0Qf)4@@P%Bwt!P[Yt3@A $i%Bwt!zAs2@ALky%Bx!t!< 6wg]2@A%Bxat!Л=˵|O1@Ap%Bxt!{ѡ|Ȋ))1@B  R%Bxt!bf ]x*4C0@BL%By!t!qx6/@Bm%Byat!V5t4V/@BN%Byt!{Qp:n.@C !)%Byt!p=p.@CL7%Bz!t!F8ll|-@Cu%Bzat!qmqhN-,@CV1%Bzt!BVdήF;,@D \%Bzt!b``Fr+@DL%|%B{!t!끥\J*@DA%B{at!bf!IXhP*@Dތ%B{t!;(TҨ)@E x%B{t!PbOLj؎)@ELA%B|!t!0ZRH"ڎW(@E>%B|at!Q!DJ'@E)%B|t! @|J&@F i'B|4!1zE8|M&@FL A}!4!"?&C}e4!0R*cBABB2B&B}4!1zE8VG{E@ %B}t!8dE@@%B~!t!-m8~MB'D@@n%B~at!38 9YD@A a^%B~t!Ql<6;C@AL#%B~t!2La%<v0)C@A/%B!t!Л=<6JвB@ASR%Bat!zjE<d<fxA@BL;%Bt!BVe<niPA@B|w%B!t!< <-@@BR%Bat!,(@f\e@@C va%Bt!v@y?@CL &%Bt!s@F: z?@C%B!t!V)@?@C%Bat!.@'H>@D (%Bt!< oA@9>@DL'%Bt!pd@r֥=@D%B!t!UDN4W1=@D%Bat!ψDR|<@E 5$%Bt!LaiD&uH<@EL%Bt!6D;@E %B!t!1QJyD\_;@Em1%Bat!#VD:g:@F 1'B4!SυDzچxw:@FL A4!"?(D@%4!?;2ݘ$l0O/f#l EL[Ce4!0R*cBBBB*2B+&B4!q儙O7@ %Bt!ܹ98@@%B!t!3az_ 8@@x%Bat!Aမ8CQ9@A %Bt!cf5~!ð9@ALp%Bt!O2]|b j:@A%B!t!]|:@A%Bat!q1xAe;@B %Bt!tz<@BL%Bt!YtAu<@B%B!t!0Vp+1=@B%Bat!GlkL=@C %Bt! v,lkS>@CL?%Bt!|/uh_>@Cؒ%B!t!1Q5dSx?@C q%Bat!#F6`-AQ @@D ޡ%Bt!,\zK_@@DLj%Bt!1cX«7A@D%B!t!¾T43A@DO%Bat!6 PjhB@E ?%Bt!Pa"%LR'UC@EL9%Bt!(yH"C@Ep%B!t!(DDc;D@E]O%Bat!Л>s<FHD@F 0'B4!1zE8VG{E@FL A4!"?0D@%4!?;2F.lj, gE#l ELf-D@et!?;2Fݘ$l0VI"f EL )D@t!q2z-JU,L,f EL--D@t!q2z-Jd'r0  EL5)D@%t!pA*'樀.2 f EL'D@et!pA*45yN.* z EL#*C4!0R*cBB3BBK2BL@&B4!1zE8gT@@ %B!t!|}@ua:@@%Bat!bqDEx85@@>%Bt! LR/@A Z%Bt!5}PZa*@ALa%B!t!6zT^ %@AV[%Bat!uXΤK@A%Bt!L\`>;<@B %Bt!B_edn`@BL~%B!t!F}h^v>@B%Bat! uUlG' @B(%Bt!Pb7lWC@C %Bt!SfIp6E@CLK8%B!t!:etf@C %Bat!SExW!@C|%Bt!xZ1@D S%Bt!6M|"giF@DL%B!t!1y25_@D6%Bat!rv)i~|@DQ %Bt!@E .%Bt!uz+QD@ELR%B!t!Lф~@E L%Bat!СAфp @E%Bt!rixn7#@F 'B4!5k.D@FL *A!4!"?,D@e4!ܠ?;2s j.Oc f#l EL<;C4!0R*cBBOBBg2Bh9&B4!5:5@ %B!t!rix 8Zְ@@%Bat!СAф7*@@ʓ%Bt!LфcD~@A %Bt!u6mҢ@ALU%B!t!Jc%@A>%Bat!rv)iZv@AO.%Bt!1yŔ@B %Bt!6M|^97@BLGQ%B!t!x汊X@BC%Bat!SExuŚ@Bg%Bt!:et~9ׁ@C %Bt!SfIp~& }@CL%B!t!Pb7lv.;x@C<%Bat! uUlꩪas@C%Bt!F}hZΞ~n@D (%Bt!B_ed^i@DL6y%B!t!L\`2d@Dy%Bat!uXB0T_@D_%Bt!6zT>sMZ@E  }%Bt!5}P,hU@EL'%B!t! LNǸ;P@E؇%Bat!bqDSJ@E%Bt!|}@t#E@F OH'B4!1zE8gT@@FL A!4!"?Ce4!0R*cBBjBB2BL&B4!1zE8fɛE;@ %Bt!|}@7U ;@@+%B!t!bqD:@@И%Bat! L^:@A %Bt!5}P^~d:@AL-%Bt!6zT!fC.:@Ah%B!t!uXd:9@A%Bat!L\`F9@B o7%Bt!B_edF;ۍ9@BL-%Bt!F}hCY9@B%B!t! uUlf@7%9@B?%Bat!Pb7lz8@C %Bt!SfIpz8@CLM %Bt!:et*8@C%B!t!SExݮ-X8@C%Bat!xګƥ%8@D L%Bt!6M|OR7@DLO%Bt!1yN(7@Ds%B!t!rv)i 7@D %Bat!'!]7@E f%Bt!uAL+7@EL}%Bt!LфR6@E7%B!t!СAфs6@Ev%Bat!rix6ܕ6@F l'B4!5c6@FL  eA4!"?׻*D@%4!ܠ?;2j,1=Zxf#l EL>Ce4!0R*cBBBB2B&B4!5jtV@ %Bt!rix v@@K%B!t!СAфb懇@@%Bat!Lфt@A Zi%Bt!u*Lݡ@AL%Bt!Մ@A%B!t!rv)iЛ@A%Bat!1yF! :@B %Bt!6M|RJ'T@BL%Bt!xvi@B%B!t!SExg@BL0&%Bt!F}h @B4<%Bt! uUlw @B%B!t!Pb7l&. @C %Bat!SfIpj;@CLg%Bt!:etk{q@C5%Bt!SEx`!@CS%B!t!x@@D (%Bat!6M|>4}7@DLU%Bt!1yʑ@D%Bt!rv)i~@D]%B!t!1#@E *%Bat!uֲ+^v@EL &%Bt!Lфr,p@E%Bt!СAф%Bt!СAфvu6@@%B!t!Lф 'o6@A dl%Bat!uE6@AL%Bt!*g 7@AO%Bt!rv)i\=7@A%B!t!1yJ-_o7@B ~m%Bat!6M|7@BL |%Bt!xF7@B%Bt!SExg8@Bt%B!t!:etk598@C {%Bat!SfIp}Ml8@CL %Bt!Pb7lJ8@CW%Bt! uUlg8@CU%B!t!F}h҉9@D %Bat!B_edj;9@DL(>%Bt!L\`,q9@D^&%Bt!uXg9@DN%B!t!6zT?}9@E L%Bat!5}Pn:@ELF%Bt! LR} 5J:@E& %Bt!bqD :@EI%B!t!|}@:@F  'Ba4!1zE8H:@FL A4!"?C4!0R*cBBBB2Bf&B!4!55w5@ E%Bat!rixѵ5@@%Bt!СAф^3R5@@H%Bt!LфRɛ!!5@A o%B!t!uE4@ALq%Bat!p4@A,%Bt!rv)iV_{4@A%Bt!1ydxY4@B 7%B!t!6M|:zU'4@BLI%Bat!x?A3@Bs%Bt!SExFYd3@Bќ%Bt!:etz3@C nh%B!t!SfIpY\3@CL%Bat!Pb7lB)3@CV%Bt! uUl>J\p2@C%Bt!F}hE8N2@D %B!t!B_edb2@DLn%Bat!L\` W2@D%Bt!uXNW"2@D%Bt!6zTBʡN1@E ^%B!t!5}PF ɵ1@EL%Bat! Lv.~1@EP%Bt!bqDF1@E%Bt!|}@bQ<1@F m'B!4!1zE8!>0@FL PAa4!"?,D@4!ޡq2z-J?t0f#l EL[)D@t!ޡq2z-J'樀.f EL)U'D@%t!ܠ?;23 .BZ&z EL'D@et!ܠ?;2jYl,[~Q EL)D@t!ޡq2z-Jekv,f ELu@)D@t!ޡq2z-J< `,f ELz'D@%t!ܠ?;2?0,+Z EL"Ce4!0R*cBBBC2Cu&B4!1zE8B@ ؎%Bt!Av8^0̞@@%B!t!R68@@O%Bat! vM8ގg A@A %Bt!"W8r@AL%%Bt!+'80@A.N%B!t!"U<.p@Ab%Bat!Ψ<phh+@B 9%Bt!s<JR @BL<%Bt!SM]<p᠜@B%B!t!3VI<8[@B%Bat!7 <b@C Q~%Bt!0[a<Zћ@CL%Bt!S< o@C%B!t!3 <l}G@CI%Bat!œ?a<.G@D %B¡t!<J@DL4R%Bt!  @x@D %B!t!A@e@k 4@D;%Bat!akD@BU@E @x%Bát! @b@ELo%Bt!a@ f@E1-%B!t!@.Ij!@E%Bat!Rf#& @ܘ@F 7'Bġ4!p{/]@sj@FL A4!"?XC%4!0R*cBCBC-2C.&Ba4!Pb_)̎@ ;j%Bšt!3VbUp@@%Bt!pـfGV@@d[%B!t!;5|2n@A %Bat!pki| `@AL %Bơt!J}x|@A%Bt!AmxB!6@A%B!t!A5tfS@B j%Bat!At޽@BL%Bǡt!< Yp4X@B%Bt!lfqM@B"%B!t!,lsU(@C n%Bat!5hhu@CLr%Bȡt!A[dJ4O@C|%Bt!|-`&$I@Ck}%B!t!pi1`i@D j%Bat!Ӧ<\Ƶ9[@DL%Bɡt!!X> @D9%Bt!3T@D%B!t!+\Ps@E 2%Bat!sL )@EL%Bʡt!"UxiH@E"%Bt!Pf@Rb@Ej%B!t!!)<JXT@F J'Ba4!1zE8B@FL qAˡ4!"?MC4!0R*cBC0BCH2CI&B!4!6q2@ %Bat!"9FXK@@+%B̡t!|ـb@@%Bt!plIQt@A _%B!t!Qa|Ys>@AL%Bat!Ѕ|0ˎ@A%B͡t!B^ǹxтޅ@A%Bt!SxK]-@B %B!t!ЫF1tN|@BL/%Bat!?t Ƀ@B%BΡt!2ZpV0@B%Bt!O)lF,Xb@C %B!t!ѡD)l: @@CL ~%Bat!"Wh@Cv%Bϡt!œ>d8y?@C^%Bt!A.`֗Ɇ@D p%B!t!&i\"~@DL%Bat!K҉XZ~@D %BСt!R}Tp T}@D%Bt!FAPnP2|@E %B!t! tL{@EL%Bat!q1=H `{@EE%Bѡt!ӜqD*vNz@E%Bt!FGu<Qy@F $W'B!4!1zE8$x@FL Aa4!"?m0D@ҥ4!% 2i.Ttg&fG_f#l ELl-D@t!% 2i/~ ;"Dt]f EL¾-D@%t!q2z-J!#>&Cg EL)D@et!q2z-J|>e~"f ELs-D@ӥt!KYlxn:2 uef EL/D@t!$IxR}S/'0)N62f ELg-D@%t!݂FR=l3xq0}T ELC/D@et!݁ `b[ʎ2Lh f EL!-D@ԥt!ۢSC#=`l Ŵ譜2r ELTQ-D@t!\Ua=ױ32+gqm:f EL)D@%t!]PBV@^H-D@et!fT֢*`q^R'2/RT~}vvf EL/D@եt!@=*4'4P̋ԕ f ELrv/D@t!`Q*!OjWܴSM'f ELm/D@%t!ا$*hX<WaW(w- f ELGc'D@et!ا$*2!eWaW(f EL/D@֥t!!@r* )'.WbǠUf EL'D@t!!@r*fY7'.Wbf ELq-D@%t!yJ*9yQ1U؉ˠ| EL/KHet!82d# @jVWbF{DʐC!Κ?!sŲEO"?$CH@ץt!әd# @jVWVF{DʐC!Κ?EO"?^'D@t!ݧ2+}*p2`A`3vf ELn'D@%t!ݧ2+}*2vVfV]f ELw/D@et!eQsA*aXL+5 EL/D@إt!ڠ`.yQ*T`̫?} ELl'D@t!ڠ`.yQ*8hK̫?~f ELM/D@%t!aD+Q*DԨ TM*O EL'D@et!aD+Q*6ΨTM~f ELW/D@٥t!&I* y0XPGlhexp ELIT/D@t! \)9*&Ɇ =[( f EL/D@%t!نf1*|8W NbOG EL VKHet!ؠy+&?ٙ#BF{DʐC!Κ?>*CE/"?-LCH@ڥt!by+&?|S#ZF{FʐC!Κ?EO"?'D@t!ߡUA*lPq@0v/۽~f ELw'D@%t!ߡUA*lPq@Z1@Hnf EL/D@et!Bf,Az27 f EL6'D@ۥt!Bf, T!27~f EL3|/D@t!K6Сw M|vL, EL'D@%t!؄,Azw M|~f EL/D@et!ހP(!/27_-~ EL/D@ܥt!؄, T vXXvL, ELv-'D@t!K!/vXXf ELCH@%t!р*]Y?S5 #fF{FʐC!Κ?J5O"?Q$CH@et!`oYY?:#(X fF{DʐC!Κ?EO"?H)D@ݥt!P[O`.61:f EL)D@t!P[O`.,>#~f ELCH@%t!cVPcJ|Y[Tל @3Q4;fF{DʐC!Κ? $5O"?'D@et!ƬƔA0]f EL^)D@ޥt!ƬƔ.w=f EL)D@t!]P32 @H)D@%t!]P32 @H̰)D@et!߂.7x!&j!qh-~f EL( )D@ߥt!܄HƑRqh-~f EL>)D@t!܄Hj+ͳ|48f ELY)D@%t!GH>!&j!ͳ|48f ELS)D@et!E|qlpQ$M z f EL`)D@t!9P.7&1,)e f ELd)D@t!@j+ͳ|48f ELt9)D@%t!@ͳ|48CM^ f EL))D@et!@cj&YZ4Ky EL5)D@t!߂.7x&j/qh-~f EL!s)D@t!GH>"N}ͳ|48f EL\6)D@%t!;U ƑRqh-~f ELf)D@et!;U {(*3l  f EL^)D@t!;U qh-;&U ELx)D@t!Bo[ Z[@b/\Hc)D@%t!@gKWZ[@b/\H#)D@et!Bo[ /PC4@b/\H)D@t!@gKW/PC4@b/\H)D@t!Ң$LCO@a^Hճ)D@%t!"$LCO@#H-D@et!%;A|"d76*ţo f EL)D@t!=;g?~ţo f EL-D@t!=;|#g?~ EL-D@%t!8`p_=hK_ | EL;-D@et!ހ`'8[_!kIb ELu-D@t!8`a=b:Ab EL'D@t!8`047:N|#f ELH'D@%t!8`y3n( 5̏ EL`-D@et!A8`@a<1_Զ*piLۊ f EL{+D@t!`'8,3Ҷ*JmQ9f EL:Dj@t!С}cl?z7ЬsFj@D %Bt!2E_PWj)@DL8%Bt!,WY@D%B!t!`ǞyW`@DO%Bat! AMnWH@E %Bt!Wo@ELk%Bt!is瞘WV2)@EŅ%B!t!CNtW^48@E7%Bat!h2PW* @F ''B4!(WLYر@FL A4!"?=tC%4!0R*cBCBC2C &Ba4!(WX? @ {%Bt!EPPW~"@@*%Bt!BytW:H@@>%B!t!œjWC@A ɂ%Bat!# 4WV!@AL%Bt!~{iRW5+'@Ax%Bt!⎃mW\A,@A%B!t!h,WRh2@B %Bat! CMoPW?>8@BL30%Bt! tWt8>@B(%Bt! sWP{TD@Bj%B!t!ݨGWbDJ@C +%Bat!lW5QP@CL1%Bt!C6WN0oW@C%Bt!"ʐ8 [~<1 ^@C%B!t!ؤ@[wd@D %Bat!aGޚ`[Zk@DL%Bt!dld[Foʁr@D\%Bt!Р[NqKy@D@%B!t!tt[F.@E %Bat!B4V[[?Ç@ELE%Bt!+9[e@E#%Bt!2e [6*(H@E%B!t!BMA@[9@F ])'Ba4!R\[@@FL U_A4!"?C4!0R*cBCBC2CP&B!4!c@D ;%B !t!7&g<8@DLP%B at! {cf2@D"%B t!C[l#R˷,@D%B t!AX#f'w/'@E %B !t!Fd#j!@EL١%B at!L#F@E%B t!E}8#j@EBD%B t!\"m#A@F 'B !4!7E#X? @FL 4A a4!"?O.C 4!0R*cBD/BDG2DHr&B 4!7E#LYر@ %%B !t!lɄ#K!@@%B at!,b8#Z?@@:%B t!k/ #>m1@A a%B t!K#@ALi%B !t!@LX# @A%B at!|0vt#HW @A9%B t!XgQ W@B %B t!Hǁ@BLg/%B!t!4<I'@B~%Bat!CVj* l{@B%Bt!MjBT.u@C *%Bt!@l*Fn@CL%B!t!;(* Ph@Cf%Bat!=}. iga@C {%Bt!N=$Z@D M?%Bt!~`>)T@DLH{%B!t!CY)?>M@D%Bat!{2L;S=F@D%Bt!I&?@E /%Bt!f&nt\~"7@EL!%B!t!|0@E%Bat!Ľ'vx)@E"%Bt!|oJh "@F |*'B4!s[de^@FL A!4!"?mHCe4!0R*cBDJBDb2Dc'&B4!K+~3}٤@ %%Bt!MO(+@@{[%B!t!CViz+9D@@ %Bat!EP+g;@A E%Bt!BI+Fo@ALA%Bt!<x+Lv@A.%B!t!e +b%e@A%Bat!T$+@B %Bt!q-8+T}@BL@%Bt!&g'='@B %B!t!K&d'$@B%Bat!F'B @C %Bt!CLkΐ'$@CLV%Bt!;#('N0*@C#o%B!t!K&'Sٚ@C;%Bat!95X'^@D %Bt!+ 'f6.@DL%Bt!s'^"@D' %B!t!Ϭ$'. i @D3"%Bat!6g#Q t@E i%Bt!@\#?@EL%Bt!, a#Ku@E̖%B!t!A斔#>"#@E4%Bat!F4#v2@F u2'B4!7E#LYر@FL oA4!"?vVH%4!!f@m1<tɜ@7{˚?وu |\]/C "?oSHet!У%0{!f@m14tɜ@7{˚? xDΤeaD"?C4!0R*cBDgBD2DW&B4!(WLYر@ !%B!t! )QWv2@@%Bat!!W>"#@@Z%Bt!B Wb%u@A O%Bt!)dWF>@AL%B!t!0W"t@AU^%Bat!@C^[ WB @Av%Bt!,W"@B j%Bt!W~3})@BLB%B!t!B\dW7z@Bhr%Bat!"0WBњ@B0%Bt!#(sSP*@C 2%Bt! SR@CL%B!t!#NSU@Ce%Bat!"ɓ\S@Cp%Bt!a#>(S'@D ?%Bt!`ǞSF.z@DL2%B!t!B4WfSt@Dg%Bat!B˜Sb%e@DI%Bt!mzTSLv@E ,%Bt!,GSFo@EL%B!t!RSg;@E%Bat! p=S9D@E%Bt!ݪQ|S@F  'B4!c8Sƛ@_s$@ Q>BP 0FJ:Dj@ t!">8S68S@-DT! @!` 2DZ@ t!҂[р(/68S@0V<>@2DZ@!%t!҂[р(/ƛ@p!zO?/D@!et!ڇq[*(k-r ELx/D@!t!܂Ӄqps_]c EL*:Dj@!t!҃HrLiP 2n@ z7Ьs-DT! @>iOko O:Dj@"%t!ӀTJP l?z7Ьs6?p a-D@"et!'@>%Nof;Z; f EL#-D@"t!E'@>%$Z; f ELn-D@"t!E'@@%$E^f ELk+D@#%t!ۄ'@@$ 7Y*~^E ELT'D@#et!ۄ'@7Y*%zf ELa+D@#t!؀`P#8SG*JmQ9f ELFJ+D@#t!t`@9l^ ,jz EL-D@$%t!`@8SG*z  f ELCG/D@$et!܃1< 81U9 ϤpaQ ELd1D@$t!1< 081Ep/*1 f ELY:Dj@$t!MNgqn^?^t-8R@-J*Đ gl:Dj@%%t!ЂMNg~|&{@a^r?5 N@ )D@%et!,TM%U=Lf ELC%4!0R*cBDBD2D1&B%4!WgG @ %B&!t!.DE&@@%B&at!q΀ Ͱx@@9%B&t!;۾toL}@A W%B&t!) [p@AL%B'!t!8e74o@AC %B'at! Bt&@ (%B,t!:|H{3$+@@"H%B-!t!fV"oѲN0@@1U%B-at!}_Կ) 5@A B$%B-t!ՅeO N :@ALZ%B-t!x7 0bf?@A0%B.!t!ܑL}&D@Aw%B.at!s2BI@B S%B.t!gN@BL@%B.t!0ķ%S@Bu%B/!t!6X@B%B/at!;Tn^@C ;%B/t!0PbJ5[c@CL%B/t!! ]xah@Cj%B0!t!˞^4qn@C%B0at!P`t.ys@D 8%B0t!)N4x@DLmi%B0t! I lj~@DM%B1!t!Ҧe|@Dl%B1at!qs|r*t@E%B2at!&;n8fx@@F "'B24!Ff& @FL HA24!"?i0D@3%4!A,TM%K8#O@S f#l EL-D@3et!;)؟Ō|L ߅f ELG1D@3t!";)KI`(/~Pvc` f EL<:Dj@3t!,N˟$ڴ4@^-DT!?>Z[ c ::Dj@4%t!,N˟Ͳ }@^7ŵ@4L6D (W-D@4et!A,TM%'e~8#f ELy>)D@4t!'eHu|f EL C44!0R*cBDBD2D,&B5!4!<#`sC@ (E%B5at!#0st^@@%B5t!BH&sDH@@%B5t!s,@A !{%B6!t!a!ts\@AL-%B6at!!sl.@AU%B6t!s7)@A%B6t!b Fs @B %B7!t! ߸s\ @BL% %B7at!Bv{@sl\@B%B7t!Os4vN@Bi%B7t!B| s@C 7`%B8!t! u sCt@CLٮ%B8at!ñE0st@C%B8t!A6yDsx^U@C %B8t!`XsTXn@D .[%B9!t! ۬W}ls4S@DLH%B9at!sl @DF%B9t!@qxisp @DJ%B9t!¬}s@E %B:!t!st㓰@EL%B:at!&jst@E%B:t!O'sTq@EN?%B:t!=s=2@F 'B;!4!C`yn0s @FL  A;a4!"?0D@;4!܀t`p6Cyq6f#l EL|C;4!0R*cBDBE2E u&B!t!P5 @BLz%B>at!a[NXUQq@Bѵ%B>t!cډhdn@Bu%B>t!ld@C %B?!t!!;K>~OM-D@Ct!CVX~r5ԅ;euN EL-D@D%t!Co ~r5H}$f EL~sCDe4!0R*cBEBE*2E+s(&BD4!kQDk3%@ %BDt!\ӑLkw#@@%BE!t!sq6Tk>-@@|%BEat!B\kveK@A q%BEt!!y'`k"j@AL%BEt!,8fhk.ai@A_%BF!t!#z%Bpk6}@AP%BFat!@ tk60@B h%BFt!&7|kұ@BLg%BFt!@k@B=%BG!t!;>kN=G@B%BGat!CKEˮk@p@C R$%BGt!@[*k^%u@CL"%BGt!nvk6 n@C(%BH!t!ALHkj@Cj%BHat!#ъk1@E c%BIt!ABz:k6@EL?%BIt!vrk"K@E%BJ!t!Q͢k"3@E%BJat!"\kΖ3۳@F ''BJ4!|Rky3@FL AJ4!"?*D@K%4!D5nۉӖ( 'RAV#l EL8sCKe4!0R*cBE.BEF2EG&BK4!v_4kn~u@ h%BKt!A&6ZkF.@@%BL!t!7k߷J@@%BLat! zk2@A %BLt!v_6|krŨK@ALS%BLt!"v|ke@A%BM!t! xkjOR@Aa-%BMat!!2SNtkn͜@B %BMt!@tk om@BL%BMt!pk@B'%BN!t!/Rlk*@BJo%BNat!llkH@C 5%BNt!Cuhk⫱3@CLu%BNt!!0 dkT@C~%BO!t! 'X2dk,v@Cm%BOat!`;V`k~ӌ@D %BOt!an\kn@DLv%BOt!Cu3~Xk.vH@D{%BP!t!̋Xk64@Dg%BPat! !тTkڲJ+@E x#%BPt![vPkOR@ELX %BPt!\Ӄ^Lk"6Vz@E.%BQ!t!cKDBLk{ K@E)5%BQat!lHkw.@F 'BQ4!kQDk3%@FL AQ4!"? CR%4!0R*cBEIBEa2Eb.M&BRa4!kQDkn$Z۰@ l8%BRt!!,lPk{}@@%BRt!bTXk3@N@@,%BS!t!vdk@A 6[%BSat!")lkH@ALD%BSt!ܐBtkrJq@A%BSt!֏r|k+d@A3m%BT!t! {kf6@B  %BTat!}wk}]@BLV%BTt!"6#k6|@B %BTt!8A&k@B%BU!t!$ký@C W%BUat!Rk@CL,0%BUt!@^kV@C%BUt!kO@C %BV!t!`rkB2@D !%BVat!vkjsJ@DL#%BVt!""kNH`@D8%BVt!cvzkl|v@D,R%BW!t!@qVzkfڽE@E J%BWat!g "k0@EL*%BWt!7>vkL@Eq%BWt!,vk?@E%BX!t!3k@F }'BXa4!!LKnkj8@FL PAX4!"?*D@X4!D5ݐw$tf#l ELf-D@Y%t!D5)dIZ/(tc:!f ELY>-D@Yet!D5)dݐw$ub9|Kf EL)D@Yt!Gގ̈>% 3,`$f EL)D@Yt!ގ̈q>% 3Ne(f ELCZ%4!0R*cBEiBE2Ea&BZa4!`{QDkF@ %BZt!$j^PkjaPse@@>%BZt!<&>\k>K-@@O%B[!t!Fhk}^'@A %B[at!-1Ztkvp@ALTq%B[t!V|kfӪ@A%B[t!Nk@A6%B\!t!Ñc~kJ҈@B %B\at!Cс.k2G, @BL~k%B\t!nZk"?*@BI%B\t!+ kt@B %B]!t!Cۆ:kv@C %B]at!`_kR֊ @CLp%B]t!BL*kv@C.%B]t!AքKk&ʱ@C%%B^!t!.kBΆ@D  %B^at!Uknc3\@DL%B^t!{2Rk *"@D0%B^t!2kzꔕ&@D%B_!t! k(4+@E %B_at!&/LkJQHo0@EL%B_t!ckdI5@E%B_t![DkY:@Ep%B`!t!Vk(4e>@F J'B`a4!#11krC@FL A`4!"?D0D@`4!D5(*nۉӖ$WN!f#l EL'D@a%t!FZc5#0=Ӗ$f ELCae4!0R*cBEBE2E&Ba4! {QDk@ I#%Bat!a$j^Pky\ye@@%Bb!t!<&>\knc3@@"%Bbat!Fhk18'@A E%Bbt!11Ztk p@ALr%Bbt! V|kΓ鿪@AI%Bc!t!BNk$@A%Bcat!Cc~kb@B -%Bct!с.k @BLvE%Bct!BnZkVW0@B%Bd!t!`+ k*€ @B%Bdat!ۆ:k2Ƃ@C %Bdt!_k @CL{%Bdt!L*k2Ƃ @C%Be!t!քKksٷ@Cu%Beat!B.k`{@D 7%Bet!Uk{9\@DLQ4%Bet!{2Rk"*"@D%Bf!t!2k&@Dn%Bfat! k&A@+@E ' %Bft!!&/LkziTu0@EL %Bft!ckpJ5@E%Bg!t![Dk(_:@E%Bgat!Vk&A@k>@F 'Bg4!C11kZYLC@FL Ag4!"?<,D@h%4!D5= l&WN! f#l ELM7Che4!0R*cBEBE2E &Bh4!C11kv6T@ %Bht!Vk*%X@@%Bi!t![Dk^[1]@@%Biat!ck:ʄb@A %Bit!!&/LkOg@AL %Bit! k*l@A:%Bj!t!2kziTp@A %Bjat!{2Rk6IDu@B #F%Bjt!UkWwz@BL%Bjt!B.kbI@B<%Bk!t!քKkΓ!@BH%Bkat!L*kr@C #%Bkt!_k}^@CLb%Bkt!ۆ:krВ@Ce%Bl!t!`+ ktė@Ch%Blat!BnZk*`œ@D R%Blt!с.k &^ʡ@DLCC%Blt!Cc~k`{ݦ@D %Bm!t!BNkncѳ@D'%Bmat! V|ksٷ(@E ]%Bmt!11Ztk~kյb@ELI"%Bmt!FhkR֊@Ed%Bn!t!<&>\k$]@EP%Bnat!a$j^Pkn@F 'Bn4! {QDk@FL &An4!"?*D@o%4!̈q7ۃӖ(f#l ELR+D@oet!D5Q(*́= l(tf EL=Co4!0R*cBEBE2E &Bo4!#11k2Ƃ6T@ pI%Bp!t!Vk*C+X@@ ~%Bpat![Dks7]@@A%Bpt!ckj␓b@A %Bpt!&/Lk!Og@AL%Bq!t! k*Cl@A!%Bqat!2k`p@A" %Bqt!{2RkjaPu@B %Bqt!Uk$]wz@BL%Br!t!.knJ@B%Brat!AքKk!@B%Brt!BL*kZYLq@C }%Brt!`_k18@CL(%Bs!t!Cۆ:k"~ В@C%Bsat!+ k*€ė@C5%Bst!nZk,6fœ@D Ԉ%Bst!Cс.k$2dʡ@DL;%Bt!t!Ñc~kڙlݦ@DYI%Btat!Nk@D%Btt!V|k(@E %Btt!-1Ztkb@EL%Bu!t!Fhk@EX%Buat!<&>\k 0c@EY`%But!$j^PkV n@F #'Bu4!`{QDkޛ@FL Av!4!"?l,D@ve4!ڇ̈QF% 3nۉӖ(f#l EL>I'D@vt!D5\w8&*)`OHf ELav)D@vt!ڇ̈QF% 3nۉӖ$f EL-D@w%t!̈F% 3nۉӖ&f EL`'D@wet!D5e\w8(*1`OHf ELkCw4!0R*cBEBE2E۹&Bw4!`{QDkۄ[? B%Bx!t!$j^PkX &J?@%Bxat!<&>\kz?@7%Bxt!Fhk8BT?A 4{%Bxt!-1Ztk%B|at!2kD;?D U%B|t! k>6N?E g%B|t!&/Lk߆a?EL %B}!t!ckNt?Ew%B}at![Dk}ս?EMU%B}t!Vk>6 ?F w'B}4!#11k20k(?FL lA~!4!"?$0D@~e4!D5(*4ַ)W~#l EL'D@~t!FZc5#0= *~f EL vC~4!0R*cBEBF2FL&B!4! {QDkhH[? %Bat!a$j^Pk>J?@x%Bt!<&>\kh((?@%Bt!Fhkl/#)@A  %B!t!11Ztk@AL%Bat! V|k/@A%Bt!BNk'@A'%Bt!Cc~kw%1@B %B!t!с.k_;@BL^%Bat!BnZk|IE@B+%Bt!`+ kQCO@Bo%Bt!ۆ:kYEY@C 3%B!t!_kdYc@CL%Bat!L*kYEm@C)%Bt!քKkte=w@C%Bt!B.ks#@D )%B!t!Ukm@DL%Bat!{2Rk4t/@D%Bt!2kcŝ@DJ%Bt! kO3V@E B%B!t!!&/LkL[@EL%Bat!ck43n@E%Bt![Dk@E%Bt!VkO3@F R 'B!4!C11k K@FL Aa4!"?a,D@4!D597k f#l EL C4!0R*cBFBF02F1B&B!4!C11kR@s? %%Bat!VkF:?@@%Bt![Dk( ?@%Bt!ckx)?A m%B!t!!&/Lkh\kţ?El%Bt!a$j^Pkdɷl?F %'B!4! {QDkhH[?FL ;Aa4!"?*D@4!̈q8 a[f#l EL-D@t!D5Q(*Xf ELC%4!0R*cBF5BFM2FNM&Ba4!#11kYEG@ "v%Bt!VkS5@@w(%Bt![Dkteb @@%B!t!ck4S@A %Bat!&/Lk px@ALh%Bt! kS5(@A%Bt!2ks#1@A%B!t!{2Rk,S,;@B ^/%Bat!UkD@BL,k%Bt!.k$ 1nN@B%Bt!AքKk\%X@B]%B!t!BL*k Ka@C ?%Bat!`_kl/#k@CL%Bt!Cۆ:kIAzu@CD%Bt!+ kQCc@CP%B!t!nZk\'^@D y%Bat!Cс.k<n@DL%Bt!Ñc~k/@D%Bt!Nknӧ@D%%B!t!V|k}+@E X%Bat!-1Ztku@EL%Bt!FhkdY1@EG%Bt!<&>\k,@E`%B!t!$j^Pk ~N@F  'Ba4!`{QDk@FL A4!"?v0D@4!ڇ̈QF% 3wk[#l ELo'D@%t!D5tQ]Gx|MM EL)D@et!ڇ̈QF% 34ַ~f EL)D@t!̈F% 34ַ~f EL|'D@t!D5RT:)#'x& EL)D@%t!a;U (4-kۡ f ELW)D@et!a;U N}Ln0f EL)D@t!a;U N}(4f EL+)D@t!D0L0^+ f ELij)D@%t!D0 &j/{w̮4f EL)D@et!D0 &j/D0f EL%/D@t!QYW!;l`Kx? f EL/D@t!܄yXV} 'L9 ELP)D@%t!BdU<!;lV# 'L~f ELD"/D@et!ڀ" ІB᭻ 'L9 EL,/D@t!'hO/`K? +~ EL'D@t!'hB᭻`K~f ELX/D@%t!߆ 4`Kx? f EL/D@et!BdU<*H 8@T9 EL)D@t!܄yXO.! 8@Tf ELKHt!ЃאCx0%sU?sGN2F{DB[1?BPEO"?Z)D@et!`Kʽ^=)Vf ELq)D@t!`Kʽ^/c!8o~My EL;)D@t!ܦ]iIX"8tf EL)D@%t!ܦ]i|A5d } ELQ)D@et!cFI]Q'86f EL,,)D@t!g>Lv5X ch-~f ELU/)D@t!`Kʽ^-mR68~=l f EL)D@%t!ܦ]iYa6K[T f EL~'D@et!ْ>!^f|A5~f ELl'D@t!ܦ]iYK4]|A5~f EL3'D@t!۰ ׸nK-mR68f ELC'D@%t!qe)GZy7)-mR68f ELs'D@et!+I)",5|A5~f EL'D@t!ݣ!fa.<-mR68f EL!'D@t!`Kʽ^d-mR68f ELz)D@%t!Eg`"Ʊѕzp=,3XWe f ELӐ'D@et!@Qfahs{|A5~f EL)D@t!V47{ ^aa]$e^{ f EL?CH@t!nS.p ?զ,[z'2s{К?EO"?C%4!0R*cBFBF2F&Ba4!R'z WPz @ `%Bt!^#dD @@@%Bt!1,CO͸n @@%B!t!=) @A %Bat!i=o,hF @ALW%Bt! kbv' @AgA%Bt!3~$@3 j> @A%B!t!MUS oZzV @B Q%Bat!C dT1n @BL$X%Bt!'* b @Bw/%Bt!b WN @Bq^%B!t! ό^! @C q%Bat!" 7@r] @CL%Bt!M׋ OLxN @C%Bt!P[ " @C|%B!t!S-FW v C @D e%Bat! k /j* @DL^%Bt!N 4O 'B @Db%Bt!GHvY @D%B!t!A2EG6p @E k%Bat!y'/j @ELj%Bt!^^g_;0 @E4%Bt!2אߤ @E8%B!t!s"/gX~ @F 'Ba4!Y(fE @FL A4!"? ,D@4!ݣ!fdW-mR68f#l EL:)D@%t!ْ>!^hszaY|A5~f EL1'D@et!qe)nK-mR68f EL'D@t!+I)YK4]|A5~f ELC4!0R*cBFBF2F|&B!4!a$+ d~$? A%Bat!do'?@C%Bt!@h3>)*?@D%Bt!xФh>d,?A %B!t!K,hy/?AL%Bat!R\`IhyZ2?A r%Bt!)O8hy5?A}%Bt!{ph>d7?B S%B!t!(˚#Hh3>:?BL%Bat!I_hn"6O=?BM %Bt!!ǸTl~ @?B%Bt!!F8lB?C t%B!t!dl.\ E?CLU%Bat!&Flή{bMH?C%Bt!,plK?C%Bt!rlM?D %B!t!E|lӍP?DL%Bat!q)lp~'8TS?D~%Bt!țpNV?D" %Bt! p..X?E %B!t!0qpneן[?EL%Bat!p'd^?E%Bt!;Q~p^)a?Ez%Bt!I_p>0c?F 'B!4!uӠp׏lf?FL Aa4!"?C4!0R*cBFBF2FܹV&B4!R\b˄Nr? B%B!t!C;..?@0%Bat!p2T?B.%Bt!<=CFb?C q&%Bt!=@n~cVp?CLB*%B!t!øDDNr?Ct%Bat!Dn"6?C!6%Bt!1~H/<Μ?D  %Bt!A& Lʉ锫?DL|{%B!t!Hۢ@P^tp?DT%Bat!"FVpT-;Ba?D%Bt!?7TGȈf?E %Bt!6X?EL?%B!t!|s\.?E%Bat!`9A?E%Bt!)Od^v_TJ?F V'B4!a$+ d~$?FL A!4!"?=Dj@e4!D o2@ .QJsfVM;@ aD 0FrC4!0R*cBFBF2F &B4!,Jk(׏ll? %B!t!bfe,P̊s?@A%Bat!1?0&{?@z%Bt!,J}4ΰk?A 8!%Bt!!8~'8̉?AL%B!t!vg<&I?AM%Bat!rli@3>?AG%Bt!R\bD.?B %Bt!@sHNKJe?BL%B!t! ??L3>Q?B%Bat!!`To\X?Bz:%Bt!A8cXL {?C %Bt!"FV\ ?CLh%B!t!K`nv?C#d%Bat!xqo3d>jYш?Cal%Bt!Rܢshn~cV?D 4%Bt!9l;?DLv%B!t!1=p5?D?D~%Bat!tn?D%Bt!HۣfKx޸l?E %Bt!ۡ{|AEDž?EL"%B!t!ء~x?E %Bat![#DŽ~ ) !?EF%Bt!z޴#v*?F $'B4!"FT ~ )3?FL ǞA!4!"?%Ce4!0R*cBFBG2G#&B4!X᥋9AM? %Bt!ioHΰ O?@%B!t!NKJOP?@%Bat!;P؆-Q?A ã%Bt!E[kZR?AL%Bt!8џd3(T?A%B!t!2!5_U?A%Bat!I_7V?B (%Bt!r^tW?BLG%Bt!>jY6Y?B%B!t!2L[{1Z?BI%Bat!WNr[?C R%Bt!)Oآ3N]?CL %Bt!bK c^?Cf%B!t!n|_?C1%Bat!P -`?D w%B¡t!z .`ԎOb?DL\%Bt!,w ,c?Dg%B!t!8џ'O ~d?D2%Bat!諉8+$XЌDf?E %Bát!C9$>fWPg?EL_|%Bt!}$qh?EH%B!t! ?޷$^4Bj?E2%Bat!b椋$k?F '}'Bġ4!,Jk(׏ll?FL YA4!"?X^C%4!0R*cBGBG-2G.`&Ba4!3&׏ll? %Bšt!B3]k?@j%Bt!R^4Bj?@.%B!t!qh?A %Bat!u>fWPg?ALtS%Bơt!2)XЌDf?A%Bt!7~d?A%B!t!M,c?B 4A%Bat!\I.`ԎOb?BL&%Bǡt!͔-`?B%Bt!s6n|_?B%B!t!Bec^?C %Bat!{N]?CLd%Bȡt!{Nr[?C%Bt!B11Z?C`%B!t!>>jY6Y?D o%Bat!1,^tW?DL @%Bɡt!q&j7V?D%Bt!Tb!5_U?D8%B!t!h~(T?E %Bat!2CkZR?ELhv%Bʡt!q= -Q?E%Bt!\_> NKJOP?E/%B!t!7ΰ O?F ;'Ba4!Rs&9AM?FL UAˡ4!"?MnC4!0R*cBG0BGH2GI;&B!4!R 4m~ )3? ^Y%Bat!$޴#v*?@F%B̡t!`vh,~ ) !?@%Bt!J94~x?A %B!t!M<AEDž?AL^%Bat!r'{iD޸l?A%B͡t!qILn?A7%Bt!rʱT5?D?B %B!t!a5!\;?BL%Bat!btdn~cV?B%BΡt!(,p>jYш?BJ%Bt!(|lxnv?C ~%B!t!R ) ?CL%Bat!չL {?C%Bϡt!Uo\X?C+%Bt!g3>Q?D %B!t!8ONKJe?DL%Bat!s!(I.?Dr%BСt!2,3>?Dω%Bt!=M&I?E pO%B!t!Ruķ~'8̉?EL)%Bat!3%C9̷ΰk?E{%Bѡt!Sط&{?E%Bt!B0P̊s?F ='B!4!3&׏ll?FL sAa4!"?mv=Dj@ҥ4!C!<?2@QJsv"ҝ@&/6P 0FC4!0R*cBGLBGd2Ge$&B!4!{gl~$? j%Bat!G 2{p^v_TJ?@T%Bӡt!{x9A?@4%Bt!G2|.?A :%B!t!=?ALh%Bat!?GGȈf?A%Bԡt!R5-;Ba?A %Bt!r'x^tp?B K%B!t!2cʉ锫?BLy%Bat!SXۤ/<Μ?BJ@%Bաt!R_n"6?B%Bt!a6ﰳNr?C %B!t!rv苸n~cVp?CLo%Bat!B3=CFb?Cw%B֡t!Bij>p2T?C%Bt!!}&@̳T E?D %B!t!-}osгy7?DLH%Bat!rtjKسXЌ)?Dl%Bסt!+.\ ?DŽ%Bt!r'yh.. ?E %B!t!p޴#?ELD%Bat!Q1F^v_TF?E%Bءt!b+޴#?EK%Bt!2kD..?F 'B!4!s!pNr?FL SAa4!"?wC٥4!0R*cBGgBG2G&B4!җ;P׏lf? %B!t!C*CT>0c?@%Bat!h=KT^)a?@c%Bڡt!WT'd^?A %Bt!U[_Tneן[?AL%B!t! |gX..X?A%Bat!r sXNV?Ai%Bۡt!gz{X~'8TS?B %Bt!W7XӍP?BLw%B!t!QT\M?Be%Bat!M\K?B޻%Bܡt!S,ƫ\ή{bMH?C ~%Bt!\.\ E?CLSZ%B!t!c1`B?Cd%Bat!Q2`~ @?C~%Bݡt!C(F`n"6O=?D  %Bt!`3>:?DL%B!t!b8d>d7?D/[%Bat!G dy5?Dn%Bޡt!s!dyZ2?E <%Bt!(|'hy/?EL?%B!t!,7h>d,?EC%Bat!]Gh3>)*?EZ%Bߡt!s!+Who'?F (Z'B4!{gl~$?FL A!4!"?*Ce4!0R*cBGBG2G&B4!{gla@ %Bt!s!+WhL8 @@%B!t!]Ghp B@@ӏ%Bat!,7h0*>蓶@A %Bt!(|'h(&<'@AL""%Bt!s!dn@6@A %B!t!G d(&<'@AP%Bat!b8d\׳@B %Bt!`p (@BL,q%Bt!C(F`y@B%B!t!Q2``BJnɱ@B̬%Bat!c1`@C %Bt!\4,i@CL%Bt!S,ƫ\ה@CV;%B!t!M\X @C@%Bat!QT\hX@D |%Bt!W7X܀}@DL%Bt!gz{X|ϐ@D%B!t!r sXlF@D%Bat! |gX@E 7%Bt!U[_T@EL3 %Bt!WTl3@E/%B!t!h=KTb@EO%Bat!C*CTT<Ш@F pA'B4!җ;PvD@FL VA4!"? |C%4!0R*cBGBG2Gf&Ba4!s!plnjb@ G%Bt!2kD( @@%Bt!b+~O0F7'D@%t!ف塙1vD'/5*f EL:Dj@et!D o2@K_v=s7Ks@2L6D $)D@t!ہBx9vt"QOc}+~f ELcB:Dj@t!C!<'2@;_v=s!3|@'O 2DZ@%t!C!<72@;_v=sx!@;`)D@et!掤DLIf82$wtf`f EL2DZ@t!ЉC!<wt@;_v=sh9<:Dj@t!D 2@+_v=sij> @7#O  )D@%t!۰ ׸q#`c!-mR68f EL)D@et!S@mni,5"e|A5~f EL)D@t!#n.4p]$\C5~f EL6j'D@%t!Xߑn[(Ɩ]$\C5~f EL")D@et!D` HavB#[|A5~f ELBSHt!CnQNEa@9jLkdxZ&~tc?w؈ 6{"?l0KHt!Ѩfj$NEa@9jLcPxZ&~tc?gۿD ǢXf"?EQKH%t!пލ?29jLk8lZ&~tc?;'ۿD Xf"?KHet!!H$ލ?9jLctZ&~tc?  6"?J +D@t!_`"Ʊ=W΁嶘W%f EL+D@t!_`"ƱWPK<4 zf ELq+D@%t!%O{ ^y+62oYp?f EL+D@et!%O{ ^8y 4l S\ ELd)-D@t!ߢO{ ^yΰ 2w f ELZO+D@t!'F47{ ^Ӎ ^4L^!_Ӝkf ELq-D@%t!'N47{ ^Iэ U2 f EL+D@et!%O{ ^yTd2U1-f ELKHt!Ґm8 @9jLclxZ&~tc?'<MCNQ"?KHt!s0̯Lki @!9jLk(xZ&~tc?&|q"?\KH%t!s0̯8 @9jLklxZ&~tc? !P v|"?n%KHet!ҐmLki @A9jLc xZ&~tc? P V|"?'D@t!Eg`"Ʊͽ$We3Xf ELVa)D@t!Eg`"Ʊɕzp=,'FAw f ELw-D@%t!gV47{ ^qՍ 62e^{ f EL -D@et!V47{ ^Ս aa]$T3S f EL#-D@t!Ug`"ƱQY%L4'FAw f EL9-D@t!Eg`"ƱUY ͽ$Ǡym7f ELv/D@%t!Ug`"ƱվBg%L4'lf EL/D@et!Ug`"ƱվBg嶘}@gؾHf EL@:Dj@t!P!7DBG@-z7Ыs r? Q>BP -D@t!ܥg`"UY ġD.B!#Ҍf ELj%)D@%t!ܵg`" N,Gg f EL:Dj@et!P!7 @-z7Ыs-DT! @=JS*Đ !-D@t!Ug`")Y!]W 8 t/ f EL^)D@t!+>a4x @7/.H/D@%t!٢x!)#vgaِc= BEa|CW ELW:Dj@et!ғQFd?@$e@=kݲDP W@/D@t!GFM!fCq4 rI$l! f ELUT:Dj@t!Es0.7}@vʁ@#NEw>/D@%t!(lY`iˠz]P g*_]|/ EL:Dj@et! y h@m8-?4LP? ,_/D@t!ɖ}bI@~MC 7<ى f ELv:Dj@t!XF@\$2@@*)}@ .:Dj@%t!BEsl.7}@щγvʁ@#NEw>/D@et!NmAfk(p 9\8W7 f EL :Dj@t!QFd@[щγe@=kݲDP V1D@t!ص-;[e]=ډ)U EL#5:Dj@%t!X?F@kщγ2@@*)}@ /D@et!ܠh[R9, A9@l[h$\f ELw:Dj@t!+ ,z h@щγm8-?4LP? 01D@t!آYvfMtcA-S*-m f ELÍ:Dj@%t!ұ Vu<6ϳK@[o$@ঊ "k+D@et!g`")Y ¾V&.AQz<(f ELdj-D@t!g`"=Y 8N,xpf ELC4!0R*cBHBH2H &B!4!.eU^+@ ܍%Bat!9Wq@@5%Bt!ʞi@@o%Bt!ӣAf$@A %B!t!@پu I*@ALQ=%Bat!.ԁhou/@AX%Bt!na%0 5@A:%Bt!h9|,y:@B ?%B!t!oepg?@BL%Bat!qL'1E@B8E%Bt!^]p,w}J@BCo%Bt!R)EoGO@C !;%B!t!H T@CLI%Bat!4e 82(Z@C%Bt! NR_@Cv%Bt!% pud@D $%B!t!.Y$Lxi@DL 3%Bat!.dq$DѬn@DQ%Bt!δ"i$xus@Dl%Bt!A$bx@E %B!t!+X$S}@ELo%Bat!X(o^D@Ey%Bt!9@%(o@E(v%Bt!U}(|@F r'B!4!(پa((@FL ~Aa4!"?]0D@4!C ÂQ0H,_I f#l ELXC4!0R*cBH BH82H9&B!4!پa(F}j@ %Bat!{U}(u֨@@}%Bt!)@%(@@ELD@%B at!ˣAv$@Ew%B t!ʞi,} @E#%B t!9WqX@F M'B!4!.eU^+@FL HAa4!"?@(C4!0R*cBH;BHS2HT|&B4!.eU&"@ `%B!t!SqL͑#@@p%Bat!zidc<$@@%Bt!{A 5$@A  %Bt!پu $?-%@ALP%B!t!.ԁh*c&@A%Bat!YnJ'@AҰ%Bt!9&ܙ'@B b%Bt!)oeHcx(@BL;%B!t!qhHs')@Bo%Bat!P^])@BL%Bt!*R)։ۀ*@C %Bt!D?++@CL%B!t!X4e P+@C%Bat! ؙ~,@Cn%Bt!:% pq&-@D %Bt!k.Y$u8-@DL&e%B!t!b.dq$o(u.@Dw%Bat!δ"i$ Rr/@D|%Bt! A$ͥ/@E %Bt!T$\Fqg0@EL-$%B!t!( 1@E%Bat!@%(.-β1@E{%Bt!U}(X=X2@F p'B4!پa(ȡ2@FL hA!4!"?e 0D@e4!C ÂQ0OF./ f#l ELC4!0R*cBHWBHo2Hp&B4! پa(Ȕvģ@ c%B!t!U}(hGר@@%Bat!1@%($}@@p%Bt!H(@@A {%Bt!X$@1@ALۻ%B!t!A$hz"@AB%Bat!δ"i$lohMܫP,@C%B'at!s4趉ew+@D %B't!Y)js'+@DLA %B't! ~ʵY*@DJK%B(!t!eWڟ)@D%B(at!j" `)@E X%B(t!2E ˪(@EL;%B(t!h*(@Eԑ%B)!t![N)e'@En%B)at!<g&@F  i'B)4!z.eUĉ|M&@FL A)4!"?6q.D@*%4!C ÂQ1p|j0 :f!(#l EL3C*e4!0R*cBHBH2H&B*4!پa(>5@ W%B*t!U}(5@@z%B+!t!@%(Љ6@@%B+at!($Ψ@07@A f%B+t!T$q)7@ALA%B+t!A$`{8@AB%B,!t!jδ"i$0fJ!9@A%B,at!".dq$LLE9@B I*%B,t!#.Y$t o:@BL%B,t!ꔛ% F;@B%B-!t!ɀ tƾ;@BA%B-at!4e g<@C %B-t!KD}=@CL%B-t!R)2=@C|%B.!t!^]gh>@C%B.at!qoI?@D "%B.t!oeX?@DL%B.t!9lt@@D%B/!t!ɐnr&A@D]}%B/at!.ԁ4P*CA@E z%B/t!Hپu iB@ELG%B/t!ӟAƲ8GC@E%B0!t!ʞiYD@E%B0at!1SqLlۼD@F FZ'B04!.eU\G{E@FL }A04!"?(0D@1%4!C ÂQ5).lj, jE#l EL3-D@1et!C ÂQ5阄$l0VI"f EL7'D@1t!d-YU,L,f EL,'D@1t!T-=Y ¾V&.f EL+D@2%t!C ÂQ1vJ*,5R,/f EL+D@2et!C ÂQ1d0,Ff EL'D@2t!ܴ-YKcD0f EL/9+D@2t!4,Yp'r0  EL+D@3%t!K ÂQ1y0Q$.bQ,f EL2+D@3et!g`"-Y $gǕf ELh+D@3t!ܥg`"=Y aо$o/lf EL%+D@3t!C ÂQ1z& F" 4 EL1C4%4!0R*cBHBH2HV&B4a4!پa(dz@ %B4t!U}(H/M@@kZ%B4t!@%(4s@@%B5!t!(,&@A ,%B5at!T$0MÍ@AL%B5t!A$@Ay%B5t!jδ"i$Mh@Am%B6!t!*.dq$ҝ;@B %B6at!+.Y$4.9@BLc%B6t!򔛧% <@Bs%B6t!ɀ HZ۸@B%B7!t!4e #@C %B7at!KDT_f@CLy%B7t!R) QR?@CP%B7t!^]H%@C%B8!t!q!X]@D T%B8at!oe7җ@DLL%B8t!9_1a@D=%B8t!ɐn 쓙@D%B9!t!.ԁ*w@E '%B9at!Pپu Ы]@EL{%B9t!۟AF@ED%B9t!Ҟi4B1@E%B:!t!9SqlYP @F 'B:a4!.eU$B@FL GA:4!"? C:4!0R*cBHBI2I&B;!4!r.eU$x@ %B;at!Sqy}@@%B;t!Zi$𙕂@@se%B;t!cAd`}Xi@A i%B!t!D<C@CLv%B>at!x4e X0 )@C1%B>t!A ԋ@CD~%B>t!j% $@D %B?!t!.Y$TG@DL1%B?at!.dq$@D%B?t!δ"i$tI@D%B?t!hA$qC@E %B@!t!T$J]$t`@@ȱ%BBt! ۝$X%}@@%BBt!^$㪙@A ^%BC!t!U p@ALCP%BCat!G oʅ@A%BCt!+9 0A%W$@A%BCt!R4j |V }@B u%BD!t!Q);^>Ճ@BL%BDat!Pnag\,@B%BDt!* 4@Bq%BDt!p :؁@C X%BE!t!"6-{-@CL?%BEat!xCphx[+@C%BEt!Ӹ#;7@CI%BEt!T%MY' %@D %BF!t!e;!+u~@DL%BFat!y<.}@D%BFt!; KG}@DL%BFt!X)fI Q#]|@E P%BG!t!+oe{@EL.+%BGat!Uixuz@E%BGt!( W!l w7z@En%BGt!yt\8 |y@F j'BH!4!r.eU$x@FL AHa4!"?.CH4!0R*cBI#BI;2IB%BK!t!qW1%{@B%BKat!X^]<R|@BS%BKt!*R)`G%|@C %BKt!D}@CL-%BL!t!X4e d&K~@C{%BLat! Ia@C~%BLt!:% ih6@D %BLt!k.Y$P7> @DL@%BM!t!j.dq$4ށ@D4%BMat!δ"i$H@D_%BMt!(A$,ך@E G%BMt!T$+V@EL%BN!t!(>(@E%BNat!@%(@E9%BNt!U}(8nG͆@F pG'BN4!پa(N6@FL AO!4!"?V0D@Oe4!C ÂQ0@D%Bb!t!nhEa C@D%Bbat!.ԁ,ӷG@E s%Bbt!8پu |oL@EL%Bbt!ˣAt 35Q@EI%Bc!t!ʞiCV@E<%Bcat!9Wq\}Z@F  'Bc4!.eU,Yg_@FL +Ac4!"?л0D@d%4!C ÂQВJd-&fG_f#l ELFu-D@det!C ÂQВJeW/u"Dt]f ELE'D@dt!D-=Y $f EL'D@dt!ܴ-Y$S^&f EL'D@e%t!K ÂQإc$/2f ELV+D@eet!4,Y!#>&Cg EL+D@et!C ÂQ1x?&=E|% ELDm'D@et!T-Y >e~"f ELӄ'D@f%t!C ÂQ"fRP EL-D@fet!S8=۱ltHX (-:uu f ELA:Dj@ft!qeJ@i-=@{+=9/D@ft!5GvTI>ԥ& f EL-D@g%t!'zIU ()d$p.f ELVQ:Dj@get!qeJ@i-/xY?{"-D@gt!1gY儉RI@(s%%f EL/D@gt!ۣDa% y;$Lf ELs:Dj@h%t!qeJ@mi-Z".@7 o7-D@het!ߓ_5Ui"$N^zf ELW-D@ht!cbg9 )H(t9" ELE:Dj@ht!qeJ@=i-. >n? ǜ-D@i%t!ٔNy6Xۆ(!RJl=f EL3-D@iet!ؕteEg b$F#? ELe:Dj@it!qeJ@i-3Aqx@AS l/D@it!<:5'Y%i'xd,&)?؉ f ELQ/D@j%t!R[1XcQ:g&BjYf EL-P:Dj@jet!qeJ@i-%@#<Ð -1D@jt!7y%TV2 e(Nĉf EL-D@jt!ܐ GgqIK[ H&G&:.f EL -D@k%t!MUZϸ0$x6Un ELS-D@ket!Rc3aY{_&)FT.\5f EL<-D@kt!QS4]7H(v/zf EL-D@kt!s2َGFi?E>(F7n3 EL-D@l%t!V9@kkACP 7y1D@net!F?2OT6= e A1n9 EL^/D@nt!޵E q=8l f EL9:Dj@nt!Kq1s?mi-}"0@;֚Gw/D@o%t!T1`C<j O1n9 ELY/D@oet!8|v]đs9G f EL:Dj@ot!Sq1s?i-JPA?9@A 'D@ot!߱} ~ ;ƅđsf ELq'D@p%t!ۓɎyNIđsf EL3:Dj@pet!Sq1s?mi-0?9A$b>L/D@pt!Ԃ|Am2_l$}\f EL['D@pt!S_ %<]C0sf EL ,-D@q%t!W$?'ܐUU.lr3f EL$7-D@qet!rB:O ܪ_O YO ELC-D@qt!=|A u7\eSo* ELE_-D@qt!ݴT1}i_ A)K EL4'D@r%t!]u~ x|c~f EL'D@ret!٤In+-0_ߘ$f EL:Dj@rt!Q5.DpfJ@i-̚ @ FxÊĐ /D@rt!܁\LnciiR)SF&y f EL /D@s%t!e["9nIɩߘ$jѢ f EL:Dj@set!Q5.DhfJ@i-V*@Ő 'D@st!Lanȏaߘ$f EL-D@st!'[B)vx(e}ߘ&*n EL,y:Dj@t%t!Q5.DlfJ@i-0ئI>@kkACP  >/D@tet!Pv0J ІR-F(Y_pw f EL 1D@tt!kf9׈@[e}ߘ&DQ f EL:Dj@tt!Q5.DpfJ@mi-}"0@;֚Gwy/D@u%t!^ Yn+YIVx&whY_pf EL-D@uet!٤In W&ߘ(*z EL!:Dj@ut!Q5.DpfJ@i-jPA?/9@A 'D@ut!|^nciiRߘ(f ELM'D@v%t!e["9nߘ(f EL:Dj@vet!Q5.DlfJ@mi-0?9A$b>B-D@vt!&!nȏabx(wesf EL'D@vt!zlan+-ȓ̕ߘ(f ELԅ/D@w%t!#n]jx(Q0n ELe/D@wet!b&Pvm3[jx&Q2n EL-D@wt!$!n@Akɺ0;F&*w EL-D@wt!寞YnHQ-0;F(*w EL('D@x%t!LNpn^̕ߘ$f ELC'D@xet! In+,_1P~f EL%M:Dj@xt!5.Dn4s?i-̚ @ FxÊĐ Ψ/D@xt!\LnciRIeL|:i EL/D@y%t!["9nI!1Pw Y~ EL4:Dj@yet!5.D^4s?i-V*@Ő +'D@yt!`LanȎya1P~f EL!/D@yt!݇SB)v؂(ڃS~ ELMc:Dj@z%t!5.Dn4s?i-0ئI>@kkACP /D@zet!bPv0KaІ A2n9 EL{%1D@zt! kf׈@[l f EL*|:Dj@zt!5.Dn4s?mi-}"0@;֚Gw/D@|t!܆!nȎyap}\f ELr-'D@|t!ۅzlan+-(_4sf EL-/D@}%t!كnp]YU.lr3f ELgb/D@}et!&Pvhm3[_O Yd ELP-D@}t!ބ !nAi炜!eS?,* EL-D@}t!EYnI-A)3UK ELś'D@~%t!bLNpn^i~f EL-D@~et!ޣgqR<[28Zɯf EL-D@~t!`6A@Ũq\l2Tf EL/D@~t!E央Za8LQh\0\G f EL%C/D@%t!uMaQyi*`n2Z0W9 f EL--D@et!ڧ0GZUBq`ɍm02[%f EL-D@t!- F k&2[LdX2cf ELZ)D@t! Y4zrg@^HKH%t!iX,x# @]z7(CZF{DVfC!Κ?BȐX_cITEO"?'D@et!ҰX61-`PP~V]f ELY'D@t!ҰX61G[5)A`3vf ELPKHt!*y+&?krZF{FffC!Κ? rCP8 B"?SaCH@%t!P4y+&?7Jp{vF{DffC!Κ?5O"?'D@et!.iQZpZ1@Hnf ELS'D@t!.iQZp0v/۽~f EL KHt!гpTB̯Y?CxfF{D.C!Κ?.7ԭ P 3Kr"?iKH%t!ґu{ U̯Y? C% +fF{F.C!Κ?>,MEO"?h'D@et!"^fY*K\>#~f ELa'D@t!"^fY*JN1:f ELc/D@t!e[!^)"8MN f EL/D@%t!ا[^ C?m 2:kf EL'D@et!c|\ ^)?m 2:f EL/D@t!ݦ:4^Xo"8CLN f EL;'D@t!ݦ:4^YC"8f ELT/D@%t!c|\ ^)i^6}8kf EL'D@et!ا[^Xo^6}8f ELBKHt!ВHgTל @tD3F{DefC!Κ?>OBdEO"?KCH@t!Ҁof gTל @ifF{DdfC!Κ?EO"?"'D@%t!^Igw=f EL'D@et!^Igv]f EL)D@t!+>a4x @_H6)D@t!+>a4x @HuC%4!0R*cBJBJ12J2z&Ba4!}GK0@ %Bt!؝qWZ}@@w;%Bt!zrPݼ@@%B!t!إŨ+T@A !%Bat!;͈w[d_@ALT%Bt!)3a@A%Bt! v;x?;@A[%B!t! ORapw@B %Bat!Yhdk@BL%Bt!e\is*@B;%Bt!P9P7@B %B!t!8dC@YKdT@C %Bat!>a4o@CL}%Bt! S;(YKdT@Ck=%Bt!.7@C%B!t!ais*@D  '%Bat!Hk@DLc%Bt!Sd(dw@D%Bt!, G ?;@D}3%B!t!})3a@E #%Bat!٨Ew[d_@EL%Bt!<+T@E%Bt!(*$ݼ@Eu%B!t!ژqWZ}@F qh'Ba4!!GK0@FL kA4!"?*D@4!R]/f[v#l EL+D@%t!J]咁Γ`!+f ELv0+D@et!P2) 讞d3f EL''D@t!ؔs[)nFE~!  EL$'D@t!R]%nFE~f ELʲ:Dj@%t!s>a4u @qm}s}$Ԉ4?5 mCO%:Dj@et!л>a4u @N:YB C >?"ڔ)D@t!!N蹚lhA5~f ELW)D@t!doi٢kc!BP .:Dj@t! Gg0@s-DT! @ wB5P U-D@t!6CAq3&bg*+kOf EL-D@%t!vs[3p 'k;d EL,2DZ@et!Hȉapt@z7Ьs&iK@>:Dj@t!ƏrK?z7Ьs FjBP Ŵ)D@et!z92Mf#L4f EL=2DZ@t!xm=`X@ȮU͞s Q>~O)D@t!ٓfߣ+d$0,w f EL2DZ@%t!xm=oѕѲ@خU͞s!3|@?)D@et!ߴY4fj܁嶘f ELH:Dj@t!d, oѕѲ@U͞s-DT! @4L6D K+D@t!ّ&cH BEa|CW EL/+D@%t!ّ&\cH BEeLe ELd-D@et!і&teH>&2*<ى f EL,-D@t!і&teIC <ى f EL-D@t!і&cIC |CWa EL-D@%t!4sG=)Ϲ\f ELi-D@et!4sG=)l[h$\f EL-D@t!4sG=)&l[h$Ȇ?} f ELZ-D@t!Wqjx"=QN ELT:/D@%t!޷ qjf=,;*Ȇ?} f EL:Dj@et!ҙ4L-w?^S@#1E :Dj@t!Ï4+YK|@1^p-8R?8R!InC4!0R*cBJxBJ2J[&B!4!OJn\@ %Bat![",ث@@s%Bt!ANz_A\@@T%Bt!)וrYٿ@A S%B!t!X-`&@ALQ%Bat!L.C@A%Bt!x=iVP}P2@Ah%Bt!­>@B [ %B!t!z8gb2&՜@BLm%Bat!5j *(@B%Bt!Ȯ"֎@B?%Bt!״g2E@C %B!t!)i@CL%Bat!R@C*%Bt!~Fi@C%Bt!Ww$&@D 2%B!t!ACAAg@DL2U%Bat!:2@DI%Bt!Xt+^>1ū@D<%Bt!ȮVͻ߭@E %B!t!x.ĩ@EL%Bat!kanB @EcU%Bt!r%,k7@E%Bt!fV2@F 0'B!4!H:ż @FL -Aa4!"?؃,D@4!ِ֮uyt}-"`v/Pf#l ELeC4!0R*cBJBJ2J`&B!4![D @ %Bat!HG@ L@@ %Bt!dF@<ƈ@@%Bt!Zv9x8֐ٖ@A %B!t!241@ALj%Bat!x0^R@AK(%Bt! `(>6@A%Bt!I!v$lGw@B %B!t! E, VP}0z@BL(%Bat!-pxu@B%Bt!*V<p@B%Bt! `.2j@C %B!t!6 0&6Yge@CL@%Bat!б`@CL%Bt!i1ChޔAZ@C%Bt!sAU@D f%B!t!qf_sP@DLP{%Bat!08֐NK@D'%Bt!ЇnB#3F@D%Bt!qg֎ A@E %B!t!8ؽW<@EL?%Bat!b{н7@E%Bt!{CȽ0m2@Ez0%Bt!lK20-@F 'B!4! [K(@FL Aa4!"?̌0D@4!%Љd}-v/P0 f#l EL)2-D@t!'5qz?lhzV% f EL;1D@%t!'5qzd}-"`lhz0 f ELc:Dj@et!Ӹh+mS@!^!3|@  9:Dj@t!ӸhF8o~@^. _)O? Q>~O0)D@t!v9u 4d#f EL-D@%t!ݓ%Љu 4d|Ö0 EL7-D@et!mMjnPd!f ELC4!0R*cBJBJ2JХ&B4!_&K0@ J%B!t!i2ƛ+@@q%Bat!y2JyvqWZ}@@?'%Bt!9 /@A %Bt!Qݼ@ALLc%B!t!G@At%Bat!D+T@A%Bt!(f#w@B P%Bt!cXV[d_@BL%B!t!In@BM%Bat![/ (3a@B%Bt!8jG &A?@C %Bt!);@CLW%B!t!Brl*h@Ca,%Bat!DV|V@C0%Bt!r @D %Bt!d{h~k@DLI%B!t![0(`>K@@D%Bat!c5֕is*@D!%Bt!:p);@E %Bt!s9~7@EL%B!t! #@(NME@Ep%Bat!X$fYKdT@E,%Bt!к@F n'B4!I0To@FL \A!4!"?,Ce4!0R*cBJBJ2J3&B4!jH6OG2CV@ %Bt!u)[@@%B!t!D~~sY`@@%Bat!sK^a&e@A %Bt!vzj@AL;%Bt!KFo@Aɰ%B!t!j0s^/F+t@A >%Bat!H;FԉFy@B z2%Bt!ANWKk~@BLw%Bt!i7fVYd@Bv%B!t!s6V؋d҈@B?K%Bat!A9 @C <%%Bt!ny|_@CLS%Bt!I xδ@CQ%B!t!8i4)#@C<*%Bat!y}@D %Bt!ZGrΓiS@DLu\%Bt! bڬwjo@DG%B!t!K>#@DF%Bat!SAޕ3@E a%Bt!+)@ELC%Bt!F&^ԉ@E%B!t!?^N̅@ECr%Bat!Hn D@F f'B4!8}FI0@FL A4!"?0D@%4!۲m=rXR[e f EL :Dj@t!ٶ6v~[@^)DT!? c :Dj@%t!щ6rYv@!^'ŵ@ L6D -D@et!۲mtphlInaSۘf ELd-D@t!Faiphl }$f EL-D@t!2 Z_lЂMab2&%f ELj:Dj@%t!hlw@-i-ɫ O ?G" o/D@et!}mdn?)&6LXX EL>-D@t!_A cL' R$?q ELA:Dj@t!hl{@i-_p@' Ϳ  A,/D@%t!ߒs1eD;b2&S T f EL-D@et!ҭ21 HA蝮$K&Tī EL:Dj@t!hlw@mi-I{? b0}/D@t!a`©̌4AA$轉f EL9/D@%t!2Ʊo}cؘ$)vwf EL:Dj@%t!hl{@i-e@ 4#lvb/D@et!1sL?"ϟX&7 f ELj-D@t!Qњʘy"2?kS'f EL-D@et!ܵ<"q"MzA#"m lf EL,g-D@t!ڒx0Z]0$f~ ELH-D@t!ڕ)!?Cw(gS&JEՄ EL-D@%t!`t]ƤV$ )f ELg-D@et!}wpf.8>ۜO"F%( EL@-D@¥t! I$S {H~R&X5 ELp-D@t!ے{!ld V&.IG ELb:Dj@%t! T{nh^-h5@͵i-!\@ $e5/D@et!۶z#^y/佞H,B/f EL-D@åt!u!V13H<:MD0LdPf EL,:Dj@t!T{nh^-h5@=i-=2^?e /D@%t!޷dvՍmgq(F.Na f EL-D@et!t7 4gDL,JdH ELy:Dj@ĥt!T{nh^-h5@i-JMQ+>@ o6;څ %A-D@t!ٗn&nMl,&YľQf EL(/D@%t!۴,3]x5r0=>k f EL:Dj@et! T{nh^-h5@i-ڼ?5A Wy, -D@ťt!w& /#15|j0= \ ELy-D@t!4G\q!Twcw1F ,eIP ELc:Dj@%t!T{nh^-h5@=i-x:ӭ @,R΄ |-D@et!RFK,$ Q ELH/D@ƥt!7‚轔aH:.˟l f EL:Dj@t!T{nh^-h5@i-'u*M@/cE K-D@%t!ڕo) pXĽ.N`5f EL@-D@et!T]f y6oA,2Y EL?-D@ǥt!it!*bF&p,D_f EL-D@t!ABnaמm8`vJ*,5R$/f EL-D@%t!Qd$!?5Zd0,Ff EL !-D@et!ݗA˥g@ۉju./c/ f EL]-D@ȥt!+_hy0Q$.bQ,f ELC/D@t!g9)D#cꨀ.5c f ELg:Dj@%t!hl^-h5@i-;r@%UoC -D@et!VH籏!e@uPk j.* F EL΂/D@ɥt! 'O$.f6v,1Wv EL:Dj@t!hl^-h5@ i-V @<1ʿㄐ  -D@%t!Ң!E j," ELb/D@et!SɰɒyEut0M]H; J.9[FX˭f EL -D@ͥt!fl .7%C]j0 bO/f EL-D@t!Tě1c +3 .BZ&z EL-D@%t!ٶS6ʼjYl,[Ϗ~Q EL$-D@et!3$U]邔 L,"[88Kf EL-D@Υt!3}q?0,+Z EL&-D@t!J GsymCn$$f EL>:Dj@%t!+T{nh@i-[ @)'- p/D@et!Ռy[9@:̴H&Pۉ f ELX-D@ϥt!Ф{5 a\9E>DH"rf EL t:Dj@t!T{nh@=i-xl @+CF <2/D@%t!x B)O2@J$Ϸ.Rf EL+-D@et!rF]Nux&<#>& f EL:Dj@Хt!+T{nh@i-V? yjf\ e-D@t!sK@. d\Qr&ω!a EL-D@%t!Eͣy7HI~"hrCz ELܭ:Dj@et!+T{nh@ݥi- ʰf@8ؒ `-D@ѥt!ޑ#dLij,Š"_MRf EL-D@t!TyR6A7M.T&OZf ELc:Dj@%t!+T{nh@=i-GU?+P =,/D@et!ِݣ6Tп$9f ELU-D@ҥt!4+?M 7 Ͼ$Dp EL`:Dj@t!T{nh@ݵi-@X@OV/D@%t!tQqM ^m-",﯉ f ELt-D@et!'6ͫ-Αlc$/)f EL-D@ӥt!51B V?&=Es EL}-D@t!V|;QVnWonf&f EL1-D@%t!wgL@ALP8%Bat!IJV#(= @A%%B֡t!,w/Ջ@A%Bt!xF,%0@B %B!t!0_ @BLS%Bat!X__0[@BO%Bסt!*54_12@Bh%Bt!64r@C ~R%B!t!`X{8׷8@CLι%Bat!:R8I@C%Bءt! “w8{/@C!'%Bt!(L$<h!@D C%B!t!YJ<W^nq@DL^%Bat!XJ<+@Db%B١t!h @s2?@D(%Bt!*J`@#ZT@E sy%B!t!pU@Ӯ_@ELm%Bat!xn?@/iĕ@E%Bڡt!@Ax@EO%Bt!)*@/@F 'B!4!nc@7\R@FL hAa4!"?s.D@ۥ4!7zmƁUޛp;()dI>/f#l EL͌C4!0R*cBKpBK2K&B!4!JWz B@ ?%Bat!o1@@%Bܡt!xPJ m޻5@@k%Bt!y($gYL@A \%B!t!n$3}lt@AL%Bat!JV#(6@A%Bݡt!k,7@A%Bt!+xF,D^K{@B &%B!t!K0_&u@BL%Bat!__0S@\p@B%Bޡt!z54Йj@Ba%Bt!H 64+kNe@C iC%B!t!`X{8oZ _@CL`%Bat!R8Y1EZ@C%Bߡt!K“w8+NDT@C%Bt!xL$<O@D %B!t!J<p3J@DL.s%Bat!J<lD@Db%Bt!h @%g˖?@D!%Bt!jJ`@"M:@E R%%B!t!pU@+TU5@EL%Bat!;xn?@GD/@ES%Bt!@D8x*@E%Bt!i*@ 1%@F 'B!4! nc@rD#@FL Aa4!"?/.D@4!WzmƁuޛp^ۆ(tf#l ELHC4!0R*cBKBK2K~&B!4!nc@B@ %Bat!9*@S;@@%Bt!@W$If@@cp%Bt!xn?@1l#@A #%B!t!pU@[t~@ALh%Bat!:J`@1@A}%Bt!h @Y@An%Bt!xJ<s;j@B O%B!t!yJ<;<ι@BLe%Bat!HL$<2@B%Bt!+“w8w$@@B%Bt!jR8/7|@C 3%B!t!`X{8[k@CLJ%Bat!8 64;!]@C3%Bt!Z54ׯ@C%Bt!__0# @D Jp%B!t!;0T~^Aa4!"?5C4!0R*cBKBK2K&B4!xJWS@ %B!t!jWeyDz@@V%Bat! ~_&߫@@˹%Bt!cm ~?@A /%Bt!Bg K o@ALl%B!t!z0#$ N@A2%Bat! $Y+@A] %Bt!`$Do(8It@B %Bt!um(O@BL:I%B!t!`'($y@BV%Bat! ,巟@Bo-%Bt!g,?.Pi@C %Bt!ZE?,gA>@CL8%B!t!:506@CR%Bat!؀4c0oNJ"@CE8%Bt! 0@D %Bt!iT4AQÇ@DL%B!t!4w/јW@D-%Bat!*/ 4%X&@Db%Bt!يh8>@E 9%Bt!s 8@EL!G%B!t!8 @E%Bat!I@v8BZ@E%Bt!ZU38O%@F 'B4!iP`<kq@FL 4A!4!"?h0D@e4!ݗzmƁMޛpvx,&af f#l ELpC4!0R*cBKBK2KQ&B4!nc@<2U@ O%B!t!Y*@<@@ɶ%Bat!@\@@W'%Bt!xn?@ @A a%Bt!pU@SEܜ@AL~%B!t!ZJ`@G`{@A%Bat!h @u@A>%Bt!J<gmm@B %Bt!J<sb@BL%B!t!XL$<K6T@Bn%Bat!;“w8,lA@B%Bt!zR83])@C *%Bt!`X{8HjJ @CL%B!t!( 64s ^p@Cs9%Bat!Z54N}@CZ%Bt!__0gI@D ~%Bt!+0S[O@DL%B!t! xF,o9 @D%Bat!K,v߻@DjC%Bt!yJV#(^.b@E [%Bt!n$@EL#+%B!t!Y($@E%Bat!XPJ s @Ejh%Bt!o1'~@F M'B4!xJWS@FL \:A!4!"?/Ce4!0R*cBKBK2K&B4!JWW3@ ?b%Bt!oc▄@@c%B!t!PJ #Qim @@%Bat!($t*{@A (%Bt! n$G=w@ALV%Bt!JV#(۲r@A%B!t!{,yZ*Yn@A=%Bat!;xF,#w^ j@B b%Bt![0Cgre@BL}%Bt!__0/fPa@B-%B!t!z54ˌW]@BO%Bat!X 64#滙,Y@C  %Bt!`X{81 U@CL%Bt!R8cwYP@C%B!t!K“w8/L@C%Bat!xL$<KNH@D %Bt!J<VD@DLW%Bt!J<+o@@D#%B!t!h @1y<@DD%Bat!jJ`@SS8@E %Bt!pU@C=m4@ELg%Bt!+xn?@J 0@Eϝ%B!t!@,@E:%Bat!Y*@c<͊(@F 9'B4!nc@ó紅$@FL A4!"?d0D@%4!zmƁmޛqnݸ(R’ f#l ELCe4!0R*cBKBL2Li&B4! nc@q @ 1%Bt!i*@cxD@@%B!t!@CJK@@%Bat!;xn?@Ͷ@A ]%Bt! pU@dz.p@AL%Bt!zJ`@kls(@AG9%B!t!h @k'@AL%Bat!J<y@B ъ%Bt!J<%A@BLA%Bt!xL$<|@B0%B!t![“w8o'@B%Bat!R8P0@C '%Bt!`X{8+@CL%Bt!X 64ǜ4V@C%B!t!54k}q@C,%Bat!__02V@D t %Bt![0;O@Ʒ@DLY%Bt!;xF,05*@D%B!t!,cQ@D%Bat!JV#(>uȦ@E P%Bt! n$d@EL%Bt!($/(;)@E j%B!t!PJ ߚ?@E%Bat!o'.C@F 'B4!JWW3@FL A4!"?Z0D@%4!zmƁI :;(wя#l ELvs-D@et!zmƁI :h$xb EL'D@t!S18gIg&f EL'D@t!PS18|gIb$f EL,'D@%t!ݗzmƁK[ H&G.f EL+D@et!7zmƁUޛq&(vᗯzf EL'D@t!S18dgHB(f ELk'D@t!ڐS18gHH(f EL]'D@%t!ݷzmƁG?E>(F۷n3 EL-'D@et!41zp+P~f EL-D@t!ݷzmƁEޛpe9 ELۅC4!0R*cBL BL82L9q&B!4!nc@@? H%Bat!Y*@<"?@%Bt!@6JQ ?@%Bt!+xn?@<{lx?A %B !t!pU@|e?AL_%B at!jJ`@?E %B !t!n$,)A)?EL%B at!i($JTl?E%B t!hPJ L ?E%B t!ob?F P'B!4!JWl(t?FL Aa4!"?@C4!0R*cBL;BLS2LTAv&B4!JW c`s? %B!t!o|>K?@h%Bat!PJ ,wjaާ?@%Bt!($/{?A C%Bt! n$L0W}?AL %B!t!JV#("@oh?AU}%Bat!, S?A4-%Bt!;xF,Z\B??B %Bt![0Lre*?BL4%B!t!__0m?Bʓ%Bat!54<?Bg%Bt!X 64 ?C %Bt!`X{8JT\?CL2%B!t!R8?CM %Bat![“w8S?Cl%Bt!xL$<kd?D ,%Bt!J<l:I?DLB1%B!t!J<D6 @E)%Bat!PJ  ?E %Bt!o:Lb?F $'B4!JW c`s?FL <A!4!"?xCe4!0R*cBLrBL2L&B4!JWaH@ #%Bt!oڄ@@%B!t!hPJ k<@@%Bat!i($.=@A %Bt!n$10@AL%Bt!JV#(A87@A%B!t![,W÷ߩ@A&%Bat!xF,]Fy@B O%Bt!;0t>{@BL'+%Bt!__0.Bk@B+%B!t!j54~no@B9%Bat!H 64njw@C %Bt!`X{8>Dm@CL%%Bt!zR8Yc@Cc%B !t!K“w8&X*Z@CP%B at!hL$<eJ{zP@D י%B t!J<;0F@DL%B t!J< ]8=@DQ%B!!t!h @~-.m3@D%B!at!jJ`@*@E %B!t!pU@_ǹ @EL+%B!t!+xn?@@E%B"!t!@F n @Ez%B"at!Y*@@F 'B"4!nc@rS@FL b0A"4!"?,;0D@#%4!zmƁmޛq0sUUK f#l ELn'D@#et!uƁD% +‘sf ELˡ'D@#t!pS18gI}0sf EL'D@#t!S18gHc~f EL޶'D@$%t!ݷzmƁUU.lCr3f EL 'D@$et!pS18gHc~f EL'D@$t!ݷzmƁX_O Y. ELr)D@$t!سdoiْihz0}xJ4 f EL|'D@%%t!سdoiْm6,ڱ(4f EL'D@%et!سdoiْm6,qhz0f EL)D@%t!سdoiٲ04>-ê f EL'D@%t!سdoiٲl6,h0f ELU'D@&%t!سdoiٲl6,۱04f EL-D@&et!cZq2u4\T/I̋ ELN-D@&t!ޱͨɚ g'2/RT~sLvvf ELU\'D@&t!ޱͨɚ2u4'2/RTf ELA2/D@'%t!֌ɚFo'2/RTE'f EL2/D@'et!ߕ\Q,3Ak4PI̋ԕ f EL]'D@'t!ߕ\QFo4Pf EL/D@'t!ڲK$ 0P4P_# f ELe/D@(%t!ٓcr1EW+-ܴSE'f EL!Z/D@(et!ڕ²܌\+-aW(Ew- f EL2/D@(t!BRg,WbGUf EL-D@(t!1TtP#1UK | ELKH)%t!H@~# @;^ .F{FB[1?B17 D"?wCH@)et![~# @H<DNF{DB[1?EO"?'D@)t!طS5 zL,<V]f EL'D@)t!طS5 {$ A`3vf ELtC/D@*%t!҉=RG$~OU:Dj@.t!ӁoGe%E-@0$+(W @4L6D )D@.t!RnjT(g,@b/\Ho~)D@/%t!С$e(g,@b/\Hi)D@/et!RnjT#sc1@b/\H*)D@/t!С$e#sc1@b/\H--D@/t!٦\"kDUqVf ELw)D@0%t!߅w]HkDWqVf ELs%-D@0et!Ew]HGˎa0WqVif EL^:Dj@0t!Ңe:񽭒+@ $+(W @, :Dj@0t!q`<:񽭒+@od2Z@TP -D@1%t!`Chaj҈2\ߚbW6f EL'Q-D@1et!`ChYX#d\ߚb9tkU EL-D@1t!Ǩ*"YQuӹV|b7W6f EL+D@1t!1{7҈ddߚb: ELF+D@2%t!%1L^pߚb: ELO-D@2et! %]R6m\ߚb6f ELwn'D@2t!FTy8S]\ߚbf EL^:Dj@2t!Ѣ/]߀w1@z7ЬsP1鴦@TP 6~:Dj@3%t!D#݀w1@z7Ьs%+(W @ĔQP i)D@3et!C:, .H$Dbf ELTQ)D@3t!6"PbΫF.KXf EL/D@3t!jUiA*|.)!.K^4f EL#/D@4%t!اߜ*ZQڱ#txLb bf ELb'D@4et!DkZG.KXf EL 'D@4t!ޏ iZ34=$Dbf ELz/D@4t! bGp+.K^]%f EL4/D@5%t!8b|gZ~Z bf EL:Dj@5et!СŝWčx"1@-DT!??"2T@P :Dj@5t!бŝWč%E-@`oQ@4L6D :Dj@5t!"fhxe%E-@!3|@~£P :Dj@6%t!"fhxex"1@ЅO ?> >~OUlC6e4!0R*cBLBL2LY&B64!{v(X% l1@ %B6t!Ӝd;- m1@@B`%B7!t!@VLlߥo1@@T%B7at!xNaq1@A %B7t!Aڊ [zs1@AL<%B7t!Ӝt1@A%B8!t!Sܥ2lUTv1@AM%B8at!1˝ дIw1@B +i%B8t!1QcOԶZry1@BLE%B8t!S\f8čz1@B%B9!t!*Ѝ[=dq|1@B?[%B9at!{`%^}1@C bW%B9t!f<ϦQ1@CL%B9t!AY<e>1@C%%B:!t!"Q)1@C/%B:at!Qᩰ;-j1@D m%B:t!{u$gト1@DL%B:t!:4G1@D%B;!t!?xiDjĮF\1@D%B;at!+IPSv 1@E \n%B;t!|=`91@EL%B;t! C5phCn)1@E5%B!t!jS_?lm#/1@A X%B>at!2"mGs=21@ALb{%B>t!0 ӬSv"T51@A]%B>t!dﰉ} -h81@A%B?!t!2m7+bx;1@B 1%B?at!AZ縉m>1@BL%B?t!s4Wx#A1@B%B?t!rq+ĉID1@BB%B@!t!㦋#̉hCn6G1@C v&%B@at!|]ԉhCn~J1@CL;_%B@t!D=܉7M1@C %B@t!vVwsP1@C%BA!t!A[S1@D :%BAat!gf-;V1@DLǑ%BAt!C֢KeY1@D~U%BAt!ѡx xKr[1@D%BB!t!rky ^1@E q%BBat! FI$T!ka1@EL@%BBt!P+0ܺ!d1@E%BBt!2K܊<9f1@E%BC!t!:DLri1@F WH'BCa4!{v(X% l1@FL AC4!"?%VHC4!3vk׆4@&p Lc0d7{˚?j,<P@3 "?k(SHD%t!3v,XԖ$&@&p Lc0d7{˚?$v n?QD"?^CDe4!0R*cBMBM*2M+-&BD4!{v(X,@ %BDt!:DL#ܸ,@@9I%BE!t!2K܊<z$,@@%BEat!P+0*~,@A %BEt!{vU$L{,@AL%BEt!Ӝgj,@A?%BF!t!2 x (g,@A*%BFat!; ,@B 2%BFt!0g,/K,@BL? %BFt!çx ,@B8%BG!t! ~wdK,@BX%BGat!|tY܉,@C )%BGt!@V䍳ԉŢ,@CL%BGt! #̉JD;\,@C#%BH!t!@$/+ĉ"ә-@C%BHat!2QL,s-@D c%BHt!rq縉lՃе-@DL%BHt!y-@D:%BI!t!dﰉ-@Dv%BIat!0 Ӭ:<7!-@E %BIt!2"mG G'-@EL%BIt!jS$q{--@ELo%BJ!t!2QOĀY 3-@E%BJat!Q[g#(-9-@F l'BJ4!t.@-@FL "AJ4!"?CK%4!0R*cBM-BME2MF:&BKa4!Q[fN.%n,@ D%BKt!1Ѣo4uYp,@@*%BKt!`,%Ȃkr,@@ %BL!t!#FZI-p*ou,@A m%BLat!P\=`,s8w,@ALG%BLt!]PH;tz,@AR%BLt!Ң DDy{},@A%BM!t!K4^N,@B %BMat!3̝/q$ M0,@BLp%BMt!Öxӄ,@B%BMt!2 bʣ,@B5%BN!t!c0&2B,@C %BNat!#Ƙ%,@CLj%BNt!Ң `RH==,@Ca%BNt! FJЍL{Ԓ,@CI%BO!t!#F[Idčz\GB̕,@D ?%BOat!;,xј,@DL{%BOt! D,@DW%BOt!cfhR.68 ,@DT%BP!t!ѡbH܌_.F,@E v%BPat! :D"01w,@ELG%BPt!x,@EH%BPt!1Qa\l.q,@EM%BQ!t!"I@dVJ-,@F 'BQa4!{v(X,@FL -YAQ4!"?CQ4!0R*cBMHBM`2Ma&BR!4!"m,@ %BRat!4\mlՃ,@@T%BRt!Ԡlm $+$v,@@%BRt!cTTmfD,@A %BS!t!1@DL;%Bdat!!t,mx;1@D %Bdt!c<فmv10h81@D,%Bdt!Ymy $T51@E %Be!t!Vma=21@EL_ %Beat!!nm_?lm#/1@E%Bet!'mWxk,1@Eh%Bet!Ym郎f(1@F -'Bf!4!!~0Qm+%߶%1@FL Afa4!"?Cf4!0R*cBMBM2Mf&Bf4!#R i͎1@ (%Bg!t!i&*,iW;jD1@@P%Bgat!>Hi7;d1@@%Bgt! hiN)1@A ~%Bgt!Ni[=1@AL%Bh!t!NĢiM'Ӧ1@AiU%Bhat!)~2iO7h3`1@A%Bht!3?i)1@B E%Bht!9~iVȄ1@BL%Bi!t!D/i5!pw1@B%Biat!Ve4i?1@B^/%Bit!E^'PiK1@C ;U%Bit!eOliY1@CL%Bj!t!T'isR}1@Cw%Bjat!"iK5v|1@C)W%Bjt!,iz1@D a%Bjt!#s+i5!xy1@DLI%Bk!t!QirȰw1@D$%Bkat! mZv1@D %Bkt!V$mQٽt1@E 1%Bkt!^!JLmEZm1@F 'Bl4!"m% l1@FL Am!4!"?ŵ*D@me4!$pA*Vt~xb@ƒrf#l EL/W'D@mt!$pA*&5}0X$ EL5'D@mt!cZ Bڪb= EL,)D@n%t!cZoƓ.XHf EL'D@net!$pA* 8ATt~xbf EL)D@nt!9PV,Tt~xbf ELc)D@nt!cZ@8h.oƓ.Xf EL/'D@o%t!Z!*,{oƓ.Xf ELU)D@oet!$pA*@.K^l)9 f EL)D@ot!$pA*DkN\ bf EL'D@ot!ǦZvڪb{f ELl'D@p%t!ǦZeUݫZ 9i EL)D@pet!ǦZa \Uwj긖f EL)D@pt!cZ4.K^XQq f EL޳)D@pt!cZ~|` bf EL)D@q%t!ǦZgZ b f EL:Dj@qet!p-q*{:?<1@~nS2@4L6D z}:Dj@qt!Ҁq](]7cI,@ 7|& ? Q>~O"c:Dj@qt!Ҁq](]*{:?<1@/!3|@ $]#`P  :Dj@r%t!p-q7cI,@-DT!?i2P )D@ret!C:34{Κ?.;{|OW*:Dj@st!D#"+#p ,@z7Ьs5}n+@ W`{ )D@st!$pA*$5}0X8Ė` f ELY'D@t%t!$pA*vv`9{) ELk'D@tet!$pA*DkN\` 8Ėf EL)D@tt!$pA*vv`ƒr@f ELUs-D@tt!$pA*לG{bK; ELw-D@u%t!$pA*לG 1vU0XJkZn EL'k)D@uet!pA*(VԸbٯpm] f EL\2DZ@ut!Q0_ߓ`1@=z7Ыsj!11)D@ut!pA*(Y*\ٯpm] f EL5B2DZ@v%t!Q0j_$,@z7ЫsS@)D@vet!pA* Y*\(Qp f ELk-D@vt!s!8d,8X^Hd(W ELn-D@vt!DVm%!8d,82^Hd(W EL-D@w%t!DVm%!iNH2^HdW EL+D@wet!ا<"Ni^HdW EL^)+D@wt!ا<"0ĸ^Hd(oW ELjw)D@wt!Q7q-g6Zߚbf EL]+D@x%t!efu"&( kXߚbV6f ELA+D@xet!٢("&( ڻZߚbV6f EL:-D@xt!٢("8NHDZߚbֶf EL-D@xt!Q78NHDZߚbVf EL/D@y%t!_A"FY6;r,d67映f EL/D@yet!A/^Z6;r,dV7映f EL`:Dj@yt!ѢLŀ4e2@!^8Ʀ@O/ :Dj@yt!pd}2@A^{Ϊ?Nx\)D@z%t!݀ZC! fN9ZYwf ELCze4!0R*cBMBN2N]&Bz4!iАDֲ)@ J%Bzt!Xp ])@@%B{!t!$\\ܥA)@@%B{at!HkE*W*@A %B{t!t *@AL%B{t!TzBmT *@A2%B|!t!0Xȁ6*@AY%B|at!!N܁paX*@B %B|t!]Z=ƌ*@BL6%B|t!i\g*@Bz%B}!t!Z) Tdu*@B5%B}at!ɰ86+*@C %B}t!]P=*@CL%B}t!Fh6+*@C%B~!t!`Tdu*@C%B~at!RPݜ\g*@D %B~t!2SѰZ=ƌ*@DLhi%B~t!ȁpaX*@DIq%B!t!4jU؁6*@De%Bat!cmT *@E @%Bt!GI*@EL %Bt!skE*W*@E+%B!t!3R \ܥA)@E.%Bat!b*> ])@F H'B4!NvDֲ)@FL \A4!"?,D@%4!'!igRáf#l ELЫ)D@et!߄'!^ΆfNUn f EL)D@t! !iUeLWf EL\'D@t!'!I`iUeLf EL7-D@%t!3hOyH`H@ fNá EL]-D@et!'!`(B fNC EL+D@t!܄2yGmiUeLUnf ELY-D@t!݀ZC!pZ>iUeLUnf ELh/D@%t!‚%j8RiUeLCf ELF1D@et!܄2`(BiUeLCf EL2DZ@t!6yP+@^Jfs}:<:Dj@t!ӰT|[DP+@^$@ Q>BP U)D@%t!3hOyH fNYLӈf EL)D@et!݀ZC  fNYLӈf EL)D@t!߂h0 TLVhV67 f EL;C4!0R*cBNBN,2N-&B!4!mfdTro2@ L%Bat! >`jX2@@7%Bt!r\HY92@@T%Bt!D"Tv0%7/2@A %B!t!s,:HwpP2@AL(%Bat! <%M2@A0%Bt!P@,b `2@A%Bt!cfrZ?X2@B H%B!t!Z8)i2@BL'e%Bat!6a&2@Bo%Bt!?n ԁ 2@B:%Bt!ҟQJ킵2@C %B!t! >H])QN2@CL,%Bat!qrCJ킵2@C3%Bt!9*p 2@C|%Bt!AYX&2@D J%B!t!S\a@8)i2@DL%Bat!"a,?X2@D5%Bt!,Wb `2@Do%Bt!%M2@E %B!t!!KwpP2@EL%Bat!q0vv0%7/2@E'%Bt!R\g%HY92@E%Bt!: jX2@F 'B!4!'XTro2@FL 'Aa4!"?-,D@4!%NXߚdBU f#l ELN'D@t!݆-N^)TLVh`. EL'D@%t!!hG仂hJUf ELq'D@et!%N3 9?仂hf ELW-D@t!%NA  82@z TLVhBUf EL-D@t!%N6qd> TLVhBUf ELE-D@%t!7m.p@仂h. EL-D@et!߂h0cYn:BG仂h. EL-D@t!!eQ Pm.仂hBUf EL-D@t!7d6p仂hBUf EL0:Dj@%t!ғ<2@1^-DT! @% e 2DZ@et!Ѣ{C\y<2@^a@q)D@t!%NA z TLVhF^ f ELO)D@t!aŒz TLVhF^ f ELx'D@%t!$pA*#<b5. f ELCe4!0R*cBN>BNV2NW&B4!1zE8|k1@  %Bt!|}@ 1k1@@c%B!t!bqD?(j1@@߷%Bat! L(ai1@A %Bt!5}P*\i1@AL%Bt!6zT2Nnh1@A %B!t!uX&-h1@AI%Bat!L\`=g1@B ^b%Bt!R_edw-g1@BL%Bt!"F}hT9qf1@Bt%B!t! uUlkZe1@B%Bat!Pb7lOe1@C (%Bt!cfIpled1@CL=%Bt!:etϧ0d1@C{%B!t!SExY֮c1@Ce%Bat!xvbac1@D C%Bt!6M|S&b1@DLt&%Bt!1yEma1@Di%B!t!v)i9Zpa1@D%Bat!ޓ `1@E 4%Bt!u1@C %Bt!cfIp%<1@CLq%Bt!:et:t;1@C5 %B!t!SEx3:1@C'%Bat!x5M]81@D %2%Bt!6M|H~OlJ71@DL/%Bt!1y'ޯ51@D7%B!t!v)i641@Dk%Bat!x *31@E m%Bt!uI}11@EL%Bt!LфMn01@ELv%B!t!СAфY)/1@E_%Bat!ixxձ-1@F fC'B4!5u S,1@FL A4!"?*D@%4!?;2tb)/%ʇ#l EL8Ce4!0R*cBNvBN2N.&B4!5[_7H\1@ n%Bt!ixļ[1@@%B!t!СAф|1[1@@1#%Bat!LфHZ1@A K%Bt!u"IZ1@AL%Bt!8Y1@A\%B!t!v)iޚc/Y1@A‹%Bat!1ytIyYxX1@B Z%Bt!6M|cW1@BL%Bt!x[e_W1@B%B!t!SExV1@B<%Bat!:etHDV1@C i%Bt!cfIpP^U1@CLr%Bt!Pb7l<%U1@C %B!t! uUlc0T1@C%Bat!"F}h»T1@D B%Bt!R_ed$pS1@DL %Bt!L\`@;R1@D%B!t!uXj+(AGR1@D%Bat!6zTXQ1@E D%Bt!5}Py7Q1@EL\%Bt! Lߧ}P1@EL%B!t!bqDrO1@EW#%Bat!|}@0AߺCO1@F 'B4!1zE8&龣N1@FL (cA4!"?{C%4!0R*cBNBN2N>&Ba4!1zE8@1@ L%Bt!|}@UM1@@@%Bt!bqD\^1@@{%B!t! LPq1@A %Bat!5}P>R1@AL.%Bt!6zT/NPC1@A*%Bt!uXB피0@A+%B!t!L\`,y%0@B fH%Bat!R_edl0@BLi%Bt!"F}h?\R0@B%Bt! uUl&V>0@Bd%B!t!Pb7l7c0@C :%Bat!cfIp]!B0@CLG%Bt!:et0@C%_%Bt!SExzӁ0@CɅ%B!t!x*=d0@D 5%Bat!6M|%/0@DL%Bt!1yG!Z0@DO%Bt!v)i\yd0@D%B!t! VL0@E %Bat!u~(0@ELZ%Bt!Lф1<2 0@EtY%Bt!СAфK2B:0@E%B!t!ixD3g0@F g'Ba4!5;G0@FL A4!"?͍,D@4!?;2Y! Nbr f#l ELC%4!0R*cBNBN2N&Ba4!5ϐ'1@ %Bt!ix[2&1@@%Bt!СAфw3$1@@%B!t!Lф u#1@A %Bat!u8AB^"1@ALm %Bt!5 1@A3j%Bt!v)i̝Y1@A]%B!t!1y7c+1@B %Bat!6M|!r1@BLH%Bt!x~71@B"{%Bt!SEx1@BN%B!t!:etWn1@C %Bat!cfIp3®1@CLk%Bt!Pb7l5x1@C%Bt! uUl(31@CN%B!t!"F}hIJ1@D %Bat!R_ed- tS1@DL%Bt!L\`**1@D%Bt!uX2#g1@D#%B!t!6zT& 1@E ?%Bat!5}PP/l 1@ELX%Bt! L(s+ 1@EV%Bt!bqDM_1@Evu%B!t!|}@f1@F d'Ba4!1zE8@1@FL EA4!"?C4!0R*cBNBN2N&B!4!1zE8  0@ %Bat!qk8sY30@@%Bt!7}<^\0@@QB%Bt!P[<Ē 0@A %B!t!cf@q0@AL(%Bat!v:5@k0@A&%Bt!!@0@A`%Bt!'==Di'0@B =%B!t!!DCO0@BLa%Bat!GT5Hhx0@B%Bt!-YH r0@B%Bt!Ҝ<H[0@C m0%B!t!< lLUF0@CL/%Bat!2WLx0@C%Bt!pfQLЗ?0@CD%Bt!P}f0@D 3%B!t!Ir PӍ0@DL%Bat!pq*[]PY0@DN%Bt!FT똂-0@D'%Bt!~TWW.0@E %B!t!A'AT[E*0@EL~W%Bat!Qa,X P0@EL%Bt!30@F 'B!4!Q[1\]xg0@FL CAa4!"?*D@4!?;2Kk`0Kou#l EL3C4!0R*cBNBN2NФ&B!4!5٨0@ 9%Bat!ix.q0@@F%Bt!СAфK0@@&%Bt!Lф<0@A H%B!t!ui0@AL|%Bat!Ɗ0@A-%Bt!v)i0@A'9%Bt!1y50@B %B!t!6M|J0@BLM%Bat!x{E0@BE%Bt!SEx^o0@Bp%Bt!:et\>0@C 0%B!t!cfIp0@CLq%Bat!Pb7laM0@C%Bt! uUl/M: 0@C %Bt!"F}h.0@D o%B!t!R_edlP0@DL%Bat!L\`Rwo0@DF%Bt!uXؠK0@D6}%Bt!6zTf0@E G%B!t!5}P#0@ELh%Bat! L$˟0@E%Bt!bqDQ}0@EO%Bt!|}@(/0@F 'B!4!1zE8  0@FL Aa4!"?Y0D@4!?;2)Qb 4x} f#l ELJ*-D@t!?;21Q/1`bn tZ EL)D@%t!q2z-JS`f EL#d)D@et!q2z-J#<bf EL'D@t!?;2*XbHff ELz)D@t!q2z-J5!Fbf ELOG)D@%t!q2z-J*8 bf EL='D@et!?;2~5'`ZRf ELP'D@t!?;2L}? Xb$.hvf EL%'D@t!pA*СEXٳP)f EL7C%4!0R*cBO BO!2O":g&Ba4!1zE8U{1,@ %B¡t!"8f'gO,@@Ǵ%Bt!B^A8Lm,@@h%B!t!_8jN ,,@A >%Bat!Al=<,@ALs%Bát!Pe<zƳ,@A.%Bt!A[)9<6k,@AQ%B!t!Sݵ<fsK,@B %Bat!p{/1<L ,@BL%Bġt!<ɱ=,@Br%Bt!;)<I-V[,@B%|%B!t!"<Šx,@C 1P%Bat!S@Q,@CL3A%Bšt!͌@6?,@C%Bt!@ܲҠѴ,@C%B!t!-@?,@D %%Bat!R`@ݖ ,@DL%Bơt!2 }@s*,@D%Bt!L@&\oG,@DǼ,@EF %B!t!lEDڵ,@F  'Ba4! DرG,@FL SAȡ4!"?Ko*D@4!ܠ?;28kXhc*G#l EL8C%4!0R*cBO%BO=2O>&Ba4!5C,@ %Bɡt!rix``,@@%Bt!СAфz<,@@O%B!t!Lф4&Tt,@A %Bat!uZΒU,@AL%Bʡt!r1 ,@A,A%Bt!rv)i9,@A%B!t!1yK&,@B q%Bat!6M|>p ,@BL%Bˡt!x$,@B`%Bt!SEx }[+,@B %B!t!:et*,@C _3%Bat!SfIp|.,@CL%B̡t!Pb7lڭ4,@CL%Bt! uUlzb(,@CR%B!t!F}h~V&,@D %Bat!B_ed,@DL%B͡t!L\`G,@Dcz%Bt!uX /,@Dd%B!t!6zTRb,@E %Bat!5}P4"ȹ,@ELL]%BΡt! L+*,@EF%Bt!bqD؜u,@Ew%B!t!|}@+4ߴ,@F  'Ba4!1zE8U{1,@FL ^Aϡ4!"?@(C4!0R*cBO@BOX2OYq&B!4!1zE8@5}-@ %Bat!|}@),@@+^%BСt!bqDbY;,@@)%Bt! Lv)x,@A A%B!t!5}PiK,@AL8%Bat!6zTph`,@A{F%Bѡt!uX`b,@F ka'B!4!5X,@FL uAa4!"?`0,D@֥4!ܠ?;2x`DZ7n f#l ELC4!0R*cBO\BOt2Ou\&B!4!5^|UF-@ %Bat!rix$_C-@@l%Bסt!СAфL@A-@@(P%Bt!Lфu^>-@A %B!t!u;-@AL%Bat!˟R8-@A%Bءt!rv)iH6-@A`G%Bt!1y2U3-@B %B!t!6M|$0-@BL,Z%Bat!xa--@Bd%B١t!SEx`2D*-@B%Bt!:et -(-@C )%B!t!SfIp~Z%-@CL%Bat!Pb7l"5׃"-@C%Bڡt! uUlN-@Cd%Bt!F}hʛ-@D 1%B!t!B_ed0?i-@DL$Q%Bat!L\`-@D"%Bۡt!uX8٭P-@D%Bt!6zTQ-@E %B!t!5}P] -@EL%Bat! L -@E%Bܡt!bqDHZ-@E)%Bt!|}@2t-@F cG'B!4!1zE8@5}-@FL |-@BL(%B!t!F}hdgz-@B&%Bat! uUlU0w-@B%Bt!Pb7lBTt-@C %Bt!SfIp}q-@CL%B!t!:etr n-@C#%Bat!SEx,Vack-@C%Bt!xT3k i-@D (%Bt!6M|f:Hf-@DL[A%B!t!1ybNc-@D %Bat!rv)iFƾ`-@D&%Bt!NZ]-@E @>%Bt!uU:[-@EL%B!t!Lфb-'zX-@E%Bat!СAфmU-@E(%Bt!rixFeSR-@F 5'B4!5.}R6P-@FL cA!4!"?'*D@e4!ܠ?;2sejZ(K(#l EL*C4!0R*cBOBO2O&B4!5\p-@ %B!t!rixRxg-@@%Bat!СAфW-@@ %Bt!Lф~Iѱ-@A XJ%Bt!uq-@ALh%B!t!2}&Y;-@AL%Bat!rv)i6-t-@AE/%Bt!1yZur-@B V%Bt!6M|'4V-@BL= %B!t!xEZ-@B;%Bat!SExB-@B%Bt!:et.ĥf-@C %Bt!SfIpr-@CL5\%B!t!Pb7lt+-@Ci%Bat! uUl6f-@C%Bt!F}hhk -@D J%Bt!B_ed-@DL %B!t!L\`?O-@D'%Bat!uX26-@DZ%Bt!6zT-@E %Bt!5}P.-@EL%B!t! L",V-@E %Bat!bqDg:-@E%Bt!|}@LQÖ-@F 'B4!1zE8NS}$G-@FL skA!4!"?3Ce4!0R*cBOBO2OR|&B4!1zE8lB-@ %Bt!|}@n|v -@@C%B!t!bqD-=-@@%Bat! L6-@A %Bt!5}P-@ALu%Bt!6zT:Y]-@AN%B!t!uX&c-@A%Bat!L\`-@B I%Bt!B_ed9)4-@BL%Bt!F}hRO-@B.%B!t! uUl;}-@B%Bat!Pb7lF|%-@C %Bt!SfIpqmj-@CL%Bt!:etq1}-@C6%B!t!SExxA+-@Cg%Bat!xP-@D r/%Bt!6M|-@DL%Bt!1y:d@-@D%B!t!rv)ih-@D+%Bat!~-@E V%Bt!uae]-@EL%Bt!Lф-@EgV%B!t!СAфЯǼ-@E%Bat!rixh|-@F 'B4!5:9$g1-@FL yA4!"?i*D@%4!ܠ?;2 Zu7:f#l ELK-D@et!ܠ?;2ܢX CX{yĠ EL÷-D@t!ܠ?;2ܢ`  ZkkL=uf EL-D@t!ޡq2z-Jak9ZuZ ELT)D@%t!ޡq2z-JyH*Zf ELI'D@et!ܠ?;2ctZYZ EL'A)D@t!ޡq2z-J<.' "Zf EL}'D@t!ܠ?;2A/HlZQ#r,f EL)D@%t!ޡq2z-J@cfXf ELV'D@et!ܠ?;2bٸXkk$f ELC4!0R*cBOBO2O&B4!nr0 N2@ I%B!t!jfq~O2@@ e%Bat!r MHX2@E%Bat!q hX2@Em%Bt!JGLi@X2@F 'B4!ר2`CX2@FL <A!4!"? ".D@e4!ߢ2 QkIN$d)#l ELcC4!0R*cBOBP2Pߋ&B4!Qi;_y}U2@  %B!t!ħ*']U2@@%Bat!-(Ku\U2@@"%Bt!L+[ R$U2@A u%Bt!2ѻ ;g&T2@ALVD%B!t! "X UlT2@A%Bat!qyYNs7doT2@AoU%Bt!rʰC/T2@B ?%Bt!O ?#ψS2@BL&%B!t!qowÓS2@B%Bat!MkӣcS2@B%Bt!)wuS2@C 56%Bt!yo$R2@CL'%B!t!S{NFͅR2@C+%Bat!1֖7R2@C*%Bt!WR\Q2@D %Bt!RMՓQ2@DL%B!t!3OUAQ2@Di%Bat!֩ipP2@D%Bt!p^,xP2@E U%Bt!rJ &7P2@EL%B!t!_@O2@E%Bat!3Bk @{O2@E%Bt!u>ɫHO2@F 'B4!nr0 N2@FL yA!4!"?VCe4!0R*cBP BP"2P#&B4!H0 N2@ 5%Bt!0KЌwq~O2@@Q%B!t!1ĪM%Bt!jB)Sb~T2@B %B!t!tګHJT2@B%Bat!D&XlU2@C e0%Bt!2qw.U2@CLw%Bt!B8;V2@C%B!t!ܽ /V2@C %Bat!ߠ,KV2@D a%Bt!2RG4dqp8W2@DL.%Bt!p>e@0}W2@DXd%B!t!P+%)L3YW2@D%Bat!avcT#W2@E %Bt!`x{0 !X2@EL%Bt!Qy}alEHX2@E:%B!t! xhX2@E%Bat!2ՀTi@X2@F 'B4!0啌9`CX2@FL  A4!"?M0D@ %4!@m67bF$d)#l ELC e4!0R*cBP&BP>2P?B&B 4!r43`CX2@ %B t!%ȉMi@X2@@%B !t!ӄF;ЉhX2@@%B at!qT؉AHX2@A %B t!ISs{0 !X2@ALK%B t!2#W2@A%B !t!s8s/YW2@A]%B at!0}W2@B %B t!S-kaqp8W2@BLk%B t!$@KV2@B2%B !t!Ѹ /V2@B%B at!g'8;V2@C /%B t!Av\nw.U2@CL8%B t!6$$&XlU2@C%B !t!~:A,׫HJT2@CII%B at!!<4&Sb~T2@D 1b%B t!z<NS2@DL\%B t!j1DEpS2@Dj%B!t! ,AL R2@DO%Bat!2?V(Tdq BR2@E %Bt!W,bp\9`HQ2@EL;%Bt!IdP2@E8%B!t!r{b@lM&Ba4!Y/0 N2@ MG%Bt!Gsq~O2@@x%Bt!M:čM-D@%%t!%VQϡ5j$dcMҾ ELD'D@%et!AI|QAnd +e5Jd[Af#l ELu-D@4t!#v)mx5Jd[Af ELW+D@5%t!؃>(+QAnd<}(oW ELm'D@5et!mQAnd<}(oW ELo+D@5t!Lj !{$d) ELdC54!0R*cBPBP2PhU&B6!4!cc|m.`CX2@ ^%B6at!" ImIi@X2@@%B6t!(imhX2@@%B6t!m9HX2@A %B7!t!'mk{0 !X2@ALa%B7at!cbm #W2@A@%B7t!4m'YW2@AzS%B7t!"dm0}W2@B %B8!t!aӿmVqp8W2@BL%B8at!gNm KV2@Bư%B8t!]N.m/V2@B 1%B8t!wjm 8;V2@C %B9!t! m`w.U2@CL%B9at!5pm&XlU2@Cq%B9t!"FmɫHJT2@CnK%B9t!'$mSb~T2@D ]%B:!t!bt0m!t!C \eQq BR2@A?f%B>at!C8ڠe R2@A%B>t!,e4pS2@B %B>t!,fe{He9HX2@Ex%BBat!!˹TehX2@E(%BBt!8ć`eIi@X2@F A'BB4!a(Ïhe.`CX2@FL DAC!4!"?.D@Ce4!ǠɥǵԸ$d)#l ELZCC4!0R*cBQBQ'2Q(Fr&BC4!Dm0 N2@ Z%BD!t!`iPmvq~O2@@%%BDat!`\mMHX2@EQ%BIat!r~@mhX2@E%BIt!`&LmJi@X2@F B'BI4!"5.Xm0`CX2@FL mAJ!4!"?U0D@Je4!ۇ0P0,6$d)#l EL%CJ4!0R*cBQ+BQC2QDW&BJ4!c?i9`CX2@ &%BK!t!/m0iTi@X2@@e%BKat!+DihX2@@Θ%BKt!c'> \iEHX2@A 1%BKt!c`tix{0 !X2@AL%BL!t!!}#i#W2@A%BLat!<;i3YW2@A"%BLt!a0}W2@B %BLt!>idqp8W2@BLDZ%BM!t! iKV2@B`%BMat!"}7i/V2@BB%BMt!` m8;V2@C $%BMt!=FD$mpw.U2@CLYY%BN!t!# YTi0 N2@ m%BQt!!ķivq~O2@@ %BR!t!!ĴiM%BTt! Ixipw.U2@CLu%BTt!`2^ei8;V2@C%BU!t!]p i/V2@C%BUat!2l>iKV2@D >%BUt!.idqp8W2@DL?%BUt!c-@4i0}W2@D8%BV!t!.Hi3YW2@D%BVat!]L`i#W2@E C%BVt!2tix{0 !X2@ELq%BVt! iEHX2@E3%BW!t!# ;ihX2@E%BWat!!ĵ"iTi@X2@F 3'BW4!#2i9`CX2@FL ;AW4!"?0D@X%4!d[[ Qf4$d)#l EL NCXe4!0R*cBQbBQz2Q{6&BX4!Hie0`CX2@ %BXt!8ceJi@X2@@D%BY!t!hyehX2@@0%BYat!2ne>HX2@A 7%BYt!WIep{0 !X2@ALT%BYt!Bfe #W2@A6%BZ!t!"}e+YW2@AL%BZat!Xs#e0}W2@B %BZt!GF?e]qp8W2@BL<%BZt! DuceKV2@B%B[!t!?ti/V2@Bgf%B[at!`i8;V2@C  %B[t!a"Կikw.U2@CLPb%B[t!BNt i&XlU2@C[%B\!t!`2\,iԫHJT2@C%B\at!WIl8i$Sb~T2@D %B\t!" DiJS2@DLv%B\t!"PiBpS2@D%B]!t!]r \i R2@Dxc%B]at!3hibq BR2@E  %B]t!"}ti8`HQ2@EL\-%B]t!"ЀiP2@E%B^!t!b(iMTi0 N2@FL A^4!"?0D@_%4!z\ $d[}Af#l EL-D@_et!Ǡɥ*0$d[}Af EL:n'D@_t!݇+D@`t!B\\?q 4$d) EL7'D@`t!nDQAnd.K Xf ELv'D@at!Ƕ.K Xp" EL'D@at!u^.K Xp" EL(Z)D@b%t!Űx!A&M@$bf ELg'D@bet!4~O:Dj@eet!XT\!3|@ TP :Dj@et!ӁoGe,DT!?W`{  )D@et!RnjTYqͅ+b/\Hu0)D@f%t!С$eYqͅ+b/\Hr^)D@fet!RnjT ͔ w b/\H)D@ft!С$e ͔ w b/\Hx-D@ft!ۅ.9p]R6vߗ# ELW)D@g%t!ۢݮ]R6vߗ#f EL--D@get!ۢݮi&dHvߗ#흷 EL:Dj@gt!ҢeLyy 78@W`{ :Dj@gt!q`<Lyy <{Κ?1Uy+D@h%t!ݡ:G`"n6m[CVf EL-D@het!c#NhNH[CVf EL 7+D@ht!udN)|?LC1 EL+D@ht!Z (([CVf ELF+D@i%t!ݥ0ҹ6[CVf EL/-+D@iet![= xCIp/[CVf EL+D@it!߀0HC@VΩ[CVf ELы-D@it!DP8HAGu @2?LC1 ELN+D@j%t!1{7 Avm[CVf ELl+D@jet!Ʋ=J 1L^i[CVf ELI:Dj@jt!Ѣ/]mt/!j7Ьs<{Κ?6{|Oa:Dj@jt!D#mt/!z7Ьs5}n+@W`{ !-D@k%t!dҹkD?LC1 EL)D@ket!߅w]HkD?LCf EL !-D@kt!߅w]HxCH4?LC1 ELd-D@kt!A:=J Z0\?LCS1 EL+D@l%t!"n\8(?LC1 ELhi-D@let!`m`[LZC%S1 EL^-D@lt!eG";=LC>~OCm4!0R*cBQBQ2QaN&Bn!4!Q3T>x %Bnat!1K\4u@%Bnt!z}Umr@<%Bnt!vp]F>pA a%Bo!t!'OCA hmALz%Boat!Qr1kAH%Bot!񱓥)jhAs%Bot!vr)$ eB  %Bp!t!pl1(4LcBL%Bpat!|vZ90ի۝`B)%Bpt!@I8j%B^B%Bpt!ODLϔ%Brat!@VAh.MDK%Brt!|tZ}pY|JDQ@%Brt!Ӝx8THE ɓ%Bs!t! hEELP%Bsat!C֡=kpCE_%Bst!@%/I*Ŕ0>F ?'Bt!4!Q[fN=<FL G=Ata4!"?Ct4!0R*cBQBQ2Q캪&Bt4!@V `\ %Bu!t!c2`WmxFL CA{!4!"?$C{e4!0R*cBQBR2RJ/&B{4!2Q̫V  %B{t!ߤqyBL@^%B|!t!X@͊%B|at!R[N yA  %B|t! (M,AL:%B|t!CVa Y|̡AQ%B}!t!pl𔣴RYAF%B}at!AOMB %B}t!rk쒓#}BL %B}t!(gĉl qB@3%B~!t!+͂ȉ{eBx%B~at!%ЉKg YC %B~t!{G؉&&MCL~%B~t!C֡_ј[AC%B!t!ћy}Dr5CI%Bat!1K\K/o*D O%Bt!gDL&%Bt!0LO N7JD%B!t!;9"Dg%Bat!GA0sE (%Bt!q1(8"EL%Bt!QX408E%B!t!D>0@E۝%Bat!;ULF 'B4!@V `\FL A4!"?VH%4!@CG0ҥ&p Lc0d7{˚?j,<̧3 "?SHet!@CGyN'&p Lc0d7{˚?9cmH n?QD"?H3C4!0R*cBR BR#2R$&B4!@V `\S4 %B!t!;UL @fC%Bat!2KJ0@ R} @;e%Bt!QX4vPlx A "%Bt!DA(trs ALw%B!t!0LM0FDm Al%Bat!1Eo:ug A%Bt!y[ Hcb B Qr%Bt!~R!\ BL|%B!t!g/zV B;%Bat!V33Q Bm%Bt!=_ g6#[K C d%Bt!q믱G؉xtuE CL%B!t!=Љ>B? C{%Bat!S\eȉ g69 C%Bt!04gĉ23 D %Bt!ӜT v- DL"%B!t!AOa' Df4%Bat!pl𔣴@E! D`%Bt!CVa R" E  %Bt! ( ELS%B!t!R[N v E%Bat!(3 E߂%Bt!ߤ.w>wb F 'B4!2Q̫ hPFL JtA!4!"?Ce4!0R*cBR&BR>2R?&B4!Q3er %Bt!6"y @`%B!t!4 @ %Bat!ް܍xԋ A %Bt!#ƙԍ ALP%Bt!CVcЍNF A%B!t!qkn ȍ0e Aw%Bat!_L,v B %Bt!+ q BLA%Bt!^O B%B!t!CV`V. B0%Bat!1Ѡ ( C Y%Bt!cfiҬo CL3%Bt!8d qƛ C#4%B!t!ћ0ro C%Bat!CV`Lbc D s%Bt!  &s< DLQ)%Bt!E@ b D%B!t!GH|,&, D}%Bat!cx>Bd E ͫ%Bt!2KJpZ0 EL%Bt!qqqU`lzEǍ E%B!t!r-wdb EX%Bat!c2`:}( F 'B4!@V `\S4 FL sA4!"?C%4!0R*cBRABRY2RZ}&Ba4!Q[fNdj c%Bt! &ŔvP @%Bt!rq^Jj @_%B!t!sln== A , %Bat!@V j AL]%Bt!ٹx&s< A8%Bt!^}pz@ A`%B!t!&̃Ehz B $%Bat! dBd AO%Bat!CBLm,&, Ab%Bt!9 C@mb B %Bt!a@4m&s< BL%B!t!'4(mbc B%Bat!]mLl B%Bt!C6m$ƛ C %Bt!mo CLX%B!t!ZeGi( CB%Bat!פ_iV. C9k%Bt!NSiO D N%Bt!ain DLG%B!t!Ni,v D%Bat!bCinN_ Dx%Bt!%iNF E  %Bt!doߘi EL%B!t!NiR,΋ E%Bat!c#;|i4 EI %Bt!#y.Qpi"y F 'B4!K_`ier FL 2A!4!"?ߺCe4!0R*cBRBR2R&B4!& m hP *>%Bt!!hom.w>wb @n%B!t!# m(3 @%%Bat!#Mmv A %Bt!aiemZ  AL8%Bt!զUm<" A%B!t!`m g6E! Al5%Bat!4 @mta' B .%Bt!4=m$v- BL%Bt!C7VmL 3 Bo%B!t!aʹm49 By %Bat!b{ݤm@? C %Bt! tpјm auE CLq%Bt!Tdmv[K Ct[%B!t!>atm*u&3Q Cͽ%Bat! }dm^V D ;%Bt!SPm\ DL%Bt!%m qD %Bt!Zf=m#S#}DL%B!t!$m%MDJ%Bat!.~mKgLD%Bt!cUm'U0̡E %Bt!aiemߟELn%B!t!#MmyE7'%Bat!# mXE%Bt!!homqyBLF ~Y'B4!& mVFL @ A!4!"?Ce4!0R*cBRBR2R&B4!K_`iT>x >%Bt!#y.Qpi"{{@%B!t!c#;|ies~@a%Bat!NiA Y%Bt!#0Sߘi5)AL<%Bt!%i/Y2A/%B!t!bCi A=%Bat!Niu{#B +%Bt!aiHTFBLA%Bt!dSirB%B!t!c_ibB %Bat!ZeGixC %Bt!m42CL%Bt!C6mHC%B!t!]m4 C%Bat!'4(mE(ID fw%Bt!a@4mFsDL %Bt!9 C@m4D%B!t!CBLmu{qD9%Bat!E@XmOi:GE %Bt!"xdm^ELP%Bt!bpm4E%B!t!c<|xmM,0E%Bat!G^$mWm@s%Bt!@^,iI*JA%B!t!a$ti MB %Bat!`#{BiY|.OBLq%Bt!Yei:QB+%Bt!aic~bTBv)%B!t!:iݯݞVC %Bat!)|ni6IYCLO%Bt!`|i,[CM%Bt!#y.оikp?^C^%B!t!IFiTZ`D @%Bat!cAXidbJcDL%Bt!>i$|eDH%Bt!F]iihDZX%B!t!c8Vi hkE Z%Bat!B,imEL{%Bt!A 8i ;>pEj%Bt!"xcHi";rEj%B!t!NFTi%'uF g'Ba4!K_`iT>xFL  A4!"?,D@4!$pA*dP;ov `f#l EL@)D@%t!$pA*a5ӽFX׌`f EL)D@et!ǦZ,?(?>,`f ELհ)D@t!ǦZ.2)|=Ħ f EL)D@t!cZa5ÿr}_-`f ELp6)D@%t!cZõ/ov `f EL)D@et!ǦZS-> f EL? )D@t!ǦZt+9T!`f ELz:Dj@t!p-q?$! -DT!?=)2P Q:Dj@%t!Ҁq](]?َ !3|@]#`P +D@et!cZy~:a5o EL :Dj@¥t!Ҁq](]޶?$!|& ? Q>~OfB+D@t!$pA*f >Пa5o ELb:Dj@%t!p-q?َnS2@4L6D 8]'D@et!$pA*&OFAMp[ ELui'D@åt!$pA*)aȕ˘ EL(+'D@t!cZl7HAg%_-f EL)D@%t!cZ?l+ `f EL'D@et!Z!*,{l7HAf EL)D@ĥt!cZ@8h.l7HAf EL.)D@t!9PV,)f EL'D@%t!$pA* 8A)f EL'D@et!DkEI푳 Af ELf EL/D@ƥt!Ǩ*"ܞH&yzל%'x? `f ELV:Dj@t!Ѣ/](y z7Ьsj1鴦@ TP %:Dj@%t!D#(y]z7Ьs$+(W @QP q)D@et!$pA*&OFA 4&`f EL)D@ǥt!$pA*P/ƽFX׌`f EL6^)D@t!$pA*dP; 4&`f EL)D@%t!$pA*P/˘Ȋ`f EL-D@et!$pA*לFauFA' EL-D@ȥt!$pA*לFSd7 )9L(R EL"2DZ@t!Q0L=Kq z7ЫsS@@)D@%t!pA*,Ҕ=S3`f ELA?2DZ@et!Q0?E{z7Ыs*!B)D@ɥt!pA*,Ҕ=T+cŋf EL,7)D@t!pA*BNf +T+cŋf EL-D@%t!܀;=7D@-C2Cf EL-D@et!܀;=q $2@-C2Cf EL-D@ʥt!ЕFq $2X-C2Cf ELiF+D@t!ЕF%X-C1f EL-D@%t!k{"7D-C2Cf EL+D@et!"FY9LCS1 EL-D@˥t!_A"FYs+C%S1 EL-D@t!A/^ZAs+C% 1 EL:Dj@%t!ѢLŀ4eޛ^!A^6 @8SԃP k :Dj@et!pd>ߛ^!!^~> @MW`{ K)D@̥t!݀ZC R>FL_f ELd)D@t!‚%j8! Ay@Oڳrf EL1D@%t!܄2`(BOڳrѓ#f EL/D@et!‚%j8ROڳrѓ#f ELP:Dj@ͥt!ӰT|[DI/^-DT! @e j2DZ@t!6yI/^`a@eP)D@%t!݀ZC FL__Af EL)D@et!3hOyHFL__Af EL)D@Υt!aŒm.PB Mf EL)D@t!!eQ 1MǶE >`uLvMf EL-D@%t!7d6q`uLvM8$C EL-D@et!!eQ Pm.`uLvM8$C ELJ2DZ@ϥt!Ѣ{C\yE~1("^=Jfs}::Dj@t!ғE~1("^ض$@ Q>BP )D@%t!aŒ Mm"`f EL7)D@et!%NA  Mm"`f EL;)D@Хt!pA**j)ә f EL\&C4!0R*cBSDBS\2S](&B!4!1zE8wM T%Bat!|}@@A%Bѡt!bqD]6"@%Bt! L%mA %B!t!5}PL-AL߉%Bat!6zTVA%Bҡt!uXoADC%Bt!L\`1ކB r%B!t!B_ed~BLA%Bat!F}hsTB7%Bӡt! uUliB1%Bt!Pb7lF C %B!t!SfIp%|aaCLe%Bat!:et=gC%Bԡt!SExE>Cd%Bt!x1ND t%B!t!6M|7\DL%Bat!1y4De%Bաt!rv)i!%D+%Bt!A ljE %B!t!uYEL%Bat!Lф9EO %B֡t!СAфa4E%Bt!rix7' xF C'B!4!5?7nFL  Aa4!"?dv,D@ץ4!ܠ?;2?)u^ f#l ELMC4!0R*cBS`BSx2Sy H&B!4!1zE8^ bA H%Bat!|}@#ʮG@A%Bءt!bqD~UM@mD%Bt! L1Xb TA %B!t!5}PZAL1%Bat!6zT =R`A E%B١t!uX:"fA"%Bt!L\`u{kB a%B!t!B_edqBL:%Bat!F}h#wB%Bڡt! uUlaxK}Bd%Bt!Pb7lSҼYC %B!t!SfIpw CL%Bat!:etܹCCO%Bۡt!SEx%ړC%Bt!xc|jD %B!t!6M|]DLD%Bat!1y1|zD3%Bܡt!rv)iPD%Bt! nzE ie%B!t!u}ELs%Bat!LфmIrEm%Bݡt!СAфq/T&Et%Bt!rixce!jF 'B!4!5jFL =lAa4!"?y*D@ޥ4!ܠ?;2Km8+soIf#l EL)C4!0R*cBS|BS2Sb&B!4!5C l ve%Bat!rixMo @%Bߡt!СAф^$ @f%Bt!LфgA %B!t!u;ALm`%Bat!CA%Bt!rv)ic3A%Bt!1yӯtyB m %B!t!6M|S BL%Bat!xSߕ B+i%Bt!SExF 'B!4!1zE8^ bAFL pAa4!"?"C4!0R*cBSBS2S&B4!1zE83 %B!t!8,G@M$%Bat!0] <# @ c%Bt!1e<%|A I%Bt!O<RAL!%B!t!|-%@W€YA@%Bat!ze@A@c%Bt!SO@88B h%Bt!qqDBLb%B!t!юIDFBR%Bat!"LD%BB=%Bt!3HQZ C %Bt! Hssm CL%B!t!0ZEHoA CwV%Bat!pm}L rQ C%Bt!LFC D %Bt!|-.L) Z7 DL^i%B!t!M PŪ D:%Bat! wY5P/bט D%Bt!Pav]Pƒ E y%Bt!S\GPB EL=%B!t!0[ȝT}7#|EB %Bat!1 Twg9/ER%Bt!Rf!TfF uI'B4!~T \{FL WA!4!"?>2*D@e4!ܠ?;2-!׉f#l ELC4!0R*cBSBS2S&B4!5r 'M%B!t!rix \@%Bat!СAф @%Bt!LфGA %Bt!uqTAL%B!t!ᗁA%Bat!rv)ipyA9%Bt!1y_<*B G%Bt!6M|7ABL1|%B!t!xŠ$B%Bat!SExBB%Bt!:etGC %Bt!SfIp]j:[CL%B!t!Pb7l1 ЭCHH%Bat! uUl 2Ck%Bt!F}hncD yO%Bt!B_edCDLU%B!t!L\`S4Dm%Bat!uXQ }jD,9%Bt!6zT &E 7%Bt!5}P#; HEL+C%B!t! L= E%Bat!bqDZW E%Bt!|}@MF 4a'B4!1zE83FL WA!4!"?Ce4!0R*cBSBS2S`(&B4!1zE8۪g %Bt!|}@}#2k@ %B!t!bqDm2n@F%Bat! L'durA %Bt!5}Pk5vALy%Bt!6zTlyA<%B!t!uX=c }Aw%Bat!L\`,~B V%Bt!B_ed,rBL_%Bt!F}h~OBlQ%B!t! uUlZB[%Bat!Pb7l>EC %Bt!SfIpFWCLS%Bt!:etsVF8C(%B!t!SExJC=|%Bat!xϔ0D |%Bt!6M|\qDL+%Bt!1y/4ꯡD(%B!t!rv)iDu%Bat!%E Z%Bt!utG^ELTv%Bt!LфGZEG%B!t!СAфycNαE%Bat!rixF ?'B4!5@FL A4!"?,D@%4!ܠ?;20:u+̒ \ `f#l ELCe4!0R*cBSBT2T3&B4!5C1  %Bt!rixix@3%B!t!СAф@U%Bat!LфȁAoA %Bt!uM8AL%Bt!E47gAj%B!t!rv)im2A!%Bat!1y#z{gB A%Bt!6M|n BL%Bt!x7wBf%B!t!SExB%Bat!:etG۬!C x%Bt!SfIp#M> CL"%Bt!Pb7lzd%C0%B!t! uUlKja0+C%Bat!F}hXCS1D L%Bt!B_edY7DL̈%Bt!L\`)<D<%B!t!uXxsBDg%Bat!6zT[4HE f%Bt!5}P߾qNEL%Bt! LkTEH%B!t!bqDUHZEv$%Bat!|}@S3aF 'B4!1zE8۪gFL ]!A4!"?R0D@%4!ܠ?;2X c?)&f#l EL/D@et!ܠ?;2X bJ^$-k'D@et!pA*yS){㐪f ELGC4!0R*cBTBT'2T( &B4!1zE8}+F %B!t!;#58WN @}y%Bat!)<x@%Bt!u<-A Ǫ%Bt!&<-rqALz%B!t!rv)2<31A%Bat!2 <A8SAh%Bt!'\@WFB !K%Bt!œ?@}4BLd%B!t!M @UӤB*.%Bat!3Vu@#Bz%Bt!S%Bt!:et[E}Cd%Bt!SExCv%B!t!x(j5D 2%Bat!6M|KN+ DL%Bt!1yWqLUD[%Bt!rv)iDg%B!t!7E %Bat!uSs!EL%Bt!Lф[S$E!j%Bt!СAфr 9(E%B!t!rix+F 'Ba4!5?0FL 0A4!"?y*D@4!ܠ?;2[=|n #l ELC %4!0R*cBTBT2Tz&B a4!1zE8QMò1 %B t!|}@{7@=%B t!bqD]ܾ#>@Z%B!!t! LW>DA %B!at!5}P?WGJALx%B!t!6zTY?PA%B!t!uX&VAI%B"!t!L\`\B X%B"at!B_edj+daBLq%B"t!F}h}gBb?%B"t! uUlZ=mB{%B#!t!Pb7l ^rC l%B#at!SfIp'HxCLk%B#t!:etGkU~CY@%B#t!SExɨCb%B$!t!x+:\0D %B$at!6M|"DL3%B$t!1ys/Dr%B$t!rv)i\Dj%B%!t!°E d%B%at!uCՑEL/%B%t!LфBEn%B%t!СAф[2wEN!%B&!t!rixwZʉF ,'B&a4!5_FL A&4!"?%,D@&4!ܠ?;2&Rc=$үf#l EL8KC'%4!0R*cBTBT2T&B'a4!58$61 ź%B't!rix?v5@K%B't!СAфM9@e%B(!t!Lфy-as<A %B(at!u"?ALR%B(t!C A ?%B(t!rv)iG#MH A%B)!t!1y{NhM B %B)at!6M|q+'UBL%B)t!xJ^B(%B)t!SEx%;iB|%B*!t!:etwzvC 9 %B*at!SfIp?PCL%B*t!Pb7lgC\%B*t! uUlm5&2C%B+!t!F}h[D 5>%B+at!B_edDL%B+t!L\`"D%B+t!uX㸧4:$D/n%B,!t!6zTh&E %B,at!5}P3Yr(ELq %B,t! LJ*E0%B,t!bqD5#-E%B-!t!|}@u{b/F  'B-a4!1zE8QMò1FL ͖A-4!"?? C-4!0R*cBTBT2Tц&B.!4!1zE8e+ D%B.at!|}@0, @t%B.t!bqD4m. @2%B.t! L50 A M%B/!t!5}P 2 ALd%B/at!6zT\ל4 A%B/t!uX6~6 A%B/t!L\`"V8 B f%B0!t!B_ed^f~): BLQ%B0at!F}hB _; BW%B0t! uUlNQQ= B%B0t!Pb7ln[? C *u%B1!t!SfIppSA CL%B1at!:et>C C%B1t!SExLD C%B1t!xڔF D '%B2!t!6M|HQH DL%B2at!1yә) J D%B2t!rv)iµK DM%B2t!tx~M E e%B3!t!u: 6O EL$%B3at!Lф.0P E%B3t!СAфCϥR E%B3t!rix]T F 'B4!4!5l V FL A4a4!"?,D@44!ܠ?;25Χ?Z +`f#l ELC44!0R*cBTBT2T&B5!4!5zS MJ%B5at!rix=@$%B5t!СAф[\<@/%B5t!LфA  u%B6!t!u!AL1%B6at!/塕A%O%B6t!rv)i\9 A%B6t!1y?틄B {%B7!t!6M|oBL5%B7at!x[3B6b%B7t!SEx!t!"TH88Ѓ B%B>at!&5iL s B"%B>t!sv3)L > C |m%B>t!ҦCP$ CLqP%B?!t! v^P80_ Co%B?at!IAT䖎 CY%B?t!A[T&n D ?{%B?t!S\ׁT[M DLl%B@!t!|,Xr D;%B@at!SXd2 DJ%B@t!{-\R5> E N%B@t!{\lF EL3%BA!t!:)\ek EZ%BAat!`B+>2 E %BAt!S^ `fQ~ F 'BA4!Ӝm`t}~ FL AB!4!"?*D@Be4!ܠ?;2RA /Ο#l EL{CB4!0R*cBU BU#2U$`}&BB4!5&f\ b%BC!t!rix֛] @Vp%BCat!СAфg_ @%BCt!Lф7a A %BCt!u,(?b AL%BD!t!5Jd Am%BDat!rv)i{v_f A̱%BDt!1y]h B %BDt!6M|( vi BL%BE!t!xEtݐk B{%BEat!SExFdOm B%BEt!:et~Sto C w%BEt!SfIpMFp CLBE%BF!t!Pb7lՉؗr C\%BFat! uUl[m`t Cx5%BFt!F}h$&c,v D  %BFt!B_ed4w DL8%BG!t!L\`Jy D%BGat!uXˀ{ D1%BGt!6zTܪ} E %BGt!5}P"ūe ELH%BH!t! LцL E@%BHat!bqD0ssU9 E%BHt!|}@;, F >'BH4!1zE8Q% FL AI!4!"?W0D@Ie4!ܠ?;2][={Dm#l EL-D@It!ܠ?;2]ܿ:~*A@?q0Tf ELP-D@It!q2z-J|KA*f EL)D@J%t!q2z-JME]=f ELi='D@Jet!?;2\Jt?)渵s ELЍ-D@Jt!q2z-J.ydb?ʻ^f EL<-D@Jt!q2z-JmrVAhܳ ELKe+D@K%t!?;2(jX$,Ag, ELR'D@Ket!ܠ?;2(*.a= ELCK4!0R*cBU/BUG2UHX&BK4!FP$ῑM" %BL!t!gDb O"@44%BLat!gZ8 ]P"@%BLt!8Q,=*R"A ^%BLt!3b H{`S"AL%BM!t!$!T"A%BMat!DغU"Ag%BMt!8P`W"B n%BMt!Sr=pX"BLխ%BN!t!q[$iC Y"B%BNat!`؍\Z"B&%BNt!bS̍r.Z"C %BNt!č+e`"ALe %BT!t!q}.Vz`"A%BTat!2bۦ,u _"A3%BTt!Sr$_"B %BTt!s@!`^"BLik%BU!t!X]"BY%BUat!"Cf϶Q]"B%BUt!M}ʜ_~\"C m%BUt! _"'["CL%BV!t! dvh.Z"C %BVat!q~\Z"C%BVt!S<iC Y"D %BVt!"X*jX"DL%BW!t!"XN|ZW"D<%BWat!Rrbt׺U"D/%BWt!Ҳ-jp!T"E Ic%BWt!2bbhD{`S"EL%BX!t!Fd =*R"E%BXat!s#\ ]P"Ej%BXt!s Xb O"F @'BX4!FP$ῑM"FL AY!4!"?CYe4!0R*cBUfBU~2U^&BY4!8sP$ῑM" q%BYt!Mb O"@%BZ!t!pb ]P"@%BZat!bx =*R"A %BZt!Rr wD{`S"AL|K%BZt!k!T"A%B[!t!2bs܉׺U"AB%B[at!bx؉ZW"B `%B[t!bxЉjX"BL%B[t!0Ex̉iC Y"Bo%B\!t!Hzĉ~\Z"B%B\at!8Qch.Z"C z<%B\t!¶3'["CLn%B\t!s"_~\"C%B]!t!-mo϶Q]"CM%B]at!2nרX]"D :%B]t!@uG!`^"DL[o%B]t!1]$_"D[%B^!t!Rr/,u _"Di%B^at!R}Vz`"E %B^t!0E{'+e`"EL~%B^t!"g N̴`"Ep%B_!t!1g#@`"E#J%B_at!M}|j&a"F X'B_4!Wx4{Ha"FL 4]A_4!"?@0D@`%4!ہ7z)2TDm Eo#l EL.C`e4!0R*cBUBU2Ue&B`4! ǽH{Ha" %B`t!Ӳ, |&a"@8%Ba!t!3R`"@%Baat!F`̴`"A _<%Bat!Ⱥ7Ĺ+e`"AL'%Bat!2FVz`"A%Bb!t!+iԍ%Bet!Qm4H{`S"EL%Bet!Ȼ4(=*R"E%Bf!t!Ӳ,x ]P"E%Bfat!Ӳ/ b O"F ]'Bf4!8sP$ῑM"FL /Af4!"?yCg%4!0R*cBUBU2U`{&Bga4!ѭxp$ῑM" %Bgt!7pb O"@%Bgt!7͋l\P"@=%Bh!t!(O_d=*R"A l%Bhat!#XG`"{`S"AL)%Bht!ҿ7;Xv!T"A8H%Bht!ECT׺U"Ag%Bi!t!(O[L<W"B %Biat!3bHLX"BL%Bit!@iC Y"B%Bit!2M<d\Z"Bf%Bj!t!'h38R.Z"C %Bjat!Qw0'["CLv%Bjt!Pm\,^~\"C%Bjt!2D?$϶Q]"C%Bk!t!0Iy X]"D %Bkat!񽷰!`^"DLu%Bkt!_~$_"D @%Bkt!"H u _"Df%Bl!t!qX{Vz`"E d%Blat!+e`"ELCf%Blt!DsH̴`"ENK%Blt!` :`"E%Bm!t!7nf&a"F K'Bma4!X2{Ha"FL UAm4!"?.D@m4!ڥVQvY Eo#l ELޭ+D@n%t!!KG@A Eo EL+Cne4!0R*cBUBU2Uӱ&Bn4!ǹd2{Ha" w%Bnt!ͼk`f&a"@)%Bo!t!ѷX:`"@˩%Boat!;qcTH̴`"A "%Bot!=L+e`"ALWG%Bot!ȹ6_HVz`"A`%Bp!t!Э/lD u _"A%Bpat!񽶳O<~$_"B G%Bpt!^8!`^"BLڶ%Bpt!S<34X]"BfW%Bq!t!Q̾,϶Q]"B@%Bqat!0g X(^~\"C %Bqt!#XW '["CLT%Bqt!2DR.Z"C%Br!t!$kd\Z"Cі%Brat!=+iC Y"D 3%Brt!)h[ NX"DL_%Brt!)j<W"D]Q%Bs!t!7p׺U"DK[%Bsat!pVv!T"E X(%Bst!Qw"{`S"EL4\%Bst!+jv=*R"E R%Bt!t!"J\P"E_%Btat!; b O"F o'Bt4!"X۶؉p$ῑM"FL qAt4!"?0D@u%4!ڥVQ + EH g#l ELb-D@uet!2 Qmx EH g EL<-D@ut!؃>(+)"E3C |f EL)D@ut!A )"E3C |f EL,+D@v%t!f._nYpA Eo EL+D@vet!`R6kE Eo ELy)D@vt!eƠ)"E3C |f EL<)D@vt!m)"E3C |f EL$'D@w%t!&T[*yފ`m Ef ELWCwe4!0R*cBUBU2U&Bw4!Dm$ῑM" _%Bwt!#/oi(mb O"@M%Bx!t!#/nim ]P"@2;%Bxat!Lm=*R"A  2%Bxt!@^tPmH{`S"AL0%Bxt!ஜ,m!T"A/%By!t!HmغU"AC%Byat!Lm`W"B %Byt!~0mpX"BL%Byt!äbhm$iC Y"B]%Bz!t!%kPm\Z"Bx%Bzat! Yi!`^"DL%B{t!$_"D(%B|!t!a<;i \i`̴`"E%B}!t!!+DiR`"E?J%B}at!#/m0i|&a"F ;'B}4!?iH{Ha"FL 9A}4!"?b0D@~%4!B\\q4I Eo#l ELzC~e4!0R*cBUBV2VEt&B~4!b5.Xm4{Ha" ١%B~t!&Lmj&a"@89%B!t!`n~@m@`"@7%Bat!`8mN̴`"A %Bt!,m+e`"ALr$%Bt! mVz`"Ai-%B!t!"Yrm,u _"A%Bat!~m$_"B z%Bt!m!`^"BL%Bt! سmX]"B%B!t!#MJm϶Q]"B>%Bat!4cEm_~\"C v%Bt!gm'["CLf%Bt!ǥ$mh.Z"C`s%B!t!छ)m~\Z"CÊ%Bat!եmiC Y"D %s%Bt!"Ij mjX"DL%Bt!"Ij MmZW"DN%B!t!byym׺U"Dj%Bat!b6m!T"E %Bt!"YrutmD{`S"EL%Bt!ഡAhm =*R"EɃ%B!t!\m ]P"E54%Bat!iPmb O"F &'B4!Dm$ῑM"FL ^A4!"?ZC%4!0R*cBVBV-2V.7d&Ba4!'>Ti$ῑM" C%Bt!4cib O"@%Bt!£(i ]P"@;%B!t!Ѐi =*R"A %Bat!bytiD{`S"AL%Bt!!3hi!T"A+%Bt!"Yr \i׺U"A%B!t!PiZW"B  %Bat! DijX"BLkQ%Bt!#WIl8iiC Y"B)%Bt!.\,i~\Z"B[%B!t!Nt ih.Z"C %Bat!"Կi'["CLH%Bt!i_~\"C`%Bt!c?ti϶Q]"Ca%B!t!@uceX]"D K%Bat!GF?e!`^"DL%Bt! Ts#e$_"Do%Bt!bye,u _"Df%B!t!>feVz`"E C%Bat!#WIe+e`"ELU%Bt!C2neN̴`"E2%Bt!`dye@`"E%B!t!4cej&a"F 'Ba4! Die4{Ha"FL dA4!"?j0D@4!F?(m2m Eo#l ELdaC%4!0R*cBV1BVI2VJz&Ba4!#2iH{Ha" o%Bt!ĵ"i|&a"@%Bt! ;iR`"@É%B!t! i`̴`"A %Bat!2tiĹ+e`"AL%Bt!#]L`iWz`"Aa%Bt!B.HiiY]"BzC%Bt!"Yp i϶Q]"Bi%B!t!.^ei_~\"C ~%Bat!Ixi'["CLl%Bt!!Hir.Z"CH%Bt!λ-i\Z"C-%B!t!2!i$iC Y"D և%Bat! TshipX"DLri%Bt!ǧ%qPi`W"D%Bt!'=8iغU"D/%B!t!$[ i!T"E N%Bat!`tiH{`S"EL%Bt!2Xi=*R"E3%Bt!Ĵi ]P"Ec%B!t!ķib O"F G'Ba4!'>Ti$ῑM"FL ˝A4!"?3C4!0R*cBVLBVd2Ve&B!4!`÷mp$ῑM" K%Bat! IKmb O"@^%Bt! Ixm\P"@e%Bt!a 5 Eo#l EL`+D@t!ƒ/Wi{+3A Eo ELC%4!0R*cBViBV2V &Ba4!(Ïhe2{Ha" |%Bt!8ć`ef&a"@[s%Bt!˹Te:`"@h%B!t!'>{HeH̴`"A %Bat!Qw%Bat! g;e!`^"BLa%Bt!areX]"BH%Bt!aye϶Q]"Bn%B!t!Bcu e^~\"C r%Bat! Nl^e'["CL%Bt!#]NeR.Z"C%Bt!"׭+ef\Z"C%B!t!QeiC Y"D /%Bat!B,feNX"DL_%Bt!B,e<W"Dz%Bt!8ڠe׺U"D %B!t! \ex!T"E %Bat!ֈe"{`S"EL@%Bt!B,|e=*R"Ea%Bt!"ͪ(Jpe\P"Ej%B!t!8`eb O"F 'Ba4!"Ih "Tep$ῑM"FL wA4!"?Ӂ0D@4!z\ɰ  EH g#l EL-D@%t!ǘɥ* EH g EL)D@et!$' )"E3C |f EL)D@t!z)"E3C |f EL#+D@t!؇ ,1A Eo EL+++D@%t!d[[ ǴqI Eo EL)D@et!G"L/i 56C140TC A 2PRQL/D63D A 2PRQxL/D71D A 2PRQvL0)D80D A 2PRQ!La DEFPOINTSÀ A 0PRQ&LVisible (ANSI)A 0PRQ)xMC)@0! """"\/.MR@i ACANSGDT`jffffg$ amgdt.shxC ?L=NC@0!!"I"J""""""""""""11NE AM_ISO02W050ĵ}|}|}|}|}|}|}|}|}|}|}|}|}|}|}|@A YNn@) AM_ISO08W050Ľ}}}|}}}|}}}|}}}|}}}|}}}|}}}|2@A  !hA0PPPPP=NKi AM_ISO09W050ĭ}}}}|}}}}|}}}}|}}}|}}}|6@A  !h +ShNC Amconstra}}}}}}}}}}}}}}}}}}}}}}|@A ! NL@AM_ISO08W050x2q}|}|}|}|}|}|"@A h迀A0PPPPPYwNa)AM_ISO02W050x2d||||||||||||@A |Ng Amzigzag`ppppppuq &@A P:؀RAl!(ehNd@)CENTER2Ľ ѕȀँ}}||}}||}}||}}||}}||}}|?A: hA0PPPPPNiHIDDEN2Ľ!ँ|||||||||||||||||?A0 }Ni Amzigzag2`pppppp 0*?A P:؀ shA/R!(eJNI ACANSTGB9}|}|qjZ?AT 12*K @hc,BP(T )2*KCbNw ACANSTGL)|||||Bx1&@CKMH IL *#ahh1&@$C̈H IL ,#a0&@dCLKH IL .#a1&@CMH IL 0#a0&@CLKH IL 2#aC0&@$CLH IL 4#aׂ0&@dCLK̈H IL6#aj0&@CLH IL8#a&&BHH IL:#am2&@$CKLK̈H IL<#a9u.&@dBȈH IL>#a1.&@B͈H IL@#au1&@CILH ILB#a% Jz$@@7FF&@!Ju@@&Ev&Vg&P(! 3dWireframeA\X'&vFV1  ConceptualA[@f6WGFW&FlatWithEdgesB\]YvW&VEvFVFvW011ѕɸ RealisticBX[FFwwwHvȄxywȄxHyHuȄvvHvyxx^e%v`4F%6fVD'&V7EfW'6` A\Xt@C33333>;@PA@tH \T!c j%x`4F%6fVD'&V7EfW'6` BPY[ 33333>;@PA@tH \!cm%y`4F%6fVD'&V7EfW'6` Cܐ[@ @33333>;@PB@tH \!c.s%w`4F%6fVD'&V7EfW'6` Bۘ\X[ 33333>;$ @PA@t H L!ch%xQ`4F%6fVD'&V7EfW'6` A[@ 33333>;@PA@tH g!cl%yQ`4F%6fVD'&V7EfW'6` CX\]\ 33333>;@PA@tH \!c7d%u`4F%6fVD'&V7EfW'6` AQ]$ @C33333>;@@PA@tH X!ck{p%v`4F%6fVD'&V7EfW'6` C]]Y\ @C33333>;@@P@T@tH \$!cmh%vQ`4F%6fVD'&V7EfW'6` B\]Y$ @C33333>;@@PA@tH \4!c~s%v`4F%6fVD'&V7EfW'6` DQ\]Y]Y\4 @C33333>;@@P@T@tH \D!cl%y`4F%6fVD'&V7EfW'6` C[\]\ 33333>;@PuA@tH:\!c=@i%x`4F%6fVD'&V7EfW'6` BX[\X 33333>;@PB@tH L!c9h%x`4F%6fVD'&V7EfW'6` BX[ 33333>;@P A@tH \!cj"S$ZJ@PFF?Jd@@444P9 51IMQe1 CTABLESTYLEBQSPTDU5D91%!Q%9U9%QL MSLTSCALEBTԕSFFHȄH0>^d10B0'>^$0/B0>^0B0 >^$0B0>b127.B0^(Jd@@67FDF7F'!'|dJ@@FF?0J@@FF?[S@$DWGPROPS COOKIE 100005554 ,=-=.=/=0=1=2=3=4=5=(>?)=BA*h̺BAZ@PFF?sLx@cR!;p`#$#cӔD3tR#cscS##dc'!HNt4$$DU$ts2#T EP ٨ա ʡ ؙ!֨-CD@@Q!;`pP9XMvE ֣q\R<:AD@@!;`pP9h]vE ֣q\Rxf6tI(ҌAD@@!;`p P9x]vC ֣q\RZ rwiQ(ED@@!;`p0P9]vC ֣q\Rz\*Y(geKSHQ!;`p@P9]u&fffffO$]?2O,9IU H%9<0RQ OSP!;`pP:H]u&fffffO ^>  v-0ROSPQ!;`qP:X]u&fffffO#JXT> vQ?0RVj@!;`qP]w3Qːէ?AT@e5EPENTER THE REDUCER STYLE0RQ fe@!;`q P]w3Q;k?A U4PENTER THE UNIT SIZE0RQ s@!;`q0P]w3Qlc?@@d52u#ENTER THE ASSEMBLY POSITION NUMBER0RQ p@Q!;`q@P]wCQ>SnT?A@T$$PENTER THE OUTPUT BORE DIAMETER0RQ RI@~@!;`qPP:]w3Q`mO?AS@0LACc@t!;`q`P:]vKM X>]?jhR51 QIH0RQ S@T!;`qpP:]uCQ~C)9o.p 0RQ ER@RQ!;`qP:]uCQ~C)9o.p   0RQ fX@^!;`qP:]uCQ~C)9o.p ( Q !0RQ tS@T!;`qP:]uCQ~C)9o.p "0RQ QS@T!;`qP;]uCQ~C)9o.p #0RQ Z@^Q!;`qP;Mvֽ3|`Z*``w?wyO  $0@RQ QAWk!4!_#'Lk@GENAXEHUR bZYj2+D@4!~p RAWa4!3_uMLw@`FW6v6VFW"FF `` CI ̌NN 0@`dTʄd@,D@a4!5pa'_n8`p ELm+D@t!5p3ᕱp>`x F EL0Y+D@t!~cB@Sr]g`x f EL+D@!t!~cB~jt!`.i`x EL+D@at!5!5*\j?>BA`#~x ELl+D@t!ئn 4{R%pJ six EL+D@t!5paG cW EL)+D@!t!~cBa'_ya~x! EL)D@t!ƀu]Ara~x! EL+D@!t!!BjE}SG_T" EL+D@at!{^I-j@~jt!x"& EL+D@t!ؤHXjE}SG_T_"F EL/ C4!0R*cB*xB*2* &B!4!1嵴0>C p%Bat!ٙ1Vw@%Bt!7f`$@W%Bt!ݰA %B!t!2Ss%PF◚AL%Bat!8U}."lA}%Bt!{ oka~x& ELm$+D@at!{^1:~jt!x&& ELL+D@t!X Vm/.H4DZ@t!X T ࿏uS Q>~OL+D@!t!)Y  lVLCώ~x& EL]}<Dj@at!X T࿏%S-DT!? Q>BP0ML+D@t!هtp_& ELA<Dj@t!` ṪS-DT! @4L6D0MT>+D@!t!ڰ)Y2 lVB.dx' ELqL4DZ@at!X TUS!3|@NLp+D@t!ش^ϔA:@`x'F EL!)D@t!޵32`Ja~x'f ELT)D@!t!daKi2|YHۮ~x' EL)D@at!ߐ2R)ۮ~x' ELs)D@t!ٱ1 ę2A}!5Pt!x' EL)D@t!ۆ|Wi21&lLC'Pt!x' EL+)D@!t!r}I2Pt!x( EL)D@at!A412~8s~jt!x(& EL)D@t!7cI1 "ۮ~x(F EL-+D@t!&x @ۮ~x(f EL)D@!t!@OɁ /a~x( EL))D@at!wp2_ a~jt!x( EL-+D@t!۲1ݗA,BPt!x( ELc)D@t!ݗebPt!x( ELG)D@!t!߰(\L#ePt!x) ELUHat!ҳNVf|D?9jLcdxZ&~tc?ۿD wXf "?BUHt!zaBܕD?9jLkPxZ&~tc?7؈ 6{ "?)MHt!hSx57z29jLc8lZ&~tc? 6˥ "?ؿMH!t!K*+ܕ57z9jLktZ&~tc? 'ۿDǢXf "?+D@at!EpL2 N~x) ELF+D@t!@Cw9:}f4A|L~jt!x) EL')D@t!'q1Ьa~x) ELD)D@!t![TLjI-~jt!x* EL#)D@at!!Ba2KH*& EL.%)D@t!!B@a zwRq*F EL>)D@t!ؤHX*J$H*f EL;+D@!t!ۢ$?HXY =_* EL-E+D@at!ۢ$?HX!t~#* ELw~+D@t!ۢ$?HXGMwu* EL_+D@t!ۢ$?HXMN$Qp#* EL)D@!t!ؤHX@a zw = + EL!MHat!ҹp1c`z?9jLklxZ&~tc?!P &| "?MHt!Rq`z!9jLc(xZ&~tc?P &| "?MHt!Rq`z?9jLclxZ&~tc?'3NQ "?|MH!t!ҹp1c`zA9jLk xZ&~tc?#Bi0pѴ "?+D@at!!B_RG_T+ EL +D@t!!BjE}SYԸ `q_+ EL]+D@t!ؤHXaQXrG_T_+ ELRq+D@!t!ؤHXjE}SYVu, EL^+D@at!!B_RqR,& EL+D@t!!B2KYT `q_,F ELU1D@t!!BEHRTJRA2KR@x,f EL1D@!t!!BEHRTJR2KR@qx, EL4DZ@at!w"-/?j7Ыsj!YL+D@t!J!XZ_# ٛs, EL+D@t!JV39y*p, ELZ4DZ@!t!w"P-/j7ЫsS@Z K+D@at!JAV-& EL C4!j0R*cB*B*2*襽&B4!{ ]MX,k3 L%B!t!R c2@%%Bat! jx\0@j%Bt!23 ^o,A =%Bt!.zp8N&AL>%B!t!QVXPN A$%Bat!:i$y<Aw%Bt!*V4FQRB c%Bt! nxZL@ &`BL %B!t!r#ߣN`05 B%Bat!RxP"MB%Bt!1<OC 9%Bt!X V`J CL%B!t!#č<OC%Bat!b+܍P"MC:%Bt!B oZ05 D T%Bt!/O 0 &`DL> %B!t!t3S FQRD[s%Bat!F4x<D%Bt!kYD@N E  %Bt!+d/Tp8N&ELk%B!t!)ߛ\^o,E%Bat!ï/dx\0Ef%Bt!bDl c2F 'B4!AR.[lX,k3FL A!4!"?,D@a4!l\@G`gkQ0#l ELN0+D@t!ނ \`Ylg&Y0 EL'+D@t!@ț@Mfg,[5_0 EL)D@!t!܅Fzx1 EL)D@at!l\&!sFz~x1& EL%<Dj@t!X Vqm}se$Ԉ4?0mCObwJ<Dj@t!X V^:YB C >?ڔb+D@!t!JX'wy}as_1 EL+D@at!JZ> 1 EL C4!0R*cB*B+ 2+ Z&&B4!s`”$g,wԿ r%B!t! 7lԿ@5J%Bat!0|տ@%Bt!:>{)kտA ð%Bt!!G@= fտALų%B!t!ydaֿA%Bat! ˽bORVֿA%%Bt!w(vyֿB %Bt!;⼥ii5ֿBL(%B!t!(:׿B %Bat!Mĥ~׿Bq|%Bt!˘:Rjȥ<׿C %Bt!|̥@$PؿCL%B!t!@TХD]bؿC%Bat!ʗХ@qؿCv%Bt!2fԥcUؿD "J%Bt!ygإ@<ٿDL"n%B!t!sbإwٿD%Bat!),ܥ@νٿD%Bt!Ȯܥ@2L~ڿE 6%Bt!= \\ڿELoR%B!t!w(NgڿE%Bat!KX2N.ڿE %B¡t!EC2ۿF 'B4!!GlzۿFL mA!4!"?KC.D@a4!۵CW5JTP=m5&#l EL& Cá4!0R*cB+B+'2+(]k&B4!}/ ^@N+;տ .%B!t!*R=k3տ@%Bat! #ܥ@+տ@D%Bġt!+PEܥ#տA M%Bt!7tܥ7"տAL%B!t!pJإ@SNWտAF%Bat!scRإptq տA"%Bšt!2ԥI6տB O%Bt! 7/ХԿBLr%B!t!+H^ХbԿB %Bat!kh#̥:ԿBc%Bơt!:ȥeԿC j%Bt!ѝ?hȥBQԿCLG%B!t!A9ĥԿC$|%Bat!zv@}xԿC %Bǡt!)v@9ԿD )%Bt!0H]ԿDLL%B!t!zmނ ԿDZ%Bat!JjPԇԿD%%Bȡt!pD7ԿE k%Bt!ѝ?y^@꫚ԿEL%B!t!p@r ԿE"%Bat!.~JnUԿE%Bɡt!J>@ָԿF ,'B4!s`”$g,wԿFL A!4!"?V!Ca4!0R*cB+*B+B2+C&Bʡ4!s`”Ὺ c%Bt! 7/6NAῪ@a%B!t!0| a⿪@;j%Bat!:>0C⿪A ̽%Bˡt!!Gcp⿪ALĞ%Bt!ydWoh⿪A %B!t! ˽`B⿪AѶ%Bat!w(vp⿪B %B̡t!;⼥㿪BL%Bt!*H9H㿪B߸%B!t!Mĥ`fCr㿪B#%Bat!˘:RjȥN㿪C %B͡t!|̥PVt㿪CLc`%Bt!@TХ`Z#㿪C%B!t!ʗХ43俪C,%Bat!2fԥſn@俪D p%BΡt!ygإSD i俪DLAg%Bt!sbإ@!俪D(%B!t!),ܥ}俪D%Bat!Ȯܥ :U.俪E h%Bϡt!=`ߕf 忪EL%Bt!w(NK2忪E@S%B!t!KX2N`и$Z忪EjM%Bat!E ٫u忪F 'BС4!!GHԆ<忪FL A4!"?sQ.D@!4!۵CW5J]o`U<#l EL Ca4!0R*cB+FB+^2+_0-&Bѡ4!!GdvUsܿ l%Bt!EO/=ܿ@ %B!t!KX2NHbIݿ@%Bat!w(Nd JݿA Z%Bҡt!=}ݿAL3%Bt!Ȯܥ@@CݿA3%B!t!),ܥ@X{ ޿At%Bat!sbإah޿B %Bӡt!ygإIٮ޿BL0%Bt!2fԥ9޿BI%B!t!ʗХ@A߿B%Bat!@TХ8.͊߿C 7%Bԡt!|̥ 0*߿CL%Bt!˘:Rjȥ@8h~࿪C!M%B!t!Mĥ`i!4࿪C %Bat!eY࿪D %Bաt!;⼥NgF࿪DLR]%Bt!w(v R࿪D%B!t! ˽࿪Dj%Bat!yd~࿪E f=%B֡t!!G ῪEL%Bt!:>MAῪE%B!t!0|@biῪEp%Bat! 7z1ῪF i'Bס4!s`”ῪFL <A4!"?x!C!4!0R*cB+aB+y2+z&Ba4!s`”dc4'꿪 %Bءt! 7 UG,꿪@%Bt!0|>̵I1꿪@%B!t!:>`0u;6꿪A %Bat!!G@;꿪AL^%B١t!ydY?꿪A%Bt! ˽9.վD꿪A%B!t!w(v1{I꿪B %Bat!;⼥#.N꿪BL%Bڡt!R꿪B)%Bt!MĥsW꿪B%B!t!˘:RjȥF1 \꿪C y%Bat!|̥|`꿪CLa%Bۡt!@TХP;e꿪CSh%Bt!ʗХ qi꿪C~%B!t!2fԥ ?n꿪D  %Bat!ygإй\r꿪DL%Bܡt!sbإw꿪D%Bt!),ܥs{r{꿪D%B!t!Ȯܥ ( 꿪E %Bat!=4\J꿪EL%Bݡt!w(N@sE꿪E%Bt!KX2N`꿪E%B!t!E^x꿪F 'Ba4!!G`BV꿪FL DAޡ4!"?d/D@4!۵CW5J;oh'z_@"#l EL!C!4!0R*cB+}B+2+:&Ba4!!G { 7濪 ^%Bߡt!E{=M_濪@G%Bt!KX2N@0݁濪@o%B!t!w(N keg濪A %Bat!=`uS$濪ALA%Bt!Ȯܥ翪Ab%Bt!),ܥʄa(翪A%B!t!sbإ`3M^P翪B Q3%Bat!ygإc:y翪BL%Bt!2fԥ):١翪BOp%Bt!ʗХ ΢翪BNA%B!t!@TХ\-ў翪C V%Bat!|̥\迪CLA%Bt!˘:Rjȥ NHF迪C %Bt!Mĥp迪CQ%B!t! *1迪D  %Bat!;⼥sK4o迪DLw%Bt!w(v ,迪DI%Bt! ˽ FO鿪D`%B!t!ydPE鿪E |%Bat!!G`WXq鿪ELv[%Bt!:>4hf鿪En%Bt!0|`>o鿪E:%B!t! 7$鿪F zA'Ba4!s`”dc4'꿪FL ĽA4!"??-D@4!۵CW5JA,K/TM.x@&f#l EL~!C!4!40R*cB+B+2+&Ba4!!GS@Q꿪 a%Bt!EI'꿪@%Bt!KX2N (꿪@%B!t!w(N꿪A /%Bat!=TC꿪AL%Bt!Ȯܥ@ig꿪A~%Bt!),ܥ4$Կ꿪Af%B!t!sbإ@ȢC꿪B  %Bat!ygإV꿪BLIk%Bt!2fԥ%,꿪BB%Bt!ʗХ$k꿪Bg%B!t!@TХ J'꿪C 4%Bat!|̥`{h꿪CLۦ%Bt!˘:RjȥCn<꿪CY%Bt!Mĥх꿪C%B!t! p꿪D ^ %Bat!;⼥꿪DL%Bt!w(vdUM꿪D%Bt! ˽`\T꿪D8%B!t!yd@<҃P꿪E %Bat!!G(&뿪ELS%Bt!:>eoO 뿪E6%Bt!0|J 뿪E%B!t! 7oq뿪F }'Ba4!s`”1.뿪FL A4!"?"R3D@4!۵CW5JpDTx@)#l EL0D@!t!۵CW5JpDA4̽S$Pd5@* EL`*D@at!ݷP1))Jj@y~]")~x@*& EL?*D@t!ݷP1))Jj@y~56~x@*F ELt-,D@t!۵CW5Jj yW$腛_@*f EL.D@!t!ݷP1))Jj@y~X'w~>x@* ELk*D@at!ݷP1))Jj@y~hO~x@* EL*D@t!۵CW5Ja+(Ґo9x@* EL/,D@t!۵CW5JEC[*9_@* EL *D@!t!խCW5J&?x@+ EL!Ca4!Y0R*cB+B+2+וo&B4!ȶv@0UG? %Bt!0`=?@v%B!t!~G24?@%Bat! :ܥd*?A  %Bt!AVܥ)o !?AL%Bt!ܥp?Am%B!t!KR2إh ?AQ%Bat!2إ:Q+?B =%Bt!ԥq|?BLG%Bt!^Х̩?BB%B!t!ZlХV?B%Bat!AW̥Ru1?C aN%Bt!Pَȥ[Q?CL%Bt!qg"Snĥ\d?CC%B!t!@CQe?CN%Bat!6@[ U?D +X%Bt!qv?A /%Bt!!GBobK?ALڂ%Bt!yd@&<0!?Ad%B!t! ˽]4?A%Bat!w(v'!>6?B %Bt!;⼥ ϣ?BLp%Bt! rz?B5%B!t!Mĥk> R?B%Bat!˘:Rjȥ)y)?C %Bt!|̥8v?CL%Bt!@TХ`z4?C%B !t!ʗХڱ?C]%B at!2fԥ`_X?D %B t!ygإ@pzb?DLrQ%B t!sbإм;?D+%B !t!),ܥdP?D%B at!ȮܥvVW?E g%B t!=&l?ELe(%B t!w(N@VYđ??E%B !t!KX2No%S?E%B at!E@գ?F 5X'B 4!!G@uU?FL aRA 4!"?V/D@ !4!۵CW5JA/WI5 Il@9#l EL$!C a4!0R*cB,2B,J2,K[&B 4!!G ? H%B t!E1?@:%B !t!KX2NȄZ?@*d%B at!w(NS4?A 7f%B t!=G_?AL%B t!ȮܥQR*?A"%B!t!),ܥ^B?A%%Bat!sbإP?B %Bt!ygإ Vy?BL&%Bt!2fԥmֱS?BX%B!t!ʗХ@J-?B %Bat!@TХ )?C .%Bt!|̥ C֒5?CL%Bt!˘:Rjȥ*?C %B!t!Mĥٓ?CQS%Bat!=1l?D ܲ%Bt!;⼥ :ZE?DL$%Bt!w(v{?D2i%B!t! ˽@?Dm%Bat!yd Ѳ?E >v%Bt!!G ?EL%Bt!:>y"z?E%B!t!0| 0P?E%Bat! 7`"{e&?F O'B4!s`”t?FL AA4!"?u"C!4!0R*cB,MB,e2,f&Ba4!s`”+u? q0%Bt! 7@ ^?@<%Bt!0|[7՞?@%B!t!:>\$fX?A %Bat!!G@TV?AL%Bt!yd@|?Aw%Bt! ˽^?A%B!t!w(vBLxō?B %Bat!;⼥"rv?BLq%Bt!ʈ,?BH%Bt!MĥtR7?Bo%B!t!˘:Rjȥd?C +[%Bat!|̥70y}?CLx!%Bt!@TХ&Iz?C%Bt!ʗХ@|w?Cr%B!t!2fԥ,s?D Gh%Bat!ygإksp?DL%Bt!sbإ@Rm?Dn%Bt!),ܥ/j?D%B!t!Ȯܥ@ jg?E ky%Bat!=F|Md?EL,%Bt!w(NZ#1a?E;%Bt!KX2N@O^?E4%B!t!EZ{Z?F 3'Ba4!!GʙW?FL  HA4!"?ng/D@4!۵CW5J[~(c,@@f#l EL!C!4!0R*cB,iB,2,l&Ba4!!G%F? ^s%Bt!E_?@%Bt!KX2N 1!?@m%B!t!w(NؿH]?A s%Bat!=@m?ALJ%Bt!Ȯܥ?A%Bt!),ܥ@{Kys?Ac%B!t!sbإ G%?B s%Bat!ygإc=-?BLɷ%Bt!2fԥ)?B%Bt!ʗХ@\^$9?B%B!t!@TХO?C %Bat!|̥@ޯ?CL%Bt!˘:RjȥdޑI?C%Bt!Mĥ@m)?Cy%B!t!`7R?D ~%Bat!;⼥:U?DL%Bt!w(vn?D%Bt! ˽ݮ?D"%B!t!ydxZ?E Y7%Bat!!GS1?EL%s%Bt!:>lV?EF.%Bt!0|{=W?E%B !t! 7xi?F 'B a4!s`”+u?FL )BA 4!"?2^"C 4!0R*cB,B,2,&B!!4!s`”{Zj? `%B!at! 7=zx?@g%B!t!0| b{?@%B!t!:>?4Q?A %B"!t!!G@v'?ALO%B"at!ydD?A J%B"t! ˽@\`?AFx%B"t!w(vd&C?B %B#!t!;⼥ '?BL%B#at!kd_?B%B#t!Mĥ8?BI%B#t!˘:Rjȥ`5?C %B$!t!|̥ˀ?CL%B$at!@TХ 7X?Cp^%B$t!ʗХ8R;?CF%B$t!2fԥaNx?D H%B%!t!ygإ ER?DL%B%at!sbإś ,?D!%B%t!),ܥ+CZ?D,%B%t!ȮܥO?E c%B&!t!=ͤM?EL)%B&at!w(NǪ?EL%B&t!KX2Nَq?E%B&t!E#0_L?F h'B'!4!!GX&?FL A'a4!"?:X/D@'4!۵CW5J@Zy~S?s@GF#l ELǧ!C'4!;0R*cB,B,2,&B(!4!!G`U]? %B(at!E[ ?@5%B(t!KX2N {?@%B(t!w(No ?A ^%B)!t!=`Ko?AL,%B)at!Ȯܥ'?AH%B)t!),ܥ`!?E.%B-t!0| ?E]%B-t! 74?F lb'B.!4!s`”{Zj?FL A.a4!"?'"C.4!V0R*cB,B,2,y&B.4!!GM? D%B/!t!E8I?@[%B/at!KX2N@AF?@;%B/t!w(NKҪC?A No%B/t!=L@?AL5%B0!t!Ȯܥo=?A%B0at!),ܥcwP:?A-)%B0t!sbإ>07?B %B0t!ygإ24?BLY%B1!t!2fԥf|0?BO%B1at!ʗХR-?Bt%B1t!@TХ~*?C %B1t!|̥@ daa'?CLz%B2!t!˘:Rjȥ֮,*$?C%B2at!Mĥ@S ?Cۯ%B2t!?D k%B2t!;⼥pd?DL=%B3!t!w(vPO?Dϸ%B3at! ˽@Ӿ2?D%B3t!yd]?E %B3t!!G2OR ?EL;%B4!t!:>5w+ ?E+%B4at!0|@?Z?Es%B4t! 7|?F Y'B44!s`”p?FL {gA5!4!"?-D@5a4!ݷP1))Jj@y~^)xա~x@N&#l EL$F*D@5t!ݷP1))Jj@y~A~x@NF ELN,D@5t!۵CW5J@#MKRs@Nf EL:*D@6!t!۵CW5Jw&,|x@N ELj{*D@6at!ݷP1))Jj@y~kK~x@N EL*D@6t!ݷP1))Jj@y~A~x@N ELZ[,D@6t!۵CW5J1%ߊ#@N EL!C7!4!x0R*cB,B,2,Jh&B7a4!s`”OKԿ /%B7t!2=!Կ@"S%B7t!}.Qrg%Կ@%B8!t!!RʔV*ԿA l&%B8at!3*"@E.ԿALO%B8t!c_Bz8B<3ԿAq%B8t!P"Ҕ>Z7ԿA%B9!t!r*;ԿB %B9at!3QB@ԿBL%B9t!ڝkڔ@g0YDԿBX%B9t! td2&HԿB%B:!t!B(;gLԿC х%B:at! ޘGNQԿCLq%B:t!}, 6 UԿC8g%B:t!!RpYԿC%B;!t!AW☥>">^ԿD %B;at!Ͳ6]bԿDLd%B;t!*"fԿDym%B;t!^☥@%kԿD<&%B!4!˘:z.ܥ!տ %B>at! w|ܥ^տ@ Q%B>t!L#Vإ@= տ@%B>t!:MUإYտA Q7%B?!t!@ԥufԿALU%B?at!kh#ԥԿA`%B?t!:_Х}ĜԿAI%B?t!jХ(;*ԿB &%B@!t!V̥ԿBL%B@at!̥61!ԿBM %B@t!0.ȥ@0[ԿB%B@t!wGbĥ`ԿC G`%BA!t!Pnĥ/ԿCL޿%BAat!yV#tiԿCt%BAt!7 .)/ԿC%BAt!A6@aԿD %BB!t!Z][@5xԿDLV%BBat!#f@mԿD ,%BBt! 8 #kbԿDqo%BBt!c]{z(WԿE %BC!t!F&KԿEL%BCat!1栥ReX@ԿE%BCt!ۢ>Zl4ԿE%BCt!)q)ԿF a'BD!4!s`”OKԿFL FADa4!"?;"CD4!0R*cB-B-+2-,&BD4!ygܥ@?e꿪 G%BE!t!PҶܥؼ꿪@.^%BEat! 7VܥM꿪@%BEt!Dgإ`"E꿪A %BEt!}إ@꿪AL%%BF!t!}>إp2J꿪Al%BFat!:6ԥ *?꿪A)%BFt!x+ԥi꿪B %BFt![bɮХ`V}S꿪BL:%BG!t!;R.̥` Q꿪B%BGat!7~̥ Fs꿪B%BGt!w+ȥf 꿪C 8%BGt!PXbĥ\꿪CLA%BH!t!3v HL|꿪C~%BHat!AW7뿪C{%BHt!D W 뿪D %BHt!Y_8渥 j뿪DL%BI!t!kh#&뿪D%BIat!}.`BM뿪D%BIt!ag#`58"뿪E t%BIt!!P(VK*(뿪EL%BJ!t!O.뿪E%BJat!JWE4뿪EB%BJt!a*:뿪F ]T'BJ4!s`”C~:A뿪FL AK!4!"? 3D@Ka4!Jo,a<>@VwSP@Y&#l EL0D@Kt!Jo,a=Al֓eߐDp@YF EL .D@Kt!P1))JjHy~6Ҭ;~4x@Yf ELb*D@L!t!P1))JjHy~^ t~x@Y EL&2D@Lat!3 <2}10.%$Cy@Y ELi2D@Lt!a!@k1$q~M@Z& EL\0D@Mt! \iϬ, _ڐx@ZF EL#,D@Mt!X Vp= ?^ LH52D@N!t!t: qB^0{SD]!@Z ELʘ2D@Nat!EqB\]BNh#}@Z ELm0D@Nt!f`ĎB]Q|x 6$&Sx@Z EL2D@Nt!ߵ Q}B`1" ↵(@Z ELz*D@O!t!ߵ Q}Bq]p ↵~x@[ ELFvYx@\ EL2D@Rt!؄ћBz*CE/ ."?VFH@Sat![:>PS |S#ZF{FʐC!Κ?EO ."? *D@St!޷ u}B̮ʠx@]F EL *D@St!޷ u}B̮q Qx@]f ELX2D@T!t!%gΖPX3ˀvC *qKPJx@] EL *D@Tat!%gΖP$e .=vC *x@] ELA2D@Tt!.9`UIY)W*(J`x@] ELt*D@Tt!އx]!X3)W*(x@] EL2D@U!t!܂HavC *JUʶx@^ ELÃ2D@Uat!އx]!$e .=,AA*J`x@^& EL*D@Ut!.9`Ha,AA*x@^F ELFH@Ut!Ђu;! S5 #fF{FʐC!Κ?J5O /3"?FH@V!t!b#Ըu;! :#(X fF{DʐC!Κ?EO /C"? *D@Vat!4GũpU\Az1Ǡ^x@^ EL*D@Vt!4GũpU\AzX˻px@^ ELFH@Vt!`A4uE)I3Q4;fF{DʐC!Κ? $5O /s"?*D@W!t!0h V)L~*z~x@_ EL6*D@Wat!0hu]Ar&5?x@_& EL,D@Wt!X V H,D@Wt!X V H0,D@X!t!؁ :ᯥ,{~jt!x@_ ELc,D@Xat!@E8k~jt!x@_ ELˬ,D@Xt! C8ka~x@_ ELx,D@Xt!:ᯡ,{a~x@_ ELlO,D@Y!t!ڇUjE}SG_T@` ELt,D@Yat!UjE}SG_T_@`& ELF,D@Yt! C8ka~x@`F EL,D@Yt!a[ɪ@`f ELg,D@Z!t!v+t>`x@` ELe,D@Zat!؁ :ᯥ~jt!x@` EL,D@Zt!:ᯡ`a~x@` EL,D@Zt!ـ@E8k~jt!x@` EL,y,D@[!t!4Q?yP`?B ׯ%Bdat!J'cvM?BLN%Bdt!C3*D?B%Bdt!O'[jP?B%Be!t!P(!?C %Beat!U*ONh;?CL9%Bet! O'dЌ@!+U?C\%Bet!BP;r,n?C%Bf!t!P*ït?D C%Bfat!##LJx?DLn%Bft!c9p\(u?D=1%Bft!u:@D?Dy%Bg!t!o?E %Bgat!$E?EL%Bgt!DK`b& ?E%Bgt!#拳jVb!?ENT%Bh!t!B|84?F \'Bha4!!eb&G?FL Ah4!"?"Ch4!?0R*cB-B-2-C&Bi!4!!eb@AG󿪠 A%Biat!ccݭ5󿪰@-%Bit!E"˳c|!󿪰@37%Bit!GRD 󿪰A %Bj!t!0` Ea򿪰AL(%Bjat!d[Yon򿪰AY%Bjt!!i 8򿪰A1%Bjt!A*,M޵򿪰B [%Bk!t!Z셞򿪰BLM%Bkat!#Xk򿪰Bi%Bkt!|;<$Q/n򿪰Bj%Bkt!j,8U򿪰C %Bl!t!dMOn;򿪰CL%Blat!B/A>!򿪰C%Blt![tyP򿪰C<%Blt!bn0u@_o񿪰D Pg%Bm!t!z?g&%񿪰DL_%Bmat!CJz񿪰D$\%Bmt!CXk:t񿪰DO%Bmt!aDQN}񿪰E ]q%Bn!t!`@"kZt`񿪰EL 9%Bnat!~^`ƉC񿪰E%Bnt!sc o`&񿪰E_%Bnt!#T0W 񿪰F 'Bo!4!@U)?[:p𿪰FL Aoa4!"?"Co4!Z0R*cB-B-2-ؐ&Bo4!F.{ í%Bp!t!Ajx@%Bpat!W@u@,%Bpt!B3RmqA :%Bpt!jBZlAL{%Bq!t!@D _pѧYfA%Bqat!h \ml_A %Bqt!B9UNWB L%Bqt!yocNBLA%Br!t!P*Q 8EBb%Brat! ⳾ |}~:B!0%Brt! /V.C  %Brt!X`J"CL%Bs!t!@* N*C%Bsat! 2(CP%Bst!co(󿪰D %Bst!O'?x{󿪰DL%Bt!t! P* 2󿪰Dx%Btat!mD(S󿪰Dn%Btt!@0 &hsR󿪰E L%Btt!wck@Þ󿪰EL%Bu!t!E H3\mV󿪰Ei%Buat!"0> u󿪰ER%But!տV^󿪰F 'Bu4!!eb@AG󿪰FL Av!4!"?YHva4!Ӳʠ?L/Zd;m14ήtɜB7{˚? وu |l]/C 7S "?{mVHvt!ʠ?L-Zd;m1<tɜB7{˚? xDΤeaD 7c"?4!Cv4!w0R*cB-B-2-8&Bw!4!Aeb@AG󿪠 W%Bwat!@ տV^󿪰@*%Bwt!B0> u󿪰@h%Bwt!A H3\mV󿪰A H%Bx!t!wck@Þ󿪰AL B%Bxat!q&@AR󿪰A1%Bxt!l:@{ 󿪰A"3%Bxt! 2󿪰B %By!t!?x{󿪰BLd%Byat!A o_󿪰Bc%Byt!6nB,%Byt!@PHc*C b%Bz!t!u\`J"CL %Bzat!/.Ce%Bzt!泼$K~:Cڤ%Bzt!6NQ 8ED %B{!t!u9scNDL%B{at!|@#YNWDd%B{t!e0 \ml_D%B{t!a_pѧYfE '|%B|!t!~BZlELh%B|at!LTRmqE%B|t!W@uEv%B|t!jxF 9'B}!4!F.{FL _A}a4!"?"C}4!0R*cB-B.2.t&B}4!U)?[:p𿪠 %B~!t!~@$ 񿪰@Kj%B~at!Cšc`Le&񿪰@C%B~t!Ae i:C񿪰A Β%B~t!k5yg:`񿪰AL$A%B!t!`X<0sv}񿪰A%Bat!Cg&ƙ񿪰AJ%Bt!}>`ͥ񿪰B %Bt!wc kM񿪰BL{%B!t!*局񿪰BQ}%Bat!@M'[٫P򿪰BZ%Bt!, &!򿪰C %Bt!O` ;򿪰CL%B!t!B hV*U򿪰C5%Bat!h;*,n򿪰Cc%Bt!A @ï |}򿪰D M%Bt!CLJ`$򿪰DLw%B!t!{?p򿪰D%Bat!A2򿪰D!l%Bt!Bo` 򿪰E %Bt!BPE򿪰EL%B!t!0LK`Le& 󿪰EU%Bat!PVPb!󿪰E-%Bt!zV4󿪰F 'B4!Aeb@AG󿪰FL pA!4!"?"Ca4!0R*cB.B.*2.+&B4!Aeb&G? q%Bt!c5?@F%B!t!A"˳0:,|!?@n%Bat!GLD ?A -%Bt!B 0PJPa?AL9%Bt!`[Yo?A%B!t!Ai ?Af%Bat!A A*E޵?B %Bt!Cޅ?BLc%Bt!C~]?Bܷ%B!t!|;|8=/n?B%Bat!j`R8U?C VK%Bt!C%MOx6ܻ;?CL+%Bt!+A|8!?Cp%B!t!z^[<_P?Cx%Bat!bnPNQo?D ^%Bt!v?g 2%?DL%Bt!C`Vz?D%B!t!Xk@Ft?D(%Bat!@QpZ}?E %Bt!uk`P"t`?EL%Bt!CʼnC?E*%B!t!_תcz`&?E%Bat!Cb ?F 0'B4!U)?[9p?FL yA4!"?"C!4!0R*cB.-B.E2.F&Ba4!F&'{? Tm%Bt!jp\(x?@%Bt!W0>mu?@a%B!t!+mq?A %Bat!j T Zl?AL-N%Bt!< _˦Yf?A"E%Bt!h pYl_?A%B!t!1UpZW?B %Bat!qocN?BLR%Bt!P*Q PN1E?B[%Bt! ⳼`*v~:?B%B!t!@ /P.?C y%Bat!X`*"?CL %Bt!& @Z*?C~%Bt!@2'?Cq%B!t!Aco 4?D @%Bat!K'?rz?DL%Bt!@P* 4K?D %Bt!m3 "?AVH!t!ʠ?L/Zd;?m14tɜ@7{˚? xDΤeaD >C"?/!Ca4!0R*cB.JB.b2.cW&B4!!eb&G? qi%Bt!տ 0^?@d%B!t!" 2J u?@%Bat!E H3pYV?A %Bt!wckrÞ?ALl%Bt!q&l0YR?An%B!t!p:`R2?As@%Bat! h.8?B %Bt! ?&g?BLF%%Bt!E o 6?B%B!t!6N?B)%Bat! @n*?C /#%Bt!y\P^Є"?CL %Bt!/.?C`%B!t!泾\~:?C%Bat!A>NQ %E?D %Bt!u9sc RN?DLsj%Bt!@#Y(W?DEq%B!t!e0 pYl_?D%Bat!i_˦Yf?E (,%Bt!~ T Zl?EL%Bt!TTmq?E%B!t!W0>mu?E%Bat!Ajp\(x?F p7'B4!F&'{?FL A4!"?@Dj@!4!Q㧪@5"?_s$@ Q>BP0 0F=Dj@at!҃Q㧪@5"࿀-DT! @!`0L55DZ@t!Q㧨@5"࿀0V<>@ח5DZ@t!Q㧨@5"?pu!zOJ4D@!t!Wo0ݺg5.Ӟ5gg@ ELJ2D@at!~ϕg0ݺgA+gp\{'x@ EL?=Dj@t!BR@8? z7Ьs-DT! @=Oko0+=Dj@t!ӂ xBhz7Ьs6?6p0@0D@!t!ߡ:H`hVuʾ`bDx@ ELmd0D@at!rH`hVu/bDx@& EL0D@t!rH`Zu@/8>@F ELH0D@t!܁:H`Zu=ɠ8>@f ELr.D@!t!܁:H`Nu=ɠ]3H@ EL.D@at!@}?;e:஘qB;@K@ EL .D@t!}?#e;2ä/Z/x@ EL0D@t!}?#e:஘qZ//@ ELT2D@!t!E",%e;O|l1f@ ELAD4D@at!",p#e;O~BעE̠0@& ELS)=Dj@t!ҀNɢDxg ^t-8R@,J*Đ0:=Dj@t!ӠJɢDR?a^r?6 N@0,D@!t!a߉ !+Pfg~x@ ELb!Ca4!0R*cB.zB.2.&B4!@pX,k3 3%Bt!߆3}<p33@K%B!t!"A  c2@m-%Bat!`0˼`V+1A `I%Bt!x\0AL%Bt!<6xd>.A@%B!t!lH^o,A0%Bat!!)B %Bt!Ccp8N&BL%Bt!u@#B0`%B!t!w(PN Bv%Bat!A9[pl6C %Bt!#Ly<CL%Bt!u[,@LFmCK%B!t!<5 FQRCh%Bat!lR0HD <%Bt!#zB@ &`DL%Bt!8X, D+%B!t!h05 D]%Bat!oM~ E %Bt!*ƺP"MEL%%Bt!BxT*UE.%B!t!?p<OED%Bat!.l!BF ɼ'B4!߇0l`J FL )A4!"?$"C!4!00R*cB.B.2.E&Ba4!ԡr,E7)@%Bt!1ZEZ@%B!t!P~ EP(kA Q%Bat!B_zE "k AL%Bt!|9EFqXAVj%Bt!:eE`V3A[%B!t!ǬaqEB0B q%Bat!~ YE</BL%Bt! !Ep8NUB%Bt! QŔE:NB%B!t!~ EExME %Bt!0g EL-%B!t!R ."~EK%Bat!#P-ET%Bt!ݖ,CF u'B4!2qCKLSp{FL TA!4!"?3D@a4!ހNw>@#~qŶ@#l EL]!C4!n0R*cB.B.2. &B4!h$#`GSp{ %B!t!srȔG`@^%Bat!Z#vG@M%Bt!I+ GA s%Bt!^4dG{zGALm%B!t!r6G8jA%Bat!Q}GVѩA8%Bt!s7G &B }%Bt!>UG< +1BL%B!t! L,G蚞qGB%Bt!a}PGf50RC vB%Bt!N, E`Gq#\CL%B!t!d9kpGcqgCG%Bat!aGqCv %Bt!GCe|D %Bt!d;GEDL;%B!t!S G D%Bat!G&~ECD7%Bt!f:VG+hE >%Bt!{EG@zEL%B!t!~TG;{E_%Bat!rA' G@})[jEx%Bt!pG0y'GF x'B4!U,GMmFL yA!4!"?3D@a4!B>>LaF\`x@&#l EL30D@t!wXu*@Ae5 _@F EL;0D@t!wX@L@F\x@f EL1=Dj@!t!p ` )喺󿊁^"3|@ 0# =Dj@at! ` G!^_)O?>K>~O#L60D@t!O6sia9M~h@ ELP0D@t!">>simpE\x@ EL+!C!4!0R*cB.B/ 2/&Ba4!xdV_|? D%Bt!m x],wOx?@ %Bt!I;uSc6u?@N%B!t!Q1i@`rWq?A %Bat! TYƙRl?AL%Bt! %{~Ze?A}%Bt!Z3\?A%B!t!QKtlI"jD ϣ%Bat!)`sV#aDL:%Bȡt!#P=PDc%Bt!Lu 4r"?D%B!t!@T?E %Bat!gc?EL%Bɡt!m [ň4l?E>%Bt!A @D s?E%B!t!C5|ww{w?F 'Ba4!xdV_|?FL ; Aʡ4!"?T5"C4!0R*cB/,B/D2/Ez>&B!4!Px,'xῪ #%Bat!ۿ2@wNnῪ@|5%Bˡt!Rx^e2{dῪ@"%Bt!(fIZῪA %B!t!ѱ@ UaQῪALк%Bat!clڵ`zGῪAFY%B̡t!c\~I>ῪA%Bt!/Ha@ךJ5ῪB %B!t!]D j,ῪBL%Bat!Λ@"ῪB{%B͡t!2+R(#ῪBM%Bt!ዔ4hHῪC ɱ%B!t!A+e@@ЌῪCLz%Bat!`.+L@i࿪C1%BΡt!D72X̀;࿪Cc %Bt! Ud]q࿪D Ľ%B!t!k7l2ѱ࿪DL%Bat!LNx M࿪D%Bϡt!sEiN࿪D%Bt!`|N࿪E R%B!t!0mN࿪EL}%Bat!! }n࿪EFN%BСt!KGذ࿪E%Bt!qPBGD࿪F 'B!4!KeN࿪FL Aa4!"?so1D@ѡ4!p"uh#DGCZOJ@F#l ELU2D@t!p"uh>`/E'8uW!wD@f EL/0D@!t!p"uh>#DGCWFx@ EL=,D@at!'`TtB;N~x@ ELp,D@ҡt!ۧHVt!Q~x@ EL_/!C4!0R*cB/LB/d2/e+&B!4!x͐࿪ #%Bat!ۯ)DLs࿪@/X%Bӡt!,ءH࿪@N}%Bt!<)b۩࿪A %B!t!`߿ALW%Bat!з5W߿Ak%Bԡt!3ܭ@߿A%Bt!"(@{޿B U%B!t!#Vib ,j-r޿BLm%Bat!p910ML޿Bb%Bաt!5@@TݿBWF%Bt!SfszL3̭ݿC %B!t!{}\: _ݿCL%Bat!@L Zh3ݿC%B֡t!c\ntIܿC%Bt!sb|1luܿD ^_%B!t!0iA(ܿDL%Bat!@M[ۿD|%Bסt!!af@OۿD%Bt!s̥h6\&BۿE G%B!t!@ڿELV%Bat!)@V#eڿE{%Bءt!aog]ڿE-%Bt!c\ڿF 'B!4!X:@t4ٿFL Aa4!"?l'3D@١4!"uh,*ʳi?]l@F#l EL[K*D@t!#uhjS i?~x@f EL!C!4!0R*cB/iB/2/&Ba4!xe;i?ѿ X%Bڡt!qۯ)@cп@L%Bt!0ءiп@c:%B!t! @);пA %Bat!+=ϿALd%Bۡt!5 &ϿA!%Bt!Cܭ)N.οA>%B!t!2(fJͿB %Bat!3Vib 읿:ͿBL%Bܡt!P910U̿Bw%Bt!5@$(˿B%B!t!CfszLyb[˿C %Bat!a{}\o_ ʿCLi!%Bݡt!L Zhyb!ʿCF%Bt!\nt҅ɿCx%B!t!3sb| -ȿD e%Bat!̍PȿDL3%Bޡt!}ǿDܕ%Bt!afVǿDa%B!t!̥h65LƿE %Bat!H{ſELV%Bߡt!))RſE%%Bt!ao';ĿE=%B!t!s5\!ĿF #Q'Ba4!2X:kÿFL h A4!"?3_/D@4! "uh5e7uӿD%B!t!5g|yҿE %Bat!GٗҿELb5%Bt! @):KCҿEU%Bt!0ء^'ѿE0`%B!t!qۯ)@w#ѿF c'Ba4!xe;i?ѿFL wA4!"?8-D@4!!N)Z@Y'~x@f#l ELF0D@!t! "uh*f˾nZYEI@ ELv!Ca4!=0R*cB/B/2/3&B4!X:yb8u o%Bt!c{D@%B!t!aoC@%Bat!)AUA %Bt!3{K$AL1%Bt!s̥h6)򼿪As%B!t!!afZA%Bat!%b׍B %Bt!0RxnCL^%Bt!SfszLFDCnK%B!t!5@ICq%Bat!p910@XzǰD %Bt!#Vib  DL%Bt!"(gD%B!t!3ܭiw񩿪D%Bat!5 /[E 92%Bt!(3ɾEL%Bt!<)}\Er%B!t!,ءi۞E%Bat!ۯ)>rF 'B4!x NFL zA4!"?$/D@!4!ڧ[ftidY'~x@#l EL0D@at!"uh,wkMYwl_@& ELT,D@t!ڧ[ftA*ʳi?~x@F EL0D@t!ݧ[ftWd~x@f EL0D@!t! "uh,@ ELd!Ca4!]0R*cB/B/2/۔&B4!xfq %Bt!ۯ)C @R%B!t!,ء(pH @9%Bat!<)` } A V%Bt!5Y AL%Bt!з5Ea̐ A%B!t!3ܭ%Q8 A2%Bat!"(boS B %Bt!#Vib 8xԃ BL%Bt!p910Xy B%B!t!5@go BR C<^%B!t!c\ntP܂H Ct%Bat!sb|jsU> D *%Bt!0? .5 DLר%Bt!(67+ D<%B!t!!af1WG! D*%Bat!s̥h6j E 0%Bt!d ELJ%Bt!)0wR E\%B!t!aopI E}%Bat!c; F e'B4!X:i FL dA4!"?63D@!4!"uh,!1M%UVt`x@#l ELo*D@at!#uhjS~ %x@& EL~!C4!z0R*cB/B/2/&B4!xH mE%B!t!qۯ)p @M%Bat!0ء? H @^%Bt! @) A l%Bt!PA AL-%B!t!5߭ A%Bat!Cܭ088 A"%Bt!2(@y B ?:%Bt!3Vib hG?ԃ BL*%B!t!P910Wy B%Bat!5@H[o BZ%Bt!CfszL8z{Ye C ]%Bt!a{}\)SE\ CLT%%B!t!L Zh8z{Y>R C%Bat!\ntH Cq?%Bt!3sb|P{> D W%Bt!h-5 DL %B!t!++ DKO%Bat!afH?;! De%Bt!̥h6Pj E =%Bt!3؇ EL%B!t!)ŸkR E%Bat!ao0E?%Bt!sP;F 'B4!2X:S菬FL A!4!"??/D@a4! "uh UVt`x@#l ELT!C4!0R*cB/B020t&B4!2X:ey {%B!t!s' @%Bat!aoO^ @>%Bt!)(rwWӪ A 0%Bt!H?;H ALhw%B!t!̥h6' A%Bat!af3؇* Am%Bt!0t B w%Bt!%Qz BL %B!t!3sb|@yRq B %Bat!\nt߭g B%Bt!L Zhi] C  %Bt!Q{}\` }T CLf%B!t!CfszLiFJ C<%Bat!5@g]@ CV%Bt!P910,a6 D %Bt!3Vib  4Q, DL!%B!t!2(P{+" D%Bat!Cܭ?  D%Bt!5 E %Bt!/! ELg=%B!t! @)YkQ E%Bat!0ء08 ET%Bt!qۯ)!OC F ~'B4!xH FL 4JA!4!"?E-D@a4!!N)ZK%x@&#l EL10D@t! "uh* LStlx@F EL!C4!0R*cB0B00201&B!4!X:8z{Yy R%Bat!cH@>%Bt!ao^@kb%Bt!)A_KӪA %B!t!&/HAL%Bat!s̥h6HAm%Bt!!afP{*Ad%Bt!CB %B!t!008zBL%Bat!sb|ʣmRqBr %Bt!c\ntgB\V%Bt!@L ZhS]C `%B !t!{}\TCL>%B at!SfszLX]FJC%B t!5@H[]@C&%B t!p910a6D E%B !t!#Vib Q,DLe%B at!"(ҧo+"D%B t!3ܭ*1D%B t!5( E D%B !t!H EL%B at!<))SEE%B t!,ء Ebz%B t!ۯ)UiP F w'B !4!xΥFL A a4!"?Yt3D@ 4!ڧ[ft1M%LSt@#l ELw.D@ t!"uh,1TYBPEO _3"?,D@!t!ߥi8&5?RX`x@ EL_,D@at!ߥi8 r>`x@ EL,D@t!@^5>K7A`G cW_@ EL,D@t!@^5>~jt!&,`x@ EL,D@!t!L*k& yAA`#~x@ ELp,D@at!fZҗI six@& ELPR,D@t!ߥi8aG cW@F ELc,D@t!@^5>a'_y/T4~jt!x@ EL+ *D@t! l!6[UA6a~x@ EL*D@t!Q> wsa~x@ EL*D@!t!ޅۭmQ6[ o~jt!x@ ELQ*D@at!4@*]Ka~x@& EL*D@t!ߥi85LAWa~x@F EL,D@t!tugpaFjE}SG_T_@f EL10*D@!t!v/ 7~jt!x@ ELb,D@at!ܓ jE}SG_T@ ELXFH@t! /x~jt զ,[z'2s{К?EO `c"?!C4!0R*cB0lB020‹&B!4! 0s2 %Bat! e֋50sIe@3%Bt!Ѽu4sj@%Bt! 8sPTA %B!t!iyDs(7BL%%Bat!xoDs* wBa%Bt!kjHsNHBs%Bt!+99HsJWC U%B!t!ȕoUHs:CL@%Bat!*JD Hs4C %Bt!JZM Hs.CA%Bt!!Ds0w]D R%B!t!'0Ds z-DLp0%Bat!Eł@s0~D\%Bt!1??A6[TMa~x@Ć ELM,D@"at!ޅۭmQ64/TO~jt!x@Ħ EL!C"4!&0R*cB0B020&B"4!L0q %B#!t!t˴"Pw @:%B#at!ix 6PhI @C%B#t!i2FP Z A Q%B#t!RP\1x AL%B$!t!bT\1x A%B$at!rT\1xA A]%B$t!*4T  B %B$t!ӎThI BLn%B%!t!XM% BO%B%at!]X0š BD%B%t!ZXYf C 5%B%t!dóX(b CL~%B&!t!_\Z7 C%B&at!OE3\E C%B&t!yZ?n\s D 3%B&t!y~\H' DL05%B'!t!/%``" D%B'at!Љ׺`_ D%B't!*`Q_ E n%B't!cO7hdq; EL@%B(!t!jT&d` Em%B(at!Sq.d87 E5}%B(t!6dԏ F ('B(4!pY,>hFq FL A)!4!"?+."C)a4!A0R*cB0B020׮&B)4! :/\ ;%B)t!T1Q>V @em%B*!t!cv MyO @~%B*at!_}]ěwH A %B*t! Te̛A AL(%B*t! []ЛQ: A%B+!t!M؛(b3 A%B+at!]10, B 5%B+t!X\1x% BLO%B+t!0 B%B,!t!> B$%B,at!iP9EHE C %B,t!uIs=O CL$%B,t!Y:/  Cl %B-!t!E@1M CY%B-at!9mpe D 3f%B-t! L)t DL̶%B-t! ~ 6 D%B.!t!~(XG D%B.at!L20@ E C%B.t!ɀRv4e EL%B.t!`S<cu E:%B/!t!0@PMӾ EU3%B/at!Hw' F 'B/4!L0q FL ^A/4!"?!@Dj@0!4!9 .QJsoVM;@ !D0 0FO!C0a4!]0R*cB0B020۸w&B04!#fЗFT b%B0t!#ؗ8 #· @%B1!t!iP8wu9 @VS%B1at!#g?o A |%B1t!\}| AL%B1t!ɀSyU(y A_%B2!t! 3|hI\u A %B2at!, cq B ]%B2t!ӅP{8Cm BL%B2t!Yw hIi B%B3!t!~M (fe BG%B3at!T08 da C b%B3t!|P8gp] CL.%B3t!Z@2-CY C|%B4!t!09`H }AU CBR%B4at!Ps=P D f%B4t!ZT\H fjL DL%B4t!9odPH D%B5!t!@,leC D%B5at! Ytm? E le%B5t!۽|HK: EL%B5t!޾<.5 EΔ%B6!t!^YG1 E%B6at!sʲ֑̔, F h'B64!Y' FL ?A64!"?"C7!4!x0R*cB0B020C"&B7a4!ϨPM %B7t!."oF @%B7t!E@0h?8C @X%B8!t!xW  A P%B8at!y~j;b AL %B8t! UcԿ A(%B8t!cO7hS  A%B9!t!XϴPy B G%B9at!%0(Օ BL%B9t!z^; }A1 BO%B9t!pU B_%B:!t!0G:/ C %B:at![!4!٭JFT Nw%B>at!)xY @u%B>t!3 $Ϋ @%B>t!-7~d5zV A u%B?!t!$SH  AL+W%B?at!N0 A5%B?t!0S A1%B?t! % B %B@!t!fІ(! BLN~%B@at!C@?xW M B %B@t!Y+Z] BF%B@t!)zs C =%BA!t!.ލXYG1 @7%BEt!>= C%BOt!ɧB{0 D ]%BOt!֨{\1x% DLm1%BP!t!Rꆴ{0, D%BPat!py_LJ{(b3 Dc%BPt!r&{Q: E aO%BPt!c({A ELu%BQ!t!) &{wH E%BQat!YmֈJ{yO E\%BQt!xއ{Q>V F <'BQ4!Xh{:/\ FL AR!4!"?"CRa4!0R*cB1JB1b21c_&BR4!0YNDi{Fq %BRt!y{ԏ @q%BS!t!y}ߌ{87 @%BSat!@cQF{` A '%BSt!ZnWȭ{q; AL7D%BSt!â{Q_ A%BT!t!s,մ{_ Aw%BTat!sx{" B 7%BTt!)WɁ{H' BLX%BTt!*TK{s B%BU!t!H-{E B:%BUat!E{Z7 C 0%BUt!CC=]{(b CLYx%BUt!9 y{Yf C%BV!t!) {0š C%BVat!{M% D %BVt!!-{hI DLJ%BVt!YmՋ{  D[%BW!t!3z{\1xA Dvg%BWat!Xh!{\1x E A%BWt!={\1x ELQ%BWt!l]{ Z EdX%BX!t!Ig҆}{hI E %BXat!Xh{w F ('BX4!{0q FL AX4!"?"CY!4!0R*cB1eB1}21~&BYa4!{c# "{%BYt!Xh{jXz@%BYt!Ig҆}{ا4Ѥ@X%BZ!t!l]{xwF)A  %BZat!={|yAL%BZt!Xh!{GإA %BZt!3z{|y/Aj%B[!t!YmՋ{F?B "%B[at!!-{ا4ަBL%B[t!{У26BC%B[t!) {`kB%B\!t!9 y{,n槿C %B\at!CC=]{ve>CLM%B\t!E{ qpC %B\t!H-{C;%B]!t!*TK{:LFD 7%B]at!)WɁ{"FDL%B]t!sx{$sQDK%B]t!s,մ{IOD%B^!t!â{ȟ00E y%B^at!ZnWȭ{ EL $%B^t!@cQF{IZYE=%B^t!y}ߌ{EOl%B_!t!y{f F p0'B_a4!0YNDi{?cFL ɾA_4!"?"C_4!0R*cB1B121h&B`!4!Xh{&׊=? %B`at!xއ{FB?@%B`t!YmֈJ{˄zޣ?@D%B`t!) &{,n*?A %Ba!t!c({t~^ws?AL%Baat!r&{2s?A`%Bat!py_LJ{஧?AD%Bat!Rꆴ{Tz?B Y%Bb!t!֨{تE?BL%%Bbat!ɧB{Ԏ?BR%Bbt!)yŒ{ó?B%Bbt!.Z{P%3?C Go%Bc!t!R p{*r?CLx%Bcat!Id{ZaP?C%Bct!#RX{@{eC%Bct!:^OǪH{nv4yD AM%Bd!t!<{^xDL*%Bdat!r0{pJkD9 %Bdt!MŁ*${ qDLq%Bdt!${03E :%Be!t! { EL%Beat!3{{`'UzŜE_%Bet!){`k#KE>%Bet!3z{26F {'Bf!4!{c#FL %Afa4!"?@Dj@f4!9࿍QJs0$?? Q>~O͌0FK*D@ft!*1.~x@ EL=Dj@g!t!9K_v=s7Ks@2L6D0 k,D@gat!#\s9K1x@& EL5=Dj@gt!9;_v=s!3|@'O0Ό~5DZ@gt!9;_v=sx!@`,D@h!t!ܲ`@`x@ ELz5DZ@hat! 9 ࿇;_v=s7h9LD=Dj@ht!G9(+_v=sij> @5#O 0ό>,D@ht! l!6AK~x@ EL,D@i!t!.x.o[M~jt!x@ EL,D@iat!ڲ4-H]K*=a~x@& EL,D@it!v/-"M R?~jt!x@F EL *D@it!oI.ۮ~x@f EL2 *D@j!t!ܐ.S[ۮ~x@ EL*D@jat!߇#K .&O0a~x@ EL-*D@jt!pi.o~jt!x@ EL*D@jt!Q.|gEPt!x@ EL'O*D@k!t!࿇ގy.aT9j}Pt!x@ EL1*D@kat!W./Pt!x@& ELJ*D@kt!2'Bf%a~x@F EL]*D@kt!܏~ )흗ۮ~x@f EL,D@l!t!}<-H#߷rJAۮ~x@ EL&*D@lat!mT S=OPt!x@ ELL+,D@lt!'Y!U;m+?Pt!x@ ELU*D@lt!MʙHDpɨPt!x@ ELm*D@m!t!ۻ2Ca2g~jt!x@ EL2VHmat!~rKlD?9jLkdxZ&~tc?w؈ 6{ u"?VHmt!ӑ5]'̓D?9jLcPxZ&~tc?gۿD ǢXf u#"? BP0L0D@st!tugtaF[X V@F EL۬,D@st!tugtaFlF_@f ELDl=Dj@t!t!㖰ixP-/-z7Ыs-DT! @> S*Đ0 0D@tat!1lugtaFp]XXZ_#A\ s_@ EL[b,D@tt!ҎP `s'7/.H2D@tt!%; x*KWQ`#tZH@ ELɄ=Dj@u!t!ʤE5L-$e@=kݲDP0 u 2D@uat!s܌ s4D@ut!.)@f ELV`=Dj@v!t!Rnh`lC῏u8-?4P?0 |2D@vat!t8 Ǚ6Zµށgy (" p@ EL=Dj@vt!HK\$2@@*i}@0݌,=Dj@vt!т Uo_t㿄щγvʁ@NEw>4D@w!t!ڕE x;[<”I@ ELW=Dj@wat!E4L-[щγe@=kݲDP0L 2D@wt!%.QOA+>{Dv@F EL=Dj@wt!HKkщγ2@@*}@064D@x!t!φTRy64-O(c_`x@ ELz=Dj@xat!ЊnhlCῄщγu8-?4P?0LN4D@xt!1-+Tx.pnK஘qZ//@ EL=Dj@xt!ѡi{5u [o$@Xঊ0g0D@y!t!qtugtaFr]YzO%-s@ EL 0D@yat!tugtaF]Y^-p@& ELs!Cy4!0R*cB1B122&By4!5f T'? ^k%Bz!t!㈣ٰ?@tX%Bzat!ؐ!Ӑ n?@cj%Bzt!ޕ{~?A 7=%Bzt! Otߜ@FH?AL= %B{!t!9@{8u?A%B{at!bۤCr?A)%B{t!:fsz׼?B Td%B{t!YZukˬR#?BLx%B|!t! (G㰣`m["?BI%B|at!pL?B%B|t!W_wO`ev?C %B|t!]>@ ?CL` %B}!t!Ě ލ?C%B}at!J^ģ`g6^?CB%B}t! Kģ/y?D [v%B}t!񰠹ȣq#hE?DL%B~!t!篟ȣ 2n?D%B~at!hḄr ?D1%B~t!tzṢ$tw?E Ґ%B~t!4У@4H?ELS{%B!t!:fj3У:~?Eܱ%Bat!V3У /Ǘ8?E%Bt!]p;Уya?F .'B4! OLԣs?FL A!4!"?F3D@a4!=;F#Nzqr@#l EL!C4!0R*cB2B222&B4!a OLԣ–@8? %B!t!9p;У_?@Љ%Bat!V3У;0?@%Bt!:fj3УVPO ?A ]%Bt!j4У@1R?AL%B!t!XzṢ@+?A.%Bat!LḄ@uQr?A%Bt!ϯȣQ.f'?B Y%Bt!ٰȣn0n?BLPr%B!t!x KģW?B%Bat!6^ģZO?Bb%Bt!z,E?C Sy%Bt!I>3?CL`%B!t!G_wO\y?C%Bat! `+?CQ%Bt!(G㰣"ڜ5?D %Bt!IZukˬ[Z?DL7%B!t!:fs@?D %Bat!bۤ R;ե?D5%Bt! 9 ?E {%Bt! Otߜ R?ELK%B!t!ڕ{@{?E%Bat!Ԑ!ӐpHA?E%Bt!㈣Q,i?F 'B4!5f T'?FL YA!4!"?"Ca4!0R*cB2B26227LN&B4!5&d? %Bt!㈣ ?@VL%B!t!4!Ӑ _?@h%Bat!6{Ė~ ?A (%Bt! Otߜ 0}9&?AL4s%Bt!a9wڰ+?A%B!t!bۤ󜶂1?A%Bat!a:fsn(+7?B  |%Bt!Zukˬ@Qe}D+R?CL%Bt!|yW?C&B%B!t!r^ģd\?C%Bat! Kģzb?D e%Bt!ȣM>g?DL%Bt!ȣ ǟul?D%B!t!|ḄϨq?D.%Bat!zṢvv?E c2%Bt!4Уi|?EL%Bt!:fj3У 5?Eղ%B!t!V3Уb?Epd%Bat!]p;У10?F A'B4! OLԣ@|U?FL 0A4!"?J3D@!4!u;FL燎C-9`Hu@#l EL!Ca4!0R*cB2:B2R22Sm&B4!} OLԣ@7? p-%Bt!Mp;У@ƒf??@hC%B!t!V3У]Hh?@H;%Bat!:fj3У 4a?A r)%Bt!j4УY'?AL%Bt!LzṢ@ Kl?A-%B!t!@ xx?CL&%Bt!_wO'H>*?C%B!t!SnpLT?C%Bat!(G㰣r~?D %Bt!Zukˬ:LE]?DLZ%Bt!:fs@#o?Di%B!t!2bۤ@J?D6%Bat!9+?E ]v%Bt!A Otߜؙ(X?EL(%Bt!V{?ED%B!t!H!Ӑ c?E<%Bat!㈣T?F Kv'B4!5&d?FL Q A4!"?"C!4!0R*cB2UB2m22n&Ba4!75@ WrV? =%Bt!㈣3_/?@S%Bt!!Ӑ?@%B!t!{WF?A '%Bat! Otߜ$?ALx/%Bt!U9@?Af%Bt!bۤ@*/?A%B!t!m:fs@ftz?B %Bat!Zukˬ ?BLq%Bt!(G㰣S܄?B/%Bt!ULjZ?B%B!t!_wO@{_ƣ?C %Bat!>?CL.%Bt!D\As5?C%Bt!^ģV9}?CT%B!t! Kģm?D X%Bat!ȣ,W3 ?DL#%Bt!ȣ>YS?D%Bt!ḄM?DK%B!t!zṢ#?E C9%Bat!:4Уg'?EL%Bt!:fj3У8rn?E5%Bt!wV3У5?E:%B!t!!p;У(?F J'Ba4!U OLԣB?FL ?A4!"?#3D@4!3F NTqM@!mAf#l EL!C!4! 0R*cB2qB222A&Ba4! piKУQ3? %Bt! ؜У@*?@%Bt!MIf̣et!?@%B!t!ʿ'C̣@P?A g%Bat!ໟȣ%>J?AL^%Bt!5`ȣ}?AN%Bt!j˟ģ@w?A5%B!t!8iuģ@.?B h%Bat!ZuK?8?BL%Bt!dzػ/ Y?CLn%Bt!_wO`C?C%Bt!v?C%B!t!l(G㰣@~{?D  %Bat!Zukˬ@?DL.+%Bt!Q:fs`Kr?DE%Bt!{bۤ`=o?D4%B!t!19u?E ˫%Bat! OtߜI ?EL%Bt!{k!?E%Bt!Ԍ!Ӑ`V??E[%B!t!㈣`;?F 'Ba4!5 $?FL noA4!"?֑3D@4!3FGԲT(xAf#l EL0D@!t!3FGԳA4̽SjA ELX*D@at!FkO F(]Y$rB䭨~xA EL*D@t!kO F]YzO%~xA ELD0D@t!%;FNU51nA EL<.D@!t!ޅ3FL@k!aP~XxA  EL *D@at!kO FN]XѺ~xA & ELǵ.D@t!ެkO F[YULI~hcxA F EL0D@t!؅;FN@:D# sA f EL0D@!t!atugtaF|]X8plF_A EL0D@at!tugtaF]Ys0jr_A EL.D@t!e3FLvͫ&>xA EL2W!C4!O0R*cB2B222ͣ(&B!4!u OLԣԧfտ %Bat!=p;УLYտ@%Bt!V3Уg pLտ@%Bt!:fj3УO?տA C=%B!t!J4УW,2տAL%Bat!,zṢW%տA"f%Bt!ḄSտAw%Bt!ȣBj տB f%B!t!ȣsԿBL%Bat! Kģ@B3-ԿBS%Bt!Zģ ԿBs%Bt!@*uԿC %B!t!>ԿCLT%Bat!_wO%rԿC<%Bt! =?άԿCh(%Bt!t(G㰣yqԿD 1%B!t!Zukˬ@ny9ԿDL@%Bat!Y:fs@[4AԿD%Bt!{bۤ@Ɇ(uԿD%Bt!=9@>ffԿE ’%B!t! OtߜXԿELi%Bat!{IԿE%Bt!!ӐCSG;ԿE%Bt!㈣@K=b,ԿF 'B!4!5OKԿFL Aa4!"?J"C4!j0R*cB2B222j6&B4!'5C~:A뿪 %B!t!㈣+ڟ뿪@)%Bat!!Ӑo4Ԇ꿪@J%Bt!{꿪A \%Bt! Otߜ꿪AL%B!t!I9 꿪Aa\%Bat!bۤMZ꿪Aes%Bt!a:fs`g5꿪B e%Bt!Zukˬ꿪BL@%B!t!t(G㰣 B鿪B%Bat!߸M鿪B~%Bt!_wOpΤ鿪C %Bt!> 'A鿪CL'%B!t!8@F?C]鿪C%Bat!^ģ(Z':鿪C?'%Bt! Kģ#鿪D :y%Bt!yȣ`迪DL^%B!t!{ȣ`'?迪DQ%Bat!Ḅ`UU迪D%Bt!zṢ`(H迪E w%Bt!.4У *xj迪ELP%B!t!:fj3У2!H迪E%Bat!oV3У`GE%迪ET%Bt!p;Уx1迪F U'B4!M OLԣ@%Bt! cJ뿪DLwX%B!t!,IK Ww 뿪DL%Bat!Ek@lf뿪Dy\%Bt!_:J$뿪E %Bt!u+P}w)뿪ELd %B!t!IJo7ː в/뿪E_ %Bat!exCu{5뿪E%Bt!PI΋`IS;뿪F u'B4!'5C~:A뿪FL  A!4!"?J"Ca4!0R*cB3B323.&B4!5ֿ %Bt!㈣"$ֿ@V%B!t!<!ӐM߿ֿ@%Bat!>{z(ֿA hK%B¡t!! OtߜֿAL%Bt!i9E]9ֿA8%B!t!bۤҭֿA%Bat!i:fs@wֿB K%Bát!Zukˬ@\s2iֿBL1%Bt!h(G㰣\/\ֿBR%B!t!@QRXNֿB%Bat!_wOL@ֿC w+%Bġt!>@~(3ֿCLĵ%Bt!@F %ֿCk%B!t!z^ģ"NֿCs%Bat! Kģ ֿD z%Bšt!ȣ dտDL:%Bt! ȣ7xտDJ%B!t!Ḅ=GտD%Bat!zṢ@տE S%Bơt!4У@~IտELH%Bt!:fj3УػտEP%B!t!V3У㖵տE%Bat!ep;У˒տF *`'Bǡ4! OLԣ lտFL A4!"?@3D@!4!u;FL療Vѽ[v!5jA#l EL!Ca4!0R*cB3"B3:23;t&Bȡ4! OLԣ h޿ -%Bt!Qp;У:Y87޿@j%B!t!V3УAD޿@6%Bat!:fj3У@SݿA "%Bɡt!j4УݿAL%Bt!PzṢjMݿA{#%B!t!@ḄAɡܿA%Bat!ȣ5ܿB {%Bʡt!ȣYVܿBL:%Bt!X Kģ+ɛܿB.%B!t! ^ģ@vERۿB.2%Bat!@v\ۿC D%Bˡt!>#ۿCL4%Bt! _wO@7fڳڿCm%B!t!W5^ڿC%Bat!(G㰣ڿD 7%B̡t!ZukˬŒDٿDLf%Bt!:fs8ZٿD3%B!t!6bۤcTmٿDr%Bat!9"ؿE :t%B͡t!I OtߜͪPؿEL%Bt!^{3׿E `%B!t!P!Ӑ,>׿E%Bat!%㈣; )<׿F 'BΡ4!5ֿFL I@A4!"?]I"C!4!0R*cB3=B3U23V0&Ba4!5Gh8俪 b-%Bϡt!㈣ =0㿪@m%Bt!Ԑ!Ӑ8Z㿪@_%B!t!ڕ{|㿪A a%Bat! Otߜ@AO㿪ALv%BСt!9 G#+"㿪A6%Bt!bۤ ~⿪A %B!t!:fs A⿪B e%Bat!UZukˬ`k]⿪BLT%Bѡt! (G㰣ar⿪B%Bt!>G⿪By%B!t!W_wO@ W9⿪C V%Bat!]>JῪCL%Bҡt!Ě@yῪCZ %Bt!J^ģ`yῪC%B!t! KģNXuῪD %Bat!񰠹ȣX?KῪDLܻ%Bӡt!篟ȣW"ῪDT%Bt!hḄU࿪DJY%B!t!tzṢ '5࿪E $%Bat!4УKG%࿪EL_%Bԡt!:fj3У`2 ~࿪E!F%Bt!V3УSgU࿪E %B!t!]p;У ,࿪F (3'Ba4! OLԣ`O0U࿪FL ƢAա4!"?xm3D@4!-;F#N女3g7 p_Af#l ELG!C!4!0R*cB3YB3q23r.2&Ba4!Y OLԣOh翪 %B֡t!1p;У@{\@F翪@-%Bt!V3У#翪@ZY%B!t!:fj3УEP翪A %Bat!b4Уi%濪AL|%Bסt!PzṢlU\濪A~%Bt!HḄGљ濪A%B!t!ǯȣtv3w濪B 5%Bat!Ѱȣ@P/|T濪BL!%Bءt!p Kģ`Y1濪BO%Bt!.^ģ`b#濪B7%B!t!忪C %Bat!E> d\1忪CLa%B١t!C_wO`忪C%Bt!yـ忪Ct%B!t!(G㰣'\忪D '%Bat!EZukˬ]Au8忪DLd%Bڡt! :fs忪DU%Bt!bۤ俪D%B!t!9pu俪E י%Bat! Otߜô俪EL%Bۡt!ҕ{`ů}俪E%Bt!А!ӐɠV俪E֧%B!t!㈣ 6/俪F &'Ba4!5Gh8俪FL fOAܡ4!"?e3D@4!3F TSPA!#l ELL0D@!t!3F 4̽SߐDpA" EL*D@at!kO F]X8p~xA"& EL.*D@ݡt!kO FR]X~xA"F ELE0D@t!؍;FN@j\+U4o_A"f EL}.D@!t!ެkO F[Y6Ҭ;~4xA" ELo.D@at!ޕ3FL女m؄)]@i.4xA" EL*D@ޡt!.kO F"]Y^ t~xA" ELk.D@t!;F N@ #Yc40LA" EL2D@!t!5i.j->T_A# EL9D=Dj@at!2yOt6˲h?ѿi-=@+=9FLqh2D@ߡt!ض3M .hxb:O_A#F EL2D@t!ܦő.{%PȬl< L_A#f ELy=Dj@!t!*yOt5˲h?ѿi-,xY?=G e2D@at!tX.e)[o@c2+/A# EL+>2D@t!߾n{.<0*1iuk_A# EL=Dj@t!.yOt6˲h?ѿmi-\".@[70G2D@!t!ߖv[t.Hf Do_A$ EL>2D@at!=_ֲ6TAh]e*e_A$& ELEW=Dj@t!.yOt6˲h?ѿ=i-. >n?0H.4D@t!ۗ.OoM19#)W_A$f EL4D@!t!١QhA6xYшKYMJNHUcp_A$ EL=Dj@at!*yOt6˲h?ѿi-3Aqx@AS0IL2D@t!G&|96ZhzKSRpA$ EL22D@t!\ۋi60|_2kB\*{|mA$ EL=Dj@!t!*yOt6˲h?ѿi-%@"Z<Ð0J 2D@at!ՙW\*6Ĭ7D@ו_З=A%& EL2D@t!ٶ16nW iX0A_A%F EL0D@t!MGOF!.)wӖ@ER+32xA%f EL]2D@!t!t !.@Q<ݭc͠$A% EL&t2D@at!܄.##E+)1p\?N_A% EL9y2D@t!vr~6 p{g?%ɐ_A% ELw2D@t!#'s.?p$,'u^CA% EL$,D@!t!ܥ96'ػK%xA& EL7=Dj@at!yOtX i-Қ @xÊĐ0LL2D@t!ߢ`X:Q6O)Gy!y6Y3 lxA&F ELz2D@t!ߖed.<*%^Mt`xA&f EL}=Dj@!t!yOth i-X*@ݻŐ0M *D@at!'F.Y'墧%xA& ELΛ2D@t!0g6@80}%Uɲ`xA& EL0=Dj@t!yOt` i-8ئI>@^kkACP0Mt2D@!t!㆒q6ⴀY_} lxA' ELJ2D@at!ٴ7.*I.$0}%*Gt`xA'& ELY=Dj@t!yOtX mi-}"0@4֚GwNP2D@t!a.vm W&_} lxA'f EL2D@!t!ܥ96#VqK%=`xA' EL3=Dj@at!yOtX i-JPA?9@A0OLV,D@t!‟b.)GyNMqK%xA' EL*D@t!ߖed.FIqK%xA' EL=Dj@!t!yOt` mi-?7A$b>P '2D@at!7,.Y'墧 hR lxA(& ELH*D@t!6[&F.Ĕ#3M%xA(F EL0D@t!4:Q6Vt@kkACP0SU/2D@!t!hOC ';)e2A* ELf 4D@at!ކ/ (? v YdaA*& EL'=Dj@t!لO+˲h?ѿmi-}"0@8V֚GwT-4D@t!b|v=~g%9u2A*f ELˏ2D@!t!J[@|l@Y'<1:A* ELH=Dj@at!&لO+˲h?ѿi-bPA?/9@A0ULxq,D@t!ڐLuG`ҖvA@Y'~xA* EL*D@t!X z2xA`@Y'~xA* ELD=Dj@!t!&لO@+˲h?ѿmi-?9A$b>V S2D@at!:* PPx_p'VFIA+& EL*D@t!OQzidY'~xA+F EL=2D@t!ܚgY43h˾n@kkACP0Yt!2D@!t!ضOC ~;Y lxA- EL%4D@at!f/ i(?{%)Gt`xA-& EL=Dj@t!ЊلO mi-}"0@8V֚GwZf4D@t!ݤZ|Yv=1U& lxA-f ELp2D@!t!߂J[|mK%==`xA- EL =Dj@at!ЖلO i-bPA?/9@A0[Lu,D@t!pDuG`ҖvAK%xA- ELz*D@t!P z2x^K%xA- EL$=Dj@!t!ЖلO mi-?9A$b>\ IP2D@at!* PP2^pgR lxA.& EL;*D@t!GQ؊z!1M%xA.F ELx/0D@t! gYĐ3 VtUxA.f ELKd0D@!t!@wCw VtUxA. EL{0D@at!lQPP(r&1TY?dT LA/& ELx4D@t! hvRbGY>$A/F EL2D@t!P@šĚ=΋7l&gwA/f ELC2D@!t!3u1hT1% l.(sA/ EL 2D@at!MuC PV/[#A/ EL,,D@t!\pѳm H0?^%H7NHt! /z+@AE]z7(CZF{DVfC!Κ?BȐX_cITEO "?*D@!t!4^Wa>ׂ ^ .~xA0 EL֭*D@at!4^Wa> v(r"} xA0& ELNHt!T:PS krZF{FffC!Κ? rCP8 B #"?wMoq QxA0 EL*D@at!O>wMoʠxA0 EL_NHt!يV,MEO s"?,D@!t!C)6QE8+:N9X˻pxA1 ELޏ,D@at!C)6QE8+:N91Ǡ^xA1& EL2D@t!٧ipH㎕`tS֓JR_A1F EL62D@t!T8S8i\:=p"_A1f ELk*D@!t!ۥ6$㎕=p~xA1 ELYU2D@at!QȎ6)M`tS֓{O\$_A1 EL>*D@t!QȎ6\;`tS֓~xA1 ELt2D@t!ۥ6$Mr#A)Kh:"_A1 ELG*D@!t!T8S8)MA)Kh:~xA2 ELNHat!ј@>sE)ItD3F{DefC!Κ?>OBdEO "?FH@t!рN oE)IifF{DdfC!Κ?EO #"? o,D@t!( z9&5?xA2f EL,D@!t!( z9~*z~xA2 ELQ,D@at!ҊP ps'_&THڡ,D@t!ҊP ps'&XH>^!C4! 0R*cB3B424&B!4!},İSp{ -%Bat!TG$P-@V%Bt!88+28g @VR%Bt!]2)A k%B!t!wFfCALl%Bat!մxPvA9%Bt![g?ڔn ,D@at!ͩDj~jt!xA7& EL,D@t!Z &{l~jt!xA7F EL|,D@t!Z "jcfa~xA7f EL,D@!t!ܛQ,!Dja~xA7 EL,D@at!?JjE}SG_T_A7 EL ,D@t!hՑQjE}SG_TA7 ELA*D@t!ڈ\ c"ka~xA7 EL,D@ !t!ڈ\ a0TOA8 EL,D@ at!ڈ\  >`xA8& ELp*D@ t! ͩD~jt!xA8F ELp,D@ t!ܛQ,!Dna~xA8f EL,D@ !t!xX &{l~jt!xA8 EL,D@ at!ڈX o&S7yLۉ<'θxA: EL 0D@at!\~±1YJA+g {"vA: ELP)VHt!\g]xZd;m1<֮tɜB7{˚?2̑ΤeaD c"?oVHt!\g]xZd;?m1<tɜ@7{˚?! وu |;4C s"?VH!t!絲PGZd;?m14tɜ@7{˚?2̑xΤeaD "?VHat!ﵲPGZd;m14ڮtɜB7{˚?وu |;4C "?p5DZ@t!%\``5"࿍/s@v 5DZ@t!З%\`@5"?eV)S-v=Dj@!t!tS5"?`V~)o@ Q>BP0w 6 =Dj@at!dO@5"࿋s-DT! @ 7B5P0wLM2D@t! UZLa5.Ӟ5ggA; EL0D@t!KcLaA+gp\{'xA; EL=5DZ@!t!ѶL@8?z7Ьs&iK@x W=Dj@at!W":-lxBhz7Ьs3FjBP0xp_,D@!t!η~ɲ"`.hA2K~xA< EL4C5DZ@at![nld= ףp?ȮU͞s Q>~OyLW,D@t!h6zFkѸpA< EL5DZ@t![nld= ףp῅خU͞s!3|@yg,D@!t!ܙI߷62l2K~xA= EL=Dj@at!DP]= ףp῅U͞s-DT! @4L6D0zL,.D@t!n?m`WQ`#tZHA=F ELPi.D@t!n?m`WQ`s@rA=f EL0D@!t!پOm`#t͠(" pA= ELBD0D@at!߮Gm`gy (" pA= ELC0D@t!߮Gm`gy ZHxA= EL0D@t!+Qa>Jaۉc_`xA= EL,0D@!t!+Qa>J(c_`xA> EL80D@at! +QaJ&E̠0A>& ELW0D@t!+P򣩺YF|l1fA>F EL92D@t!ۋP򣩺XJ怵BעE̠0A>f EL'=Dj@!t!xg ^S@#31E0} =Dj@at!ҌR?1^p-8R?6R!}L!C4! 0R*cB4[B4s24t$&B4!OP`J  %B!t!tLi!B@xx%Bat!DNɴ<O@ %Bt!p%ŴT*UA (%Bt!ƉUP"MAL%B!t!vcC} A%Bat!晻905 A[y%Bt!UOޑX, B %Bt!䔹0 &`BL6M%B!t!$4! HBK %Bat!%uFQRB{%Bt!00LFmC %Bt!cUx<CL`%B!t!l6C2&%Bat!mU@N C:%Bt!&U@#D %Bt!9pp8N&DLt%B!t!)D%Bat!4Y|^o,DM%Bt!%td>.E #%Bt!Lpx\0EL%%B!t!r.h`V+1E%Bat!_Rud c2E%Bt!oP"=\p33F 'B4!hXX,k3FL  A!4!"?d/D@a4!}J2D`fg~xAB&#l EL%*!C4! 0R*cB4wB424}&B4!E? ?X,k3 @%B!t!^tcp6M?@q%Bat!ENwRT~J@z%Bt!4jBUA :%Bt!.1:7aAL %B!t!_߯slAl%Bat!\nwA%Bt!z) BB F%Bt!~[pBL[%B !t!$2B%B at!obaB%B t!Yv{ C d%B t!44Q˸CL%B!!t!%-x~OL"g*D@%t!Z(;q3t~xAFF EL0D@%t!oޑ3dEhmAFf EL0D@&!t!ԝ^ IHXp~oŶAF ELs=!C&a4! 50R*cB4B424&B&4!_(Sp{ ^%B&t!,C@%B'!t!D{̠P-@+%B'at!mL) "~A %B't!TEPg ALp%B't!.0%,>MA %B(!t!(2)A#=%B(at!jQP u'B %B(t!?]Ǭ|CBL%B(t!Hx`aB)%B)!t!9,tPvB[@%B)at!pt`p]UC g%B)t!k43hcCL%B)t! %d@t}C%B*!t!&0` bCP%B*at!!` =XD %B*t!Fᨼ\@3oDL-%B*t!YXSPD%%B+!t!4gT8 DDT%B+at!T ~#E Vo%B+t!TjP@b]EL %B+t!qq|PQE%B,!t! tPpE Eڬ%B,at!EF&L{QF E5'B,4!LP FL vSA,4!"?$"C-!4! P0R*cB4B4243a&B-a4! }rMm /%B-t!DG%f0y'G@%B-t!R@})[j@c%B.!t!_y6;{A r%B.at!PzALh%B.t!(||+hAa%B.t!܍Jx&~ECA*%B/!t!hrt B %B/at!)*pEBLe%B/t! hCe|BC%B/t!_fdždqB1%B0!t!(C&`cqgC %B0at!!\q#\CL%B0t!y=NXf50RCy%B0t!reT>qGC%B1!t!'1 RP蚞G@VѩDW;%B2!t!TGr<8jE %B2at!$28{zGELF%B2t!v4E*%B2t!LIJ0E%B3!t!(`F `'B3a4!$Sp{FL A34!"? 3D@34!؞ԝ^ Is'VmpqŶAMf#l ELDl0D@4!t!۪!'<8+`xAM ELY0D@4at!ښ!''V@F\xAM ELkB=Dj@4t!D4hG^)DT!?Z c0,=Dj@4t!4h)喺!^/ŵ@ L6D0Xv0D@5!t!؞ԝ^ IE4nmpE\xAN EL0D@5at! wHE4na9M~hAN& EL2D@5t!HY8P6=mANF ELA=Dj@5t!lB08,⿃-i-ѫ O ?G"0(4D@6!t!. @1+gf8:3N;_AN EL2D@6at!۸@=qCJ 'w$jCUAN EL`$=Dj@6t!lB08,⿎i-_p@%Ϳ 0T2D@6t!o8վap*nxB AN EL2D@7!t!ݿ]ail&ܨ AO EL*AQ ELN=Dj@@&o6;څ0L2D@=t!k+ٲk<TeYn+9+jARF EL+2D@=t!ؙw\!5LIOWsARf ELĬ=Dj@>!t!}͜" -?i-ڼ?7 Wy,0 %2D@>at!Lh^\1&]:h=+EMSuAR EL2D@>t!nD){t; P?jAR EL6=Dj@>t!Ѕ͜"-?=i-v:ӭ @,R΄0`2D@?!t!/Tj9>%]AkAS ELY2D@?at! %!Gy:[o{TXEAS& EL=Dj@?t!Ѕ͜"-?i-'u*M@/cE02D@?t!zʂaHnB+A4~gNASf ELa2D@@!t!)J)Z%e9Xb8AS EL0D@@at!ئ("z]AS EL2D@@t!ߪG kcU51nAS ELTS0D@@t!> tQW jA@k!aP~XxAS EL0D@A!t!kO1ryڕk@=]_xAT EL2D@Aat!ݵt=uUܠ}yQ xAU EL=Dj@Dt!lB08 -?i-%~?/p =O2D@E!t!ڙ0ˡɢ|SZB'Y7(s>uAV ELH2D@Eat!ڜZJYfwc)Ci@֩0sAV& ELeX=Dj@Et!lB08-?Mi-4[ @ J3P2D@Et!jTԱɢҖ2ִ^«(8qAVf EL0D@F!t!IzU٢r*w@HI/paAV ELT0D@Fat! M1,NZnG._AV EL62D@Ft!)}@i B8T@#MKRsAV EL2D@Ft!ޛs7?`hw&,|xAV ELM2D@G!t!;Ȱa,s32kJɺCzq*AW EL9_2D@Gat!6NAQB'1%ߊ#AW& ELQ!2D@Gt!͢/*Bs5Ln^&rAWF EL~2=Dj@Gt!Е͜"`,⿃i-[ @('-02D@H!t!۪Eminhʁ!BcrS#AW ELY2D@Hat!ؽ]B b]Km;E^T_AW EL2=Dj@Ht!Ѝ͜",⿎=i-xl @CF02D@Ht!߹)z1/WG䀧EU%xptAW EL2D@I!t!_=;1^&;AS3om_AX EL=Dj@Iat!Е͜",⿂i-V? jf\0L]2D@It!X쉔A̗xOvͫW_AXF ELT2D@It!ȼL)c0@"t:sAXf EL`=Dj@J!t!Е͜",⿏ݥi- ʰf@7ؒ0 T2D@Jat!mAɲ82/,1X9!ȿ AX ELe2D@Jt!))yG#1R6JjAX EL =Dj@Jt!Е͜"`,⿀=i-\U?+P =!2D@K!t!mUzٲ5_JJbѽ`Hnn_AY EL2D@Kat!/PQzC.)@p'*p_AY& ELX=Dj@Kt!Ѝ͜"`,⿂ݵi-=X@Or2D@Kt!T79 ݌#4r_AYf ELv}2D@L!t!߼3wvb@j\+U4o_AY EL*-0D@Lat! U|aeJK$m؄)]@i.4xAY EL 2D@Lt!;-4⁲*'oKͽ?0mAY EL0D@Lt!LQ ?dw3S @PwAY EL:0D@M!t!T#ig4-@ #Yc40LAZ ELO0D@Mat!KzA %BOat!^UAf%BOt!Ekt.罬eB {%BOt!e{Z*q5pBLd%BP!t!(fcuBk%BPat!a.R zB%BPt!nxUd0. C %BPt!p†wCL%BQ!t!Z\9C1%BQat!u(ۀ̇C%BQt!V`Y\D 4%BQt!ϦNpu ꌿDL%BR!t!΢kXF45 Eb%BSt!r0[PF /'BS4!5Q8xFL  AT!4!"?3D@Ta4! 3!m Ĉ`/E'>Q} L_A]#l EL!CT4! 0R*cB5SB5k25l&BT4!hJF 4R f`%BU!t!UfO @%BUat!{^*&.,@ %BUt!'Z2^A  %BUt!eQ$ALz%BV!t!v.UA+%BVat!v}XAW%BVt!kt.5cfB y%BVt!{Z<ͺBL,%BW!t!',f/1B%BWat!a.R(B%BWt!xUdyk^񾿪C %BWt!G3 'CL#%BX!t!Z7R(C5%BXat!\YRCt%BXt!V t+¿D c%BXt!NS¿DLx%BY!t!k%B]at!/FZ(֯FA%B]t!k%B_!t!xUd.XĦC5%B_at!̍a.R1lC*%B_t!,fvJ=D C%B_t!{Z bDL=%B`!t!kt. S~kDa%B`at!DA%B`t!vȪE ]%B`t!]Q$^'yEL%Ba!t!'Z2>o,E2%Baat!{^ZP#7ᬿE!Z%Bat!UfF]F "'Ba4!hJF 4RFL :dAb!4!"?Ϥ"Cba4! %0R*cB5B525A&Bb4!hJ,'xῪ "'%Bbt!:pῪ@}%Bc!t!}qЍǣiῪ@%Bcat!;`bῪA 1=%Bct!~ U[ῪAL%Bct!>҂r YXwTῪAX%Bd!t!v8@9HMῪA%Bdat!vuoFῪB %Bdt!5R޲$@ῪBLA%Bdt!u[9ῪB%Be!t!L/vῪDR%Bg!t!\V࿪DA%Bgat!O ^`3࿪E .%Bgt!5[N^@3#࿪ELH0%Bgt!eOR`Y࿪Eh%Bh!t!6ఎ^࿪E>%Bhat!aU࿪F 'Bh4!߬`Y࿪FL aAh4!"?3D@i!4!|3!m Ĉ{UK_Ah#l EL!Cia4! A0R*cB5B525ۯ&Bi4!]QMqܿ %Bit!džr@yܿ@pO%Bj!t!nXF3~&ݿ@$/%Bjat!kΟ(V6fݿA %Bjt!W;ymݿAL%Bjt!6|;ݿA)%Bk!t!?FZ8'޿A2%Bkat!k!Cw!4! x0R*cB5B5252&Bwa4!uQ"] kʿ %Bwt!߆rd}?˿@?~%Bwt!XF%%˿@=%Bx!t!kΟe̿A %Bxat!w ͿAL%Bxt!64`!ͿA?%Bxt!_FZ`οAz&%By!t!k%Byt!VAe/пBx%Byt!KпBz%Bz!t!Z_H>bпC p%Bzat!W@ϧ1ѿCL.m%Bzt!xUdWѿC%Bzt!a.R@Y@ѿC|%B{!t!7,fE8ҿD H%B{at!{Z@lҿDL%B{t!kt.ҿD%B{t!jT"_FӿDo%B|!t!'v@ ߡӿE %B|at!}Q$DVӿEL%B|t! 'Z2[ԿE"%B|t!{^gjԿE%B}!t!mf>-տF 'B}a4!&hJ.{տFL tA}4!"?E5D@}4!3!mjC$e`/E'4uW!wDArf#l ELz0D@~!t!3!mjC$e#DGCWFxAr EL*D@~at!߽ i)ۓ`Q\~xAr ELS*D@~t!= i)`B;N~xAr ELt,D@~t!|3!mX0A_Ar EL0D@!t!3!m ĈE+)1p\?N_As ELs*D@at!޽ i)`!Q~xAs& EL*D@t!} i)˓`0x]~xAsF ELi,D@t!ڜ3!m{g?%ɐ_Asf EL*D@!t!D i[n%xAs EL0D@at!ڌ3!m ĈVYLtlxAs ELN!C4! 0R*cB6B626?&B4!mQi R%B!t!φr; @]%Bat!~XFI @%Bt!kΟwR A %Bt!_`e AL%B!t!6j ABJ%Bat!OFZ3WG! A%Bt!k B%Bat!܂H BK%Bt!Ze>R C %Bt!7P[kQ\ CLi%B!t!xUdee Cs%Bat!ԍa.Rgo Ck%Bt!,fy D %Bt!{Zyԃ DL%B!t!kt.`coS D]%Bat!&Q8 D %Bt!v(Ga̐ E Z*%Bt!UQ$7Y ELUl%B!t!'Z2 } Es%Bat!{^xqH EU%Bt!Ef E F s'B4!hJhgq FL eA!4!"?"Ca4! 0R*cB6B66267l&B4!.hJ %Bt!mf"OC @ɭ%B!t!{^8 @h%Bat! 'Z2P[kQ A 5W%Bt!}Q$0! ALRS%Bt!'v  A%B!t!A  AM%Bat!kt.{+" B v%Bt!{Zx4Q, BLJ%Bt!/,fX,a6 B%B!t!a.Rg]@ BU%Bat!xUdiFJ C %Bt!W }T CL\%Bt!Zi] C<%B!t!Xg C%Bat!VyRq D  @%Bt!N&Qz DL %Bt!k B%B!t! H Ba%Bat!Z{{Y>R C i%Bt!W*SE\ CL%Bt!xUd{{Ye C x%B!t!a.R[o CU%Bat!/,fHYy D K<%Bt!{ZG?ԃ DL%Bt!kt.y D %B!t!88 D?-%Bat!'vX E "%Bt!}Q$A EL7%Bt! 'Z2 EP%B!t!{^A H E%Bat!mf F  d'B4!.hJ FL `A4!"?"C!4! 0R*cB6UB6m26n&Ba4!hJ8Х L%Bt!EfHWiP @%%Bt!{^ @%B!t!'Z2*SEA %%Bat!UQ$ ALGB%Bt!vx A02%Bt!P*1A P%B!t!kt.@ԧo+"B %Bat!{ZQ,BLȲ%Bt!,fa6B%Bt!܍a.R[]@B)%B!t!xUd]FJC  %Bat!7TCL%Bt!Z@U]C%Bt!gCC"%B!t!V0̣mRqD %Bat!N8zDL%Bt!kU 6$&SxA EL2D@!t!zHo1YT ↵(A EL+2D@at!ޭdޒƀlC"~_A& EL2D@t!ܿbɢy|:d-_AF ELNHt!жv^@AE;^ .F{FB[1?B17 D 3"?FH@!t!4H<@AEH<DNF{DB[1?EO C"?*D@at!݌hyGT .~xA ELs*D@t!݌hyF[;/"} xA ELP0D@t!ؿBQt*uOT/ДfFvYxA ELJ*D@t!n/Дf`L`O&xA ELZ2D@at!ݩM+(vK]PS z=KZF{FB[1?EO 3"?J*D@!t!ߘ} ZY%q QxA EL-Q*D@at!ߘ} ZY%ʠxA EL~=Dj@t!҂@}t. "@-DT!?W`{0 b=Dj@t!r01Ѹ\1@!3|@ TP0 i=Dj@!t!r01Ѹt. "@K{Κ? Q>~O  =Dj@at!҂@}\1@0$+(W @4L6D0L2d,D@t!~hlX}'@b/\0HG,D@t!Ӣ}X}'@b/\0H-,D@!t!~hl]=u#@b/\0H,D@at!Ӣ}]=u#@b/\0Hϵ0D@t!ش^ϔA: lVL.A`A EL,D@t!)Y  lVL.xA EL<0D@!t!ڰ)Y a6>.A$`A EL!=Dj@at!FD|˫@ $+(W @,0L\}=Dj@t!m`|˫@oa2Z@TP02.D@t!C(Ok(XH9VxAf ELЭ0D@!t!C(@(XHh??A ELeX0D@at!5a'%I:7SbVH9VxA EL.D@t! OpekHpA ELR0D@t![' 1:{>HpA EL0D@!t!spC' 1 lVBXH9xA ELK*D@at!qQ V l$XHxA& EL=Dj@t!А]k&yBy-$@z7ЬsP1鴦@TP0=Dj@t!s>y-$@z7Ьs %+(W @QP0;*D@!t!@Cw9:ݹ]]0FxA ELT*D@at!v`cq: йb%2xA ELq2D@t!~cBQU.]0@J% xA EL[R2D@t!ߕETqB6L$CyD{  xA ELD,D@!t!'qAn}נ>йb%2xA EL,D@at!{^I-j@]0FxA& EL l2D@t!5p1]0@ #} xAF EL2D@t!ƀu]Ar (CW6{  xAf EL&=Dj@!t! At. "@-DT!??"2T@P0 =Dj@at!(A\1@`oQ@4L6D0L=Dj@t!ғZ8\1@!3|@£P0U=Dj@t!ғZ8n. "@ÅO ? Q>~O!C!4! X0R*cB6B626}&Ba4!2R0Z dA#@ /R%Bt!RWapi#@@ %Bt! ș^"s#@@5%B!t!#=յԙN#@A V%Bat!K#@AL>%Bt!RW`8gQ#@AG%Bt!җHHkК#@AC%B!t!yŊ:#@B 2B%Bat!?jz> #@BLU%Bt!B+n*#@BV%Bt!xtE2,: #@Bg%B!t!"=W8Z #@C {%Bat!rgk|HZ ouˬ#@CL%Bt!1&Tϥ#@CY%Bt!hbk5S*@&p Lc0d7{˚?j,<P@3 "?@VHt!XR{ܕJ @&p Lc0d7{˚?$v n?QD "?!C!4! 0R*cB6B7 27&Ba4!2R08@ %Bt!To @@%Bt!ax"O@@%%B!t!Ӕ 4M@A %Bat!2Rp!'@AL%Bt!RW`ItH %@A%Bt!hXE@A%B!t!"%\,e@B &%Bat! P<@BLK%Bt!Rף!Hg&@BX%Bt!2ǘ@82@B%B!t!7PpI8i4=@C B%Bat! -08ەI@CL%Bt!(›ԝ(U@Co%Bt!ÍI qa@C}%B!t!k9``m@D V%Bat!(αaשy@DL%Bt!X_@Do%Bt!rsiboS3@D%B!t!M|@E I%Bat!Hߪ@ELj%B¡t!wpP^F@Et%Bt!jh.Uf@E%B!t!C,}y.@F G'Ba4!h 8@FL 3Aá4!"?O"C4! 0R*cB7B7(27)&B!4!BhD=8@ ؈%Bat!~pg=@@`%Bġt!ؙ2W'CB@@.%Bt!6gș4/G@A p%B!t!躼`,L@ALU%Bat!8ȟڬ8Q@A-%Bšt!YX?FSV@A %Bt![#j"{[@B  %B!t!yE@`@BLQ'%Bat!BM]pSe@BZ%Bơt!Nd6Wk@B5%Bt!❅OTTp@C =%B!t!}uH\ov@CL%Bat!YX8&|@CeX%Bǡt!eb,@C%Bt!7g0@D o%B!t!@DL%Bat!c]ks@D_3%Bȡt!Dmd h@D %Bt!XXd|Faܠ@E !%B!t!(™TL>y@EL[%Bat!moԙRg@@E%Bɡt!=șJc2@EZ%Bt!a%_R@F 2B'B!4!2R08@FL Aa4!"?Qr"Cʡ4! 0R*cB7+B7C27D&B4!18@ s%B!t!Q"שW@@%Bat!lߐu<@@+g%Bˡt!xa$:N@A %Bt!-r xlM@AL_E%B!t!袋ld @Az%Bat!hbj`D@A%B̡t! QTJc6@B E%Bt!H/H:[ @BL@T%B!t!A8d3@B0%Bat! w,`@B>%B͡t!,#8>|@C z%Bt!1v@CL%B!t!2R($p@C%Bat!({{yk@C}%BΡt!(šWש)f@D 8%Bt!2%&؁ 4V`@DL_x%B!t!#=6ȁ[@D+%Bat!xhl¸({{bV@DJ%Bϡt!⬁>]?Q@E %Bt!+x"O-L@EL7%B!t!hbh>0},G@E%Bat!Q!|\I>B@EM%BСt!.pswwc=@F 'B4!E&`D=8@FL (9A!4!"?tV"Ca4! 0R*cB7FB7^27_&Bѡ4!wC<\ 8@ ª%Bt!r^\,}y.@@-v%B!t!Ĭ<\ǡl@@%Bat!XP^F@A %Bҡt!❅Tߪ@AL%Bt!袋XP>]@A%B!t!(e#@A%Bڡt!7FN`#@B %Bt!9HNSZ#@BLM%B!t!IR8j8T#@Bo%Bat!ib}EO#@B%Bۡt!(›\ j(s2I#@C 5%Bt!nx(P,DGC#@CL%B!t!7P20P=#@CWh%Bat!ؘ8b$q6P7#@C0%Bܡt!ůl<:F1#@D %Bt!eDDp94+#@DL%B!t!rHR%#@D(%Bat!xȁ^eT#@B X%Bt!Rעغ؁<}#@BL%Bt!a&_j#@B%B!t!❇MZPff#@B8 %Bat!ˏ@ir#@C %Bt!v.8ڬ#@CLu%Bt!#@Cx%B!t!3G,M#@C%Bat!-L8P#@D ö%Bt!rpDjH#@DLC0%Bt!۔ Th27#@D=%B!t! ?`8gݚ#@D%Bat!❇lۣ#@E `y%Bt!sgxDU#@EL %Bt!} 8*#@EY %B!t!Jlϐ:x#@Eb%Bat!BM^\#@F Ѵ'B4!1Z dA#@FL A4!"?8c-D@!4!!BMADFxxA#l ELO*D@at!!B0I4qdN& A ELQC*D@t!ؤHXHF(\FPQm#SxA EL,D@t!ؤHX8/4'a9 xA ELG*D@!t!!BǰMADFxA EL*D@at!Ƣ )8MADFxA& EL*D@t!ؤHX+񨃉8/4xAF EL-*D@t!t BkHy~8/4xAf EL,D@!t!!BH]0@d~OQLv=Dj@t!сQWu F"$@/!3|@ $]#`P0Q&=Dj@t!:}hȜL@-DT!?}i2P0Q0,D@!t!@Cw9:I-j@]0FxA EL^,D@at!'q N b%2xA& EL?2D@t!CZr8' 2= xAF EL2D@t!0Rm1:R XHj0  xAf EL>=Dj@!t!А]k&yL52u@z7Ьs>{Κ?){|OS v=Dj@at!sL52u@z7Ьs5}n+@ W`{0SLe,D@t!!BХI4ZhCxA EL%,D@t!!B#RHDdBP0c,D@t!l\YZ IϿxA EL?,D@!t!܅Y"Z IϿxA EL|,D@at!އyR8V xA& EL!C4! 0R*cB7B828;&B4! 㼍,U I&@ V%B!t!(?ZUcB&@@%Bat!xhWI<&@@f%Bt!H 9#pw6&@A %Bt!ŷb 0&@AL;%B!t!1ǘ&+&@A%Bat!ۘ_[`#@A %B at!1GK%#@AL-%B t!d/#@A%B t!˽c2~#@A%%B !t!w(v2TX}#@B %B at!ї;⼥rq40|#@BL[%B t!,5֙ {#@B%B t!+MĥZiTy#@By%B !t!ۘ:RjȥAa-x#@C %%B at!|̥Iw#@CL%B t!PTХ"fwv#@CH%B t!җХ}mu#@C.%B !t! 2fԥRt#@D %B at!gإ*z9s#@DL%B t!{bإ'[!r#@Dp%B t!-,ܥV q#@D_%B !t!Ȯܥ@>?o#@E Y%B at!"=ln#@ELH%B t!w(N C$m#@E%B t![X2Nt~l#@E%B!t!En+k#@F pb'Ba4!1GFj#@FL A4!"?^-D@4!խCW5JkG2F@hIA#l EL%!C!4! 0R*cB8=B8U28V!&Ba4!{`”oK#@ ή%Bt!7_?JH#@@%Bt!@|U0E#@@x%B!t!J>B#@A +%Bat!1G.?#@AL&%Bt!d*;,<#@AZ.%Bt!˽Ɨ!9#@A%B!t!w(v%16#@B q%Bat!ї;⼥dH3#@BL/N%Bt! yf0#@B~%Bt!+Mĥt!ԉ-#@B%B!t!ۘ:Rjȥ,*#@C Q%Bat!|̥'#@CLi%Bt!PTХ%#@C%Bt!җХ`G"#@C!Q%B!t! 2fԥ$l#@D %Bat!gإp#@DLnh%Bt!{bإ~f#@D4\%Bt!-,ܥؓ> <#@DO%B!t!Ȯܥ~#@E {%Bat!"=|"#@EL%Bt!w(NCq#@Eq%Bt![X2N6={H #@Eɚ%B!t!Eҋ #@F ;r'Ba4!1G?#@FL A4!"?z-D@4!խCW5JI9pFg VxAf#l EL|!C!4! 0R*cB8YB8q28rݺ&Ba4!1G:f#@ F%Bt!EFe#@@@%Bt![X2NR`!d#@@ %B!t!w(N,"۸tc#@A %Bat!"=@cF^b#@AL%Bt!Ȯܥ4Ga#@Ad%Bt!-,ܥ@L0`#@A]%B!t!{bإl_#@B k%Bat!gإ b^#@BL%Bt! 2fԥ~Έ\#@B%Bt!җХW[#@B %B!t!PTХkeZ#@C %Bat!|̥$/|Y#@CL-%Bt!ۘ:RjȥsX#@C%Bt!+MĥgRW#@C%B!t! HC/V#@D  k%Bat!ї;⼥_ U#@DL%Bt!w(v?GS#@D1%Bt!˽Xm!R#@D%B!t!dL׈Q#@E Lv%Bat!1GvWP#@EL%Bt!J>}w#O#@E'K%Bt!@|h;vM#@E%B!t!7䘏L#@F 'Ba4!{`”oK#@FL 2A4!"?gg"C4!0R*cB8tB828v&B!4!{`”a"@ 6%Bat!7.ɘö"@@b#%Bt!@|N}"@@}y%Bt!J>lr "@A ˩%B!t!1G̓8"@AL(V%Bat!dqj"@A:%Bt!˽?Q"@A%%Bt!w(vprܫ"@B a%B!t!ї;⼥\ٶ"@BL%Bat!^"@B%Bt!+Mĥ|d}l"@B%Bt!ۘ:RjȥA"@C %B !t!|̥>YU <"@CL %B at!PTХ o"@C%B t!җХxw+ݟ"@C%B t! 2fԥLK0"@D %B!!t!gإF3s"@DL%B!at!{bإ9rݚ"@D%B!t!-,ܥ< 5"@Dۤ%B!t!Ȯܥ "@E /%B"!t!"=ly"@EL%B"at!w(NB"@En%B"t![X2N6"@E˙%B"t!E <"@F  'B#!4!1G`O"@FL A#a4!"?1-D@#4!խCW5J]傓D' xAF#l ELz!C#4!+0R*cB8B828<@&B$!4!1GAI"@ j%B$at!Eg4"@@09%B$t![X2N>8"@@q%B$t!w(NDXH"@A ѐ%B%!t!"=UV"@AL%B%at!Ȯܥ<9"@AN&%B%t!-,ܥ "@Az%B%t!{bإܽ"@B %B&!t!gإƈ ["@BL C%B&at! 2fԥ$"@BV~%B&t!җХS"@B3%B&t!PTХ"@C %B'!t!|̥.7"@CL7%B'at!ۘ:Rjȥ€e"@C<%B't!+Mĥf"8"@C'%B't!9Y"@D %B(!t!ї;⼥ކ"@DL*%B(at!w(vk%8"@DW%B(t!˽蚄o"@DF%B(t!dJL"@E Sk%B)!t!1G/*"@ELR%B)at!J>Ԉ~"@Ew%B)t!@|"@Ept%B)t!7 ,ͻ"@F 'B*!4!{`”a"@FL A*a4!"?,"C*4!F0R*cB8B828W&B*4!{`”ݭ;`"@ %B+!t!"bL(`"@@ %B+at!1GX`"@@Q%B+t! -B2a"@A 3%B+t!"a"@AL%B,!t!-TZCKa"@A%B,at![X::bVe&b"@Ań%B,t!j[%Cwb"@B }%B,t![Y:Xb"@BLR4%B-!t!kbr-c"@B\%B-at!zp*XDhc"@B6%B-t!QW͚:c"@C 4]%B-t!.q^d"@CLX%B.!t!3jH.Wd"@Ca%B.at!>)Ψ$FT7d"@C%B.t! #.#d"@D @%B.t!m%8|Ce"@DL%B/!t!$uڬDe"@D%B/at!kb*ZHւe"@D}%B/t!QZv2w.f"@E c%B/t!jA[V|f"@ELe%B0!t!}Kbf"@E%B0at!k>+]g"@ES%B0t!z'dg"@F x'B04!{>g"@FL A1!4!"? 4-D@1a4!խCW5Juv83)DuY#A&#l ELM!C14!b0R*cB8B828&B14!1GB""@ ^%B2!t!Est"@@,%B2at![X2NڭWG"@@!%B2t!w(Nx0|"@A %B2t!"=RԊ"@ALK%B3!t!ȮܥVBU"@A%B3at!-,ܥ]Va"@AU%B3t!{bإ-ܑ~"@B %B3t!gإ]|"@BLC5%B4!t! 2fԥdJ8z"@BP%B4at!җХ} y"@B1%B4t!PTХqXw"@C Ld%B4t!|̥=.u"@CL%B5!t!ۘ:Rjȥs"@C3%B5at!+MĥZl>r"@C~%B5t!6p"@D G%B5t!ї;⼥yXn"@DL %B6!t!w(v('m"@D%B6at!˽4XؽBk"@D%B6t!dZayi"@E E%B6t!1G+̬e"@E %B7at!@|Ns"c"@Eȗ%B7t!75! b"@F t'B74!{`”ݭ;`"@FL A8!4!"?3D@8a4!խCW5JWZ kG2F*?2 cAϦ#l EL.0D@8t!խCW5JWZ dDXt5IxA EL*D@8t!P1))JjHy~EIVvDxA EL*D@9!t!P1))JjHy~r{ FxA ELӍ,D@9at!խCW5J[ FWy` xA& EL*D@9t!P1))JjHy~PޖFxAF ELe*D@9t!P1))JjHy~0!QpDxAf ELRI*D@:!t!խCW5J2 DJD] AІ EL*D@:at!խCW5J$F\3ywNxAЦ EL,D@:t!J$66Y xA ELR5!C:4!0R*cB8B929&B;!4!s`”RG@ Y%B;at!PB@@%B;t!:$`*@@G%B;t!`bz>ɺf@A r%B!t!ڝE^}@CL%B>at!wt@C%B>t!`b3G@C>%B>t!`bH R.@D <%B?!t!ѝ<,]}i@DL%B?at!p$<[@D[%%B?t!w(rzZ.@DU%B?t! 89ꜥ(L@E ;%B@!t! 7^=T@ELjl%B@at!zm֜yG@E9A%B@t!c_J_@E^%B@t!Iœ x^@F 'BA!4! (6>@FL ,AAa4!"?;/D@A4!۵CW5J~6%xt xAF#l EL!CA4!0R*cB9B9 29!&BB!4!!G)T @ x%BBat!E @@%BBt!KX2NV$@@V%BBt!w(Np8@A  %BC!t!=L@AL %BCat!Ȯܥf`@A%BCt!),ܥr@Al%BCt!sbإw@B c%BD!t!ygإ@BL%BDat!2fԥN@B%BDt!ʗХH@B!%BDt!@TХ5@C %BE!t!|̥ CH@CLwX%BEat!˘:Rjȥ ʩ@C+%BEt!Mĥm@C%BEt!Λ@D %BF!t!;⼥ }@DLI%BFat!w(v؅b@D%BFt! ˽?@Dt%BFt!yd Z@E /%BG!t!!Gpq@EL%BGat!:>]@E;%BGt!0|f;_@E*%BGt! 7|@F >'BH!4!s`”RG@FL $AHa4!"?"CH4!0R*cB9#B9;29<&BH4!s`”Vs_@ %BI!t! 7 n\@@-%BIat!0| VbX@@%BIt!:>?U@A #%BIt!!G8DR@AL.%BJ!t!yd/sO@A %BJat! ˽K@A}%BJt!w(v`D H@B F>%BJt!;⼥OE@BLH%BK!t!NB@B&%BKat!Mĥ(?@B%BKt!˘:Rjȥ|<@C AR%BKt!|̥FVIy9@CL{%BL!t!@TХ$hz6@C%BLat!ʗХ4Q3@Cb%BLt!2fԥ;2v0@D SG%BLt!ygإk-@DL!%BM!t!sbإd.*@D%BMat!),ܥPyaϳ'@D%BMt!ȮܥTw,$@E %BMt!=8U!@EL%BN!t!w(N@Ep%BNat!KX2N`3@E%BNt!Ec@F 'BN4!!GI(@FL 1AO!4!"?-D@Oa4!۵CW5JL+6 lxA&#l EL!CO4!0R*cB9?B9W29X}&BO4!!Gĝ@ t%BP!t!Ev @@%BPat!KX2Nώ@@'k%BPt!w(N$}g @A %BPt!=J@ALq %BQ!t!Ȯܥ<@AfM%BQat!),ܥP"4@Ah-%BQt!sbإl1i9@B _%BQt!ygإvb_p@BL%BR!t!2fԥ~߷@Bƌ%BRat!ʗХȑH@BsX%BRt!@TХLX]@C %BRt!|̥(* @CL%BS!t!˘:Rjȥr W@C>%BSat!Mĥ1(@C}6%BSt! L6ݕ@D H%BSt!;⼥l "@DLn%BT!t!w(v3@DW%BTat! ˽xJ@Dq%BTt!yd{R~@E %BTt!!G Kx@EL"%BU!t!:>8"1r@Es%BUat!0|WLl@E%BUt! 7H8e@F X'BU4!s`”Vs_@FL ?ZAV!4!"?"CVa4!0R*cB9ZB9r29s&BV4!s`”Ӝކ@ W3%BVt! 7QŠ@@$%BW!t!0|"Kz@@+%BWat!:>Hi* t@A %BWt!!G\n@ALI%BWt!yd g@Ai %BX!t! ˽ib@A%BXat!w(vԿ\@B z%BXt!;⼥BV@BL %BXt!qrtP@B%BY!t!MĥܱJ@Bt%BYat!˘:RjȥmD@C %BYt!|̥tZK?@CL%BYt!@TХW9@C$%BZ!t!ʗХ`d 4@C%BZat!2fԥxdr.@D o%BZt!ygإԓ(@DLZ%BZt!sbإp>U#@Dh%B[!t!),ܥt@D%B[at!Ȯܥ_I@E F%B[t!=ب>@ELgt%B[t!w(NHD @E %B\!t!KX2N@J)@E%B\at!Em@@F 'B\4!!Gd͝@FL ;MA\4!"?/D@]!4!۵CW5JA8ok8-^~ xA#l EL7_!C]a4!0R*cB9vB9296&B]4!!G /@ U %B]t!EGp@@%B^!t!KX2NQz@@ %B^at!w(Nޟ@A %B^t!=I3]@AL%B^t!Ȯܥl'Ǻ@A%B_!t!),ܥt/@A%B_at!sbإ4@B >%B_t!ygإP@BLz+%B_t!2fԥV_@BUN%B`!t!ʗХ[@B%B`at!@TХdK*@C %B`t!|̥\5w@CLXh%B`t!˘:Rjȥ_̥@C%Ba!t!Mĥt9@C%Baat!y^i@D Z6%Bat!;⼥삙@DLv%Bat!w(v "@Dʡ%Bb!t! ˽0)@D%Bbat!yd6Z\@E t%Bbt!!Gp Ƈ@ELL%Bbt!:>L-@E`%Bc!t!0|ЃŌ@E%Bcat! 7_ ։@F 'Bc4!s`”Ӝކ@FL Ac4!"?g"Cd!4!,0R*cB9B929M&Bda4!s`”@ ]%Bdt! 7%Z@@i%Bdt!0|Ԉɢ @@f%Be!t!:>>]@A i%Beat!!Gy@ALF?%Bet!yd|OU @A%Bet! ˽T>@Aq%Bf!t!w(vl|Ux@B %Bfat!;⼥@BL(%Bft!5@B^%Bft!MĥLJ@B)%Bg!t!˘:Rjȥ%@C Q%Bgat!|̥,}$@CL%Bgt!@TХ :J@C(%Bgt!ʗХq%@C?o%Bh!t!2fԥ|Xa@D %Bhat!ygإ4k@DL%Bht!sbإآ"@DB%Bht!),ܥ$8@D%Bi!t!Ȯܥ^K@E %Biat!=te @ELz%Bit!w(Nku@E4%Bit!KX2N]@E^%Bj!t!E=I@F t'Bja4!!G|@FL /Aj4!"?ё-D@j4!۵CW5J(Oxș8YnFxA#l EL+M0D@k!t!۵CW5JP5w`#%4dp [ixA EL2D@kat!۵CW5JP 5w(Oxș8.˒xA& EL.D@kt!ݷP1))Jj@y~ w":]AF EL*D@kt!ݷP1))Jj@y~LK3 8xAf EL`*D@l!t!۵CW5J9g8ZPNA ELX9*D@lat!ݷP1))Jj@y~6xA ELL*D@lt!۵CW5Jy6JSxA ELc*D@lt!ݷP1))Jj@y~ڒyg4xA ELh*D@m!t!۵CW5J P,6_"xA ELm!Cma4!Q0R*cB9B929l&Bm4![%!D*xhK%@ E%Bmt! .LP %M%@@9%Bn!t!i|N(TcN%@@%Bnat!)샠\1D P%@A s%Bnt!# dΒdQ%@ALm%Bnt!r@p0'iR%@AX%Bo!t! (px+3S%@A@%Boat!ژa U%@B M%Bot!`7L5V%@BLA%Bot!(qP $W%@B%Bp!t!}w(l nbX%@B}%Bpat!ZLD dY%@C h%Bpt!6N.jY%@CLt%Bpt!Z̬Z%@Ch%Bq!t!B#V[%@C%Bqat!0 k(P[%@D  %Bqt!|ę8' \%@DL%Bqt!8Qd̙6x#]%@D\%Br!t!+$1ԙ]%@Dd%Brat!uܙo ^%@E 7%Brt!Cd 2hj^%@ELB%Brt!zXۘu^%@Eo%Bs!t!s$4SՏ^%@E*%Bsat!&*_%@F &'Bs4!qÚQΒL_%@FL ڹAs4!"?1D@t!4!޷B 2 O\xf\JxA#l EL8!Cta4!m0R*cB9B9294L&Bt4!lB 0#Y%@ %Btt!jAlMY%@@%Bu!t!CxhX%@@m%Buat!bh\v\pX%@A |%But!4hW%@AL'%But!rd.~W%@A=%Bv!t!,5hdޚJW%@A0`%Bvat!D` 5V%@B %Bvt!Y`Hp9V%@BL%Bvt!& \YXO{U%@B^%Bw!t!sCD\hxoT%@B%Bwat!:Ԙ\r_T%@C %Bwt!QUX_۰S%@CLO%Bwt!2i4Xf^3S%@C03%Bx!t!sTKѽR%@C%Bxat!qTQ%@D s%Bxt!`hT||OSQ%@DLkG%Bxt!Th XPҪP%@D&%By!t!qPVO%@D%Byat!eLpMO%@E %Byt!&%LʐǗN%@EL%Byt!I_PHIPM%@EF%Bz!t!HMR M%@E|%Bzat!S,Dnbv]L%@F `F'Bz4![%!D*xhK%@FL eAz4!"?>"C{!4!0R*cB9B:2:&B{a4! fؙLxhK%@ _ %B{t!a#Mr %M%@@{%B{t!ycN%@@%B|!t!;ߏ}1D P%@A S%B|at!WbΒdQ%@AL9$%B|t!T"N'iR%@A%B|t!k +3S%@A`L%B}!t!KF,ۘa U%@B J%B}at!`8"5V%@BLٓ%B}t!!\Dּ $W%@B%B}t!;.6P8nbX%@B%B~!t!(LcZX$dY%@C %B~at!ihjdf.jY%@CLp%B~t!`YjpZ%@C%B~t!Z|#V[%@C_%B!t!p:P[%@D %Bat! #"L' \%@DL%Bt!y✙Jx#]%@DK%Bt!pC]%@D%B!t!)~fo ^%@E %Bat!"6"t 2hj^%@EL%Bt!iUęۘu^%@E2%Bt!z>ЙTՏ^%@EF%B!t!MRܙ,*_%@F c'Ba4!k ΒL_%@FL ?[A4!"?{1D@4!F2k*92 ueB(pf\JxAf#l EL!C!4!0R*cB: B:!2:"#&Ba4!͕ΒL_%@ B%Bt!Yf%$*_%@@%Bt!Z>\,SՏ^%@@8%B!t!,A4ۘu^%@A 8%Bat!8j 2hj^%@AL%Bt!]@o ^%@A?%Bt!;*aVH]%@Ai%B!t!`ꪁPDx#]%@B ~%Bat!ҷ XF' \%@BL%Bt!9߃`P[%@B%Bt!Psih#V[%@B@%B!t!pZ%@C 3%Bat!Vx`.jY%@CL%Bt!{8dY%@C%Bt!5\y2nbX%@C0B%B!t!94aм $W%@D N%Bat!qNV8U 5V%@DLh%Bt!P! ]ۘa U%@D%Bt!A\y+3S%@D%B!t!lL'iR%@E %Bat!K|ΒdQ%@EL%Bt!w%%I1D P%@E`%Bt!2>șcN%@E%B!t![ZMЙr %M%@F ^'Ba4! fؙLxhK%@FL ^A4!"?"C4!0R*cB:$B:<2:=&B!4!SrJtDxhK%@ `%Bat!S|j %M%@@)h%Bt!Ao) cN%@@%Bt!Z=D$1D P%@A %B!t!(ΒdQ%@AL x%Bat!:BD,>'iR%@A%Bt!x,+3S%@AB%Bt! O0ۘa U%@B %B!t! 좀45V%@BL%Bat!/8¼ $W%@B2%Bt!•8,<&nbX%@BS%Bt!iI%Bt!`SՏ^%@E%Bt!d*_%@F ,'B!4!$hΒL_%@FL HfAa4!"?3D@4!'24Nf\JxAF#l EL!C4!0R*cB:@B:X2:Y&B!4!P2c ΒL_%@ 2%Bat!R`#(*_%@@L[%Bt!"{n SՏ^%@@G%Bt!;UL, ۘu^%@A Do%B!t!8fO8p 2hj^%@AL6%Bat!s/ @o ^%@A,%Bt!)'mL]%@A3%Bt!kXFx#]%@B V%B!t!Rk_`H' \%@BL9%Bat!r7lP[%@BAe%Bt!mx#V[%@B%Bt! , Z%@C %B!t!3 `.jY%@CLQ %Bat!:LNdY%@CL\%Bt!Г?2nbX%@C!%Bt!{jLwм $W%@D L%B!t!Ǹ5V%@DLI%Bat!sQf/ęۘa U%@Dg%Bt!Й+3S%@Dz%Bt!SܙF'iR%@E pJ%B!t!Rk!ΒdQ%@ELk%Bat!"1D P%@E5%Bt!cN%@E$(%Bt!8 j %M%@F NN'B!4!SrJtDxhK%@FL uAa4!"?1D@4!ؖ4`:CUbf\JxA#l ELʫ!C4!0R*cB:\B:t2:u2&B!4!n 0tΒL_%@ %Bat!)d`x *_%@@݀%Bt!RxSՏ^%@@%Bt!w |ژu^%@A j%B!t!jEI耝R 2hj^%@ALF&%Bat!%o ^%@A%Bt!D]%@An3%Bt!*t$x#]%@B o%B!t!4&' \%@BLΎ%Bat!ܐP[%@B5=%Bt!#:1x#V[%@B%Bt! HTZ%@C y%B!t!#:.jY%@CL-%Bat! deܜcY%@C%Bt!BZb( nbX%@C%Bt!˃ !| $W%@D %B!t!vlԨ5V%@DL-%Bat!pL4ژa U%@D%Bt!$+3S%@Dz%Bt!b^u'iR%@E \%B!t!P<*ΒdQ%@EL4%Bat!:1D P%@E;%Bt!@ cN%@E|%Bt!C)>a8> %M%@F Q'B!4!AĝxhK%@FL Aa4!"?f3D@4!޷B 2Z7$txxf\J[&BF#l EL0D@t!#U : O xxf\J[&Bf EL,D@!t!Fv:Ѫ,J]FÍ xB EL+0D@at!tB؉2%Ѫ,J]FÍ xB ELZ*D@t!ݕ%2f\JxB EL0,D@t!xX2TѪ,J]FÍ xB EL,D@!t!֒\1:<Ѫ,J]FÍ xB EL.D@at!چb4H::%=f\JxB& ELr*D@t!3=v2ʎZf\JxBF ELZ !C4!0R*cB:B:2:&B!4!ptx8eS%@ h%Bat!*Ӿ`d ܤS%@@ %Bt!Qi tGPEWS%@@g4%Bt![HjS%@A %B!t!#xx8R%@ALU%Bat!{R¼hR%@A%Bt!"S@j;R%@A)$%Bt!brHQ%@B X%B!t!D>oQ%@BL]%Bat!M)Q%@B %Bt!)h:!P%@B'%Bt!P(:lP%@C %B!t!ˤ%^ P%@CL`J%Bat!஭@brO%@C%Bt!bsHĝI_O%@C%Bt!2\ĝ&pdO%@D %B!t!2ĝؘ3N%@DL 7%Bat!bsI|ȝ^$IN%@D%Bt!KEȝM%@DZ%Bt!:d̝ M%@E p%B!t!R8̝.tf(M%@ELj%Bat!̝nL%@EJ%Bt!9}hНQՙaL%@E%Bt!ک[Н[ZK%@F +'B!4!HdȘԝ2vhK%@FL -Aa4!"?"C4!60R*cB:B:2:[&B4!042vhK%@ г%B!t!ɸc4[ZK%@@%Bat!md8QՙaL%@@j%Bt!18nL%@A %Bt!Zh<.tf(M%@AL L%B!t!Kd(< M%@A%Bat!2YG<M%@Az%Bt!:L@^$IN%@B L%Bt!@ؘ3N%@BL%B!t!lD&pdO%@Bpb%Bat!mDI_O%@B%Bt!DbrO%@C %%Bt!UH^ P%@CL1%B!t!/H:lP%@C%Bat!M,L!P%@C{%Bt!jiL)Q%@D ߄%Bt!ک[oQ%@DL%B!t!ѩ)PbrHQ%@D=t%Bat![JHPj;R%@D%Bt!Cw?P¼hR%@E G%Bt!ФPTx8R%@EL%B!t!"S}BTjS%@E9%Bat!0TXGPEWS%@E߾%Bt!ʣUXd ܤS%@F D'B4!HTXx8eS%@FL A!4!"?٩3D@a4!ܲD)19:LkYД8GnJK%3jxB &#l EL;0D@t!uh2|R`8GnJK%3jxB F EL?0D@t!߁fg1:Yͪ,J\FÍ xB f EL3,D@!t!K`i2ͪ,J\FÍ xB ELD0.D@at!5y1 k*xf\JxB ELf !C4!V0R*cB:B:2:z&B4!J<ΒL_%@ {%B!t!*_%@@%Bat!؟MDSՏ^%@@8%Bt!hȨژu^%@A %Bt!,HZ 2hj^%@AL.#%B!t!̴o ^%@A҅%Bat!tT]%@A>Z%Bt!ȕL.x#]%@B 8%Bt!+EAhą0' \%@BL%B!t!rjȅP[%@B%Bat!heAЅ#V[%@Bp%Bt!0ԅZ%@C B%Bt!܅D.jY%@CL%B!t!҄dY%@C/%Bat!<nbX%@C-%Bt!. $W%@D 1%Bt!hc5V%@DLP%B!t!zژa U%@DE%Bat!њl+3S%@D͓%Bt!QZM}&'iR%@E %Bt!XcΒdQ%@EL%B!t!x1D P%@E,%Bat!}cN%@EU%Bt!}!F %M%@F 'B4! 59u$ xhK%@FL QA!4!"?q"Ca4!q0R*cB:B:2:&B4![ߌ xhK%@ C%Bt!KUH`F %M%@@%B!t!.cN%@@\%Bat!*̘1D P%@A /N%Bt!䜁ΒdQ%@AL=/%Bt!&'iR%@Av%B!t!"@訁+3S%@A%Bat!*аژa U%@B d%Bt!*5V%@BLb%Bt!+Ń| $W%@BNL%B!t! @nbX%@B%Bat!heCādY%@C sQ%Bt!XáD.jY%@CLG%Bt!qꔣPЁZ%@C%B!t!u[؁#V[%@C"%Bat!pZ܁P[%@D "x%Bt!ȕL0' \%@DLyn%Bt!+E@.x#]%@D(%B!t!0,]%@D^%Bat!APK|o ^%@E %Bt!+Ń4Z 2hj^%@EL%Bt!2JŻژu^%@E%B!t!??9SՏ^%@EO%Bat!KUJ*_%@F @>'B4!;OGAΒL_%@FL HA4!"?1D@!4!eB ɩ /xf\JxB#l ELr!Ca4!0R*cB:B; 2; Pj&B4!kJxhK%@ %Bt! $k0p %M%@@v%B!t! $ipcN%@@D%Bat!( 1D P%@A } %Bt!k!ΒdQ%@AL,(%Bt!57H'iR%@A%B!t!% +3S%@A9%Bat![ߏ$ۘa U%@B li%Bt![ߏ|,5V%@BLW%Bt!z^L0̼ $W%@B@%B!t!%8,nbX%@B:%Bat!<dY%@C 6%Bt!xDZ.jY%@CLa%Bt!B HZ%@C %B!t!X_?L#V[%@C%Bat!%1TTP[%@D R%Bt!cX>' \%@DLޘ%Bt!dt`' \%@BL$:%Bӡt!U-TP[%@B?%Bt!X#V[%@B%B!t! &ha`Z%@C s%Bat!1JDz dZ.jY%@CL8%Bԡt!!hdY%@C%Bt!8]qp,nbX%@CC%B!t!b`1t̼ $W%@D %%Bat!%|5V%@DL %Bաt!&݀ۘa U%@D.%Bt!k Ɉ+3S%@Dֆ%B!t!rH'iR%@E W%Bat!$ɔΒdQ%@EL%B֡t!&嘁1D P%@E%Bt! cN%@EX1%B!t!B Qp %M%@F 'Ba4!2JƹJxhK%@FL f"Aס4!"?|3D@4!9 :=xf\JK%4jxBf#l ELU0D@!t!eB ɩBٻ>xf\JK%4jxB ELG,D@at!SKYHѪ,J]FÍ xB ELw,D@ءt!ޔ!HѪ,J]FÍ xB EL:*D@t!ߔL<-7t,Xf\JxB EL,D@!t!I Ѫ,J]FÍ xB  EL=.D@at!ݢ! MxM&f\JxB & EL`,D@١t!fl Ѫ,J]FÍ xB F EL.D@t!d؂!xf\JxB f EL,D@!t!."Q"]SL~DFb$2xB EL6Q*D@at!uM1b$2 t.vB EL *D@ڡt!."Q"b$2 t.vB EL,D@t!tMA9PrH]0hHxB ELL,D@!t!iA"]0hH{ xB! ELn,D@at!tMA9]0hH{ xB!& EL2D@ۡt!ƀu]ArWkSrxB!F EL(2D@t!ߕETqB6hIrxB!f EL!z2D@!t!~cBQU/ O骶ZxB! EL2D@at!5p1 OZ-q`xB! EL*D@ܡt!v`cq: UxB! EL*D@t!@Cw9:ݹ] GxB! EL ,D@!t!'qAn}נ> UxB" EL,D@at!{^I-j@ GxB"& EL.=Dj@ݡt!҂@})0$+(W @4L6D0D=Dj@t!r01Ѹ$J{Κ? Q>~ODf6=Dj@!t!r01Ѹ)!3|@ TP0E  =Dj@at!҂@}$-DT!?W`{0ELq~,D@ޡt!~hl3Z$b/\DXH,D@t!Ӣ}3Z$b/\D\HJ,D@!t!~hlj*b/\D`H,D@at!Ӣ}j*b/\DdHr0D@ߡt!هt lVBfWEٕB#F ELWe,D@t!ڰ)Y2 lVBjfWExB#f ELE0D@!t!ڰ)Y2-3NjfWEYB# ELCn=Dj@at!FDѰ5# 78@W`{0GL=Dj@t!m`Ѱ5# K{Κ?/uUyGq?.D@t!ܦtZ:dI@DyݱzWawlxB# ELf.D@!t!pAy:)𜕅ݱzWawlxB$ EL 0D@at!Ay:.JLiwzW]B$& EL8.D@t!RA2 "ŅݱzWwlxB$F EL..D@t!ܒi2uqɅݱzWawlxB$f EL .D@!t!ۆ}|aQxфŅݱzWawlxB$ EL.D@at!ŻL9Y0D@at!)Y - aP@iwzW]B% ELO.D@t!$?: hiwzWB% EL.D@t!a:"F4iwzW]B% ELHl0D@!t!CZ: Y#@WB& EL0D@at!bI:R XIgwzWVHƥxB&& EL#~=Dj@t!(A$p,DT!?trT@P0L=Dj@t!(A)I[oQ@1L6D0Lڔ=Dj@!t!ғZ8)!3|@~£P0M =Dj@at!ғZ8$@GO ? Q>~OMLNk!C4!60R*cB;B;2;^[&B4!ؘNbLc?/$ %B!t!4*TLY-$@%Bat!"=VX1 o,$@%Bt!-L2`U+$A G%Bt!k']h xIF)$ALKY%B!t!ؘpd_Q~($AG%Bat!xhoæt2'$AR%Bt!-N|R%$B :j%Bt!'-LY$$BLy%B!t!7Rp_#$B?%Bat!AƐzʆ"$B;%Bt!8ȞZ֘> $C %Bt!rgjꠙMȣ$CL}%B!t!`0i$C%Bat!x*x/$C%Bt!2GYV$D %Bt!?*M$DL_M%B!t! ętcӌ$D: %Bat!7Pp̙3SkY$D%Bt!RWb6ԙZ'$E }P%Bt!}vؙLYN$ELP%B!t!~ $C=%Bat!8H_xŶ<$D =%Bt!h ;$DL%Bt!8H_y\9$D%B!t!J$~18$D%Bat! ?Z(AX{6$E )%Bt!}u>0!4$EL#,%Bt!8H_.8vȅz3$E %B!t!2@;2$E4Y%Bat!BDhౌ0$F 'B4!ؘNbLc?/$FL %A4!"? 6"C!4!l0R*cB;B;2;X&Ba4!$e$ G%Bt!xwYQܣ$@6X%Bt!"%\] m$@a%B!t!h}`:$A v%Bat!}Gy;+G $ALi %Bt! =+3S{$A%Bt!'ȯ a$A0%B!t!Rף[a$B %Bat!"ȭ d_a$BL%Bt!xtF|KG$B%Bt!h⩝E$DW}$B.B%B!t!rgh<=,qj$C  %Bat!"=W0la$CL%Bt!}8}@$CA%Bt!HRcyDS7-Ӎ$Cm@%B!t!4eL>L $D <%Bat!3Gڷ]T:aU*B %Bt!xv]TgO*BLH%Bt!rgh}LI*Bf%B!t!yDk0D*B%Bat!+8|KX>*C R%Bt!袋0r8*CL %Bt!8ȜX=,DWm2*C;%B!t!AE$|K,*Cd|%Bat! RG1&*D `%Bt!RW` Zpt *DL$%Bt!Rף[o_*D0%B!t!'ȯ F-C*D%Bat! =+XO *E %Bt!}Gy*ELb%Bt!hg*E %B!t!"%=)Ej"%Bat!xwY4S_)F  'B4!$ xI%)FL iA4!"?KD"C!4!0R*cB< B0> *AL%Bt! ?Z(T[o*A%Bt!J$E*A%B!t!8H_y2 kt*B P%Bat!h')*BL`%Bt!8H_xM*Bd%Bt! <)kC*B%B!t!|ˊ=*C %Bat!E)9m*CL%Bt!V'yÎ*C%Bt!HR`x*C<%B!t! QB*BLd%B at!GZ@֌ *B%B t!h⩜2O5Դ*B^%B t!;*C "=%B !t!$LAa*CLb%B at!sg~ޘt%*C%B t!xΐM*C %B t!ؘ̾z&*D %B !t!Mi"a*DLs=%B at!HRb|*D>%B t!❆ϪtyѪ*D n%B t!wqpeᅩ*E 0S%B!t!h 7*EL %Bat!x"`i6*E_<%Bt!7SsX7)6*Ew%Bt!8Ȝ*T>*F #'B!4!ؘNbLz*FL (UAa4!"?_"C4!0R*cB*@!%Bat!-"*@%Bt!7,Q *A ~%Bt!e7*ALM%B!t!b]d}9v*Az%Bat!+W!Ъ*AzE%Bt!5$܁*B %Bt!ԁE9`*BL%B!t!1́*Bj$%Bat!b]g>āc?A*B%Bt!c]Ҽs#*C A%Bt!1To_*CLT(%B!t!rA;+*C#%Bat!#=6~z/%Ӵ*CuE%Bt!q*R* *D ]%Bt!")\9m*CLǏ%Bt!OT=*C=Y%B!t!GPkC*C.p%Bat!k$'HM*D d%Bt!3G@#*DL@"%Bt!k$<2 kt*D%B!t!=*4tc*D%Bat!D/O,T[o*E %%Bt!Pk(> *ELC%Bt!k${ gAB*E,%B!t!8H^:w:*E%Bat!wqCg7)w*F Jz'B4!ˍG z*FL hA4!"?f"C!4!0R*cB*C%B t![ ^,0Қ0D*C+%B!!t! s{I*D n%B!at!h_HO*DL&%B!t!"ʭ M8aU*DLI%B!t!rpG7)Z*D2%B"!t!"ȮK3`*E %B"at!RWc'ԁtcf*EL%B"t!ˍ ȁ|ejk*E{>%B"t!'˭ ǿp*E|#%B#!t!8Vv*F /'B#a4!ˠ1{*FL [A#4!"?2YYH#4!㔬xQWG&0&p~Lc0d7{˚?)j,<Χ3!" "?I6VH$!t!㔬x^o&pvLc0d7{˚?7#mH n?QD !""?!C$a4!-0R*cB$B%B.!t!OT\]?$C 2%B.at! >)\JA$CL%B.t!"=W`W9N@C$C%B.t! hz/%D$C%B/!t!Gp7)VF$D %B/at!tUZH$DL%B/t!RWb |b#J$De%B/t!XXd=、,K$DBp%B0!t! IjM$E %B0at!0CmijmO$ELsF%B0t!6ːy?Q$E%B0t!z;- S$E\%B1!t!ɏK3+T$F K'B1a4!ˠZV$FL xA14!"? "C14!c0R*cB~OL.D@;t!!B~}] OvrxBQF EL>=Dj@;t!:}ho Vj#nS2@4L6D0+*D@z*D@=t!Ƣ )8jtIxBRF ELP*D@=t!!BjtIxBRf EL y*D@>!t!'qx% UxBR EL *D@>at!@Cw9:3 s GxBR ELw*D@>t![H: ݝ UxBR ELU.*D@>t!ݴ#^IjI- GxBR ELM0D@?!t!ڀz$@SdG}%>>BS EL 0D@?at!5a'%I:L ʔbG:~$TxBS& EL(`=Dj@?t!А]k&y摯# z7Ьsj1鴦@ TP0+=Dj@?t!s摯#]z7Ьs$+(W @QP09,D@@!t!!BQvI,UT xBS ELܳ,D@@at!!B|?pKAk%`xBS EL6,D@@t!!Bq[QT xBS EL[,D@@t!!B|?pKtpo`xBS EL C2D@A!t!!BEHRTJRmq,U&s'&BT ELN2D@Aat!!BEHRTJR74vI[E^xBT& EL5DZ@At!w"RHd*z7ЫsS@,D@At!J%APD2S^56-`xBTf EL5DZ@B!t!w"4m$z7Ыs*! ,D@Bat!J%APD2S#xBT EL,D@Bt!J/7I#xBT ELa0D@Bt!ARL! Ԓ'.:LL8)WѼ)xBT EL0D@C!t!ARL! p>L8)W<)xBU EL.D@Cat!ijqd8)W<)xBU& EL.D@Ct!ijh?d8)W @W`{0 ,D@Eat!܅Y"<-D{%Z;xBV& EL$,D@Et!pQh&NH0)?N;xBVF EL5*0D@Et!ہ:a"&!s0)?N; V^xBVf EL2D@F!t!pQ<-D0)?N; V^xBV EL=Dj@Fat!3Tr+ȴ"^-DT! @Pe0Lf5DZ@Ft!Ӂ[+ȴ"^aa@,D@Ft!܅Y"{%Z;EEZ`xBV EL,D@G!t!l\Y{%Z;EEZ`xBW ELT,D@Gat!wȜ H9Ў_xBW& EL,D@Gt!6"P`BP0u,D@Ht!w9Ў_y `xBW EL ,D@I!t!#"p"9Ў_wy `xBX EL*D@Iat!J^)I:BX& ELo!CI4!0R*cB='B=?2=@&BI4!s`”GV$ %BJ!t! 7ڂEX$@)U%BJat!0| DY$@ %BJt!:>*Z$A c%BJt!!GI;\$ALqA%BK!t!ydIQ]$A%BKat! ˽A^$A%BKt!w(v"7_$B %BKt!;⼥TN`$BL%BL!t![θ'b$BZ%BLat!MĥVc$B#%BLt!˘:Rjȥ 釗d$C 6%BLt!|̥Eae$CL&%BM!t!@TХ%Hjf$Ct"%BMat!ʗХ7g$Cm%BMt!2fԥb$i$D %BMt!ygإ0Ij$DL%BN!t!sbإxfmk$DI%BNat!),ܥw`l$D%BNt!Ȯܥ'%Km$E w%BNt!=j{ n$ELl%BO!t!w(NSo$E%BOat!KX2NEq$EY4%BOt!E9r$F "'BO4!!G0L[s$FL  AP!4!"?-D@Pa4!۵CW5JȮ)I- B[#l EL[!CP4!0R*cB=CB=[2=\|&BP4!s`” Ėz$ -}%BQ!t! 7k 'Ԗ$@%BQat!0|Կ$@%BQt!:>m%$A S%BQt!!GV $ALJ%BR!t!yd3 $A/%BRat! ˽lu2$AXC%BRt!w(vۘ$B %5%BRt!;⼥Q$BL%BS!t!c'Į$Br%BSat!MĥEQ$BG%BSt!˘:Rjȥ0~{$C Q<%BSt!|̥ByO$CL %BT!t!@TХor$Cv%BTat!ʗХq$C_%BTt!2fԥ8y$D @%BTt!ygإw$DL%BU!t!sbإ~S:$D-z%BUat!),ܥyo$D %BUt!Ȯܥ!L$E -%BUt!=j 3y$EL%BV!t!w(N6$EC%BVat!KX2N,?$E%BVt!EȄ$F ('BV4!!GlJeq$FL wAW!4!"?-D@Wa4!۵CW5J2XI8;Y/3xB_&#l ELo!CW4!0R*cB=_B=w2=xB&BW4!!G}Kw$ H%BX!t!Emx$@lX%BXat!KX2N^hy$@xz%BXt!w(NIz$A Z%BXt!=2^{$AL%BY!t!Ȯܥ(|$A}%BYat!),ܥ84~$Au%BYt!sbإl.:$B @%BYt!ygإ ]$BLjx%BZ!t!2fԥ0$B%BZat!ʗХUv$B"%BZt!@TХhJ{2Ѓ$C (%BZt!|̥6!4$CLCi%B[!t!˘:RjȥE#$Ch%B[at!Mĥ#P$C%B[t!Ԙ$D x%B[t!;⼥H+G$DL%B\!t!w(v0]$Dr%B\at! ˽S$D(%B\t!yd:xKV$E 3%B\t!!GC蚓$EL%B]!t!:> jԏ$E%B]at!0|Ϥ#$EE%B]t! 7u+Ta$F B'B]4!s`” Ėz$FL x3A^!4!"?Z"C^a4!0R*cB=zB=2=u&B^4!s`”_}% %B^t!*G& |%@]%B_!t!5}k|%@ߓ%B_at!=☥j{;|%A %B_t!j:t{%AL%B_t!7 ?@v4{%As%B`!t!jg✥[a{%Al%B`at!ڝj2t{%B ֨%B`t!(~ƒcz%BL%B`t!xƠoz%B%Ba!t! ({Bz%B %Baat! 8 #J/!y%C %Bat!=@y%CLV%Bat!2¤ly%C%Bb!t!E-&y%C)%Bbat! ,.ьx%D |z%Bbt!7 E^!x%DL%Bbt!w*Rx%Dp%Bc!t!!Ssƀ x%D%Bcat!˘9ڬ`w%E %Bct!x]փw%EL%Bct!3Ű;w%EЈ%Bd!t!$:ȱ v%Er%Bdat!!RqtҰv%F 'Bd4!AZfñkv%FL  5Ad4!"?-D@e!4!۵CW5JlK5L6~Bf#l ELs!Cea4!10R*cB=B=2=z~&Be4!!Go{T% -%Bet!E eXSV%@4%Bf!t!KX2NW%@%Bfat!w(N*ыY%A +%Bft!=?'[%ALą%Bft!Ȯܥ4\%A`%Bg!t!),ܥg0a^%A%Bgat!sbإ63 _%B d%Bgt!ygإM a%BLl%Bgt!2fԥie>c%Ba%Bh!t!ʗХ}d%BU3%Bhat!@TХf%C  %Bht!|̥5J2T+h%CLx%Bht!˘:Rjȥ-\i%CP%Bi!t!Mĥ[hw%E%Bk!t!0|vjy%Eg%Bkat! 7;r={%F Ҵ'Bk4!s`”_}%FL @Ak4!"?"Cl!4!L0R*cB=B=2=ʵ\&Bla4!s`”҂jw&% %Blt! 7Ŧ~(%@'%Blt!0|k.Sj*%@K%Bm!t!:>G8,%A %Bmat!!G/Z.%AL%Bmt!ydI/%A%Bmt! ˽FI1%Am$%Bn!t!w(vs#]<3%B F%Bnat!;⼥Z+N4%BL"%Bnt!g36%B/%Bnt!Mĥ[B6T8%B<%Bo!t!˘:RjȥZ:%C c]%Boat!|̥Xb;%CLr%Bot!@TХ@@8O=%Cx%Bot!ʗХad:>%C%Bp!t!2fԥ|_@%D =%Bpat!ygإb6B%DL%Bpt!sbإgiC%DbU%Bpt!),ܥXz#BsE%DzU%Bq!t!Ȯܥ\>G%E %Bqat!=H%EL6%Bqt!w(N* HJ%E%Bqt!KX2NfK%E%Br!t!EI}ЀM%F 'Bra4!!GfO%FL [Ar4!"?/D@r4!۵CW5JG#I0xBl#l EL!Cs!4!h0R*cB=B=2=x@&Bsa4!!Gٶ$ &%Bst!Erw$@9%Bst!KX2Ntw$@~%Bt!t!w(N75$A %Btat!=-f1$ALپ%Btt!Ȯܥ)$A%Btt!),ܥ=a_p$AtW%Bu!t!sbإR11$B X%Buat!ygإL$BLH%But!2fԥ[?$Bs%But!ʗХj$B{:%Bv!t!@TХM%C %Bvat!|̥ x%CLF%Bvt!˘:RjȥRG[%C)%Bvt!Mĥ,E %C%Bw!t!T %D %Bwat!;⼥A%DLN%Bwt!w(vkh@u%D%Bwt! ˽nlf%DT%Bx!t!ydNC_%E O%Bxat!!G_%ELVs%Bxt!:>h%E%Bxt!0|1z{ %E%By!t! 7]#%F z'Bya4!s`”҂jw&%FL !Ay4!"?3D@y4!۵CW5J3XyoȮ)IR.߄Bpf#l ELl0D@z!t!۵CW5J3Xyo3 2> /X&B|4!s`”*nRV$  %B|t!+H=dV$A x%B}t!x@vN5W$AL%B}t!)MnnW$A%B~!t!pVg 6W$A%B~at!Z{B2VpW$B %B~t!AW&X$BL %B~t!{r%%ۿOX$B*%B!t! u 'X$B%Bat!ڝZҜwX$C %Bt!l oX$CLG%Bt!wOq/Y$C@i%B!t!tr "gY$C %Bat!N' Y$D '%Bt!=&Y$DL:%Bt!)w Z$D%B!t!°֤{DZ$D%Bat!IE*y{Z$E b%Bt!(NZ$EL%Bt!2R|iqZ$E%B!t!" Ol [$E6%Bat!r6tzW[$F }'B4!+P¨A̤%[$FL A4!"?F"C!4!0R*cB> B>%2>&r&Ba4!s`”@}% %Bt!PB{H}%@܎%Bt!:ԁ}%@y%B!t!`bz>Mc}%A %Bat!놺P!F}%ALC%Bt!ۢ=#:hY(}%A%Bt!zG }%A>%B!t!ʗ2|%B %Bat!.4q|%BL%Bt! *Ju|%B4%Bt!@RU=#C˓|%B/%B!t!P:"հ2v|%C %Bat!ڝ<X|%CL.%Bt!wK!^ ;|%Cm%Bt!`b3|%C[%B!t!`bH A-|%D '%Bat!ѝ<o{{%DLC}%Bt!p$^{%Do%Bt!w(r[F{%Dۻ%B!t! 89ꜥyT{%E %Bat! 7^"l{%ELG%Bt!zm֜{O{%Eqb%Bt!c_JӽY2{%E.%B!t!Iœ{%F 6'Ba4! (6az%FL gA4!"?"C4!0R*cB>(B>@2>A`&B!4!$ViHB>`2>a &B!4!s`”HN|U) &%Bat! 7:yV)@7%Bt!0|V3!X)@%Bt!:>&AY)A %B!t!!G׃Bd_Z)ALQ%Bat!ydnqy[)A%Bt! ˽\)A%Bt!w(v])B U%B!t!;⼥ru^)BL@%Bat!o_)Bv%Bt!Mĥ:Z\`)B\%Bt!˘:RjȥdB>|2>}y&B!4!s`”;֋) >%Bat! 71)@%Bt!0|pS)@%Bt!:>)A  a%B!t!!G!)AL%Bat!ydA)A3%Bt! ˽q)A+Z%Bt!w(vt{)B =%B!t!;⼥*&)BLL%Bat!}¦)B4 %Bt!MĥB)Bb%Bt!˘:Rjȥ6p)C r^%B!t!|̥(?)CLh%Bat!@TХʞ )C%Bt!ʗХX Ѵ)C%Bt!2fԥ_2)D Li%B!t!ygإKnV)DLq%Bat!sbإ@k)D%Bt!),ܥCqѿ)D$w%Bt!ȮܥHvj)E %B!t!=^F)EL+%Bat!w(Nf6)E%Bt!KX2N4b} )E#%Bt!EBBr)F ]]'B!4!!G"N-)FL @Aa4!"?-D@4!۵CW5J!3,S'\xBF#l EL3|!C4!0R*cB>B>2>&B!4!!GQ1'r)  !%Bat!E&$/s)@U%Bt!KX2N;t)@q%Bt!w(Nëŭu)A %B!t!=H&cv)ALh%Bat!ȮܥbYLw)A%Bt!),ܥx)An%Bt!sbإDi)Ey%Bt!0|^)E%Bt! 7O )F }'B!4!s`”;֋)FL HAa4!"?"C4!60R*cB>B>2>&B4!s`”* %B!t! 7E*@+%Bat!0|;!*@G1%Bt!:>K#*A G%Bt!!G&%*ALw%B!t!ydq'*A%Bat! ˽'ת{)*A-?%Bt!w(vңS+*B ,%Bt!;⼥d{2'-*BL%B!t!H .*BR%Bat!MĥTf0*B(%Bt!˘:Rjȥup^2*C w%Bt!|̥ήP4*CLg%B!t!@TХ6*C%Bat!ʗХR7*CSO%Bt!2fԥ.N9*D %Bt!ygإN;*DL>%B!t!sbإ讝 =*D%Bat!),ܥ@>*D1%Bt!Ȯܥ{@*E %Bt!=@3B*EL%B!t!w(N4#C*Ecg%Bat!KX2NXCE*E@%Bt!E![G*F ?Y'B4!!GrI*FL A!4!"?h/D@a4!۵CW5J|DOSe `xB&#l ELh!C4!R0R*cB>B>2>д&B4!!GV\a) %B!t!E% a)@`%Bat!KX2N4w)@i%Bt!w(Nܓs)A 1%Bt!=xQ)AL%B!t!ȮܥEH)A%Bat!),ܥSñ>)AL%Bt!sbإ& )B w%Bt!ygإ#+~)BL^%B!t!2fԥL ?)B%Bat!ʗХQ)B%%Bt!@TХݏ )C M%Bt!|̥wT)CL%B!t!˘:Rjȥ0yd)C%Bat!Mĥ?8*C%Bt!]2*D %Bt!;⼥ʉ*DL=Z%B!t!w(vXl4*D%v%Bat! ˽WZ *D%Bt!ydk ﮷*E %Bt!!GF*EL-%B!t!:>j*E;%Bat!0|q\*Er%Bt! 7tLR~*F e'B4!s`”*FL J A!4!"?1"Ca4!m0R*cB>B>2>&B4!s`”"z* %Bt!Δ2}ty*@%B!t!*ѸҘM_by*@da%Bat!w*Θsy*A $%Bt!qm'œjLFx*AL6%Bt!񚲜$4Ex*A%B!t!x+w*A#%Bat!f>v w*B *%Bt!eTN"yR+w*BLu%Bt!1>Mv*BS%B!t!Y]S椥68qv*BN%Bat!-Mv*C =%Bt!Q]b+u*CL%Bt!Ny>\u*C.@%B!t!kh!ƾꫣu*C%Bat!yb ;t*D %Bt!z&pJt*DLo%Bt!7疰bs*D%B!t!x+"jGs*D^=%Bat!+SΪYJB?2?o&B4!!G,{ O* e%Bt!EܰP*@}[%B!t!KX2N|h}R*@%Bat!w(N.5T*A %Bt!=2=U*AL %Bt!ȮܥJ辤W*A&%B!t!),ܥj]Y*A4%Bat!sbإr [*B 9c%Bt!ygإ/!\*BL%Bt!2fԥZQ^*B %B!t!ʗХLyL`*B%Bat!@TХh b*C S%Bt!|̥b c*CL\(%Bt!˘:RjȥLe*Cz%B!t!Mĥp]g*C%Bat!*;)i*D ]%Bt!;⼥:$mj*DLo%Bt!w(v_ l*D%B!t! ˽ n*D%Bat!ydˎp*E  %Bt!!G($cr*ELv%Bt!:>Jt*E%B!t!0|76v*E%Bat! 7-P)x*F 'B4!s`”"z*FL 'A4!"?JE3D@!4!۵CW5J_e ;S<BlB#l EL0D@at!۵CW5J_eef$U?8{xB EL.D@¡t!P1))JjHy~ ӐDUxB ELv*D@t!P1))JjHy~dQkSxB EL~5*D@!t!խCW5Jr[SSߥQ3B EL.D@at!P1))JjHy~SFxB& ELv.D@át!P1))JjHy~y͝:UgmBF ELJ.D@t!խCW5JkP۔ &U7{Bf ELw*D@!t!۵CW5J>*SK9GLxB EL!Ca4!0R*cB?B?*2?+&Bġ4! õ]93@, w%Bt!+?W̿B,@%B!t!+?אr.C,@%Bat!jkRE,A %Bšt!b7KxN]F,AL%Bt!Ct?;l64G,A;O%B!t! ö_G`H,AxJ%Bat!jksTf,J,B %Bơt!)j;HvK,BL%Bt!3@*~L,Bi%B!t!84/qM,B^%Bat!/#(x%M,C ~%Bǡt!<5N,CL·%Bt!>t{tdO,Cd%B!t!$;ROP,C%Bat!Hd nP,D %Bȡt!Jd6ԑQ,DLX%Bt!9R,DI%B!t!JfؙBZR,D%Bat!Ф۲̙l:S,E %Bɡt!3ę@3cS,EL%Bt!{~f@S,E5%B!t! ν⢬XZS,E%Bat!+?.t#T,F U'Bʡ4!qy NyET,FL A4!"?P3D@!4!U7z>pi:ILLS YzBB#l ELo!Ca4!0R*cB?.B?F2?GZ&Bˡ4!Qi 84:yET,  %Bt!9p=0p.t#T,@%B!t!#e40,FZS,@/%Bat!Hdʬ$T@S,A o%B̡t!کY, @3cS,AL%Bt!4pk:S,A\%B!t! 2ZR,Af%Bat!)j89R,B wf%B͡t!곭[ 6ԑQ,BL6%Bt!(TxmP,B%B!t!ROP,B%Bat!YG tdO,C _%BΡt! 7<5N,CLV%Bt!Mn%M,C %B!t!>w7/qM,C3%Bat!ک[w"~L,D %Bϡt!ܙpK,DLbo%Bt!ԙ`,J,D%B!t!$ЙH,Dq%Bat!Qi ș64G,E %BСt!ęJ]F,EL-%Bt!DzüRE,E%B!t!9r=r.C,Ex%Bat!9r?W̿B,F H'Bѡ4! õ]93@,FL !A4!"?t"C!4!0R*cB?IB?a2?bV&Ba4!{~\93@, 1%Bҡt![uT̿B,@-O%Bt!9}5Pr.C,@Ȓ%B!t!. HRE,A 3%Bat!$DJ]F,ALM%Bӡt!0<64G,A%Bt!8H,AG%B!t!.0`,J,B %Bat!.),pK,BLd%Bԡt!Y$"~L,B%Bt!V- /qM,B%B!t!jkn%M,C &%Bat!zyN-<5N,CLh%Bաt!9p< tdO,C%Bt!KEROP,C%B!t!QJ)QmP,D %Bat!6ԑQ,DLJ.%B֡t!c09R,D1%Bt!$2ZR,D %B!t! Y3$k:S,E `%Bat!@3cS,ELe%Bסt!1C$T@S,EQM%Bt!dܙFZS,E1%B!t!Yؙp.t#T,F 'Ba4!\Й:yET,FL ΍Aء4!"?h#1D@4!چt2iU`cy YBB#l EL:!C!4!0R*cB?eB?}2?~qo&Ba4!Ļ:pNyET, 5%B١t!RiK2d.t#T,@%Bt!as .\XZS,@}.%B!t! ÷]&Pf@S,A %Bat!N"D@3cS,ALJ%Bڡt!#8l:S,Ai%Bt!;^0BZR,A%B!t! $9R,B %Bat!;^6ԑQ,BLY%Bۡt!1A& nP,B8%Bt!ROP,B-%B!t!U,UtdO,C d%Bat![H <5N,CL6%Bܡt!ѩx%M,Cq%Bt!jsJ9ԙ/qM,C%B!t!Nș*~L,D %Bat!cvK,DL:%Bݡt!MYf,J,D{%Bt!{~H,DS0%B!t!{Q64G,E %Bat!$kN]F,ELu%Bޡt!OMRE,E1%Bt!RiJtr.C,Eq%B!t!RiJuh̿B,F m'Ba4!{~\93@,FL Aߡ4!"?cd"C4!0R*cB?B?2?&B!4!HdȘԝv93@, %Bat!`D̝̿B,@w%Bt!`ȝq.C,@%Bt!JeRE,A %B!t!\3(]F,AL%Bat!Q}64G,A4%Bt!ɺcH,AO%Bt!JeԨB,J,B f%B!t!`7SK,BLr%Bat!H(~L,BR%Bt!Zhdk/qM,BB%Bt!;@X%M,C O%B!t!.m<5N,CL>V%Bat!#wTsdO,C7%Bt!!ROP,C%Bt!! |mP,D %B!t!ptΌt6ԑQ,DLֶ%Bat!;!p9R,D %Bt!:gxh'ZR,Df%Bt!0dk:S,E w%B!t!Hp`@3cS,EL[Z%Bat! ö^XN@S,E*%Bt!!%Bat!.m L(]F,EL#Z%Bt!;^HRE,E%Bt!!R@q.C,E'%B!t!Є<̿B,F 'Ba4!04v93@,FL  ;A4!"?%3D@4!ٓU :LkY' YGiBf#l ELg0D@!t!B 2|R' YGiB EL50D@at!߁fg1:YSgY=) vxB ELU,D@t!GeY2SgY=) vxB EL4h.D@t!sDȑ:MޏM YBB ELp.D@!t!Uy)24aIXS YzBB EL,D@at!sTH2SgY=) vxB& EL9,D@t!K`i2SgY=) vxBF ELQO*D@t!#%128y YxBf EL!C!4!\0R*cB?B?2?V&Ba4!qk93@, %Bt!3̿B,@%Bt!ӳr.C,@%B!t![ԁRE,A %Bat! c'ȁN]F,AL%Bt!q *o64G,AD%Bt!qh#H,A]j%B!t!Of,J,B \%Bat!@gvK,BL0%Bt!b*~L,Bn%Bt!o/qM,BX%B!t!HDxx%M,C  U%Bat!U=l<5N,CL%Bt!k &S`tdO,C_%Bt!;'TROP,C %B!t!1:H nP,D %Bat!{@6ԑQ,DLoy%Bt!kf 49R,DI%Bt!x(BZR,D%B!t!;uYl:S,E %Bat!bȇ@3cS,EL@%Bt!JĹf@S,E7%Bt!l~XZS,E%B!t!v.t#T,F 'Ba4!E8nNyET,FL A4!"?3D@4!! |V7t@U YBB#l ELA!C!4!x0R*cB?B?2?7&Ba4!57:yET, 6l%Bt!a&ip.t#T,@,%Bt!0d|FZS,@%B!t!18tU@S,A  %Bat!Az^p@3cS,AL%Bt!["hk:S,Ax%Bt!!d3ZR,A b%B!t!@dt`9R,B '%Bat!QcX6ԑQ,BL%Bt!!1TTmP,B%Bt!_?LROP,B%B!t! H tdO,C %Bat!rxD<5N,CL[%Bt!<o%M,CO%Bt!k %8/qM,C%B!t!Az^L0"~L,D  %Bat! ߏ|,pK,DLx%Bt! ߏ$`,J,D@P%Bt!;% H,DWO%B!t!5764G,E  %Bat!!J]F,ELo%Bt!{( RE,E%Bt!a$ipr.C,E%B!t!a$k0̿B,F 'Ba4!qk93@,FL qaA4!"?F"C4!0R*cB?B@2@Zj&B!4!Jƹ93@, %Bat! Q̿B,@:%Bt!b r.C,@%Bt!K&嘁RE,A i%B!t!;$ɔJ]F,AL47%Bat!r64G,A4%Bt! ɈH,A]%Bt!K&݀`,J,B '%B!t!K%|pK,BL2%Bat!`1t"~L,Bx%Bt!]qp/qM,Bb %Bt!ho%M,C B%B!t!FDz d<5N,CLu%Bat!a&ha` tdO,C֞%Bt!XROP,C1$%Bt!U-TmP,D %B!t!ZοL6ԑQ,DL%Bat! H9R,D6%Bt!;$D3ZR,D%Bt!^<k:S,E %B!t!`y8@3cS,EL%Bat!S0U@S,E%Bt!*u,FZS,Et%Bt! (p.t#T,F q'B!4! m ;yET,FL Aa4!"?[1D@4!4L<-y{ YBB#l EL!C4!0R*cB@B@,2@-o&B!4!{jNyET, b%Bat!6%B!t!qhȨN@S,E(%Bat!MD@ZS,En%Bt!˿l.t#T,F 'B4!hJ<8yET,FL wA!4!"?m1D@a4!P9 LM'' YBB#l EL.D@t!؂!rkNO YBB EL!C4!0R*cB@LB@d2@e>U&B!4!KGA8yET, c%Bat!QJl.t#T,@W%Bt!;?9@ZS,@,%Bt!JŻN@S,A d%B!t!Ń4@3cS,AL%Bat!LK|k:S,A}%Bt!0,(ZR,Ad%Bt!A@9R,B %B!t!xL6ԑQ,BL%Bat!1pZ܁mP,BCh%Bt!;u[؁ROP,BG%Bt!!ꔣPЁsdO,C l!%B!t!á<5N,CLID%Bat!eCāX%M,Cd%Bt! @l/qM,C%Bt!Ń|~L,D g%B!t!*TK,DL#%Bat!*аB,J,DS%Bt!@訁H,D3%Bt!R~64G,E r%B!t!J䜁(]F,ELj%Bat!*̘RE,E& %Bt!.q.C,E%Bt!QH`̿B,F 'B!4! ߌ w93@,FL tAa4!"?v=3D@4!P9 :' YGiBF#l EL0D@t!: ɩB5>' YGiBf ELf,D@!t!gI SgY=) vxB EL,D@at!!SgY=) vxB ELF}.D@t!A5y1 BIJ9O YzBB EL.D@t!#A -U YBB EL,D@!t!0SKYSgY=) vxB ELۺ,D@at!l SgY=) vxB& EL *D@t![x@ aM"S{ YxBF EL 0D@t!ߥETqBճhIfR_Bf ELa2D@!t!rE5aBfqc*?FIjyZxB ELZ 0D@at!Ɗ/=Bh3 EhKOz[[xB EL0D@t!rE5aBѳc*?FIfR_B EL0D@t!X\B63_OrxB EL52D@!t!ٕE B˄By_MxxB ELhR0D@at! .BEV:J O B& EL:0D@t!ٕE B~\Ry_M.pFBF EL0D@t!5pO?Q O y{QxBf ELz2D@!t!ހgQ8ja/ÀO᪡o`xB† EL?x0D@at!' j>7-M!~4B¦ EL5i0D@t!ހgQ8O?ÀO y{QxB EL2D@t!ƀaN3kSQ`xB EL<2D@!t!UV!ڠȋn90'jUOJxB ELX0D@at!e?"(i?*NHS=k~O8/ h/o$F,&zA N@#ai &{$A N#a{&&{dA NA#ar%zd StandardzFQ?z7Ьs 0@    0@`,`@8  0@`BXp 0  0@`?#d%k%w`4F%6fVD'&V7EfW'6` C \Y[Y@I33333>;@P@T@tH Ld!cs%w`4F%6fVD'&V7EfW'6` BY[d@33333>;$ @P @T@t H L!ci~k%wQ`4F%6fVD'&V7EfW'6` C \Y[Y@Y33333>;@P@T@tH Lt!c >bd1:1B0w>l STANDARDB0>l STANDARDB03J$@@0BЄL?J@@p?'A?j4!M =II̴EU%10xD~A)!4!!9a D!A14!1 XlDN0@$g LKnLKKoLKLLLUUUUVVVVVVUVUUVUVUUVUVfVUUVVgUVhUVKUUV/UV0VVVVVVVVVVVVVVDDDE DDE E DDDDE DEDEEEcEEdEEeEEHEfEEgEhE,E-EEEFhEEEFiEEEEFjEEEFkEFlFOFmF2FPFnFoF3FQFF4FRFpFqFFSFTFrFUFsFVFtFWFuFXFvFYFwFZFxF[FyF\FzF]F{F^F|F_F}F~F`FFaFbFcFdFe @Ff!@Fg@"@A#@B`$@@Ca%@@Db&@@FEc'@@FFd(@@Fe@G@@FFf@H@@NFFg@I+@@NFFFh@J@@NFFi@-K@NFFj@.L@NFFk@/M@N l@0N@N m@1O@N n2P@@N o3Q@@N p4R@@Nq5S@@Nr6T@@NN.s7U@@NN/t8V@@@NN0u9W@@@NN1v@X:@@N2w@;Y@@N3GZ<@@N4G=[@@N5GG>\@N6NGG?]@N7NGGN8^@NtGGGNN9_@NuGGNXN:GfGGGGNYN;NGOGGGGJN<NNGOGGGKNN=GOGGOOZNGOOGGGG/FOO[GOGGFOGOOGGOO?GOOGGGOGOGGO#OGOGOvGOO$GGOGOGGOGOGGGGGGGHUGGGHVGGGGGH:GGGGHHGHHGHGHG@@@@@@@@A@@AA@@A AA AFAA A*A A A+A}AAAAAaAbAAABABAB0AAB1AB2AABiBMBNXYZx[y \z!]{"@^|#A_}$BXA`~C%YAa&DZxCXbE '[yR%CYc (F\zRCZCxd] )G{R R[C[Cye *H^|CR C\Czf_ +I}CQC]C{g,J`~CR@B,C^C|hP-KaCC_C}B-BiQ.LbCQC`C~B.Bjp/McCB/CaCk=Sq0NdCBCbCB>lTr1OeCCcBC/Cm?Us2PfSCBCdCB@nVt3QgSCCeBBCBoAWu4RhS(SCCBCfCXpBv5SiS)SCCgBCDqCYwT6jS*SCCCJChCBZrDx7UkS+SDICCKCiCCBsE[yV8lS,SCCCLCjzt F\9WmS-SCCMCkCu!G]{n:S.SCCNClD.D|v"H^;oxS/SCCOCmDw#I_}p<yS0SCCnCDCP$J`~=qzS1SDCoCCQ%Ka>r{S2SRCDCRCp&Lb?s|S3SRRCDCqCS' Mct}S4SSRDCCTCr (Ndu~S5SSDRCCUCsO )evS6S SRDCCVCt *fwS7S!SDCCWCug +S8S"SDCRvCv,hS9S#SRDCCwi-S:S$SDC.j0S;S%SDCk1S<SS&SDl2S=S'S mQSzS>S 3nS{S?S 4RhoiS^S@S 5SS_SAS 6TjkSBS7USCS8Vl9WmD:XnDDd;YoDDe<ZpDDf=[q>D \rD!?]s@D"^t #A_u!@`$Bv"%Caw#Ab&Dx$B 'Ecy%Cz (Fd&D )Ge{ 'E| *Hf (F  +Ig})G,J~ *H -K+I.L,J-/MKN.LTH/OMTH0NTHSHO1THSH2PTHHQ3T SHH4RT H5ST HSHq6TST H7UT_I=T H8VIT`THI>9WTTaHI:ITTItTDTbI"IH;ITTcIuI<IITdII=IITT)IIYIU >IIIIU U(?IIITHIU)IJIITIU*J IIIIU+UIJ IIIIU,UJIJ IIIU-IJ IIIU.J IIIIIIIIJJIIIIIIIIJIIIIJIIIIJIIIIJIIIIJIIIIJJ3IIIIJJ4IIIIJJ5IIIIJJ6IIIIJ7J8IIIJ9IIIJ:IIIJ;IIIJ<IJTIJ=IJIJ>IJJ?IJU%IJU&IJU'JJUe  @! A"@ B `#A % C a$B` & D b P@%Ca ' E c &Dbx ( F d  P$ 'Ecy  ) G e P%( Fdz * H f   Px )Ge{  + I g  P P[* Hf| J , h    PP\ +Ig}  - K i   POJ,h~ L . j     PO-Ki  / M k    PL.j l 0 N     P/Mk  1 O m    l0N n 2 P     0P1Om  3 Q o    1Pn2P0  4 R p    2PPP3Qo1  5 S q    3QP4Rp2P  6 T r   4RpP5Sq3Q 7 U s    5SqP6Tr4Rh  8 V t   6Tr7Us5Si 9 W u    7Us8Vt6Tj  : X v   8Vt9Wu7Uk9 ; Y w    Wu:Xv8Vl  < Z x   :XvQ9;YwWm; [ = y    YwQ<Z:Xn  > \ z  <ZxQQ;[=Yo[ ] ? {    =yQQ>\<Zp  ^ |    >\zQQ[]?=q] } _    !?{QQ^ >\r  ~   "@^|QQ]_!?s}     #A_QQ"@^t   $B`~QQu#A_   %CaPQQ$B`v&   DbPQQw%Ca   'EcPwPQQ&Dbx(  FdLPQQ 'Ecy  )GeLPQQ( Fdz* HfLLQQ )Ge{ +IgLLQQPQE* Hf|LJ,hLLQQ +Ig}-KiLLLQ)QQJ,~L.jLLQQ*Q|-K/MkLLQ Q}QL.lNLLMQ~QQQ`/MOmLLMQQQaNnLLLQQOLoLLQQLLLQQLLqLLQQLLLQQLLLULQQLLLVLQQLLLQQLLLL:QLLLQMLLLMLLLMMLLMMLLJ@MLLJALLMJBLLMJ`JCM}LLMJaJbM~LLMJDJEMMLLMJcJdMbLLMJFJGLLMMJeLLMMJHJfJIMGLMMJgMMMJJJhJKMMJiJM,MMJLJjJMMMJkJKJJNMMJlKJOMMJmJKJPMMJnJK0K1KJQMMJoJKJRMMJpJK2KPKQKJSMMJqJK3KKMMJTJrJK4KRKSKJsMMJUJKK5K JKMMJVJtJK6K!KK7JuMMJWJJK8KK"MMJXJvJK#KK9MMJYJwJK:KK$MJZJKK%K;MJ[JK<KK&J\JJ]K K'K=K>J^JK K(K?K JK)J_K@K JK*KAK JK+JKBKK,JKCKK-JKDK.KJKEK/JKKFKJKGJKKJKHKJKILKKJLKKKKLKKLKLKMLKNKKLKOKAA0ABLBKnBLBKBKoBLBKBLBLBLBUBUBUBUBVBVBVBVBVBVBUBVBUBUBVBUBVBUBUBVBUBVfBVBUBUBVBVgBUBVhBUBVKBUBUBV/BUBV0BVBVBVBVBVBVBVBVBVBVBVBVBVBVBDBDBDBE BDBDBE BE BDBDBDBDBE BDBEBDBEBEBEcBEBEdBEBEeBEBEHBEfBEBEgBEhBE,BE-BEBEBEBFhBEBEBEBFiBEBEBEBEBFjBEBEBEBFkBEBFlBFOBFmBF2BFPBFnBFoBF3BFQBFBF4BFRBFpBFqBFBFSBFTBFrBFUBFsBFVBFtBFWBFuBFXBFvBFYBFwBFZBFxBF[BFyBF\BFzBF]BF{BF^BF|BF_BF}BF~BF`BFBFaBFbBFcBFdBFeA B@BFfA!B@BFgA@A"B@AAA#B@ABA`A$B@B@ACAaA%B@B@ADAbA&B@B@BFAEAcA'B@B@BFAFAdA(B@B@BFAeB@AGB@B@BFBFAfB@AHB@B@BNBFBFAgB@AIA+B@B@BNBFBFBFAhB@AJB@B@BNBFBFAiB@A-AKB@BNBFBFAjB@A.ALB@BNBFBFAkB@A/AMB@BN AlB@A0ANB@BN AmB@A1AOB@BN AnA2APB@B@BN AoA3AQB@B@BN ApA4ARB@B@BNAqA5ASB@B@BNArA6ATB@B@BNBN.AsA7AUB@B@BNBN/AtA8AVB@B@B@BNBN0AuA9AWB@B@B@BNBN1AvB@AXA:B@B@BN2AwB@A;AYB@B@BN3BGAZAA\B@BN6BNBGBGA?A]B@BN7BNBGBGBN8A^B@BNtBGBGBGBNBN9A_B@BNuBGBGBNXBN:BGfBGBGBGBGBNYBN;BNBGBOBGBGBGBGJBNBlBBBBBBBTBrBBBB1BOBeBBCBCcBBBC/BCBBmBBBBBB?BUBsBB2BBBPBfBBSBCBBBCdBCBBB@BnBBBBBBBVBtBBBBB3BQBgBSBCBCeBBBBBCBBBBoBBBBBBABWBuBBB4BBBRBhBS(BSBCBCBBBCfBCBXBpBBBBBBBBBvBBBBBB5BSBiBS)BSBCBCgBBBCBDBBBqBBBBBCBYBwBBBTBBB6BjBS*BSBCBCBCJBChBCBBBZBrBBBBBBDBxBBBBBBB7BUBkBS+BSBDIBCBCKBCiBCBCBBBBBsBBBBBEB[ByBBBBVBBB8BlBS,BSBCBCBCLBCjBzBtBBBBB BFB\BBBBBBBB9BWBmBS-BSBCBCMBCkBCBBBuBBBB!BGB]B{BBBBBnBBB:BS.BSBCBCNBClBD.BDB|BBvBBB"BHB^BBBBBBBB;BoAxBS/BSBCBCOBCmBDBBBwBBB#BIB_B}BBBBBpBBBrA{ABS2BSBRBCBDBCRBCpBBBBB&BLBbBBBBB?BsA|AABS3BSBRBRBCBDBCqBCSB'BBB BMBcBBBBBBtA}AABS4BSBSBRBDBCBCTBCrBBB B(BNBdBBBBuAA~AABS5BSBSBDBRBCBCUBCsBOBB B)BeBBBBBvAAAABS6BS BSBRBDBCBCVBCtBBB B*BfBBBBwBAAAAABS7BS!BSBDBCBCWBCuBgBB B+BBBBAAAAABS8BS"BSBDBCBRvBCvBBB,BhBBBAAAAABBS9BS#BSBRBDBCBCwBiBB-BBBBAAAAABBS:BS$BSBDBCBB.BjBBBBAAAAABB0BS;BS%BSBDBCBkBBBBBBAAAAABB1BSBS AAAABB3BBnBBBBABS{BS?BS AAABB4BRBhBBoBBBBBiBS^BS@BS AAAABB5BSBBBBBABS_BSABS AAABB6BTBjBBBBBBBkBSBBSAAAABB7BUBBBBBABSCBSAAABB8BVBlBBBBBBBAAAABB9BWBmBBBBBBDAAAAB:BXBnBBBBBBABDBDdAAAABB;BYBoBBBBBBBDBDeAAAABBBDAAAABB B\BrBBBBBBBBABDAABB!B?B]BsBBBBB@BDAAAABB"B^BtBBBBBB BAAAABB#BAB_BuBBBBB!B@B`AAABB$BBBvBBBBB"BBAAAB%BCBaBwBBBB#BABbAABB&BDBxBBBBB$BBBB AAB'BEBcByBBBB%BCBzAB B(BFBdBBBBB&BDBB AB)BGBeB{BBB B'BEB|B B*BHBfBBBB B(BFB B B+BIBgB}BBBB)BGBBB,BJB~BBBB B*BHB B-BBKBBBBBB+BIBB.BLBBBBBB,BJB-B/BMBBBBBBBKBBNBBBBBB.BLBTBHB/BOBBBBBBBMBTBHBBBBBBB0BNBTBHBSBHBOBBBBBBB1BTBHBSBHBBBBBB2BPBTBHBHBQBBBBBB3BT BSBHBHBBBBB4BRBT BHBBBBB5BSBT BHBSBHqBBBB6BTBSBT BHBBBB7BUBT_BI=BT BHBBB8BVBIBT`BTBHBI>BBB9BWBTBTaBHBIBBB:BIBTBTBItBTDBTbBI"BIBHBBB;BIBTBTcBIuBIBBBIBIBIBIBU BU(B?BIBIBIBTBHBIBU)BIBJBIBIBTBIBU*BJ BIBIBIBIBU+BUIBJ BIBIBIBIBU,BUJBIBJ BIBIBIBU-BIBJ BIBIBIBU.BJ BIBIBIBIBIBIBIBIBJBJBIBIBIBIBIBIBIBIBJBIBIBIBIBJBIBIBIBIBJBIBIBIBIBJBIBIBIBIBJBIBIBIBIBJBJ3BIBIBIBIBJBJ4BIBIBIBIBJBJ5BIBIBIBIBJBJ6BIBIBIBIBJ7BJ8BIBIBIBJ9BIBIBIBJ:BIBIBIBJ;BIBIBIBJBIBJBJ?BIBJBU%BIBJBU&BIBJBU'BJBJBUeBBBB B @BB!B ABB"B@B BB `BB#BAB %B CB aBB$BBB`B &B DB bB BP@BB%BCBaB 'B EB cB BB&BDBbBxB (B FB dB B BP$B B'BEBcByB B )B GB eB BP%B(B BFBdBzBB *B HB fB B B BPxBB B)BGBeB{B B +B IB gB B BP BP[B*B BHBfB|BBB JB ,B hB B B B BPBP\BB B+BIBgB}BB B -B KB iB B B BPBOBJBB,BhB~BBBB LB .B jB B B B B BPBOBBB-BKBiBBBB B /B MB kB B B B BPBLBB.BjBBBBBB lB 0B NB B B B B BBPBBB/BMBkBBBBB B 1B OB mB B B B BBlBB0BNBBBBBBB nB 2B PB B B B B BB0BPBBB1BOBmBBBBBB B 3B QB oB B B B BB1BPBnBB2BPBBBBBBB0B B 4B RB pB B B B BB2BPBPBPBBB3BQBoBBBBBB1B B 5B SB qB B B B BB3BQBPBBB4BRBpBBBBBB2BPB B 6B TB rB B B BBB4BRBpBPBBB5BSBqBBBBBB3BQBB 7B UB sB B B B BB5BSBqBPBBB6BTBrBBBBBB4BRBhBB B 8B VB tB B B BBB6BTBrBBB7BUBsBBBBBB5BSBiBB 9B WB uB B B B BB7BUBsBBBBB8BVBtBBBBBB6BTBjBB B :B XB vB B B BBB8BVBtBBB9BBWBuBBBBBB7BUBkBB9B ;B YB wB B B B BBBWBuBBBBBB:BXBvBBBBBB8BVBlBBB B B \B zB B BBBB\BBBBBBB\BzBBBBQBQB[B]B?BBBBBBB=BqBBBB]B }B _B B B B B!B?B{BBBBBQBQBBB^BBBBB B>B\BrBBBB B ~B B B B"B@B^B|BBBBQBQB]BB_BBBBB!B?BsBBBB}B B B B B B#BAB_BBBBBQBQBBBBBB"B@B^BtBBBBBB B B B$BBB`B~BBBBQBQBuBBBBBB#BAB_BBBBB B B BB%BCBaBBBBBPBQBQBBBBB$BBB`BvBBBB&B B B BDBbBBBBBBPBQBQBwBBBBB%BCBaBBBBB B B B'BEBcBBBBBPwBPBQBQBBBB&BDBbBxBBBB(B B BFBdBBBBBBLBPBQBQBBBB B'BEBcByBBBB B B)BGBeBBBBBLBPBQBQB(BB BFBdBzBBBB*B BHBfBBBBBBLBLBQBQBBB B)BGBeB{BBBB B+BIBgBBBBBLBLBQBQBPBQEB*B BHBfB|BBBBLBJB,BhBBBBBBLBLBQBQBB B+BIBgB}BBBB-BKBiBBBBBLBLBLBQ)BQBQBJBB,B~BBBBLB.BjBBBBBLBLBQBQ*BQ|BBB-BKBBBBB/BMBkBBBBLBLBQ BQ}BQBLB.BBBBBlBNBBBBBLBLBMBQ~BQBQBQ`BB/BMBBBBBOBmBBBBLBLBMBQBQBQaBBNBBBBnBBBBBLBLBLBQBQBBOBBBBLBBoBBBBLBLBQBQBBBBBBBBBLBLBLBQBQBBBBBLBBBBBLqBLBLBQBQBBBBLBLBBBBLBQBQBBBBLBLBBBBLUBLBQBQBBBLBLBBBLVBLBQBQBBBLBLBBBLBQBQBBLBLBLBBL:BQBBLBLBBLBQBMBLBLBLBMBLBLBLBMBMBLBLBMBMBLBLBJ@BMBLBLBJABLBLBMBJBBLBLBMBJ`BJCBM}BLBLBMBJaBJbBM~BLBLBMBJDBJEBMBMBLBLBMBJcBJdBMbBLBLBMBJFBJGBLBLBMBMBJeBLBLBMBMBJHBJfBJIBMGBLBMBMBJgBMBMBMBJJBJhBJKBMBMBJiBJBM,BMBMBJLBJjBJMBMBMBJkBJBKBJBJNBMBMBJlBKBJOBMBMBJmBJBKBJPBMBMBJnBJBK0BK1BKBJQBMBMBJoBJBKBJRBMBMBJpBJBK2BKPBKQBKBJSBMBMBJqBJBK3BKBKBMBMBJTBJrBJBK4BKRBKSBKBJsBMBMBJUBJBKBK5BK BJBKBMBMBJVBJtBJBK6BK!BKBK7BJuBMBMBJWBJBJBK8BKBK"BMBMBJXBJvBJBK#BKBK9BMBMBJYBJwBJBK:BKBK$BMBJZBJBKBK%BK;BMBJ[BJBKBJ^BJBK BK(BK?BK BJBK)BJ_BK@BK BJBK*BKABK BJBK+BJBKBBKBK,BJBKCBKBK-BJBKDBK.BKBJBKEBK/BJBKBKFBKBJBKGBJBKBKBJBKHBKBJBKIBLBKBKJBLBKBKKBKBLBKBKLBKBLBKMBLBKNBKBKBLBKOBKh/J@@@QE4$T5U%$T44T@S!+?_Z/J@)@@QE4$T5U%$T44T@!+_0J@@@QE4$T5U%$T44T@ I!+0J@)@@QE4$T5U%$T44T@ P3!+Sހ"@`?CSހd"@` ?Sހ"@`?Sހd"@` ?Sހ"@`?=Sހd"@` ?~Sgf'VTR_0.000_0.000_1.000_1.000_VISUALSTYLETf'VTR_0.000_0.000_1.000_1.000_GRIDDISPLAYFf%VTR_0.000_0.000_1.000_1.000_GRIDMAJORFf+VTR_0.000_0.000_1.000_1.000_DEFAULTLIGHTINGf/VTR_0.000_0.000_1.000_1.000_DEFAULTLIGHTINGTYPEFf&VTR_0.000_0.000_1.000_1.000_BRIGHTNESSf$VTR_0.000_0.000_1.000_1.000_CONTRAST@P ?SѤF@`L?ٍ/B Q *ZdA!1@j(@"@|K04.0? Pԯ5@0@Є̕ӐB?Z/dB Q ji5@j(@"@@̕@nT?jJq@@QD4E$T5$TEE$% U5AQ%1 DIFFUSETILECPUUS@$TdT5DDP=II Q%=9Q%1 SPECULARTILE0"WI""""""2Sr@pAq?USsd@pAq?Sr@p@Єq?ZJo@@QD4E$T5$TEE$% U5AQ%1 DIFFUSETILECPUUS@$TdT5DDP=II Q%=9Q%1 SPECULARTILE0"WH""""""&mSp@pAo?Sqd@pAo?`Sp@p@Єo?Js@@QD4E$T5$TEE$% U5AQ%1 DIFFUSETILECPUUS@$TdT5DDP=II Q%=9Q%1 SPECULARTILE0"WJ""""""҉St@pAs?3Sud@pAs?&"St@p@Єs?'XJ@@R4E$TEE$#D$U5EU4T5ETQ }aI }I=U9QI%@] ]/Sހ"@`?Sހd"@` ?.Sހ"@`?Sހd"@` ?)J@ө@@QD4E$T5$TEE$!!#%tv)J@)@@QD4E$T5$TEE$!!%t\fSdRfMATERIAL]^HM@PqЄq?Srd@p@q?3Sr$@`q?>Ss$@pAPq?ZfS$RfMATERIAL]^HM@PoЄo?aSpd@p@o?*`Sp$@`o?'SSq$@pAPo?fSҤRfMATERIAL]^HM@PsЄs?zStd@p@s?"St$@`s?Su$@pAPs?3/AP  0@ @P}Q%Q1@j2*PXB@PTDU @h@ ףp= ? AU@CTCTC٫mSʀYf!ACAD_ROUNDTRIP_PRE2007_TABLESTYLEZ[\]^_@P?YS怀Gf SHADEPLOTFfSHADEPLOTRESLEVELFfSHADEPLOTCUSTOMDPIF,@`ӌ?YS怀dGf SHADEPLOTFfSHADEPLOTRESLEVELFfSHADEPLOTCUSTOMDPIF,@` ?'$$OOO'OODJd$d0-------0$d,+))))>+>)>)>),==**--*,*20*02,,*0,,*0,0,,,040,040040,,4,4,4,0404,**,**,*,,***,,,,,,, /-*16/,,33,)))))*)02+02+.)//11)0<,*<02<20<0,<00<*)))))*+22+22+.)//11)2<,*<22<20<0,<00<*,,,3,,*,*,,*,*,,22,24+35----+--+-++++1111----3-5-5++3-----------+--3----+---3-3-5-5-3++++++--1++--1+.0---6-6*,,*,1*+1,3/,3*,,*,3,+3,3/,3--116--1-------------33-33---1-----++++33--33--5-5-5-5----- 0.+----3----3-00>>+.++.*0000*1=+-=11=33=1+=33=1****,**3**13,11*1*0000*1=+-=11=33=1/=33=-*0000*3=+-=33=33=3/=33=1*0000*3=+-=33=33=3/=33=1-5-5-515+33+33+33-+31+13----1--++-----+-+++--++--1---3+--+--+3+--+-++-+++ 0.+++050----+,-,-*******1*11*1*33,*****3*-3,5-*3*******1,31,3*11******5,-3*3-*3-----+,-,-----------3--1--3-3++++3333----+-++-++--++-+----1------1--+-4.+--1--11++0002--11+.0--*****-,53,53*-*,,**,,3*,31*11*1*,,**,,1**13,13,1*****-*35,35,1---+--1+1+-+-13--3-5-5++++33--33--++-++--++-++-----3------1-1-1..+11--33++0002--33-!2a0---13->>+.++.-----31-----31 ------++1,,+1-!O&!&""R13-3>-->>6>6>>6>>>>>>6>>>>>>>6-----5-5------+--+-----+-+------++---+-++-+-55---->>>>>6>>>>>6>6>>>6>->>>>6----++---+--+-------+-+-+--------+-++--55----++---++-++----++++--++++++----+-+-33-----++++-----+--+---++-----++-+-+-++-55-----5-5>-->>>>>>>6>>>>>>6>>>>>6>6-----3-3---------+-------+-----+------+-----33---->>>>>6>>>>>6>>>>>>>->>6>6-------+--------+---++---------+-++-+--55++++---+++---++++-+++-+++---+++-------11---------+--+-+-+--++---++++----------33-----3-3-->>>>>6>>>6>6>>>>>>>>>>-----5-5-----+-------+----++----++----------33-----6>>>6>>>>>>>>6>>>>>>>>----++---++-+-----++---++-----+--+--55++++-----+++--+-+++-+++--++++------11--------+++--+--+---+++-----++--------13----533335-5-3-3-335-5-5-5-5-->1>>3>>>>>5>>>>>>3>>>>----555---5--------------++----++----->1>>3>>>>>5>>>>>>3>>>>----55--5-5--++++-------------------3533---++++--++-------++--++----5-5-5-5--++++------++-------------------->>>>>>>>>>>>>>>>>>>>>>>>--53331>33355>53533>13515>---++--++--------++----5-55-3--!-->>>>>>>>>>>>>>>>>>>>>>>>-----------++--++----++----3-55-5-----++++++--++----++--++++3-3>3-3>-------++--++++--++++--++--5-33-5---O,ѮOO۹OO_F~GA_F~GAճ_F~GPG@OFB ADBϯdzOO#O##$$$$$$%###$%65555454444*622MJOAPʞ ,IO!%.m#POO! ;+ۙOzM M M AAAAAA PP&`OO O-@Y@O-)-p0///////-----/-///$*)))))))))))))))))))))))+2////8///8/--------/--/--//-----////-//////558//8/$*)))))))))))))))))))))))+0//--//$*)))))))))))))))))))))))+2$*)))))))))))))))))))))))+%*)))))))))))))))))))))))+2$*)))))))))))))))))))))))+%*)))))))))))))))))))))))+3%*)))))))))))))))))))))))+1%*)))))))))))))))))))))))+74..02..0.%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+1%*)))))))))))))))))))))))+74.200%*)))))))))))))))))))))))+3%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+3%*)))))))))))))))))))))))+Yˡ&*)))))))))))))))))))))))+3%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+1.0...0%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+&*)))))))))))))))))))))))+742.66466406646.6.6..44.6.646..6.6.66.....00000000000000000000 (40424044224424449%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+&*)))))))))))))))))))))))+%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+&*)))))))))))))))))))))))+&*)))))))))))))))))))))))+%*)))))))))))))))))))))))+998644442224680%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+74440%*)))))))))))))))))))))))+7%*)))))))))))))))))))))))+74444%*)))))))))))))))))))))))+5%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+56400%*)))))))))))))))))))))))+7.%*)))))))))))))))))))))))+3%*)))))))))))))))))))))))+14%*)))))))))))))))))))))))+34044%*)))))))))))))))))))))))+7.%*)))))))))))))))))))))))+3%*)))))))))))))))))))))))+14%*)))))))))))))))))))))))+7200200000088088.8800088.880880..00000000.......0.`%*)))))))))))))))))))))))+3000%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+&*)))))))))))))))))))))))+&*)))))))))))))))))))))))+%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+&*)))))))))))))))))))))))+&*)))))))))))))))))))))))+.09090000.........0.0..224442244444444440406686868844%*)))))))))))))))))))))))+7%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+7%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+7%*)))))))))))))))))))))))+5%*)))))))))))))))))))))))+74..42.24442%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+7%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+7%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+7%*)))))))))))))))))))))))+74..422.2666666688666646666066.666660.6.4444.066.668860.6.6666.066.668860.6.4444.8686660....0066.6.6.0000%*)))))))))))))))))))))))+34400000000.00.0000440.4422244h96490090902244444446%*)))))))))))))))))))))))+3%*)))))))))))))))))))))))+744.44%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+74444686666466668464646664666666666646446664666664666446666666666666666646444%*)))))))))))))))))))))))+7%*)))))))))))))))))))))))+7%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+7%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+7%*)))))))))))))))))))))))+94..04..0.4%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+3%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+7......0..0..68068.44666..4.446644.66..0000404244244...660066%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+&*)))))))))))))))))))))))+&*)))))))))))))))))))))))+%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+1..0....0000000.00660000660909044422.2244440%*)))))))))))))))))))))))+300.4442869000%*)))))))))))))))))))))))+3..pˠ!442446900.%*)))))))))))))))))))))))+1%*)))))))))))))))))))))))+1%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+1%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+1%*)))))))))))))))))))))))+74..0....0%*)))))))))))))))))))))))+3%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+1%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+3%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+1462......%*)))))))))))))))))))))))+5%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+5%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+7%*)))))))))))))))))))))))+5%*)))))))))))))))))))))))+7404.002.%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+74402%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+5%*)))))))))))))))))))))))+7%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+5%*)))))))))))))))))))))))+7400.02020..0006666..00000040422422222422042244%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+&*)))))))))))))))))))))))+%*)))))))))))))))))))` x#)))+&*)))))))))))))))))))))))+&*)))))))))))))))))))))))+&*)))))))))))))))))))))))+&*)))))))))))))))))))))))+&*)))))))))))))))))))))))+%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+&*)))))))))))))))))))))))+300.00.022............44000066909004422424400469000086900.%*)))))))))))))))))))))))+1%*)))))))))))))))))))))))+1%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+1%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+3%*)))))))))))))))))))))))+742.......%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+&*)))))))))))))))))))))))+74...%*)))))))))))))))))))))))+1%*)))))))))))))))))))))))+1%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+3%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+1%*)))))))))))))))))))))))+742..222.%*)))))))))))))))))))))))+7%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+5%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+52%*)))))))))))))))))))))))+74402200.%*)))))))))))))))))))))))+7%*))))))))))))))))))))&))+&*)))))))))))))))))))))))+5%*)))))))))))))))))))))))+&*)))))))))))))))))))))))+52%*)))))))))))))))))))))))+74002200.464446444644664'g^1-------++-+-++-+-"*)))))))))))))))))))))))+0----6->->-6-+-+++-+-++++-+++--+++-+++--+----116--6-"*)))))))))))))))))))))))+0++-+>>++"*)))))))))))))))))))))))+."*)))))))))))))))))))))))+#*)))))))))))))))))))))))+0"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+0"*)))))))))))))))))))))))+."*)))))))))))))))))))))))+41--+1-++)"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+,"*)))))))))))))))))))))))+41-1-+"*)))))))))))))))))))))))+0"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+."*)))))))))))))))))))))))+#*)))))))))))))))))))))))+0"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+0-++--+"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+#*)))))))))))))))))))))))+411-131311-1333+3+1++33+3+333++3+3+33+--+-----------------------1-1>>11-11/111++1/>6"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+#*)) ))))))))))))))))))))+"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+#*)))))))))))))))))))))))+#*)))))))))))))))))))))))+"*)))))))))))))))))))))))+>6633>>111/+//135>>-"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+415>>1-"*)))))))))))))))))))))))+4"*)))))))))))))))))))))))+413>>11"*)))))))))))))))))))))))+."*)))))))))))))))))))))))+#*)))))))))))))))))))))))+.11--"*)))))))))))))))))))))))+4+"*)))))))))))))))))))))))+0"*)))))))))))))))))))))))+./"*)))))))))))))))))))))))+0+-1+"*)))))))))))))))))))))))+4+"*)))))))))))))))))))))))+0"*)))))))))))))))))))))))+.1"*)))))))))))))))))))))))+4+--+------33-33+33-++33+33+55+++--------+++++++-+-"*)))))))))))))))))))))))+0-++"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+#*)))))))))))))))))))))))+#*)))))))))))))))))))))))+"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+#*)))))))))))))))))))))))+#*)))))))))))))))))))))))++>->6-6>----+++++++-+Ώ +++-////1/1/+-111133>1->1-3>3>3>3>>3>5>3>5>/1"*)))))))))))))))))))))))+4"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+4"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+2"*)))))))))))))))))))))))+2"*)))))))))))))))))))))))+41++//+/////"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+2"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+4"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+4"*)))))))))))))))))))))))+41+++//++1>31>13>11>11>33>5111111+>33>+5>53>33>++>3+1111++>33>+1>35>31>++>1+3311++>33>+3>35>53>++>3+3311+113311-++++++33+3+3+++--"*)))))))))))))))))))))))+.//++>>--------------11->>+111/>>11166>>116>->-6-6->//11111113>>"*)))))))))))))))))))))))+0"*)))))))))))))))))))))))+415>>-11"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+413>>111>31>31>33>31>31>11111111>31>31>13>11>13>11111113>13>13>31>11>31>31111111>31>31>11>11>31>3111111"*)))))))))))))))))))))))+2"*)))))))))))))))))))))))+2"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+4"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+4"*)))))))))))))))))))))))+41+++/++++1"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+0"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+4++++++-++-++11+33+33331++3+333333+33++>>>>----1-1>>111//1+>>--33++33>>>>"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+#*)))))))))))))))))))))))+#*)))))))))))))))))))))))+"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+.++-+--+--++---->>>>--33>>-++-11-6-6-111//-//1133>>-"*)))))))))))))))))))))))+0--+11/1356>---"*)))))))))))))))))))))))+0+++111111>6--+"*)))))))))))))))))))))))+."*)))))))))))))))))))))))+."*)))))))))))))))))))))))+#*)))))))))))))))))))))))+0"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+."*)))))))))))))))))))))))+41--+--+++"*)))))))))))))))))))))))+."*)))))))))))))))))))))))+#*)))))))))))))))))))))))+0"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+."*))))))))))))))))))))))7 +#*)))))))))))))))))))))))+.111-+-+-+"*)))))))))))))))))))))))+2"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+4"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+2"*)))))))))))))))))))))))+2"*)))))))))))))))))))))))+41+/+++/+"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+41/+/"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+2"*)))))))))))))))))))))))+4"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+4"*)))))))))))))))))))))))+41++++/+/-++-++3333--++>>>>----1-1>>/1/////1//>>1-11/11>>>>"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+#*)))))))))))))))))))))))+"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+#*)))))))))))))))))))))))+#*)))))))))))))))))))))))+#*)))))))))))))))))))))))+#*)))))))))))))))))))))))+"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+#*)))))))))))))))))))))))+0------->>/>/>+++-+--+++++33>>----116-6--111/1/11>>--53>6----116>---"*)))))))))))))))))))))))+0"*)))))))))))))))))))))))+."*)))))))))))))))))))))))+#*)))))W6)))))))))))))))))+."*)))))))))))))))))))))))+#*)))))))))))))))))))))))+0"*)))))))))))))))))))))))+431-++--++"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+#*)))))))))))))))))))))))+41--+"*)))))))))))))))))))))))+."*)))))))))))))))))))))))+0"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+0"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+."*)))))))))))))))))))))))+411-+11/+"*)))))))))))))))))))))))+2"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+4"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+2/"*)))))))))))))))))))))))+411-//--+"*)))))))))))))))))))))))+4"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+4"*)))))))))))))))))))))))+#*)))))))))))))))))))))))+2/"*)))))))))))))))))))))))+41--//--+131133315333333OPТCAFHc{!(S$@ <u3€PL M@AM@E0B #[@VWP    V   :E= g+1l`@ۿU